DE755478C - Elektronenroehre mit mindestens einer Sekundaeremissionselektrode - Google Patents
Elektronenroehre mit mindestens einer SekundaeremissionselektrodeInfo
- Publication number
- DE755478C DE755478C DEN41815A DEN0041815A DE755478C DE 755478 C DE755478 C DE 755478C DE N41815 A DEN41815 A DE N41815A DE N0041815 A DEN0041815 A DE N0041815A DE 755478 C DE755478 C DE 755478C
- Authority
- DE
- Germany
- Prior art keywords
- secondary emission
- tube
- metals
- emission electrode
- capsules
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052751 metal Inorganic materials 0.000 claims description 16
- 239000002184 metal Substances 0.000 claims description 16
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 11
- 150000002739 metals Chemical class 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 239000002775 capsule Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 6
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 6
- 239000001569 carbon dioxide Substances 0.000 claims description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 6
- 150000001342 alkaline earth metals Chemical class 0.000 description 6
- 239000011777 magnesium Substances 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 229910052792 caesium Inorganic materials 0.000 description 2
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- OYLGJCQECKOTOL-UHFFFAOYSA-L barium fluoride Chemical compound [F-].[F-].[Ba+2] OYLGJCQECKOTOL-UHFFFAOYSA-L 0.000 description 1
- 229910001632 barium fluoride Inorganic materials 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- AIYUHDOJVYHVIT-UHFFFAOYSA-M caesium chloride Chemical compound [Cl-].[Cs+] AIYUHDOJVYHVIT-UHFFFAOYSA-M 0.000 description 1
- KOPBYBDAPCDYFK-UHFFFAOYSA-N caesium oxide Chemical compound [O-2].[Cs+].[Cs+] KOPBYBDAPCDYFK-UHFFFAOYSA-N 0.000 description 1
- 229910001942 caesium oxide Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-NJFSPNSNSA-N hydroxyformaldehyde Chemical compound O[14CH]=O BDAGIHXWWSANSR-NJFSPNSNSA-N 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 229910000018 strontium carbonate Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J43/00—Secondary-emission tubes; Electron-multiplier tubes
- H01J43/04—Electron multipliers
- H01J43/28—Vessels, e.g. wall of the tube; Windows; Screens; Suppressing undesired discharges or currents
Landscapes
- Discharge Lamp (AREA)
- Solid Thermionic Cathode (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL81866A NL50859C (enExample) | 1937-03-30 | 1937-03-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE755478C true DE755478C (de) | 1944-09-28 |
Family
ID=43795112
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN41815A Expired DE755478C (de) | 1937-03-30 | 1938-03-29 | Elektronenroehre mit mindestens einer Sekundaeremissionselektrode |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2228945A (enExample) |
| BE (1) | BE427227A (enExample) |
| CH (1) | CH207264A (enExample) |
| DE (1) | DE755478C (enExample) |
| FR (1) | FR835820A (enExample) |
| GB (1) | GB492250A (enExample) |
| NL (1) | NL50859C (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE477661A (enExample) * | 1939-02-03 | |||
| US2639963A (en) * | 1948-04-05 | 1953-05-26 | Sylvania Electric Prod | Secondary emitter and method of manufacture |
| US2576170A (en) * | 1949-06-18 | 1951-11-27 | American Viscose Corp | Staple fiber cutter |
| US2622218A (en) * | 1950-01-31 | 1952-12-16 | Rca Corp | Secondary-emission electron discharge device |
| US2744073A (en) * | 1952-11-22 | 1956-05-01 | Battelle Development Corp | Thermionic emitter materials |
| GB1200899A (en) * | 1967-04-21 | 1970-08-05 | Mullard Ltd | Improvements in or relating to photocathodes |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR629840A (fr) * | 1926-03-06 | 1927-11-17 | Thomson Houston Comp Francaise | Perfectionnements aux tubes à décharge électronique et aux moyens d'éviter des fuites électriques dans ces tubes |
| FR801041A (fr) * | 1935-01-30 | 1936-07-25 | Rca Corp | Dispositif à décharge électrique |
-
1937
- 1937-03-30 NL NL81866A patent/NL50859C/xx active
-
1938
- 1938-03-15 US US195940A patent/US2228945A/en not_active Expired - Lifetime
- 1938-03-28 CH CH207264D patent/CH207264A/de unknown
- 1938-03-28 GB GB9450/38A patent/GB492250A/en not_active Expired
- 1938-03-28 FR FR835820D patent/FR835820A/fr not_active Expired
- 1938-03-28 BE BE427227A patent/BE427227A/xx unknown
- 1938-03-29 DE DEN41815A patent/DE755478C/de not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR629840A (fr) * | 1926-03-06 | 1927-11-17 | Thomson Houston Comp Francaise | Perfectionnements aux tubes à décharge électronique et aux moyens d'éviter des fuites électriques dans ces tubes |
| FR801041A (fr) * | 1935-01-30 | 1936-07-25 | Rca Corp | Dispositif à décharge électrique |
Also Published As
| Publication number | Publication date |
|---|---|
| GB492250A (en) | 1938-09-16 |
| US2228945A (en) | 1941-01-14 |
| FR835820A (fr) | 1939-01-04 |
| NL50859C (enExample) | 1941-08-16 |
| BE427227A (fr) | 1938-04-30 |
| CH207264A (de) | 1939-10-15 |
| NL81866B (enExample) | 1941-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1085554A1 (de) | Plasmabildschirm mit UV-Licht reflektierender Frontplattenbeschichtung | |
| DE755478C (de) | Elektronenroehre mit mindestens einer Sekundaeremissionselektrode | |
| DE964793C (de) | Elektrode fuer elektrische Gas- oder Dampf-Entladungsapparate | |
| DE720713C (de) | Verfahren zur Herstellung von Leuchtschirmen fuer elektrische Entladungsgefaesse | |
| DE19962029A1 (de) | Plasmabildschirm mit rotem Leuchtstoff | |
| DE747205C (de) | Verfahren zum Aufbringen einer sekundaeremissionsfaehigen Schicht auf eine Elektrodeeines Entladungsgefaesses | |
| EP1233438A2 (de) | Plasmabildschirm mit erhöhter Luminanz | |
| AT156765B (de) | Elektrische Entladungsröhre. | |
| DE2629413C3 (de) | Fluoreszenzmasse und ihre Verwendung | |
| EP0022974A1 (de) | Plasma-Bildanzeigevorrichtung | |
| DE1512397A1 (de) | Farbfernsehbildwiedergabeeinrichtung | |
| DE2937981C2 (de) | Zinkoxid-Leuchtstoff | |
| DE565464C (de) | Elektrische Entladungsroehre | |
| DE864133C (de) | Elektronenoptischer Bildverstaerker | |
| DE579680C (de) | Photozelle mit einer photoelektrischen Elektrode und einer weiteren, fluoreszierenden Stoff enthaltenden Elektrode | |
| DE862806C (de) | Verfahren zur Herstellung einer elektrischen Entladungsroehre | |
| DE2240338C3 (de) | Gasentladungsanzeige- und -speichervorrichtung | |
| AT136262B (de) | Photoelektrische Zelle. | |
| AT128310B (de) | Verfahren zur Darstellung von Alkali- und Erdalkalimetallen. | |
| DE1639448C3 (de) | Speicherschirm für eine Sichtspeicherröhre und Verfahren zu dessen Herstellung | |
| DE819296C (de) | Verfahren zur Herstellung einer Kathode einer elektrischen Entladungsroehre | |
| DE821239C (de) | Verfahren zum Einbringen lumineszierender Stoffe in Glasgefaesse, insbesondere in Gasentladungsroehren | |
| DE1197990B (de) | Kaltkathode fuer Elektronenroehren | |
| DE565127C (de) | Verfahren zur Einbringung der chemisch wirksamen Metalle Caesium, Kalium, Rubidium oder Barium in einen evakuierten oder gasgefuellten Behaelter | |
| DE2607888A1 (de) | Leuchtstoff |