DE821046C - Schaltung zur Mischung bei Kurzwellen - Google Patents
Schaltung zur Mischung bei KurzwellenInfo
- Publication number
- DE821046C DE821046C DEP23512D DEP0023512D DE821046C DE 821046 C DE821046 C DE 821046C DE P23512 D DEP23512 D DE P23512D DE P0023512 D DEP0023512 D DE P0023512D DE 821046 C DE821046 C DE 821046C
- Authority
- DE
- Germany
- Prior art keywords
- circuit
- frequency
- carrier wave
- capacitor
- signal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000010355 oscillation Effects 0.000 description 18
- 239000003990 capacitor Substances 0.000 description 13
- 230000001419 dependent effect Effects 0.000 description 5
- 229910002367 SrTiO Inorganic materials 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 2
- 230000003321 amplification Effects 0.000 description 1
- 229910002056 binary alloy Inorganic materials 0.000 description 1
- AOWKSNWVBZGMTJ-UHFFFAOYSA-N calcium titanate Chemical compound [Ca+2].[O-][Ti]([O-])=O AOWKSNWVBZGMTJ-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000009022 nonlinear effect Effects 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03D—DEMODULATION OR TRANSFERENCE OF MODULATION FROM ONE CARRIER TO ANOTHER
- H03D7/00—Transference of modulation from one carrier to another, e.g. frequency-changing
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Digital Transmission Methods That Use Modulated Carrier Waves (AREA)
- Inductance-Capacitance Distribution Constants And Capacitance-Resistance Oscillators (AREA)
- Inorganic Insulating Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL634403X | 1946-05-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE821046C true DE821046C (de) | 1951-11-15 |
Family
ID=19788839
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP23512D Expired DE821046C (de) | 1946-05-28 | 1948-12-04 | Schaltung zur Mischung bei Kurzwellen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2719223A (enFirst) |
| BE (1) | BE473522A (enFirst) |
| DE (1) | DE821046C (enFirst) |
| FR (1) | FR947241A (enFirst) |
| GB (1) | GB634403A (enFirst) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2849628A (en) * | 1953-06-12 | 1958-08-26 | Hans E Hollmann | Variable frequency crystal device |
| US2859409A (en) * | 1953-09-14 | 1958-11-04 | Cleveland Patents Inc | Signal generator |
| US3018443A (en) * | 1958-05-20 | 1962-01-23 | Rca Corp | Parameric amplifier with lower frequency pumping |
| DE1121661B (de) * | 1958-12-05 | 1962-01-11 | Siemens Ag | Anordnung zur Verstaerkung kurzer und sehr kurzer elektromagnetischer Wellen |
| US3111629A (en) * | 1959-01-07 | 1963-11-19 | Microwave Ass | Reactance or parametric amplifier |
| US3001143A (en) * | 1959-02-04 | 1961-09-19 | Avco Mfg Corp | Low noise radio frequency amplifier |
| US3147440A (en) * | 1959-02-17 | 1964-09-01 | Singer Inc H R B | Cross-modulation detector means tuned to local oscillator frequency |
| US3012204A (en) * | 1959-04-15 | 1961-12-05 | Bell Telephone Labor Inc | Elastic wave parametric amplifier |
| US3048783A (en) * | 1959-04-28 | 1962-08-07 | Itt | Signal receiving system |
| US3046410A (en) * | 1959-05-14 | 1962-07-24 | Space Technology Lab Inc | Frequency divider systems |
| US2951207A (en) * | 1959-05-14 | 1960-08-30 | Hughes Aircraft Co | Parametric amplifier |
| US3040267A (en) * | 1959-06-22 | 1962-06-19 | Bell Telephone Labor Inc | Negative resistance amplifier circuits |
| US3109934A (en) * | 1959-06-30 | 1963-11-05 | Hughes Aircraft Co | Bi-stable circuit |
| US3063011A (en) * | 1959-07-06 | 1962-11-06 | Nat Company Inc | Wide dynamic range communications receiver |
| US3121844A (en) * | 1959-08-04 | 1964-02-18 | Itt | Amplifier control system |
| US3099801A (en) * | 1959-11-09 | 1963-07-30 | Gen Dynamics Corp | Circuitry utilizing parametrically excited harmonic oscillators |
| US3070751A (en) * | 1960-01-25 | 1962-12-25 | Jack R Vigiano | Parametric amplifiers with increased gain bandwidth product |
| US3365668A (en) * | 1960-06-08 | 1968-01-23 | Magnavox Co | Superregenerative parametric amplifier |
