DED0016039MA - - Google Patents
Info
- Publication number
- DED0016039MA DED0016039MA DED0016039MA DE D0016039M A DED0016039M A DE D0016039MA DE D0016039M A DED0016039M A DE D0016039MA
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- mixture
- oxygen
- mixtures
- halide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000203 mixture Substances 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 239000007789 gas Substances 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 150000004820 halides Chemical class 0.000 claims description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 7
- -1 silicon halide Chemical class 0.000 claims description 7
- 238000000354 decomposition reaction Methods 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- 229910052752 metalloid Inorganic materials 0.000 claims description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 150000002738 metalloids Chemical class 0.000 claims description 3
- 229910052710 silicon Inorganic materials 0.000 claims description 3
- 239000010703 silicon Substances 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 7
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 150000002737 metalloid compounds Chemical class 0.000 description 5
- 239000005049 silicon tetrachloride Substances 0.000 description 5
- 239000002737 fuel gas Substances 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- JTJMJGYZQZDUJJ-UHFFFAOYSA-N phencyclidine Chemical class C1CCCCN1C1(C=2C=CC=CC=2)CCCCC1 JTJMJGYZQZDUJJ-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 239000012717 electrostatic precipitator Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000001698 pyrogenic effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2153671C3 (de) | Verfahren zur Herstellung von feinstteiliger Oxide des Siliciums | |
| EP0595078B1 (de) | Flammenhydrolytisch hergestelltes Titandioxid-Mischoxid, Verfahren zu seiner Herstellung und Verwendung | |
| DE2533925A1 (de) | Verfahren zur herstellung von feinstteiligen oxiden von metallen und/oder des siliciums | |
| EP1553054B1 (de) | Flammenhydrolytisch hergestelltes Silicium-Titan-Mischoxidpulver | |
| DE19530339A1 (de) | Pyrogene Kieselsäure, Verfahren zu ihrer Herstellung und Verwendung | |
| DE2931585A1 (de) | Temperaturstabilisiertes, pyrogen hergestelltes aluminiumoxid-mischoxid, das verfahren zu seiner herstellung und verwendung | |
| EP1083146A1 (de) | Bakterizides, mit Silber dotiertes Siliciumdioxid | |
| DE2342889A1 (de) | Verfahren zur herstellung eines tio tief 2-pigments nach dem chloridverfahren | |
| DE602005002265T2 (de) | Durch flammenhydrolyse hergestelltes silicium-titan-mischoxidpulver | |
| DE948415C (de) | Verfahren zur Herstellung feinverteilter Metalloxyde aus fluechtigen Metallhalogeniden | |
| DE1933291C3 (de) | Hochdisperses weißes Siliciumdioxid | |
| DE1542359B1 (de) | Verfahren zur Herstellung feinteiliger Oxyde | |
| DE2821407C2 (de) | Molybdän-Titan-Zirkonium-Aluminium-Vorlegierungen | |
| EP0097378A2 (de) | Verfahren zur Herstellung von pyrogenerzeugter Kieselsäure mit verstärkter Verdickungswirkung | |
| DE2923182A1 (de) | Verfahren zur pyrogenen herstellung von feinstteiligem oxid eines matalls und/oder eines metalloids | |
| DED0016039MA (cg-RX-API-DMAC7.html) | ||
| DE974793C (de) | Verfahren zur Herstellung von feinverteilten Oxyden | |
| DE2159475C2 (de) | Verfahren zur Herstellung von Siliciumtetrachlorid oder eines Gemisches von Siliciumtetrachlorid mit einem oder mehreren anderen Metallchloriden | |
| DE2821406C2 (de) | Molybdän-Titan-Zirkonium-Aluminium-Vorlegierungen | |
| DE742664C (de) | Verbesserung von Russ durch Verminderung des Kohlenstoffgehaltes | |
| DE1567771B1 (de) | Verfahren zur Herstellung von reinem Aluminiumnitrid | |
| DE2112560A1 (de) | Verfahren zur Behandlung von Titandioxyd | |
| EP1097964A1 (de) | Polyester | |
| DE953254C (de) | Verfahren zur Herstellung von aktiven, insbesondere als Fuellstoff geeigneten Metalloxyden | |
| DE977339C (de) | Verfahren zur Herstellung von fein verteiltem Titandioxyd in Rutilmodifikation |