DE69324628T2 - Verfahren zur Herstellung von Derivaten des 2-Oxopiperidins - Google Patents
Verfahren zur Herstellung von Derivaten des 2-OxopiperidinsInfo
- Publication number
- DE69324628T2 DE69324628T2 DE69324628T DE69324628T DE69324628T2 DE 69324628 T2 DE69324628 T2 DE 69324628T2 DE 69324628 T DE69324628 T DE 69324628T DE 69324628 T DE69324628 T DE 69324628T DE 69324628 T2 DE69324628 T2 DE 69324628T2
- Authority
- DE
- Germany
- Prior art keywords
- process according
- source
- compound
- halide
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims abstract description 24
- 238000002360 preparation method Methods 0.000 title claims description 3
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical class O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 title abstract description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 36
- -1 tetrahydrofuroyl group Chemical group 0.000 claims abstract description 26
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 150000004820 halides Chemical class 0.000 claims description 14
- 239000002841 Lewis acid Substances 0.000 claims description 13
- 150000007517 lewis acids Chemical class 0.000 claims description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical group [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 8
- 150000008064 anhydrides Chemical class 0.000 claims description 8
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 claims description 8
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical group CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 7
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 6
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 claims description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 5
- 239000012346 acetyl chloride Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 150000003461 sulfonyl halides Chemical class 0.000 claims description 5
- 239000011592 zinc chloride Substances 0.000 claims description 5
- 235000005074 zinc chloride Nutrition 0.000 claims description 5
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 5
- 229910015845 BBr3 Inorganic materials 0.000 claims description 4
- 150000001266 acyl halides Chemical class 0.000 claims description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 4
- IGGHSANJNRYSQB-UHFFFAOYSA-N OS([SiH3])(=O)=O Chemical class OS([SiH3])(=O)=O IGGHSANJNRYSQB-UHFFFAOYSA-N 0.000 claims description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- PPNCOQHHSGMKGI-UHFFFAOYSA-N 1-cyclononyldiazonane Chemical compound C1CCCCCCCC1N1NCCCCCCC1 PPNCOQHHSGMKGI-UHFFFAOYSA-N 0.000 claims description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 claims description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 2
- 229910010062 TiCl3 Inorganic materials 0.000 claims description 2
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 claims description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000005228 aryl sulfonate group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 150000001649 bromium compounds Chemical class 0.000 claims description 2
- 150000001805 chlorine compounds Chemical class 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229940043279 diisopropylamine Drugs 0.000 claims description 2
- 150000004694 iodide salts Chemical class 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 2
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 claims description 2
- 229910001623 magnesium bromide Inorganic materials 0.000 claims description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 2
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 claims description 2
- 125000004665 trialkylsilyl group Chemical group 0.000 claims description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 claims 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- ABQPEYRVNHDPIO-UHFFFAOYSA-N bromo(dimethyl)borane Chemical compound CB(C)Br ABQPEYRVNHDPIO-UHFFFAOYSA-N 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract description 3
- 230000015572 biosynthetic process Effects 0.000 abstract description 2
- 238000007142 ring opening reaction Methods 0.000 abstract description 2
- 238000003786 synthesis reaction Methods 0.000 abstract description 2
- 239000000243 solution Substances 0.000 description 14
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 10
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 235000019439 ethyl acetate Nutrition 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- DVCFNCQPOANJGU-UHFFFAOYSA-N oxolane-2-carbonyl chloride Chemical compound ClC(=O)C1CCCO1 DVCFNCQPOANJGU-UHFFFAOYSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- BDLCAVORXGWRJK-UHFFFAOYSA-N benzyl oxolane-2-carboxylate Chemical compound C1CCOC1C(=O)OCC1=CC=CC=C1 BDLCAVORXGWRJK-UHFFFAOYSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000002872 contrast media Substances 0.000 description 3
- DEQYTNZJHKPYEZ-UHFFFAOYSA-N ethyl acetate;heptane Chemical compound CCOC(C)=O.CCCCCCC DEQYTNZJHKPYEZ-UHFFFAOYSA-N 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 238000004452 microanalysis Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 2
- 229940125890 compound Ia Drugs 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- YJJOMCLSOPUHEI-UHFFFAOYSA-N (1,5-dichloro-1-oxopentan-2-yl) acetate Chemical compound CC(=O)OC(C(Cl)=O)CCCCl YJJOMCLSOPUHEI-UHFFFAOYSA-N 0.000 description 1
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- RGNBMKMIJVXJRF-UHFFFAOYSA-N 2-acetyloxy-5-chloropentanoic acid Chemical compound CC(=O)OC(C(O)=O)CCCCl RGNBMKMIJVXJRF-UHFFFAOYSA-N 0.000 description 1
- SVNNWKWHLOJLOK-UHFFFAOYSA-N 5-chloropentanoyl chloride Chemical compound ClCCCCC(Cl)=O SVNNWKWHLOJLOK-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 102100021090 Homeobox protein Hox-A9 Human genes 0.000 description 1
- 101001083156 Homo sapiens Homeobox protein Hox-A1 Proteins 0.000 description 1
- 101001083164 Homo sapiens Homeobox protein Hox-A10 Proteins 0.000 description 1
- 101001083158 Homo sapiens Homeobox protein Hox-A11 Proteins 0.000 description 1
- 101001083162 Homo sapiens Homeobox protein Hox-A13 Proteins 0.000 description 1
- 101000962622 Homo sapiens Homeobox protein Hox-A3 Proteins 0.000 description 1
- 101001077578 Homo sapiens Homeobox protein Hox-A4 Proteins 0.000 description 1
- 101001077568 Homo sapiens Homeobox protein Hox-A5 Proteins 0.000 description 1
- 101001045083 Homo sapiens Homeobox protein Hox-A6 Proteins 0.000 description 1
- 101001045116 Homo sapiens Homeobox protein Hox-A7 Proteins 0.000 description 1
- 101001041174 Homo sapiens Homeobox protein Hox-A9 Proteins 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- SLTGUOPVQWULIB-UHFFFAOYSA-N [2-acetyloxy-3-[[3-[(2-acetyloxy-5-chloropentanoyl)amino]-5-carbamoyl-2,4,6-triiodobenzoyl]-(2,3-diacetyloxypropyl)amino]propyl] acetate Chemical compound CC(=O)OCC(OC(C)=O)CN(CC(COC(C)=O)OC(C)=O)C(=O)C1=C(I)C(NC(=O)C(CCCCl)OC(C)=O)=C(I)C(C(N)=O)=C1I SLTGUOPVQWULIB-UHFFFAOYSA-N 0.000 description 1
- XMVWCJJIDNJJFX-UHFFFAOYSA-N [4-(2-oxopropyl)phenyl]sulfonyl 4-(2-oxopropyl)benzenesulfonate Chemical compound C(C)(=O)CC1=CC=C(C=C1)S(=O)(=O)OS(=O)(=O)C1=CC=C(CC(C)=O)C=C1 XMVWCJJIDNJJFX-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- UXHOLTMPHQMIEM-UHFFFAOYSA-N benzyl 2-acetyloxy-5-chloropentanoate Chemical compound ClCCCC(OC(=O)C)C(=O)OCC1=CC=CC=C1 UXHOLTMPHQMIEM-UHFFFAOYSA-N 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- AQFJRVCHOVHJRU-UHFFFAOYSA-N chloro pentanoate Chemical compound CCCCC(=O)OCl AQFJRVCHOVHJRU-UHFFFAOYSA-N 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- NAYYNDKKHOIIOD-UHFFFAOYSA-N phthalamide Chemical compound NC(=O)C1=CC=CC=C1C(N)=O NAYYNDKKHOIIOD-UHFFFAOYSA-N 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- UJJLJRQIPMGXEZ-UHFFFAOYSA-N tetrahydro-2-furoic acid Chemical compound OC(=O)C1CCCO1 UJJLJRQIPMGXEZ-UHFFFAOYSA-N 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
- C07D211/76—Oxygen atoms attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/16—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/46—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having carbon atoms of carboxamide groups, amino groups and at least three atoms of bromine or iodine, bound to carbon atoms of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/18—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/893,856 US5359077A (en) | 1992-06-05 | 1992-06-05 | Process for preparation of 2-oxo-1 piperidinyl derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69324628D1 DE69324628D1 (de) | 1999-06-02 |
| DE69324628T2 true DE69324628T2 (de) | 1999-12-09 |
Family
ID=25402232
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69324628T Expired - Lifetime DE69324628T2 (de) | 1992-06-05 | 1993-06-03 | Verfahren zur Herstellung von Derivaten des 2-Oxopiperidins |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US5359077A (enExample) |
| EP (1) | EP0573289B1 (enExample) |
| JP (1) | JP3190480B2 (enExample) |
| KR (1) | KR940000431A (enExample) |
| CN (1) | CN1083049A (enExample) |
| AT (1) | ATE179414T1 (enExample) |
| CA (1) | CA2096267A1 (enExample) |
| DE (1) | DE69324628T2 (enExample) |
| ES (1) | ES2133361T3 (enExample) |
| FI (1) | FI932570A7 (enExample) |
| HU (1) | HUT65118A (enExample) |
| IL (1) | IL105609A0 (enExample) |
| TW (1) | TW239130B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5527926A (en) * | 1990-11-26 | 1996-06-18 | Bracco International B.V. | Methods and compositions for using non-ionic contrast agents to reduce the risk of clot formation in diagnostic procedures |
| JPH11296048A (ja) * | 1998-04-14 | 1999-10-29 | Sharp Corp | 画像形成装置 |
| US10729136B2 (en) | 2015-10-29 | 2020-08-04 | Rotam Agrochem International Company Limited | Synergistic herbicidal composition and use thereof |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2333771A (en) * | 1940-09-07 | 1943-11-09 | Eastman Kodak Co | 4(1)-halo-1(4)-acyloxyvaleric acid and derivatives and preparation thereof |
| US4734424A (en) * | 1986-09-24 | 1988-03-29 | E. R. Squibb & Sons, Inc. | Bicycloheptane substituted diamide and its congener prostaglandin analogs |
| IL96324A (en) * | 1989-11-29 | 1995-01-24 | Squibb & Sons Inc | 5-Amino-2, 4, 6-triiodo-1, 3-benzenecarboxylic acid derivatives, processes for their preparation, and methods utilizing them as contrast agents |
| US5278311A (en) * | 1992-06-05 | 1994-01-11 | E. R. Squibb & Sons, Inc. | Nonionic radiographic contrast agents |
-
1992
- 1992-06-05 US US07/893,856 patent/US5359077A/en not_active Expired - Lifetime
-
1993
- 1993-05-04 TW TW082103488A patent/TW239130B/zh active
- 1993-05-05 IL IL105609A patent/IL105609A0/xx unknown
- 1993-05-14 CA CA002096267A patent/CA2096267A1/en not_active Abandoned
- 1993-06-03 ES ES93304307T patent/ES2133361T3/es not_active Expired - Lifetime
- 1993-06-03 DE DE69324628T patent/DE69324628T2/de not_active Expired - Lifetime
- 1993-06-03 JP JP13322793A patent/JP3190480B2/ja not_active Expired - Fee Related
- 1993-06-03 AT AT93304307T patent/ATE179414T1/de not_active IP Right Cessation
- 1993-06-03 EP EP93304307A patent/EP0573289B1/en not_active Expired - Lifetime
- 1993-06-04 HU HU9301653A patent/HUT65118A/hu unknown
- 1993-06-04 KR KR1019930010045A patent/KR940000431A/ko not_active Withdrawn
- 1993-06-04 FI FI932570A patent/FI932570A7/fi not_active Application Discontinuation
- 1993-06-05 CN CN93106895A patent/CN1083049A/zh active Pending
-
1994
- 1994-07-15 US US08/276,185 patent/US5559237A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FI932570A7 (fi) | 1993-12-06 |
| ES2133361T3 (es) | 1999-09-16 |
| HUT65118A (en) | 1994-04-28 |
| DE69324628D1 (de) | 1999-06-02 |
| CN1083049A (zh) | 1994-03-02 |
| TW239130B (enExample) | 1995-01-21 |
| CA2096267A1 (en) | 1993-12-06 |
| US5359077A (en) | 1994-10-25 |
| FI932570A0 (fi) | 1993-06-04 |
| HU9301653D0 (en) | 1993-09-28 |
| JPH0673005A (ja) | 1994-03-15 |
| JP3190480B2 (ja) | 2001-07-23 |
| EP0573289B1 (en) | 1999-04-28 |
| IL105609A0 (en) | 1993-09-22 |
| ATE179414T1 (de) | 1999-05-15 |
| EP0573289A2 (en) | 1993-12-08 |
| US5559237A (en) | 1996-09-24 |
| KR940000431A (ko) | 1994-01-03 |
| EP0573289A3 (en) | 1994-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69428280T2 (de) | Verfahren zur herstellung von azetidinonen | |
| DE2758937C2 (enExample) | ||
| DE602004011767T2 (de) | Cyclohexylsulfone als gamma-sekretase-inhibitoren | |
| DE60215851T2 (de) | N-adamantylmethyl-derivate und zwischenprodukte als pharmazeutische zusammensetzungen und verfahren zu ihrer herstellung | |
| DE69210141T2 (de) | Herstellung von Fluoxetin und Zwischenverbindungen | |
| DE69511883T2 (de) | Iodierte röntgenkontrastmittel | |
| DE2759033A1 (de) | Verfahren zur herstellung von, gegebenenfalls an ihrer hydroxygruppe durch eine trialkylsilylgruppe geschuetzten, 4-hydroxypyrrolidin-2-on-1-ylalkylcarbonsaeureestern | |
| DE69012351T2 (de) | Neue Zwischenprodukte, ihre Herstellung und Verwendung. | |
| DE69021823T2 (de) | 3-Aryl-Oxazolidinone, Verfahren zu ihrer Herstellung und ihre Anwendung in der Therapie. | |
| DE2947118C2 (de) | Verfahren zur Herstellung von 7-Oxo-4-thia-1-aza-bicyclo[3,2,0]heptanderivate | |
| DE69408580T2 (de) | 2-amino-1,2,3,4-tetrahydronaphthalenderivate mit cardiovaskulärer wirkung | |
| DE69307730T2 (de) | Verfahren zur herstellung von taxanderivaten, die so erlangten neuen derivate und diese enthaltende zusammensetzungen | |
| DE69324628T2 (de) | Verfahren zur Herstellung von Derivaten des 2-Oxopiperidins | |
| DE69411000T2 (de) | Verfahren zur herstellung von beta-phenylisoserin-derivaten | |
| DE69126758T2 (de) | Benzamid-Derivate | |
| US5614638A (en) | Nonionic radiographic contrast agents | |
| DE69228042T2 (de) | Naphthamide, Verfahren zur Herstellung und ihre therapeutische Anwendung | |
| JP2021534174A (ja) | Sglt阻害剤の合成に有用な中間体の製造 | |
| DE69506760T2 (de) | Polyiodierte Verbindungen, Verfahren zu deren Herstellung und diagnostische Zusammensetzung | |
| RU2046795C1 (ru) | Способ получения производных 5-амино-2,4,6-трииодо- 1,3-бензолкарбоновой кислоты | |
| DE69503213T2 (de) | Baccatin-Derivate und Verfahren zu deren Herstellung | |
| DE69217277T2 (de) | Butyrsäurederivate und deren Verwendung bei der Herstellung von optisch aktivem Cyclohexylnorstatin | |
| DE69308965T2 (de) | Verfahren zum Herstellen einer gesättigten monocyclischen Kohlenwasserstoffverbindung und ein Zwischenprodukt für dieses | |
| DE3750587T2 (de) | Verfahren zur Herstellung von Eicosatetraynsäure. | |
| DE69711276T2 (de) | Verfahren zur Herstellung von Acetonylbenzamiden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| R082 | Change of representative |
Ref document number: 573289 Country of ref document: EP Representative=s name: UEXKUELL & STOLBERG, DE |
|
| R081 | Change of applicant/patentee |
Ref document number: 573289 Country of ref document: EP Owner name: BRACCO SUISSE S.A., CH Free format text: FORMER OWNER: BRACCO INTERNATIONAL B.V., 1083 AMSTERDAM, NL Effective date: 20120924 |
|
| R082 | Change of representative |
Ref document number: 573289 Country of ref document: EP Representative=s name: UEXKUELL & STOLBERG, DE Effective date: 20120924 |