DE742255C - Herstellung von Alkaliamiden durch Umsetzung von Ammoniak mit Alkalimetall - Google Patents
Herstellung von Alkaliamiden durch Umsetzung von Ammoniak mit AlkalimetallInfo
- Publication number
- DE742255C DE742255C DEN45102D DEN0045102D DE742255C DE 742255 C DE742255 C DE 742255C DE N45102 D DEN45102 D DE N45102D DE N0045102 D DEN0045102 D DE N0045102D DE 742255 C DE742255 C DE 742255C
- Authority
- DE
- Germany
- Prior art keywords
- alkali
- alkali metal
- amides
- production
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 title claims description 21
- 239000003513 alkali Substances 0.000 title claims description 11
- 229910052783 alkali metal Inorganic materials 0.000 title claims description 10
- 150000001340 alkali metals Chemical class 0.000 title claims description 10
- 229910021529 ammonia Inorganic materials 0.000 title claims description 10
- 150000001408 amides Chemical class 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 7
- 150000002830 nitrogen compounds Chemical class 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000005662 Paraffin oil Substances 0.000 claims description 2
- 239000010687 lubricating oil Substances 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 238000010640 amide synthesis reaction Methods 0.000 claims 1
- 150000002897 organic nitrogen compounds Chemical class 0.000 claims 1
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 150000003927 aminopyridines Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 3
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- ZBNMBCAMIKHDAA-UHFFFAOYSA-N sodium superoxide Chemical compound [Na+].O=O ZBNMBCAMIKHDAA-UHFFFAOYSA-N 0.000 description 2
- 229910000144 sodium(I) superoxide Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/082—Compounds containing nitrogen and non-metals and optionally metals
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/082—Compounds containing nitrogen and non-metals and optionally metals
- C01B21/087—Compounds containing nitrogen and non-metals and optionally metals containing one or more hydrogen atoms
- C01B21/092—Compounds containing nitrogen and non-metals and optionally metals containing one or more hydrogen atoms containing also one or more metal atoms
- C01B21/0923—Metal imides or amides
- C01B21/0926—Metal imides or amides of alkali metals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL2612436X | 1940-10-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE742255C true DE742255C (de) | 1943-12-01 |
Family
ID=19875025
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN45102D Expired DE742255C (de) | 1940-10-21 | 1941-09-26 | Herstellung von Alkaliamiden durch Umsetzung von Ammoniak mit Alkalimetall |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US2612436A (enFirst) |
| DE (1) | DE742255C (enFirst) |
| NL (1) | NL59005C (enFirst) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2612436A (en) * | 1940-10-21 | 1952-09-30 | Shell Dev | Method of preparing alkali metal amides |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3542512A (en) * | 1968-01-13 | 1970-11-24 | Lithium Corp | Preparation of lithium amide |
| US4051185A (en) * | 1974-05-07 | 1977-09-27 | Atomic Energy Of Canada Ltd. | Process for the reclamation of alkali metal alkylamides |
| US4206191A (en) * | 1978-02-13 | 1980-06-03 | Lithium Corporation Of America | Preparation of lithium amide |
| US5486343A (en) * | 1994-04-25 | 1996-01-23 | Fmc Corporation | Lithium amide process |
| DE10111725C1 (de) * | 2001-03-09 | 2002-07-25 | Chemetall Gmbh | Verfahren zur Herstellung von Lithiumamid |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE316137C (enFirst) * | 1914-02-02 | |||
| DE362446C (de) * | 1920-03-13 | 1922-10-27 | Chem Fab Vorm E Schering | Verfahren zur Darstellung von 2-Aminopyridin |
| DE358397C (de) * | 1920-08-04 | 1922-09-11 | Chem Fab Vorm E Schering | Verfahren zur Darstellung von Aminopyridinen |
| US1570467A (en) * | 1924-03-31 | 1926-01-19 | Ewan Thomas | Manufacture of alkali-metal amides |
| US1789022A (en) * | 1927-09-30 | 1931-01-13 | Pyridium Corp | Method of manufacturing alpha-alpha-diaminopyridine |
| US2000411A (en) * | 1931-12-30 | 1935-05-07 | Universal Oil Prod Co | Treatment of hydrocarbon oils |
| US1938890A (en) * | 1932-04-09 | 1933-12-12 | Dow Chemical Co | Method of making imides of ketones |
| US2104407A (en) * | 1933-09-23 | 1938-01-04 | Universal Oil Prod Co | Manufacture of aryl amines |
| US2163100A (en) * | 1934-09-13 | 1939-06-20 | Du Pont | Production of finely divided sodamide |
| US2202994A (en) * | 1936-03-07 | 1940-06-04 | Du Pont | Process for making alkali metal amides |
| US2106180A (en) * | 1936-07-20 | 1938-01-25 | Du Pont | Process of preparing tertiary ethynyl carbinols and product thereby produced |
| NL59005C (enFirst) * | 1940-10-21 |
-
0
- NL NL59005D patent/NL59005C/xx active
-
1941
- 1941-09-26 DE DEN45102D patent/DE742255C/de not_active Expired
-
1947
- 1947-07-29 US US764590A patent/US2612436A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2612436A (en) * | 1940-10-21 | 1952-09-30 | Shell Dev | Method of preparing alkali metal amides |
Also Published As
| Publication number | Publication date |
|---|---|
| US2612436A (en) | 1952-09-30 |
| NL59005C (enFirst) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1163790B (de) | Verfahren zur Herstellung von Propionsaeure | |
| DE2620554C3 (de) | Verfahren zur Herstellung eines Kupfer-Nickel-Siliciumoxid-Katalysators und seine Verwendung | |
| DE742255C (de) | Herstellung von Alkaliamiden durch Umsetzung von Ammoniak mit Alkalimetall | |
| DE68917099T2 (de) | Produktion von sekundären aliphatischen Aminen. | |
| DE1234896B (de) | Korrosionsschutzmittel fuer Kupfer und Kupferlegierungen | |
| EP0322760A1 (de) | Verfahren zur Herstellung von Kobaltkatalysatoren | |
| DE1278432B (de) | Verfahren zur Herstellung von Cyclohexylamin | |
| DE1202274B (de) | Verfahren zur Herstellung von Borhydrid-Carbonyl-Verbindungen | |
| DE545368C (de) | Verfahren zur Entfernung von Kohlenoxysulfid aus Gasen | |
| DE69023451T2 (de) | Orthoalkylierung von aromatischen Aminen. | |
| DE3200783C2 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten cis,cis-1,3-Cyclooctadienen durch Isomerisierung von gegebenenfalls substituierten 1,4- oder 1,5-Cyclooctadienen | |
| DE955685C (de) | Verfahren zur Herstellung von Melamin | |
| DE936265C (de) | Verfahren zur katalytischen Umwandlung von Kohlenoxyd und Wasserstoff enthaltenden Gasgemischen in Kohlenwasserstoffe oder sauerstoffhaltige organische Verbindungen | |
| DE1000157C2 (de) | Verfahren zur elektrothermischen Gewinnung von Magnesium | |
| DE1276032B (de) | Verfahren zur Herstellung von Cyclohexylamin | |
| DE956674C (de) | Verfahren zur Herstellung von Ammoniak | |
| AT112972B (de) | Verfahren zur Herstellung von Wasserstoff. | |
| DE1518402C (de) | Verfahren zur Herstellung von clor oder bromsubstituierten aromatischen Ammen | |
| DE1468018A1 (de) | Verfahren zur Herstellung von Cyclohexylamin | |
| DE841446C (de) | Katalysator zur Durchfuehrung chemischer Reaktionen | |
| DE1443378C (enFirst) | ||
| DE1015787B (de) | Verfahren zum Entzug von Sauerstoffbeimischungen aus den als Ausgangsmaterial fuer die Harnstoffsynthese dienenden Gasen | |
| AT205009B (de) | Verfahren zur Herstellung hochaktiver Mischkatalysatoren | |
| AT68574B (de) | Verfahren zur Gewinnung sehr voluminöser und leichter, insbesondere für Reaktionen zwischen Flüssigkeiten und Gasen geeigneter Katalysatoren. | |
| DE504862C (de) | Verfahren zur UEberfuehrung von Acetylen in Acetaldehyd mit Hilfe von Katalysatoren |