DE69428142T2 - Quinolin- oder Quinazolinderivate, deren Herstellung und Verwendung - Google Patents
Quinolin- oder Quinazolinderivate, deren Herstellung und VerwendungInfo
- Publication number
- DE69428142T2 DE69428142T2 DE69428142T DE69428142T DE69428142T2 DE 69428142 T2 DE69428142 T2 DE 69428142T2 DE 69428142 T DE69428142 T DE 69428142T DE 69428142 T DE69428142 T DE 69428142T DE 69428142 T2 DE69428142 T2 DE 69428142T2
- Authority
- DE
- Germany
- Prior art keywords
- salt
- group
- ring
- dimethoxy
- compound according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000002360 preparation method Methods 0.000 title claims description 10
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 title description 14
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 102
- 150000003839 salts Chemical class 0.000 claims abstract description 35
- 125000001424 substituent group Chemical group 0.000 claims abstract description 24
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 20
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 18
- 206010003246 arthritis Diseases 0.000 claims abstract description 11
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 6
- -1 unsaturated Chemical group 0.000 claims description 63
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 238000011282 treatment Methods 0.000 claims description 11
- 125000003277 amino group Chemical group 0.000 claims description 10
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 6
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- CLQRMSBSMHXMMC-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 CLQRMSBSMHXMMC-UHFFFAOYSA-N 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 3
- 208000027866 inflammatory disease Diseases 0.000 claims description 3
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 claims description 2
- 125000001607 1,2,3-triazol-1-yl group Chemical group [*]N1N=NC([H])=C1[H] 0.000 claims description 2
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 claims description 2
- 125000001401 1,2,4-triazol-4-yl group Chemical group N=1N=C([H])N([*])C=1[H] 0.000 claims description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 230000000202 analgesic effect Effects 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- ONLOPAQGNGIJOE-UHFFFAOYSA-N ethyl 4-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound CCOC(=O)c1c(Cn2cncn2)nc2cc(OC)c(OC)cc2c1-c1ccc(O)c(OC)c1 ONLOPAQGNGIJOE-UHFFFAOYSA-N 0.000 claims description 2
- CTBHAVDZLRFSJS-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(3-methoxy-4-propan-2-yloxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC(C)C)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 CTBHAVDZLRFSJS-UHFFFAOYSA-N 0.000 claims description 2
- YEPUKTLWFPFMMZ-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(4-methoxy-3-propan-2-yloxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC(C)C)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 YEPUKTLWFPFMMZ-UHFFFAOYSA-N 0.000 claims description 2
- ODDGYGKQBBBPCW-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(4-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=CC(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 ODDGYGKQBBBPCW-UHFFFAOYSA-N 0.000 claims description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 claims description 2
- 125000004353 pyrazol-1-yl group Chemical group [H]C1=NN(*)C([H])=C1[H] 0.000 claims description 2
- 125000004523 tetrazol-1-yl group Chemical group N1(N=NN=C1)* 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims 9
- 238000004519 manufacturing process Methods 0.000 claims 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 3
- 238000011321 prophylaxis Methods 0.000 claims 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 1
- 206010037660 Pyrexia Diseases 0.000 claims 1
- 230000001754 anti-pyretic effect Effects 0.000 claims 1
- 239000002221 antipyretic Substances 0.000 claims 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims 1
- WHKAKFVORZRBAU-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-(pyrazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=CC=N1 WHKAKFVORZRBAU-UHFFFAOYSA-N 0.000 claims 1
- 230000027950 fever generation Effects 0.000 claims 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims 1
- 239000003814 drug Substances 0.000 abstract description 6
- 229940121363 anti-inflammatory agent Drugs 0.000 abstract description 4
- 239000002260 anti-inflammatory agent Substances 0.000 abstract description 4
- 229940124597 therapeutic agent Drugs 0.000 abstract description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 96
- 238000000034 method Methods 0.000 description 67
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 57
- 239000013078 crystal Substances 0.000 description 50
- 238000002844 melting Methods 0.000 description 50
- 230000008018 melting Effects 0.000 description 50
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 46
- 235000019441 ethanol Nutrition 0.000 description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- 239000002904 solvent Substances 0.000 description 36
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 30
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 29
- 238000006243 chemical reaction Methods 0.000 description 29
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- 235000002639 sodium chloride Nutrition 0.000 description 26
- 239000000203 mixture Substances 0.000 description 22
- 239000011541 reaction mixture Substances 0.000 description 22
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 238000010898 silica gel chromatography Methods 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 150000003246 quinazolines Chemical class 0.000 description 18
- 238000003756 stirring Methods 0.000 description 17
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 125000000217 alkyl group Chemical group 0.000 description 15
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 15
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 15
- 235000019341 magnesium sulphate Nutrition 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 239000003795 chemical substances by application Substances 0.000 description 11
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 10
- SKCNIGRBPJIUBQ-UHFFFAOYSA-N chloroform;ethyl acetate Chemical compound ClC(Cl)Cl.CCOC(C)=O SKCNIGRBPJIUBQ-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- 238000002425 crystallisation Methods 0.000 description 8
- 230000008025 crystallization Effects 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- 238000000926 separation method Methods 0.000 description 8
- 238000000638 solvent extraction Methods 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 8
- QURQNGLMLPYTKL-UHFFFAOYSA-N (2-amino-4,5-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methanone Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)C1=CC(OC)=C(OC)C=C1N QURQNGLMLPYTKL-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 238000000921 elemental analysis Methods 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical class ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 5
- 230000002140 halogenating effect Effects 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 4
- 230000031709 bromination Effects 0.000 description 4
- 238000005893 bromination reaction Methods 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- UZZYPTSLUYJTOW-UHFFFAOYSA-N ethyl 2-(chloromethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=C(CCl)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 UZZYPTSLUYJTOW-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 235000017550 sodium carbonate Nutrition 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- VEFDQCSIVBIYFQ-UHFFFAOYSA-N 4-phenylquinazoline Chemical group C1=CC=CC=C1C1=NC=NC2=CC=CC=C12 VEFDQCSIVBIYFQ-UHFFFAOYSA-N 0.000 description 3
- LOCUXGFHUYBUHF-UHFFFAOYSA-N 4-phenylquinoline Chemical compound C1=CC=CC=C1C1=CC=NC2=CC=CC=C12 LOCUXGFHUYBUHF-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- FSEXLNMNADBYJU-UHFFFAOYSA-N alpha-Phenylquinoline Natural products C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=N1 FSEXLNMNADBYJU-UHFFFAOYSA-N 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 3
- 150000008282 halocarbons Chemical class 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 235000010355 mannitol Nutrition 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- IAKHMKGGTNLKSZ-INIZCTEOSA-N (S)-colchicine Chemical compound C1([C@@H](NC(C)=O)CC2)=CC(=O)C(OC)=CC=C1C1=C2C=C(OC)C(OC)=C1OC IAKHMKGGTNLKSZ-INIZCTEOSA-N 0.000 description 2
- VEARVAHDXMYVRO-UHFFFAOYSA-N 1,1-dichloroethane;ethanol Chemical compound CCO.CC(Cl)Cl VEARVAHDXMYVRO-UHFFFAOYSA-N 0.000 description 2
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- CHXJINAQOAKBSQ-UHFFFAOYSA-N 4-(1,2,4-triazol-1-yl)butanoic acid Chemical compound OC(=O)CCCN1C=NC=N1 CHXJINAQOAKBSQ-UHFFFAOYSA-N 0.000 description 2
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 2
- ZCWMZLARYIDEEZ-UHFFFAOYSA-N 4-imidazol-1-ylbutanoic acid Chemical compound OC(=O)CCCN1C=CN=C1 ZCWMZLARYIDEEZ-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- YTRRZWTXQVETAL-UHFFFAOYSA-N 5-imidazol-1-ylpentanoic acid Chemical compound OC(=O)CCCCN1C=CN=C1 YTRRZWTXQVETAL-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 208000009386 Experimental Arthritis Diseases 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 230000002456 anti-arthritic effect Effects 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000002917 arthritic effect Effects 0.000 description 2
- VTHJBWNRMDSTDO-UHFFFAOYSA-N benzyl 4-(1,2,4-triazol-1-yl)butanoate Chemical compound C=1C=CC=CC=1COC(=O)CCCN1C=NC=N1 VTHJBWNRMDSTDO-UHFFFAOYSA-N 0.000 description 2
- STVLWOPMFLLWLA-UHFFFAOYSA-N benzyl 4-imidazol-1-ylbutanoate Chemical compound C=1C=CC=CC=1COC(=O)CCCN1C=CN=C1 STVLWOPMFLLWLA-UHFFFAOYSA-N 0.000 description 2
- YEOJDACPZQAYIY-UHFFFAOYSA-N benzyl 5-imidazol-1-ylpentanoate Chemical compound C=1C=CC=CC=1COC(=O)CCCCN1C=CN=C1 YEOJDACPZQAYIY-UHFFFAOYSA-N 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- GNYGGEPHGFSPJB-UHFFFAOYSA-N butyl 2-(bromomethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCCCOC(=O)C1=C(CBr)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 GNYGGEPHGFSPJB-UHFFFAOYSA-N 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000007884 disintegrant Substances 0.000 description 2
- 239000003974 emollient agent Substances 0.000 description 2
- OQCGVPDWPMIXER-UHFFFAOYSA-N ethyl 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=C(CCBr)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 OQCGVPDWPMIXER-UHFFFAOYSA-N 0.000 description 2
- OBUCQESGRQQOJA-UHFFFAOYSA-N ethyl 2-(bromomethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=C(CBr)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 OBUCQESGRQQOJA-UHFFFAOYSA-N 0.000 description 2
- VIAZUXOUPABSKB-UHFFFAOYSA-N ethyl 2-(chloromethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1-oxidoquinolin-1-ium-3-carboxylate Chemical compound CCOC(=O)C1=C(CCl)[N+]([O-])=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 VIAZUXOUPABSKB-UHFFFAOYSA-N 0.000 description 2
- WSAWQIAATQVLKG-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-2-(2-ethoxy-2-oxoethyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C=1C(CC(=O)OCC)=NC2=CC(OC)=C(OC)C=C2C=1C1=CC=C(OC)C(OC)=C1 WSAWQIAATQVLKG-UHFFFAOYSA-N 0.000 description 2
- MKWDNZDEOMVHRN-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-2-(2-hydroxyethyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=C(CCO)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 MKWDNZDEOMVHRN-UHFFFAOYSA-N 0.000 description 2
- DIOJAABFGVBWDP-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-2-(iodomethyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=C(CI)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 DIOJAABFGVBWDP-UHFFFAOYSA-N 0.000 description 2
- UFEQNXJLAUDKPZ-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-methylquinoline-3-carboxylate Chemical compound CCOC(=O)C1=C(C)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 UFEQNXJLAUDKPZ-UHFFFAOYSA-N 0.000 description 2
- JGTCCFFVZHXYNY-UHFFFAOYSA-N ethyl 6-imidazol-1-yl-3-oxohexanoate Chemical compound CCOC(=O)CC(=O)CCCN1C=CN=C1 JGTCCFFVZHXYNY-UHFFFAOYSA-N 0.000 description 2
- WDCDAAMJNUHOIY-UHFFFAOYSA-N ethyl acetate;2-propan-2-yloxypropane Chemical compound CCOC(C)=O.CC(C)OC(C)C WDCDAAMJNUHOIY-UHFFFAOYSA-N 0.000 description 2
- 210000002683 foot Anatomy 0.000 description 2
- 125000000268 heptanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 210000000548 hind-foot Anatomy 0.000 description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 230000002757 inflammatory effect Effects 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 2
- 239000007951 isotonicity adjuster Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- YGNJLNWPZOCNTR-UHFFFAOYSA-N propyl 2-(bromomethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCCOC(=O)C1=C(CBr)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 YGNJLNWPZOCNTR-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 2
- 238000007348 radical reaction Methods 0.000 description 2
- 239000005049 silicon tetrachloride Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000019786 weight gain Nutrition 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- GBRCPDATOHLGQS-UHFFFAOYSA-N (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-(3,4-dimethoxyphenyl)methanone Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)C(C(=C1)N)=CC2=C1OCCO2 GBRCPDATOHLGQS-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- 125000004173 1-benzimidazolyl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N1* 0.000 description 1
- NLHOVYMVGLRDPF-UHFFFAOYSA-N 1-oxidoquinazolin-1-ium Chemical compound C1=CC=C2[N+]([O-])=CN=CC2=C1 NLHOVYMVGLRDPF-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- FUFLCEKSBBHCMO-UHFFFAOYSA-N 11-dehydrocorticosterone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)C(=O)CO)C4C3CCC2=C1 FUFLCEKSBBHCMO-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- XNEHDXALFUMQDO-UHFFFAOYSA-N 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazoline Chemical compound C1=C(OC)C(OC)=CC=C1C1=NC(CCBr)=NC2=CC(OC)=C(OC)C=C12 XNEHDXALFUMQDO-UHFFFAOYSA-N 0.000 description 1
- PBRHGJUYNWNYNM-UHFFFAOYSA-N 2-(bromomethyl)quinazoline Chemical class C1=CC=CC2=NC(CBr)=NC=C21 PBRHGJUYNWNYNM-UHFFFAOYSA-N 0.000 description 1
- NNAYPIDFVQLEDK-UHFFFAOYSA-N 2-(bromomethyl)quinoline Chemical class C1=CC=CC2=NC(CBr)=CC=C21 NNAYPIDFVQLEDK-UHFFFAOYSA-N 0.000 description 1
- BVOQPRGDVPMAMR-UHFFFAOYSA-N 2-(chloromethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazoline Chemical compound C1=C(OC)C(OC)=CC=C1C1=NC(CCl)=NC2=CC(OC)=C(OC)C=C12 BVOQPRGDVPMAMR-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- SYBDTXXJNDHNPH-UHFFFAOYSA-N 2-[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]ethanol Chemical compound C1=C(OC)C(OC)=CC=C1C1=NC(CCO)=NC2=CC(OC)=C(OC)C=C12 SYBDTXXJNDHNPH-UHFFFAOYSA-N 0.000 description 1
- YGZFYDFBHIDIBH-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]icosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCC(CO)N(CCO)CCO YGZFYDFBHIDIBH-UHFFFAOYSA-N 0.000 description 1
- PQAMFDRRWURCFQ-UHFFFAOYSA-N 2-ethyl-1h-imidazole Chemical compound CCC1=NC=CN1 PQAMFDRRWURCFQ-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- DXPQTHAFYUTZRR-UHFFFAOYSA-N 2-methylquinazoline Chemical class C1=CC=CC2=NC(C)=NC=C21 DXPQTHAFYUTZRR-UHFFFAOYSA-N 0.000 description 1
- AEDQNOLIADXSBB-UHFFFAOYSA-N 3-(dodecylazaniumyl)propanoate Chemical compound CCCCCCCCCCCCNCCC(O)=O AEDQNOLIADXSBB-UHFFFAOYSA-N 0.000 description 1
- GXCLJRNNWZDWGN-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-2-(2-imidazol-1-ylethyl)-6,7-dimethoxyquinazoline Chemical compound C1=C(OC)C(OC)=CC=C1C1=NC(CCN2C=NC=C2)=NC2=CC(OC)=C(OC)C=C12 GXCLJRNNWZDWGN-UHFFFAOYSA-N 0.000 description 1
- WGGOHCFZAYMINV-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylic acid Chemical compound C1=C(OC)C(OC)=CC=C1C1=C(C(O)=O)C(CN2N=CN=C2)=NC2=CC(OC)=C(OC)C=C12 WGGOHCFZAYMINV-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- REIYHFWZISXFKU-UHFFFAOYSA-N Butyl acetoacetate Chemical compound CCCCOC(=O)CC(C)=O REIYHFWZISXFKU-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 241000725101 Clea Species 0.000 description 1
- MFYSYFVPBJMHGN-ZPOLXVRWSA-N Cortisone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 MFYSYFVPBJMHGN-ZPOLXVRWSA-N 0.000 description 1
- MFYSYFVPBJMHGN-UHFFFAOYSA-N Cortisone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)(O)C(=O)CO)C4C3CCC2=C1 MFYSYFVPBJMHGN-UHFFFAOYSA-N 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- 239000004287 Dehydroacetic acid Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 238000001061 Dunnett's test Methods 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 206010023203 Joint destruction Diseases 0.000 description 1
- 208000012659 Joint disease Diseases 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- HLFSDGLLUJUHTE-SNVBAGLBSA-N Levamisole Chemical compound C1([C@H]2CN3CCSC3=N2)=CC=CC=C1 HLFSDGLLUJUHTE-SNVBAGLBSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- HGINADPHJQTSKN-UHFFFAOYSA-N Monoethyl malonic acid Chemical compound CCOC(=O)CC(O)=O HGINADPHJQTSKN-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GIIWGCBLYNDKBO-UHFFFAOYSA-N Quinoline 1-oxide Chemical compound C1=CC=C2[N+]([O-])=CC=CC2=C1 GIIWGCBLYNDKBO-UHFFFAOYSA-N 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000004729 acetoacetic acid derivatives Chemical class 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003470 adrenal cortex hormone Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-N anhydrous cyanoacetic acid Natural products OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000002255 antigout agent Substances 0.000 description 1
- 229960002708 antigout preparations Drugs 0.000 description 1
- 239000003907 antipyretic analgesic agent Substances 0.000 description 1
- 239000003435 antirheumatic agent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 229940009100 aurothiomalate Drugs 0.000 description 1
- XJHSMFDIQHVMCY-UHFFFAOYSA-M aurothiomalic acid Chemical compound OC(=O)CC(S[Au])C(O)=O XJHSMFDIQHVMCY-UHFFFAOYSA-M 0.000 description 1
- 229960002170 azathioprine Drugs 0.000 description 1
- LMEKQMALGUDUQG-UHFFFAOYSA-N azathioprine Chemical compound CN1C=NC([N+]([O-])=O)=C1SC1=NC=NC2=C1NC=N2 LMEKQMALGUDUQG-UHFFFAOYSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- 229960001950 benzethonium chloride Drugs 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- JJUJDJNFXYNOKI-UHFFFAOYSA-N benzyl 4-bromobutanoate Chemical compound BrCCCC(=O)OCC1=CC=CC=C1 JJUJDJNFXYNOKI-UHFFFAOYSA-N 0.000 description 1
- NFIVNRVBVQXAAY-UHFFFAOYSA-N benzyl 5-bromopentanoate Chemical compound BrCCCCC(=O)OCC1=CC=CC=C1 NFIVNRVBVQXAAY-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- NJUOXUSRLWFARF-UHFFFAOYSA-N butyl 4-(3,4-dimethoxyphenyl)-2-(imidazol-1-ylmethyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCCCC)=C1CN1C=CN=C1 NJUOXUSRLWFARF-UHFFFAOYSA-N 0.000 description 1
- SJBJWRCLBAXMNN-UHFFFAOYSA-N butyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-methylquinoline-3-carboxylate Chemical compound CCCCOC(=O)C1=C(C)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 SJBJWRCLBAXMNN-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229920003123 carboxymethyl cellulose sodium Polymers 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 229940084030 carboxymethylcellulose calcium Drugs 0.000 description 1
- 229940063834 carboxymethylcellulose sodium Drugs 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 229960001338 colchicine Drugs 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 229960004544 cortisone Drugs 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 235000019258 dehydroacetic acid Nutrition 0.000 description 1
- JEQRBTDTEKWZBW-UHFFFAOYSA-N dehydroacetic acid Chemical compound CC(=O)C1=C(O)OC(C)=CC1=O JEQRBTDTEKWZBW-UHFFFAOYSA-N 0.000 description 1
- 229940061632 dehydroacetic acid Drugs 0.000 description 1
- PGRHXDWITVMQBC-UHFFFAOYSA-N dehydroacetic acid Natural products CC(=O)C1C(=O)OC(C)=CC1=O PGRHXDWITVMQBC-UHFFFAOYSA-N 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- FHHZOYXKOICLGH-UHFFFAOYSA-N dichloromethane;ethanol Chemical compound CCO.ClCCl FHHZOYXKOICLGH-UHFFFAOYSA-N 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- ZSANYRMTSBBUCA-UHFFFAOYSA-N diethyl 3-oxopentanedioate Chemical compound CCOC(=O)CC(=O)CC(=O)OCC ZSANYRMTSBBUCA-UHFFFAOYSA-N 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- UPRKOXQMUOJRLP-UHFFFAOYSA-N ethyl 2-(benzimidazol-1-ylmethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound CCOC(=O)C1=C(CN2C3=CC=CC=C3N=C2)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 UPRKOXQMUOJRLP-UHFFFAOYSA-N 0.000 description 1
- OWOXQSWGXLMRFL-UHFFFAOYSA-N ethyl 2-(chloromethyl)-6,7-dimethoxy-4-(4-methoxy-3-propoxyphenyl)quinoline-3-carboxylate Chemical compound C1=C(OC)C(OCCC)=CC(C=2C3=CC(OC)=C(OC)C=C3N=C(CCl)C=2C(=O)OCC)=C1 OWOXQSWGXLMRFL-UHFFFAOYSA-N 0.000 description 1
- HDPNQHGDOIOCDD-UHFFFAOYSA-N ethyl 3-oxo-6-(1,2,4-triazol-1-yl)hexanoate Chemical compound CCOC(=O)CC(=O)CCCN1C=NC=N1 HDPNQHGDOIOCDD-UHFFFAOYSA-N 0.000 description 1
- URZSNYWUKMKQMA-UHFFFAOYSA-N ethyl 4-(3,4-dihydroxyphenyl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound CCOC(=O)c1c(Cn2cncn2)nc2cc(OC)c(OC)cc2c1-c1ccc(O)c(O)c1 URZSNYWUKMKQMA-UHFFFAOYSA-N 0.000 description 1
- FKXQWDLWOHOALI-UHFFFAOYSA-N ethyl 4-(3,4-dihydroxyphenyl)-6-hydroxy-7-methoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound CCOC(=O)c1c(Cn2cncn2)nc2cc(OC)c(O)cc2c1-c1ccc(O)c(O)c1 FKXQWDLWOHOALI-UHFFFAOYSA-N 0.000 description 1
- IEACBFZLECSOEU-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-2-(2-imidazol-1-ylethyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CCN1C=CN=C1 IEACBFZLECSOEU-UHFFFAOYSA-N 0.000 description 1
- BJKMXPVIBWTTAB-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-2-(3-imidazol-1-ylpropyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CCCN1C=CN=C1 BJKMXPVIBWTTAB-UHFFFAOYSA-N 0.000 description 1
- NQOXPERDJHOXHF-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-2-(4-imidazol-1-ylbutyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CCCCN1C=CN=C1 NQOXPERDJHOXHF-UHFFFAOYSA-N 0.000 description 1
- KDWSMGQGSSAICO-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-2-[(2-ethylimidazol-1-yl)methyl]-6,7-dimethoxyquinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=CN=C1CC KDWSMGQGSSAICO-UHFFFAOYSA-N 0.000 description 1
- QSRLSCKEXBORHD-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1-oxido-2-(1,2,4-triazol-1-ylmethyl)quinolin-1-ium-3-carboxylate Chemical compound [O-][N+]1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 QSRLSCKEXBORHD-UHFFFAOYSA-N 0.000 description 1
- KNYONLWPZXXIKF-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-(1,2,4-triazol-4-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NN=C1 KNYONLWPZXXIKF-UHFFFAOYSA-N 0.000 description 1
- FKNJYMNOVPKGSG-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-(triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=CN=N1 FKNJYMNOVPKGSG-UHFFFAOYSA-N 0.000 description 1
- XXEUPCBADLRJFG-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-(triazol-2-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1N=CC=N1 XXEUPCBADLRJFG-UHFFFAOYSA-N 0.000 description 1
- IQXVFYQPYWMOKK-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-[3-(1,2,4-triazol-1-yl)propyl]quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CCCN1C=NC=N1 IQXVFYQPYWMOKK-UHFFFAOYSA-N 0.000 description 1
- OYSVPHVKIZXTFY-UHFFFAOYSA-N ethyl 4-[3,4-di(propan-2-yloxy)phenyl]-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC(C)C)C(OC(C)C)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 OYSVPHVKIZXTFY-UHFFFAOYSA-N 0.000 description 1
- BMVOHVXUEHUGHK-UHFFFAOYSA-N ethyl 4-[3,4-di(propan-2-yloxy)phenyl]-7-methoxy-6-propan-2-yloxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC(C)C)=CC2=C(C=2C=C(OC(C)C)C(OC(C)C)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 BMVOHVXUEHUGHK-UHFFFAOYSA-N 0.000 description 1
- OHLRLMWUFVDREV-UHFFFAOYSA-N ethyl 4-chloro-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)CCl OHLRLMWUFVDREV-UHFFFAOYSA-N 0.000 description 1
- DFQKYAWXBOFKEB-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(3-methoxy-4-propan-2-yloxyphenyl)-2-(1,2,4-triazol-4-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC(C)C)=CC=2)C(C(=O)OCC)=C1CN1C=NN=C1 DFQKYAWXBOFKEB-UHFFFAOYSA-N 0.000 description 1
- JUFIQJPUAVPTOG-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(4-methoxy-3-propan-2-yloxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate;hydrochloride Chemical compound Cl.N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC(C)C)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 JUFIQJPUAVPTOG-UHFFFAOYSA-N 0.000 description 1
- CVBPORWMMBNWJW-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(4-methoxy-3-propan-2-yloxyphenyl)-2-(1,2,4-triazol-4-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC(C)C)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NN=C1 CVBPORWMMBNWJW-UHFFFAOYSA-N 0.000 description 1
- KZGWZTVKAXEIPX-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(4-methoxy-3-propoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound C1=C(OC)C(OCCC)=CC(C=2C3=CC(OC)=C(OC)C=C3N=C(CN3N=CN=C3)C=2C(=O)OCC)=C1 KZGWZTVKAXEIPX-UHFFFAOYSA-N 0.000 description 1
- FXNNGNZQIDRTAG-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(4-methoxy-3-propoxyphenyl)-2-(1,2,4-triazol-4-ylmethyl)quinoline-3-carboxylate Chemical compound C1=C(OC)C(OCCC)=CC(C=2C3=CC(OC)=C(OC)C=C3N=C(CN3C=NN=C3)C=2C(=O)OCC)=C1 FXNNGNZQIDRTAG-UHFFFAOYSA-N 0.000 description 1
- DRHGRCGLRSLZRJ-UHFFFAOYSA-N ethyl 6,7-dimethoxy-4-(4-methoxyphenyl)-2-(1,2,4-triazol-4-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=CC(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NN=C1 DRHGRCGLRSLZRJ-UHFFFAOYSA-N 0.000 description 1
- NFCDUISGZMHTNY-UHFFFAOYSA-N ethyl 7-(chloromethyl)-9-(3,4-dimethoxyphenyl)-2,3-dihydro-[1,4]dioxino[2,3-g]quinoline-8-carboxylate Chemical compound CCOC(=O)C1=C(CCl)N=C2C=C3OCCOC3=CC2=C1C1=CC=C(OC)C(OC)=C1 NFCDUISGZMHTNY-UHFFFAOYSA-N 0.000 description 1
- SOBZEPCRXVTUEI-UHFFFAOYSA-N ethyl 7-imidazol-1-yl-3-oxoheptanoate Chemical compound CCOC(=O)CC(=O)CCCCN1C=CN=C1 SOBZEPCRXVTUEI-UHFFFAOYSA-N 0.000 description 1
- JHZNKVZFDCOCSM-UHFFFAOYSA-N ethyl 9-(3,4-dimethoxyphenyl)-7-(1,2,4-triazol-1-ylmethyl)-2,3-dihydro-[1,4]dioxino[2,3-g]quinoline-8-carboxylate Chemical compound N1=C2C=C3OCCOC3=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NC=N1 JHZNKVZFDCOCSM-UHFFFAOYSA-N 0.000 description 1
- WNYRTHVBGYFUAH-UHFFFAOYSA-N ethyl 9-(3,4-dimethoxyphenyl)-7-(1,2,4-triazol-4-ylmethyl)-2,3-dihydro-[1,4]dioxino[2,3-g]quinoline-8-carboxylate Chemical compound N1=C2C=C3OCCOC3=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCC)=C1CN1C=NN=C1 WNYRTHVBGYFUAH-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229940076085 gold Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002483 hydrogen compounds Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 229940071826 hydroxyethyl cellulose Drugs 0.000 description 1
- 229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 229940071676 hydroxypropylcellulose Drugs 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229960003444 immunosuppressant agent Drugs 0.000 description 1
- 239000003018 immunosuppressive agent Substances 0.000 description 1
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000008011 inorganic excipient Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 210000000281 joint capsule Anatomy 0.000 description 1
- 208000018937 joint inflammation Diseases 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 229960001614 levamisole Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 238000011694 lewis rat Methods 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229960003511 macrogol Drugs 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- WVJKHCGMRZGIJH-UHFFFAOYSA-N methanetriamine Chemical compound NC(N)N WVJKHCGMRZGIJH-UHFFFAOYSA-N 0.000 description 1
- 229960000485 methotrexate Drugs 0.000 description 1
- HURFFWJKFBSESL-UHFFFAOYSA-N methyl 2-(chloromethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound COC(=O)C1=C(CCl)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 HURFFWJKFBSESL-UHFFFAOYSA-N 0.000 description 1
- YMKKSOYHHKWYII-UHFFFAOYSA-N methyl 2-[4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-5-methylquinazolin-2-yl]acetate Chemical compound C=12C(C)=C(OC)C(OC)=CC2=NC(CC(=O)OC)=NC=1C1=CC=C(OC)C(OC)=C1 YMKKSOYHHKWYII-UHFFFAOYSA-N 0.000 description 1
- WAUAGVKRZTXUQU-UHFFFAOYSA-N methyl 2-[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]acetate Chemical compound C=12C=C(OC)C(OC)=CC2=NC(CC(=O)OC)=NC=1C1=CC=C(OC)C(OC)=C1 WAUAGVKRZTXUQU-UHFFFAOYSA-N 0.000 description 1
- YCSTZPQOMVRSPK-UHFFFAOYSA-N methyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-(1,2,4-triazol-1-ylmethyl)quinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OC)=C1CN1C=NC=N1 YCSTZPQOMVRSPK-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- ANGDWNBGPBMQHW-UHFFFAOYSA-N methyl cyanoacetate Chemical compound COC(=O)CC#N ANGDWNBGPBMQHW-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 150000002816 nickel compounds Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 1
- CKQVRZJOMJRTOY-UHFFFAOYSA-N octadecanoic acid;propane-1,2,3-triol Chemical compound OCC(O)CO.CCCCCCCCCCCCCCCCCC(O)=O CKQVRZJOMJRTOY-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000008012 organic excipient Substances 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229960001639 penicillamine Drugs 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- QYSPLQLAKJAUJT-UHFFFAOYSA-N piroxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=CC=CC=N1 QYSPLQLAKJAUJT-UHFFFAOYSA-N 0.000 description 1
- 229960002702 piroxicam Drugs 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- AAZYNPCMLRQUHI-UHFFFAOYSA-N propan-2-one;2-propan-2-yloxypropane Chemical compound CC(C)=O.CC(C)OC(C)C AAZYNPCMLRQUHI-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- DHGFMVMDBNLMKT-UHFFFAOYSA-N propyl 3-oxobutanoate Chemical compound CCCOC(=O)CC(C)=O DHGFMVMDBNLMKT-UHFFFAOYSA-N 0.000 description 1
- RAJFIYZYNPFHQC-UHFFFAOYSA-N propyl 4-(3,4-dimethoxyphenyl)-2-(imidazol-1-ylmethyl)-6,7-dimethoxyquinoline-3-carboxylate Chemical compound N1=C2C=C(OC)C(OC)=CC2=C(C=2C=C(OC)C(OC)=CC=2)C(C(=O)OCCC)=C1CN1C=CN=C1 RAJFIYZYNPFHQC-UHFFFAOYSA-N 0.000 description 1
- WIDKKQIQNXKXDM-UHFFFAOYSA-N propyl 4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2-methylquinoline-3-carboxylate Chemical compound CCCOC(=O)C1=C(C)N=C2C=C(OC)C(OC)=CC2=C1C1=CC=C(OC)C(OC)=C1 WIDKKQIQNXKXDM-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 210000001258 synovial membrane Anatomy 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000002053 thietanyl group Chemical group 0.000 description 1
- 125000001166 thiolanyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- NFHRNKANAAGQOH-UHFFFAOYSA-N triphenylstannane Chemical compound C1=CC=CC=C1[SnH](C=1C=CC=CC=1)C1=CC=CC=C1 NFHRNKANAAGQOH-UHFFFAOYSA-N 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 150000003752 zinc compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Rheumatology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pain & Pain Management (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1262893 | 1993-01-28 | ||
| JP20612893 | 1993-08-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69428142D1 DE69428142D1 (de) | 2001-10-11 |
| DE69428142T2 true DE69428142T2 (de) | 2002-07-04 |
Family
ID=26348258
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69428142T Expired - Fee Related DE69428142T2 (de) | 1993-01-28 | 1994-01-27 | Quinolin- oder Quinazolinderivate, deren Herstellung und Verwendung |
Country Status (15)
| Country | Link |
|---|---|
| US (3) | US5436247A (enExample) |
| EP (1) | EP0608870B1 (enExample) |
| KR (1) | KR100224135B1 (enExample) |
| CN (1) | CN1041520C (enExample) |
| AT (1) | ATE205199T1 (enExample) |
| AU (1) | AU673213B2 (enExample) |
| CA (1) | CA2114300C (enExample) |
| DE (1) | DE69428142T2 (enExample) |
| FI (1) | FI940414A7 (enExample) |
| HU (1) | HU217907B (enExample) |
| NO (2) | NO940245D0 (enExample) |
| NZ (1) | NZ250761A (enExample) |
| RU (1) | RU2132330C1 (enExample) |
| SG (1) | SG50546A1 (enExample) |
| TW (1) | TW256832B (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW232013B (enExample) * | 1992-04-24 | 1994-10-11 | Takeda Pharm Industry Co Ltd | |
| KR100224135B1 (ko) * | 1993-01-28 | 1999-10-15 | 다께다 구니오 | 퀴놀린 또는 퀴나졸린 유도체, 그 제조 및 용도 |
| DE69422450T2 (de) * | 1993-06-29 | 2000-06-08 | Takeda Chemical Industries, Ltd. | Chinoline oder Chinazolin-Derivate und deren Verwendung zur Herstellung eines Medikaments für die Behandlung von Osteoporose |
| TW384285B (en) * | 1994-03-08 | 2000-03-11 | Takeda Chemical Industries Ltd | Pharmaceutical composition containing quinoline or quinazoline derivatives and novel derivatives therefor |
| US5641788A (en) * | 1994-06-07 | 1997-06-24 | Takeda Chemical Industries, Ltd. | Quinoline derivatives and pharmaceutical composition containing them |
| WO1996000223A1 (en) * | 1994-06-24 | 1996-01-04 | Takeda Chemical Industries, Ltd. | Processes for production of quinoline or quinazoline derivatives and intermediates therefor |
| US5523312A (en) * | 1994-09-27 | 1996-06-04 | Sterling Winthrop Inc. | Antipicornaviral agents |
| EP0830133A1 (en) * | 1995-04-28 | 1998-03-25 | Takeda Chemical Industries, Ltd. | Therapeutic composition for arthritis |
| DE19610882A1 (de) * | 1996-03-20 | 1997-09-25 | Dresden Arzneimittel | Neue 1,3,5-trisubstituierte Indazol-Derivate mit antiasthmatischer, antiallergischer, entzündungshemmender und immunmodulierender Wirkung, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| AU747026B2 (en) * | 1997-05-28 | 2002-05-09 | Aventis Pharmaceuticals Inc. | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
| DE19728835C1 (de) * | 1997-07-05 | 1998-09-10 | Ruetgers Vft Ag | Verfahren zur Reinigung von Chinaldin |
| NZ520028A (en) * | 2000-01-17 | 2004-07-30 | Teijin Ltd | Benzimidazole derivatives |
| EP1354603A1 (en) * | 2000-12-26 | 2003-10-22 | Takeda Chemical Industries, Ltd. | Concomitant drugs |
| RU2183116C1 (ru) * | 2001-07-10 | 2002-06-10 | Жаров Олег Владимирович | Фармацевтическая композиция, обладающая болеутоляющим, противовоспалительным, антипиретическим и спазмолитическим действием |
| DE60320808D1 (de) * | 2002-07-15 | 2008-06-19 | Scinopharm Taiwan Ltd | Verfahren zur herstellung von imidazo(1,2-a)pyridin-3-acetamiden |
| KR20050072798A (ko) * | 2002-11-06 | 2005-07-12 | 닛산 가가쿠 고교 가부시키 가이샤 | 퀴놀린카르발데히드류의 제조 방법 |
| ATE372324T1 (de) * | 2003-04-30 | 2007-09-15 | Inst For Pharm Discovery Inc | Substituierte heteroarylverbindungen als inhibitoren von proteintyrosinphosphatasen |
| US7937406B2 (en) * | 2003-09-11 | 2011-05-03 | Oracle America, Inc. | Mechanism for automatically establishing a resource grid |
| WO2006048146A1 (en) * | 2004-11-01 | 2006-05-11 | F. Hoffmann-La Roche Ag | Quinoline as allosteric enhancers of the gaba-b receptors |
| DE102004055633A1 (de) * | 2004-11-12 | 2006-05-18 | Schering Ag | 5-substituierte Chinolin- und Isochinolin-Derivate, ein Verfahren zu ihrer Herstellung und ihre Verwendung als Entzündungshemmer |
| WO2007109274A2 (en) * | 2006-03-21 | 2007-09-27 | Alza Corporation | Hydratable polymeric ester matrix for drug electrotransport |
| UY32743A (es) | 2009-06-25 | 2010-12-31 | Amgen Inc | Compuestos heterocíclicos y sus usos |
| WO2012068343A1 (en) * | 2010-11-17 | 2012-05-24 | Amgen Inc. | Quinoline derivatives as pik3 inhibitors |
| MX2015001099A (es) * | 2012-08-24 | 2015-04-08 | Hoffmann La Roche | Nuevos derivados biciclicos de piridina. |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4438267A (en) * | 1980-11-11 | 1984-03-20 | Daluge Susan M | Monoheteroring compounds and their use |
| GB8307865D0 (en) * | 1983-03-22 | 1983-04-27 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives |
| US5084462A (en) * | 1988-04-26 | 1992-01-28 | The Du Pont Merck Pharmaceutical Company | 4-quinoline carboxylic acid derivatives useful as immunosuppressive agents |
| GB8827822D0 (en) * | 1988-11-29 | 1988-12-29 | Janssen Pharmaceutica Nv | (1h-azol-1-ylmethyl)substituted quinoline derivatives |
| CA2002864C (en) * | 1988-11-29 | 1999-11-16 | Eddy J. E. Freyne | (1h-azol-1-ylmethyl) substituted quinoline, quinazoline or quinoxaline derivatives |
| TW232013B (enExample) * | 1992-04-24 | 1994-10-11 | Takeda Pharm Industry Co Ltd | |
| KR100224135B1 (ko) * | 1993-01-28 | 1999-10-15 | 다께다 구니오 | 퀴놀린 또는 퀴나졸린 유도체, 그 제조 및 용도 |
| WO1996000223A1 (en) * | 1994-06-24 | 1996-01-04 | Takeda Chemical Industries, Ltd. | Processes for production of quinoline or quinazoline derivatives and intermediates therefor |
-
1994
- 1994-01-24 KR KR1019940001217A patent/KR100224135B1/ko not_active Expired - Fee Related
- 1994-01-24 NO NO940245D patent/NO940245D0/no unknown
- 1994-01-24 NO NO940245A patent/NO306992B1/no unknown
- 1994-01-25 TW TW083100595A patent/TW256832B/zh active
- 1994-01-26 US US08/186,638 patent/US5436247A/en not_active Expired - Fee Related
- 1994-01-26 NZ NZ250761A patent/NZ250761A/en unknown
- 1994-01-26 CA CA002114300A patent/CA2114300C/en not_active Expired - Fee Related
- 1994-01-27 AT AT94101144T patent/ATE205199T1/de not_active IP Right Cessation
- 1994-01-27 SG SG1996004643A patent/SG50546A1/en unknown
- 1994-01-27 AU AU54742/94A patent/AU673213B2/en not_active Ceased
- 1994-01-27 EP EP94101144A patent/EP0608870B1/en not_active Expired - Lifetime
- 1994-01-27 RU RU94002335A patent/RU2132330C1/ru active
- 1994-01-27 FI FI940414A patent/FI940414A7/fi unknown
- 1994-01-27 DE DE69428142T patent/DE69428142T2/de not_active Expired - Fee Related
- 1994-01-28 CN CN94101137A patent/CN1041520C/zh not_active Expired - Fee Related
- 1994-01-28 HU HU9400250A patent/HU217907B/hu not_active IP Right Cessation
-
1995
- 1995-05-08 US US08/436,629 patent/US5770602A/en not_active Expired - Fee Related
-
1997
- 1997-10-21 US US08/954,854 patent/US5932592A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| FI940414L (fi) | 1994-07-29 |
| FI940414A0 (fi) | 1994-01-27 |
| EP0608870A1 (en) | 1994-08-03 |
| HU9400250D0 (en) | 1994-05-30 |
| NZ250761A (en) | 1995-03-28 |
| US5932592A (en) | 1999-08-03 |
| KR940018381A (ko) | 1994-08-16 |
| HU217907B (hu) | 2000-05-28 |
| DE69428142D1 (de) | 2001-10-11 |
| AU673213B2 (en) | 1996-10-31 |
| RU2132330C1 (ru) | 1999-06-27 |
| CA2114300C (en) | 2000-10-17 |
| FI940414A7 (fi) | 1994-07-29 |
| NO940245D0 (no) | 1994-01-24 |
| CN1105363A (zh) | 1995-07-19 |
| ATE205199T1 (de) | 2001-09-15 |
| HUT70194A (en) | 1995-09-28 |
| KR100224135B1 (ko) | 1999-10-15 |
| CA2114300A1 (en) | 1994-07-29 |
| US5770602A (en) | 1998-06-23 |
| NO306992B1 (no) | 2000-01-24 |
| US5436247A (en) | 1995-07-25 |
| EP0608870B1 (en) | 2001-09-05 |
| CN1041520C (zh) | 1999-01-06 |
| NO940245L (no) | 1994-07-29 |
| TW256832B (enExample) | 1995-09-11 |
| SG50546A1 (en) | 1998-07-20 |
| AU5474294A (en) | 1994-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69428142T2 (de) | Quinolin- oder Quinazolinderivate, deren Herstellung und Verwendung | |
| DE69327254T2 (de) | Substituierte pyrazole als crf antagonisten | |
| DE69617665T2 (de) | Benzmidazolverbindungen und ihre verwendung als modulatoren des gabaa-rezeptor-komplexes | |
| DE69614270T2 (de) | 5-azabicyclo(3.1.0.)hexylalkyl-2-piperidone und - glutarimide als neurokinin receptor antagonisten. | |
| DE69032550T2 (de) | Heteroarylamino- und Heteroaryloxypyridinamine und verwandte Verbindungen, Verfahren zu ihrer Herstellung und ihre Anwendung als Arzneimittel | |
| DE69113148T2 (de) | Thioxo-Heterocyclen und ihre pharmazeutische Verwendung. | |
| EP1100795B1 (de) | Disubstituierte bicyclische heterocyclen mit insbesondere eine thrombinhemmende wirkung | |
| DE69422450T2 (de) | Chinoline oder Chinazolin-Derivate und deren Verwendung zur Herstellung eines Medikaments für die Behandlung von Osteoporose | |
| DE69021501T2 (de) | Anti-entzündende 4-aminophenol-derivate. | |
| DE69203911T2 (de) | Antihistaminische und nicht sedierende Benzimidazolderivate, Verfahren zu deren Herstellung und deren Anwendung als Arzneimittel. | |
| DE69222280T2 (de) | Kondensierte Benzeoxyessigsäurederivate | |
| DE69323667T2 (de) | 4-substituierte 1,2,4-Triazolderivate | |
| DE69115588T2 (de) | Benzimidazolderivate, Verfahren zu deren Herstellung und deren Anwendung als Arzneimittel | |
| EP0499926A1 (de) | 2-Substituierte Chinoline, Verfahren zu ihrer Herstellung sowie ihre Verwendung in Arzneimitteln | |
| CH645892A5 (de) | Carbostyrilderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende, antihistaminisch wirkende mittel. | |
| DE3824658A1 (de) | N-hetaryl-imidazolderivate | |
| DE69132314T2 (de) | 7-substituierte-6-fluor-1,4-dihydro-4-oxo-chinolin-3-carbonsäurederivate als antibakterielle wirkstoffe | |
| JP2009507908A (ja) | Cbモジュレーターとして使用するためのイミダゾール−4−カルボキサミド誘導体 | |
| WO2001047896A1 (de) | Benzimidazole, deren herstellung und deren verwendung als antithrombotika | |
| DE68924221T2 (de) | Imidazolderivate. | |
| DE68906826T2 (de) | Phenothiazinderivate, deren Herstellung und sie enthaltende pharmazeutische Zusammensetzungen. | |
| DD282457A5 (de) | Verfahren zur herstellung neuer heterocyclischer derivate | |
| DE68910593T2 (de) | Chinolinoncarbonsäuren. | |
| DE68913167T2 (de) | Indol-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate. | |
| DE69521295T2 (de) | Triazolderivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |