DE69410730T2 - Kontinuierliches Verfahren zur in situ anionischen Dispersionspolymerisation - Google Patents
Kontinuierliches Verfahren zur in situ anionischen DispersionspolymerisationInfo
- Publication number
- DE69410730T2 DE69410730T2 DE69410730T DE69410730T DE69410730T2 DE 69410730 T2 DE69410730 T2 DE 69410730T2 DE 69410730 T DE69410730 T DE 69410730T DE 69410730 T DE69410730 T DE 69410730T DE 69410730 T2 DE69410730 T2 DE 69410730T2
- Authority
- DE
- Germany
- Prior art keywords
- dispersant
- block
- polymerization
- monomer
- copolymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000010924 continuous production Methods 0.000 title claims description 3
- 125000000129 anionic group Chemical group 0.000 title description 18
- 238000012674 dispersion polymerization Methods 0.000 title description 14
- 238000011065 in-situ storage Methods 0.000 title description 13
- 239000000178 monomer Substances 0.000 claims description 84
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 76
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 71
- 239000002270 dispersing agent Substances 0.000 claims description 63
- 229920001577 copolymer Polymers 0.000 claims description 56
- 238000006116 polymerization reaction Methods 0.000 claims description 49
- 238000000034 method Methods 0.000 claims description 46
- 229920003048 styrene butadiene rubber Polymers 0.000 claims description 45
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 39
- 150000001993 dienes Chemical class 0.000 claims description 34
- 229920000642 polymer Polymers 0.000 claims description 31
- 239000002609 medium Substances 0.000 claims description 27
- 229920002554 vinyl polymer Polymers 0.000 claims description 27
- 239000003999 initiator Substances 0.000 claims description 26
- 239000002904 solvent Substances 0.000 claims description 25
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical group [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 16
- 239000006185 dispersion Substances 0.000 claims description 16
- 125000001979 organolithium group Chemical group 0.000 claims description 15
- 239000003607 modifier Substances 0.000 claims description 12
- 239000003505 polymerization initiator Substances 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 8
- 239000002612 dispersion medium Substances 0.000 claims description 7
- 230000015572 biosynthetic process Effects 0.000 claims description 6
- 230000000379 polymerizing effect Effects 0.000 claims description 5
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 3
- 150000002900 organolithium compounds Chemical class 0.000 claims 1
- 239000002174 Styrene-butadiene Substances 0.000 description 38
- -1 alicyclic hydrocarbon Chemical class 0.000 description 22
- 239000003054 catalyst Substances 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 229920001971 elastomer Polymers 0.000 description 12
- 239000005060 rubber Substances 0.000 description 12
- 229920005604 random copolymer Polymers 0.000 description 11
- 125000003118 aryl group Chemical group 0.000 description 10
- 229910052744 lithium Inorganic materials 0.000 description 9
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 8
- 238000007334 copolymerization reaction Methods 0.000 description 8
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- 229920001400 block copolymer Polymers 0.000 description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- DTGZORBDGLEVNY-UHFFFAOYSA-N 2-propyloxolane Chemical compound CCCC1CCCO1 DTGZORBDGLEVNY-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000005062 Polybutadiene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229920002857 polybutadiene Polymers 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000011925 1,2-addition Methods 0.000 description 2
- WGLLSSPDPJPLOR-UHFFFAOYSA-N 2,3-dimethylbut-2-ene Chemical group CC(C)=C(C)C WGLLSSPDPJPLOR-UHFFFAOYSA-N 0.000 description 2
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000004873 anchoring Methods 0.000 description 2
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000004815 dispersion polymer Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000005227 gel permeation chromatography Methods 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- 150000002642 lithium compounds Chemical class 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- GDOPTJXRTPNYNR-UHFFFAOYSA-N methylcyclopentane Chemical compound CC1CCCC1 GDOPTJXRTPNYNR-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- DXIJHCSGLOHNES-UHFFFAOYSA-N 3,3-dimethylbut-1-enylbenzene Chemical group CC(C)(C)C=CC1=CC=CC=C1 DXIJHCSGLOHNES-UHFFFAOYSA-N 0.000 description 1
- UGWOAPBVIGCNOV-UHFFFAOYSA-N 5-ethenyldec-5-ene Chemical compound CCCCC=C(C=C)CCCC UGWOAPBVIGCNOV-UHFFFAOYSA-N 0.000 description 1
- LNCNKWLTFCQSHO-UHFFFAOYSA-N C1=CC([Li])=CC=C1C1=CC=C([Li])C=C1 Chemical group C1=CC([Li])=CC=C1C1=CC=C([Li])C=C1 LNCNKWLTFCQSHO-UHFFFAOYSA-N 0.000 description 1
- SSFGWDHVAMCZMG-UHFFFAOYSA-N C1=CC=C2C([Li])=CC=C([Li])C2=C1 Chemical compound C1=CC=C2C([Li])=CC=C([Li])C2=C1 SSFGWDHVAMCZMG-UHFFFAOYSA-N 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 238000005411 Van der Waals force Methods 0.000 description 1
- PYWOMDDOXZOOJZ-UHFFFAOYSA-N [Li]C1=CC=C([Li])C=C1 Chemical compound [Li]C1=CC=C([Li])C=C1 PYWOMDDOXZOOJZ-UHFFFAOYSA-N 0.000 description 1
- LURCBQOZOZIVCW-UHFFFAOYSA-N [Li]C1CC([Li])C([Li])C([Li])C1 Chemical compound [Li]C1CC([Li])C([Li])C([Li])C1 LURCBQOZOZIVCW-UHFFFAOYSA-N 0.000 description 1
- NTHIUKNPTBFSFZ-UHFFFAOYSA-N [Li]C1CC([Li])CC([Li])C1 Chemical compound [Li]C1CC([Li])CC([Li])C1 NTHIUKNPTBFSFZ-UHFFFAOYSA-N 0.000 description 1
- LKSSGADQJSOVHJ-UHFFFAOYSA-N [Li]CCC([Li])CC([Li])CCC([Li])CC Chemical compound [Li]CCC([Li])CC([Li])CCC([Li])CC LKSSGADQJSOVHJ-UHFFFAOYSA-N 0.000 description 1
- CYDIPADNXIGHGM-UHFFFAOYSA-N [Li]CCC([Li])CC[Li] Chemical compound [Li]CCC([Li])CC[Li] CYDIPADNXIGHGM-UHFFFAOYSA-N 0.000 description 1
- GRHMSLMCDLEHPK-UHFFFAOYSA-N [Li]CCCCCCCCCCC([Li])CCCCC([Li])CCCC[Li] Chemical compound [Li]CCCCCCCCCCC([Li])CCCCC([Li])CCCC[Li] GRHMSLMCDLEHPK-UHFFFAOYSA-N 0.000 description 1
- FNRUENJVQDCBQZ-UHFFFAOYSA-N [Li]CCCCCCCCCCCCCCCCCCCC[Li] Chemical compound [Li]CCCCCCCCCCCCCCCCCCCC[Li] FNRUENJVQDCBQZ-UHFFFAOYSA-N 0.000 description 1
- QWFRFVPEFDDMQD-UHFFFAOYSA-N [Li]CCCCCCCCCC[Li] Chemical compound [Li]CCCCCCCCCC[Li] QWFRFVPEFDDMQD-UHFFFAOYSA-N 0.000 description 1
- BZEZSORUWZUMNU-UHFFFAOYSA-N [Li]CCCC[Li] Chemical compound [Li]CCCC[Li] BZEZSORUWZUMNU-UHFFFAOYSA-N 0.000 description 1
- RZBPXBRVLREGOF-UHFFFAOYSA-N [Li]c1cccc2c([Li])c3ccccc3cc12 Chemical compound [Li]c1cccc2c([Li])c3ccccc3cc12 RZBPXBRVLREGOF-UHFFFAOYSA-N 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 238000010539 anionic addition polymerization reaction Methods 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- VUKHQPGJNTXTPY-UHFFFAOYSA-N but-2-enylbenzene Chemical compound CC=CCC1=CC=CC=C1 VUKHQPGJNTXTPY-UHFFFAOYSA-N 0.000 description 1
- IMJGQTCMUZMLRZ-UHFFFAOYSA-N buta-1,3-dien-2-ylbenzene Chemical compound C=CC(=C)C1=CC=CC=C1 IMJGQTCMUZMLRZ-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- 238000002036 drum drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- WTTUTKBXMMXKBQ-UHFFFAOYSA-N lithium;stilbene Chemical compound C=1C=CC=CC=1C([Li])C([Li])C1=CC=CC=C1 WTTUTKBXMMXKBQ-UHFFFAOYSA-N 0.000 description 1
- CKVWBMJEETWJTF-UHFFFAOYSA-N lithium;tributyltin Chemical compound CCCC[Sn]([Li])(CCCC)CCCC CKVWBMJEETWJTF-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- ZCYXXKJEDCHMGH-UHFFFAOYSA-N nonane Chemical compound CCCC[CH]CCCC ZCYXXKJEDCHMGH-UHFFFAOYSA-N 0.000 description 1
- BKIMMITUMNQMOS-UHFFFAOYSA-N normal nonane Natural products CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000009751 slip forming Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F297/00—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer
- C08F297/02—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer using a catalyst of the anionic type
- C08F297/04—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer using a catalyst of the anionic type polymerising vinyl aromatic monomers and conjugated dienes
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/137,332 US5891947A (en) | 1992-12-22 | 1993-10-18 | In-situ anionic continuous dispersion polymerization process |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69410730D1 DE69410730D1 (de) | 1998-07-09 |
| DE69410730T2 true DE69410730T2 (de) | 1998-10-01 |
Family
ID=22476911
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69410730T Expired - Fee Related DE69410730T2 (de) | 1993-10-18 | 1994-10-17 | Kontinuierliches Verfahren zur in situ anionischen Dispersionspolymerisation |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US5891947A (es) |
| EP (1) | EP0648790B1 (es) |
| JP (1) | JP3452094B2 (es) |
| DE (1) | DE69410730T2 (es) |
| ES (1) | ES2116501T3 (es) |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19528717A1 (de) * | 1995-08-04 | 1997-02-06 | Basf Ag | Polymerteilchen und Verfahren zu deren Herstellung |
| DE19621969A1 (de) * | 1996-05-31 | 1997-12-04 | Basf Ag | Verfahren zur Herstellung von kristallinen Polymerisaten durch Dispersionspolymerisation in Gegenwart von Metallocenkatalysatorsystemen |
| WO1997049743A1 (fr) * | 1996-06-26 | 1997-12-31 | The Yokohama Rubber Co., Ltd. | Copolymer sequence, composition de caoutchouc contenant ce dernier et pneumatique fabrique avec ladite composition de caoutchouc |
| DE19804912A1 (de) * | 1998-02-07 | 1999-08-12 | Basf Ag | Kontinuierliches Verfahren zur Herstellung thermoplastischer Formmassen |
| US6184287B1 (en) * | 1999-01-26 | 2001-02-06 | Omnova Solutions Inc. | Polymeric latexes prepared in the presence of 2-acrylamido-2-methylpropanesulfonate |
| US6956084B2 (en) * | 2001-10-04 | 2005-10-18 | Bridgestone Corporation | Nano-particle preparation and applications |
| US6689469B2 (en) | 2001-12-31 | 2004-02-10 | Bridgestone Corporation | Crystalline polymer nano-particles |
| US6437050B1 (en) | 2001-10-04 | 2002-08-20 | Bridgestone Corporation | Nano-particle preparation and applications |
| US6706823B2 (en) | 2001-12-31 | 2004-03-16 | Bridgestone Corporation | Conductive gels |
| AU2003301053A1 (en) * | 2002-12-18 | 2004-07-22 | Bridgestone Corporation | Method for clay exfoliation, compositions therefore, and modified rubber contaiing same |
| US6875818B2 (en) * | 2003-01-16 | 2005-04-05 | Bridgestone Corporation | Polymer nano-strings |
| US7205370B2 (en) * | 2004-01-12 | 2007-04-17 | Bridgestone Corporation | Polymeric nano-particles of flower-like structure and applications |
| US7718737B2 (en) * | 2004-03-02 | 2010-05-18 | Bridgestone Corporation | Rubber composition containing functionalized polymer nanoparticles |
| US8063142B2 (en) | 2004-03-02 | 2011-11-22 | Bridgestone Corporation | Method of making nano-particles of selected size distribution |
| US7112369B2 (en) * | 2004-03-02 | 2006-09-26 | Bridgestone Corporation | Nano-sized polymer-metal composites |
| US20050215693A1 (en) * | 2004-03-29 | 2005-09-29 | Xiaorong Wang | Clay modified rubber composition and a method for manufacturing same |
| US20050228074A1 (en) * | 2004-04-05 | 2005-10-13 | Bridgestone Corporation | Amphiphilic polymer micelles and use thereof |
| US20050282956A1 (en) * | 2004-06-21 | 2005-12-22 | Xiaorong Wang | Reversible polymer/metal nano-composites and method for manufacturing same |