| US3195062A (en) * | 1961-01-19 | 1965-07-13 | Rca Corp | Agc parametric amplifier using negative bias and detuned circuits |
| NL275870A (enFirst) * | 1961-03-17 | |||
| US3109937A (en) * | 1962-02-05 | 1963-11-05 | Boxer Victor | Diode parametric amplifier upconverter |
| FR1344349A (fr) * | 1962-10-02 | 1963-11-29 | Csf | Antenne rideau à balayage électronique |
| US3435379A (en) * | 1965-12-09 | 1969-03-25 | Us Army | Solid-state magnetoelectric modulator and switch |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1712993A (en) * | 1916-08-14 | 1929-05-14 | Western Electric Co | Signaling system |
| FR614412A (fr) * | 1925-08-21 | 1926-12-14 | Radio Electr Soc Fr | Perfectionnements aux récepteurs à interférence |
| GB460408A (en) * | 1935-08-19 | 1937-01-27 | Philips Nv | Improvements in or relating to superheterodyne radio receivers |
| US2243921A (en) * | 1938-11-12 | 1941-06-03 | Rca Corp | Variable capacity device and circuit |
| US2253853A (en) * | 1939-07-09 | 1941-08-26 | Haantjes Johan | Superheterodyne receiving circuit |
| NL57631C (enFirst) * | 1939-09-08 | |||
| NL62594C (enFirst) * | 1940-02-24 | |||
| NL62481C (enFirst) * | 1941-08-08 | |||
| US2399082A (en) * | 1943-06-11 | 1946-04-23 | Titanium Alloy Mfg Co | High dielectric material and method of making same |
| US2387472A (en) * | 1943-08-17 | 1945-10-23 | Rca Corp | Square-law detector |
| US2461307A (en) * | 1944-11-13 | 1949-02-08 | Rauland Corp | Modulating system |
| FR956108A (enFirst) * | 1946-12-18 | 1950-01-26 |
-
0
- BE BE473522D patent/BE473522A/xx unknown
-
1947
- 1947-05-03 US US745770A patent/US2719223A/en not_active Expired - Lifetime
- 1947-05-23 GB GB13905/47A patent/GB634403A/en not_active Expired
- 1947-05-27 FR FR947241D patent/FR947241A/fr not_active Expired
-
1948
- 1948-12-04 DE DEP23512D patent/DE821046C/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB634403A (en) | 1950-03-22 |
| BE473522A (enFirst) | |
| FR947241A (fr) | 1949-06-27 |
| US2719223A (en) | 1955-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE821046C (de) | Schaltung zur Mischung bei Kurzwellen | |
| DE846414C (de) | Schaltung zur Verstaerkung eines elektrischen Signals | |
| DE2915134C2 (enFirst) | ||
| DE1017220B (de) | Modulator mit Vierelektroden-Transistor | |
| DE2000755A1 (de) | Saegezahnschwingungsgeneratorschaltung mit Frequenzteilung | |
| DE2353840A1 (de) | Oberflaechenwellenoszillator | |
| DE1812503C3 (de) | Verfahren zum Prüfen der Antwort eines Systems auf ein Eingangssignal und Gerät zum Durchführen des Verfahrens | |
| DE815198C (de) | Schaltung zur Verstaerkung eines elektrischen Signals | |
| DE2439531A1 (de) | Rauscharmer hf-signalgenerator | |
| DE3024533A1 (de) | Schaltungsanordnung zur breitbandigen kompensation von intermodulationsprodukten dritter ordnung | |
| DE933517C (de) | Transistor-Mischschaltung | |
| DE1277944B (de) | Frequenzumsetzer | |
| DE2856397A1 (de) | Schaltungsanordnung zur erzielung eines gleichlaufs zwischen der oszillatorfrequenz und der resonanzfrequenz des eingangskreises eines ueberlagerungsempfaengers | |
| DE69609396T2 (de) | Demodulatorschaltung für frequenzmoduliertes Signal in der Nähe einer Zwischenfrequenz | |
| DE703509C (de) | Schaltung zur Frequenzstabilisierung eines selbsterregten, rueckgekoppelten Senders | |
| DE1912096B2 (de) | Einspulen FM WT Diskriminator | |
| DE1591263B2 (de) | Ueberlagerungsempfaenger | |
| DE2445955A1 (de) | Phasenschieber-schaltung | |
| DE3423402A1 (de) | Empfaenger | |
| DE2556124C3 (de) | Quarzoszillatorschaltung mit wenigstens einem Quarzvibrator | |
| DE870605C (de) | Kontrollvorrichtung, insbesondere zur Kontrolle der Dicke von in Form von Faeden, Baendern od. dgl. hergestellten Erzeugnissen | |
| DE862774C (de) | Einrichtung zur Frequenzsteuerung eines Schwingungserzeugers | |
| DE972212C (de) | Einrichtung zur Unterdrueckung der Phasen- bzw. Frequenzmodulation einer moduliertenSchwingung | |
| DE1466402C (de) | Schaltungskombination, bestehend aus einem parametnschen Aufwartsmischer und einem Phasendemodulator | |
| DE1773742C (de) | Pendelruckkopplungsresonanz spektrometer |