DE97876A - - Google Patents
Info
- Publication number
- DE97876A DE97876A DE97876A DE 97876 A DE97876 A DE 97876A DE 97876 A DE97876 A DE 97876A
- Authority
- DE
- Germany
- Prior art keywords
- cartridge
- water
- brought
- lime
- bladder
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 29
- 238000004880 explosion Methods 0.000 claims description 9
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 6
- 239000002360 explosive Substances 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 238000005192 partition Methods 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 239000000126 substance Substances 0.000 description 10
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 9
- 235000011941 Tilia x europaea Nutrition 0.000 description 9
- 239000004571 lime Substances 0.000 description 9
- 239000007788 liquid Substances 0.000 description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 238000005422 blasting Methods 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 4
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000005474 detonation Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010892 electric spark Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2457622C3 (de) | Nichtelektrisch zundbare Sprengkapsel und Sprengsystem unter Verwendung der Sprengkapsel sowie Zundverfahren | |
| DE69629193T2 (de) | Druckbehalter fur leichtes gas | |
| DE3334464A1 (de) | Industriekartusche | |
| DE932596C (de) | Druckgas erzeugende Sprengpatrone | |
| DE97876A (cg-RX-API-DMAC7.html) | ||
| DE2820855A1 (de) | Detonationsenergieuebertrager | |
| DE2362513A1 (de) | Vorrichtung und verfahren zur erzeugung und zum ausblasen von gas | |
| DE3821276C1 (cg-RX-API-DMAC7.html) | ||
| DE512955C (de) | Sprengverfahren | |
| DE900201C (de) | Vorrichtung zum Durchtrennen von Rohrleitungen, insbesondere von verlegten Tiefbohrrohren | |
| DE60124304T2 (de) | Zündvorrichtung für sauerstofflanze zum thermischen schneiden, bohren usw. | |
| CH654407A5 (de) | Verfahren und vorrichtung zum zuenden der treibladung in einer ein gas erzeugenden kartusche sowie kartusche mit der vorrichtung. | |
| DE651832C (de) | Sicherheitspatrone | |
| DE958539C (de) | Elektrische Zuendvorrichtung zum Entzuenden von Anzuende-Zuendschnur | |
| DE645929C (de) | Sprengverfahren | |
| EP3771881B1 (de) | Pyrotechnischer initiator zum initiieren eines zündschlauches und verfahren zum initiieren eines zündschlauches | |
| DE946879C (de) | Druckgas erzeugende Ladung fuer wiederholt verwendbare Sprengeinrichtungen | |
| DE12901C (de) | Hohlprojektile mit mehreren Abtheilungen zur Aufnahme brisanter Sprengstoffe | |
| DE300630C (cg-RX-API-DMAC7.html) | ||
| DE38734C (de) | Verfahren zur Herstellung eines Explosivstoffes aus Pikrinsäure | |
| DE84704C (cg-RX-API-DMAC7.html) | ||
| DE144206C (cg-RX-API-DMAC7.html) | ||
| DE335231C (de) | Aus einem oder mehreren brennbaren Metallpulvern und fluessiger Luft oder fluessigemSauerstoff bestehende Sprengpatrone | |
| DE727715C (de) | Vorrichtung zum Zuenden von Minen | |
| DE28745C (de) | Verfahren und Vorrichtungen zur Entzündung von Schiefspulververladungen |