| US7998554B2 (en) * | 2004-07-06 | 2011-08-16 | Bridgestone Corporation | Hydrophobic surfaces with nanoparticles |
| US7572855B2 (en) | 2005-01-28 | 2009-08-11 | Bridgestone Corporation | Nano-composite and compositions manufactured thereof |
| US7579398B2 (en) * | 2005-02-02 | 2009-08-25 | Bridgestone Corporation | Nano-composite and compositions therefrom |
| US7659342B2 (en) * | 2005-02-03 | 2010-02-09 | Bridgestone Corporation | Polymer nano-particle with polar core and method for manufacturing same |
| US7538159B2 (en) | 2005-12-16 | 2009-05-26 | Bridgestone Corporation | Nanoparticles with controlled architecture and method thereof |
| US9061900B2 (en) * | 2005-12-16 | 2015-06-23 | Bridgestone Corporation | Combined use of liquid polymer and polymeric nanoparticles for rubber applications |
| US8288473B2 (en) | 2005-12-19 | 2012-10-16 | Bridgestone Corporation | Disk-like nanoparticles |
| US7884160B2 (en) | 2005-12-19 | 2011-02-08 | Bridgestone Corporation | Non-spherical nanoparticles made from living triblock polymer chains |
| US8877250B2 (en) * | 2005-12-20 | 2014-11-04 | Bridgestone Corporation | Hollow nano-particles and method thereof |
| US8697775B2 (en) * | 2005-12-20 | 2014-04-15 | Bridgestone Corporation | Vulcanizable nanoparticles having a core with a high glass transition temperature |
| US7560510B2 (en) | 2005-12-20 | 2009-07-14 | Bridgestone Corporation | Nano-sized inorganic metal particles, preparation thereof, and application thereof in improving rubber properties |
| US7601772B2 (en) * | 2005-12-20 | 2009-10-13 | Bridgestone Corporation | Nano-composite and method thereof |
| US7935184B2 (en) | 2006-06-19 | 2011-05-03 | Bridgestone Corporation | Method of preparing imidazolium surfactants |
| EP3495322A1 (en) | 2006-07-28 | 2019-06-12 | Bridgestone Corporation | Polymeric core-shell nanoparticles with interphase region |
| US7597959B2 (en) * | 2006-12-19 | 2009-10-06 | Bridgestone Corporation | Core-shell fluorescent nanoparticles |
| US7649049B2 (en) * | 2006-12-20 | 2010-01-19 | Bridgestone Corporation | Rubber composition containing a polymer nanoparticle |
| US7829624B2 (en) * | 2007-06-29 | 2010-11-09 | Bridgestone Corporation | One-pot synthesis of nanoparticles and liquid polymer for rubber applications |
| RU2501816C2 (ru) | 2008-04-30 | 2013-12-20 | Стирон Юроп Гмбх | Стирол-бутадиеновые полимеры со стирольным градиентом и способы изготовления таковых |
| RU2560722C2 (ru) | 2008-12-31 | 2015-08-20 | Бриджстоун Корпорейшн | Наночастицы типа "ядро-оболочка", способ их синтеза и их применение |
| US7884168B2 (en) * | 2009-02-13 | 2011-02-08 | The Goodyear Tire & Rubber Company | Heterogeneous rubbery polymers having random, tapered, and block portions therein and methods of making same |
| US9062144B2 (en) * | 2009-04-03 | 2015-06-23 | Bridgestone Corporation | Hairy polymeric nanoparticles with first and second shell block polymer arms |
| US9115222B2 (en) * | 2009-12-29 | 2015-08-25 | Bridgestone Corporation | Well defined, highly crosslinked nanoparticles and method for making same |
| US20110172364A1 (en) * | 2009-12-29 | 2011-07-14 | Chen Yaohong | Charged Nanoparticles And Method Of Controlling Charge |
| US9428604B1 (en) | 2011-12-30 | 2016-08-30 | Bridgestone Corporation | Nanoparticle fillers and methods of mixing into elastomers |
| KR101768824B1 (ko) * | 2013-07-17 | 2017-08-16 | 아사히 가세이 케미칼즈 가부시키가이샤 | 중합체의 제조 방법 |
| CN105377900B (zh) * | 2013-07-17 | 2017-07-18 | 旭化成株式会社 | 聚合物的制造方法 |
| CN104558328B (zh) * | 2013-10-17 | 2017-07-28 | 中国石油化工股份有限公司 | 一种聚丁二烯橡胶及其制备方法和充油橡胶 |
| JP6828957B2 (ja) * | 2016-07-07 | 2021-02-10 | 株式会社ブリヂストン | 重合体の製造方法 |
| KR101893384B1 (ko) * | 2017-07-25 | 2018-08-30 | 금호석유화학 주식회사 | 공중합체의 제조방법 및 이를 포함하는 고무 조성물 |
| KR20220127806A (ko) * | 2019-10-14 | 2022-09-20 | 브리지스톤 어메리카스 타이어 오퍼레이션스, 엘엘씨 | 랜덤 공중합체 고무를 제조하기 위한 음이온 분산 중합 방법 |
| CN111909313B (zh) * | 2020-08-17 | 2022-07-15 | 山东京博中聚新材料有限公司 | 一种原位增强型丁苯胶乳及其制备方法和应用 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5130894A (en) * | 1974-09-10 | 1976-03-16 | Asahi Chemical Ind | Jugotaisoseibutsu no seizohoho |
| US4098980A (en) * | 1976-06-24 | 1978-07-04 | The Goodyear Tire & Rubber Company | Non-aqueous dispersion polymerization of conjugated diolefins |
| US4829135A (en) * | 1987-12-29 | 1989-05-09 | Mobil Oil Corporation | Multi-stage anionic dispersion homopolymerization to form microparticles with narrow size distribution |
| US5331035A (en) * | 1992-12-22 | 1994-07-19 | Bridgestone Corporation | Process for the preparation of in situ dispersion of copolymers |
-
1993
- 1993-10-18 US US08/137,332 patent/US5891947A/en not_active Expired - Lifetime
-
1994
- 1994-10-17 JP JP27552394A patent/JP3452094B2/ja not_active Expired - Fee Related
- 1994-10-17 ES ES94116325T patent/ES2116501T3/es not_active Expired - Lifetime
- 1994-10-17 DE DE69410730T patent/DE69410730T2/de not_active Expired - Fee Related
- 1994-10-17 EP EP94116325A patent/EP0648790B1/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0648790B1 (en) | 1998-06-03 |
| ES2116501T3 (es) | 1998-07-16 |
| EP0648790A1 (en) | 1995-04-19 |
| DE69410730D1 (de) | 1998-07-09 |
| JP3452094B2 (ja) | 2003-09-29 |
| US5891947A (en) | 1999-04-06 |
| JPH07233228A (ja) | 1995-09-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69410730T2 (de) | Kontinuierliches Verfahren zur in situ anionischen Dispersionspolymerisation | |
| DE69321086T2 (de) | Verfahren zur Herstellung von in situ Dispersion von Copolymeren | |
| DE69205931T2 (de) | Copolymere Dispersion in aliphatischen Lösungsmitteln. | |
| US5614579A (en) | Process for the preparation of tapered copolymers via in situ dispersion | |
| DE3878705T2 (de) | Polymerisationsverfahren. | |
| DE69312891T2 (de) | Verfahren zur Herstellung von Dienpolymerisaten und die hierbei erhaltene Kautschuckmischungen | |
| DE69309961T2 (de) | Sternförmige polydimethylsiloxanblockcopolymere und verfahren zu deren herstellung | |
| DE3735403A1 (de) | Verzweigte copolymerisate und verfahren zu ihrer herstellung | |
| DE69017583T2 (de) | Lösungspolymerisation mit hohem Feststoffgehalt. | |
| DE3784748T2 (de) | Verfahren und system zur herstellung von statistischen copolymeren mit niedrigem vinylgehalt. | |
| DE69625612T2 (de) | Multifunktioneller organischer alkalimetallinitiator und seine synthese, anionisch polymerisierte sternförmige polymere und ihre herstellung | |
| DE3779953T2 (de) | Initiatorsystem zur polymerisation von 1,3-dienen oder 1,3-diene enthaltenden copolymeren. | |
| DE4315300A1 (de) | Elastomer zur Verwendung bei der Herstellung von Compounds für Reifenlaufflächen | |
| DE69920785T2 (de) | Anionische Gasphasenpolymerisation von Dienelastomeren | |
| DE3510624A1 (de) | Block-copolymere und verfahren zu ihrer herstellung | |
| DE69407533T2 (de) | Verwendung von 2,5-substituierten Tetrahydrofuranen als anionische Initiatormodifiziermittel | |
| DE69906398T2 (de) | Verfahren zur Herstellung von mit Zinn gekoppelten Kautschukpolymeren | |
| DE102010006693A1 (de) | Heterogenes kautschukartiges Polymer und Verfahren zu dessen Herstellung | |
| DE60218439T2 (de) | Kautschuk mit carboxylendgruppen | |
| EP1124867B1 (de) | Verfahren zur anionischen polymerisation von dienen | |
| DE1945025A1 (de) | Polymerisat eines aromatischen Multivinylkohlenwasserstoffs | |
| DE2030641A1 (de) | Hvdnerter Pfropfpolymerisate | |
| DD237171A1 (de) | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen | |
| WO1999036451A1 (de) | Verfahren zur herstellung von statistischen styrol-butadien-copolymeren | |
| DD237172A1 (de) | Verfahren zur herstellung von dienpolymeren mit funktionellen endgruppen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |