DE7527288U - Selbstbegrenzender elektrischer widerstand - Google Patents
Selbstbegrenzender elektrischer widerstandInfo
- Publication number
- DE7527288U DE7527288U DE7527288U DE7527288U DE7527288U DE 7527288 U DE7527288 U DE 7527288U DE 7527288 U DE7527288 U DE 7527288U DE 7527288 U DE7527288 U DE 7527288U DE 7527288 U DE7527288 U DE 7527288U
- Authority
- DE
- Germany
- Prior art keywords
- resistor according
- electrodes
- tissue
- pair
- thickness
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims description 22
- 239000002245 particle Substances 0.000 claims description 13
- 239000011159 matrix material Substances 0.000 claims description 11
- 239000004744 fabric Substances 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 8
- 239000002861 polymer material Substances 0.000 claims description 7
- -1 polyethylene Polymers 0.000 claims description 6
- 239000004698 Polyethylene Substances 0.000 claims description 5
- 239000006229 carbon black Substances 0.000 claims description 5
- 239000004020 conductor Substances 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 4
- 229920000573 polyethylene Polymers 0.000 claims description 4
- 239000011810 insulating material Substances 0.000 claims description 2
- 229920000098 polyolefin Polymers 0.000 claims description 2
- 229920001567 vinyl ester resin Polymers 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 description 25
- 210000001519 tissue Anatomy 0.000 description 15
- 238000001125 extrusion Methods 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 8
- 235000019241 carbon black Nutrition 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 2
- 230000005611 electricity Effects 0.000 description 2
- 239000005038 ethylene vinyl acetate Substances 0.000 description 2
- 229920001903 high density polyethylene Polymers 0.000 description 2
- 239000004700 high-density polyethylene Substances 0.000 description 2
- 229920001684 low density polyethylene Polymers 0.000 description 2
- 239000004702 low-density polyethylene Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 2
- 239000004065 semiconductor Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- QLZJUIZVJLSNDD-UHFFFAOYSA-N 2-(2-methylidenebutanoyloxy)ethyl 2-methylidenebutanoate Chemical compound CCC(=C)C(=O)OCCOC(=O)C(=C)CC QLZJUIZVJLSNDD-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 241001326189 Gyrodactylus prostae Species 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910001128 Sn alloy Inorganic materials 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- DQXBYHZEEUGOBF-UHFFFAOYSA-N but-3-enoic acid;ethene Chemical compound C=C.OC(=O)CC=C DQXBYHZEEUGOBF-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- TVZPLCNGKSPOJA-UHFFFAOYSA-N copper zinc Chemical compound [Cu].[Zn] TVZPLCNGKSPOJA-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 229920006244 ethylene-ethyl acrylate Polymers 0.000 description 1
- 239000005042 ethylene-ethyl acrylate Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000013007 heat curing Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229920001179 medium density polyethylene Polymers 0.000 description 1
- 239000004701 medium-density polyethylene Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000005453 pelletization Methods 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C1/00—Details
- H01C1/02—Housing; Enclosing; Embedding; Filling the housing or enclosure
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Resistance Heating (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Thermistors And Varistors (AREA)
- Conductive Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB38059/74A GB1521460A (en) | 1974-08-30 | 1974-08-30 | Self-limiting electrically resistive article and process for its manufacture |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE7527288U true DE7527288U (de) | 1976-04-15 |
Family
ID=10400878
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7527288U Expired DE7527288U (de) | 1974-08-30 | 1975-08-29 | Selbstbegrenzender elektrischer widerstand |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4334148A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1067947A (cg-RX-API-DMAC10.html) |
| DE (1) | DE7527288U (cg-RX-API-DMAC10.html) |
| FR (1) | FR2283532A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1521460A (cg-RX-API-DMAC10.html) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4764664A (en) * | 1976-12-13 | 1988-08-16 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4876440A (en) * | 1976-12-13 | 1989-10-24 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4866253A (en) * | 1976-12-13 | 1989-09-12 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4425497A (en) | 1979-08-17 | 1984-01-10 | Raychem Corporation | PTC Heater assembly |
| US4547659A (en) * | 1979-08-17 | 1985-10-15 | Raychem Corporation | PTC Heater assembly |
| US4673801A (en) * | 1979-08-17 | 1987-06-16 | Raychem Corporation | PTC heater assembly |
| US4432211A (en) * | 1980-11-17 | 1984-02-21 | Hitachi, Ltd. | Defrosting apparatus |
| US4427877A (en) | 1981-09-28 | 1984-01-24 | Raychem Corporation | Printing on low surface energy polymers |
| US4471215A (en) * | 1983-08-24 | 1984-09-11 | Eaton Corporation | Self-regulating heating cable having radiation grafted jacket |
| US4668857A (en) * | 1985-08-16 | 1987-05-26 | Belton Corporation | Temperature self-regulating resistive heating element |
| US4689475A (en) * | 1985-10-15 | 1987-08-25 | Raychem Corporation | Electrical devices containing conductive polymers |
| US4633069A (en) * | 1985-10-21 | 1986-12-30 | Texas Instruments Incorporated | Heat-exchanger |
| US4801785A (en) * | 1986-01-14 | 1989-01-31 | Raychem Corporation | Electrical devices |
| GB8600985D0 (en) * | 1986-01-16 | 1986-02-19 | Pyrontenax Of Canada Ltd | Electric cables |
| US4689470A (en) * | 1986-02-18 | 1987-08-25 | Emerson Electric Co. | Self-regulating baseboard heater, system and method |
| GB8604519D0 (en) * | 1986-02-24 | 1986-04-03 | Raychem Sa Nv | Electrical devices |
| US4708608A (en) * | 1986-06-17 | 1987-11-24 | Dirocco Jobbie | Heat pad |
| US4822981A (en) * | 1987-06-19 | 1989-04-18 | Hatco Corporation | Self-regulating warmer device for food products |
| US5004190A (en) * | 1987-11-06 | 1991-04-02 | Bylin Heating Systems, Inc. | Rail heating apparatus |
| NO880529L (no) * | 1988-02-08 | 1989-08-09 | Ramu Int | Selvbegrensede elektrisk varmeelement. |
| US5111032A (en) * | 1989-03-13 | 1992-05-05 | Raychem Corporation | Method of making an electrical device comprising a conductive polymer |
| US4972067A (en) * | 1989-06-21 | 1990-11-20 | Process Technology Inc. | PTC heater assembly and a method of manufacturing the heater assembly |
| US5052699A (en) * | 1989-07-10 | 1991-10-01 | Raychem Corporation | Grommet |
| US5925276A (en) * | 1989-09-08 | 1999-07-20 | Raychem Corporation | Conductive polymer device with fuse capable of arc suppression |
| US5174924A (en) * | 1990-06-04 | 1992-12-29 | Fujikura Ltd. | Ptc conductive polymer composition containing carbon black having large particle size and high dbp absorption |
| US5122641A (en) * | 1990-05-23 | 1992-06-16 | Furon Company | Self-regulating heating cable compositions therefor, and method |
| US6111234A (en) * | 1991-05-07 | 2000-08-29 | Batliwalla; Neville S. | Electrical device |
| US5749118A (en) * | 1993-02-05 | 1998-05-12 | Holland; Dewey T. | Heated wiper blade |
| US5317061A (en) * | 1993-02-24 | 1994-05-31 | Raychem Corporation | Fluoropolymer compositions |
| US5756972A (en) * | 1994-10-25 | 1998-05-26 | Raychem Corporation | Hinged connector for heating cables of various sizes |
| US5622642A (en) * | 1995-02-06 | 1997-04-22 | Raychem Corporation | Sealing apparatus for elongate cables having movable insert with gripping members |
| US5792987A (en) * | 1995-08-28 | 1998-08-11 | Raychem Corporation | Sealing device |
| US5718600A (en) * | 1996-01-17 | 1998-02-17 | Raychem Corporation | Electrical plug |
| US6005232A (en) * | 1996-06-28 | 1999-12-21 | Raychem Corporation | Heating cable |
| US5767448A (en) * | 1996-09-30 | 1998-06-16 | Raychem Corporation | Sealing device |
| JP4044289B2 (ja) | 1998-10-15 | 2008-02-06 | タイコ・エレクトロニクス・コーポレイション | 電気ケーブル用コネクタ |
| JP3371827B2 (ja) * | 1998-11-04 | 2003-01-27 | 株式会社村田製作所 | 有機質サーミスタ装置の製造方法 |
| US6704997B1 (en) * | 1998-11-30 | 2004-03-16 | Murata Manufacturing Co., Ltd. | Method of producing organic thermistor devices |
| GB2390794A (en) * | 2002-07-09 | 2004-01-14 | Airlux Electrical Co Ltd | Heating conductor suitable for electric blanket |
| FR2844091B1 (fr) * | 2002-09-03 | 2004-11-12 | Acome Soc Coop Travailleurs | Cable electrique chauffant autoregulant |
| JP4624697B2 (ja) * | 2004-03-12 | 2011-02-02 | オリンパス株式会社 | 手術用処置具 |
| US20080000039A1 (en) * | 2006-06-28 | 2008-01-03 | Eugene Higgs | Heated Wiper Assembly |
| US12390614B2 (en) * | 2013-05-17 | 2025-08-19 | Sahamed Technologies, Llc | Humidification of ventilator gases |
| EP3257326B1 (en) | 2015-02-09 | 2020-06-03 | nVent Services GmbH | Heater cable having a tapered profile |
| FR3033445B1 (fr) * | 2015-03-03 | 2017-03-10 | Heatself | Cable chauffant a flux thermique oriente |
| DE102021213401A1 (de) * | 2021-11-09 | 2023-05-11 | Robert Bosch Gesellschaft mit beschränkter Haftung | Wischblatt, insbesondere für ein Kraftfahrzeug |
| US11904815B1 (en) | 2022-11-17 | 2024-02-20 | Robert Bosch Gmbh | Wiper blade, in particular for a motor vehicle |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2373160A (en) * | 1943-01-07 | 1945-04-10 | Bell Telephone Labor Inc | Resistor having a high temperature coefficient of resistance |
| US3344385A (en) * | 1965-01-04 | 1967-09-26 | Dow Corning | Flexible resistance element with flexible and stretchable terminal electrodes |
| US3900654A (en) * | 1971-07-15 | 1975-08-19 | Du Pont | Composite polymeric electric heating element |
| US3861029A (en) * | 1972-09-08 | 1975-01-21 | Raychem Corp | Method of making heater cable |
| US3793716A (en) * | 1972-09-08 | 1974-02-26 | Raychem Corp | Method of making self limiting heat elements |
| US3858144A (en) * | 1972-12-29 | 1974-12-31 | Raychem Corp | Voltage stress-resistant conductive articles |
| US3823217A (en) * | 1973-01-18 | 1974-07-09 | Raychem Corp | Resistivity variance reduction |
| US4055526A (en) * | 1974-03-29 | 1977-10-25 | Shin Kiyokawa | Planar heating element and production thereof |
| US4177376A (en) * | 1974-09-27 | 1979-12-04 | Raychem Corporation | Layered self-regulating heating article |
| US4058704A (en) * | 1974-12-27 | 1977-11-15 | Taeo Kim | Coilable and severable heating element |
| US4188276A (en) * | 1975-08-04 | 1980-02-12 | Raychem Corporation | Voltage stable positive temperature coefficient of resistance crosslinked compositions |
-
1974
- 1974-08-30 GB GB38059/74A patent/GB1521460A/en not_active Expired
-
1975
- 1975-08-29 DE DE7527288U patent/DE7527288U/de not_active Expired
- 1975-08-29 CA CA234,461A patent/CA1067947A/en not_active Expired
- 1975-08-29 FR FR7526588A patent/FR2283532A1/fr active Granted
-
1978
- 1978-01-16 US US05/869,786 patent/US4334148A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2283532B1 (cg-RX-API-DMAC10.html) | 1981-08-07 |
| US4334148A (en) | 1982-06-08 |
| GB1521460A (en) | 1978-08-16 |
| CA1067947A (en) | 1979-12-11 |
| FR2283532A1 (fr) | 1976-03-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE7527288U (de) | Selbstbegrenzender elektrischer widerstand | |
| DE2345303C2 (de) | Sich selbst regulierender elektrischer Widerstandskörper und Verfahren zu dessen Herstellung | |
| DE2364947C2 (de) | Elektrischer Heizwiderstand | |
| DE3050761C2 (de) | Elektrisch leitfähiger, selbstregelnder Gegenstand mit positiven Temperaturkoeffizienten des elektrischen Widerstandes, sowie Verfahren zu seiner Herstellung | |
| DE2402475A1 (de) | Elektrischer widerstandskoerper mit verminderter schwankung des widerstandswertes und verfahren zu dessen herstellung | |
| DE2948350C2 (cg-RX-API-DMAC10.html) | ||
| DE69606316T2 (de) | Verbesserte polymer ptc-zusammensetzungen | |
| DE2543314C2 (de) | Selbstregelnde elektrische Vorrichtung | |
| DE3177291T2 (de) | Schaltungsschutzeinrichtung. | |
| US6221282B1 (en) | Electrical devices comprising conductive polymer compositions | |
| DE2513362C3 (de) | Verfahren zur Herstellung eines flachen Heizelementes | |
| DE3707503C2 (de) | PTC-Zusammensetzung | |
| DE2344067C2 (de) | Stoffzusammensetzungen mit nicht-linearer elektrischer Widerstandscharakteristik | |
| DE3512483C2 (cg-RX-API-DMAC10.html) | ||
| DE2463414C2 (cg-RX-API-DMAC10.html) | ||
| DE2345320C2 (de) | Verfahren zur Herstellung eines sich selbst regulierenden elektrischen Widerstandskörpers | |
| DE2425141C3 (de) | Flexibles Überzugsmaterial für Zündkabel u.dgl. Substrate | |
| DE2634931C2 (de) | Formmasse und unter Verwendung dieser Formmasse hergestellter elektrischer Widerstandskörper mit PTC-Verhalten | |
| DE2948281A1 (de) | Elektrische schaltung und schaltungsschutzeinrichtung | |
| DE2103319A1 (de) | Polymerelement und Verfahren zu seiner Herstellung | |
| DE2903442A1 (de) | Elektrische vorrichtung, z.b. heizkoerper oder temperaturmessfuehler, mit zumindest zwei elektroden und einem ptc- element, insbesondere zur beseitigung von einschaltstromstosstoerungen | |
| DE3701814A1 (de) | Elektrisch leitende polymerzusammensetzung mit positivem temperaturkoeffizienten sowie verfahren zu ihrer herstellung | |
| DE3209577A1 (de) | Isoliertes hochspannungskabel | |
| DE602004000449T2 (de) | Kunstoffthermistor mit positiven Temperaturkoeffizienten und Verfahren zu seiner Herstellung | |
| DE3889177T2 (de) | Leitfähige Kunststoffzusammensetzung. |