DEB0018797MA - - Google Patents
Info
- Publication number
- DEB0018797MA DEB0018797MA DEB0018797MA DE B0018797M A DEB0018797M A DE B0018797MA DE B0018797M A DEB0018797M A DE B0018797MA
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- compounds
- substances
- dimethyl carbamate
- fungi
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000725 suspension Substances 0.000 claims description 6
- 239000000575 pesticide Substances 0.000 claims description 5
- 239000000839 emulsion Substances 0.000 claims description 4
- 239000000417 fungicide Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000013543 active substance Substances 0.000 claims 2
- 239000000126 substance Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 241000233866 Fungi Species 0.000 description 6
- -1 2, 4-dichlorophenyl dimethyl carbamate Chemical compound 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 4
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- VCSDFCWFZZFAEC-UHFFFAOYSA-N (2,4,5-trichlorophenyl) n,n-dimethylcarbamate Chemical compound CN(C)C(=O)OC1=CC(Cl)=C(Cl)C=C1Cl VCSDFCWFZZFAEC-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000011256 inorganic filler Substances 0.000 description 2
- 229910003475 inorganic filler Inorganic materials 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- DWLVWMUCHSLGSU-UHFFFAOYSA-M n,n-dimethylcarbamate Chemical compound CN(C)C([O-])=O DWLVWMUCHSLGSU-UHFFFAOYSA-M 0.000 description 2
- 239000012766 organic filler Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 241000222290 Cladosporium Species 0.000 description 1
- 241000395107 Cladosporium cucumerinum Species 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- 241000222418 Lentinus Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000896238 Oidium Species 0.000 description 1
- 241000488583 Panonychus ulmi Species 0.000 description 1
- 241000222640 Polyporus Species 0.000 description 1
- 241000221662 Sclerotinia Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- HJSLFCCWAKVHIW-UHFFFAOYSA-N cyclohexane-1,3-dione Chemical compound O=C1CCCC(=O)C1 HJSLFCCWAKVHIW-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000004992 fission Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE961042C (de) | Fungicide und acaricide Mittel | |
| DE1542792C3 (OSRAM) | ||
| DEB0018797MA (OSRAM) | ||
| DE69307882T2 (de) | Neues verfahren zur bekämpfung von insekteneier und ovizide zusammensetzungen | |
| DE1567025C3 (de) | Fungizide Mittel | |
| DE1128219B (de) | Schaedlingsbekaempfungsmittel mit insekticider und akaricider Wirkung | |
| DE1617982A1 (de) | Mittel zur Bekaempfung von schaedlichen Mikroorganismen | |
| DE878450C (de) | Gemische mit insekticider, akaricider, fungicider oder herbicider Wirkung | |
| DE1278427B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE2552867A1 (de) | Mittel zum bekaempfen von funguserkrankungen bei pflanzen | |
| DE1156272B (de) | Schaedlingsbekaempfungsmittel mit insektizider und akarizider Wirkung | |
| DE2161516A1 (de) | Neue Triazine und Verfahren zu deren Herstellung | |
| DE892093C (de) | Insektentötendes Mittel | |
| DE1146694B (de) | Insektenbekaempfungsmittel | |
| DE2027058C3 (de) | N-acylierte Carbamate, Verfahren zur Herstellung derselben und diese Verbindungen enthaltende Schädlingsbekämpfungsmittel | |
| DE713897C (de) | Alkaloidhaltiges Insektenbekaempfungsmittel | |
| DE1793753C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| DE2353432A1 (de) | Insektizide stoffgemische | |
| DE1542842A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1296144B (de) | 1-Thia-cyclopentan-1, 1-dioxide und ihre Verwendung | |
| DE2512556A1 (de) | Cyclische diphosphorverbindungen | |
| DE2619834A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1767396A1 (de) | Verfahren und Mittel zur Behandlung von laubverlierenden Obstbaeumen | |
| DE1667873B (de) | Fungizides Mittel mit prophylaktischer und kurativer Wirksamkeit | |
| DE1288842B (de) | Fungizide Mittel |