DE69209192T2 - Verfahren zur selektiven Darstellung von organischen Trisulfiden - Google Patents
Verfahren zur selektiven Darstellung von organischen TrisulfidenInfo
- Publication number
- DE69209192T2 DE69209192T2 DE69209192T DE69209192T DE69209192T2 DE 69209192 T2 DE69209192 T2 DE 69209192T2 DE 69209192 T DE69209192 T DE 69209192T DE 69209192 T DE69209192 T DE 69209192T DE 69209192 T2 DE69209192 T2 DE 69209192T2
- Authority
- DE
- Germany
- Prior art keywords
- mercaptan
- polysulfide
- reaction
- sulfur
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000000034 method Methods 0.000 title claims abstract description 52
- 238000002360 preparation method Methods 0.000 title claims description 8
- 239000003054 catalyst Substances 0.000 claims abstract description 76
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 70
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims abstract description 69
- 239000011593 sulfur Substances 0.000 claims abstract description 65
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 64
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims abstract description 45
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 13
- 239000011701 zinc Substances 0.000 claims abstract description 13
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 13
- 238000006243 chemical reaction Methods 0.000 claims description 62
- 229920001021 polysulfide Polymers 0.000 claims description 56
- 239000005077 polysulfide Substances 0.000 claims description 55
- 150000008117 polysulfides Polymers 0.000 claims description 55
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 30
- 229910000037 hydrogen sulfide Inorganic materials 0.000 claims description 22
- 239000000377 silicon dioxide Substances 0.000 claims description 15
- NYLJHRUQFXQNPN-UHFFFAOYSA-N 2-(tert-butyltrisulfanyl)-2-methylpropane Chemical compound CC(C)(C)SSSC(C)(C)C NYLJHRUQFXQNPN-UHFFFAOYSA-N 0.000 claims description 13
- WMXCDAVJEZZYLT-UHFFFAOYSA-N tert-butylthiol Chemical compound CC(C)(C)S WMXCDAVJEZZYLT-UHFFFAOYSA-N 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 9
- 150000001336 alkenes Chemical class 0.000 claims description 9
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 8
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 8
- 239000002798 polar solvent Substances 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 239000002638 heterogeneous catalyst Substances 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 239000011777 magnesium Substances 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 238000011084 recovery Methods 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims 3
- JYMITAMFTJDTAE-UHFFFAOYSA-N aluminum zinc oxygen(2-) Chemical compound [O-2].[Al+3].[Zn+2] JYMITAMFTJDTAE-UHFFFAOYSA-N 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 21
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 5
- 150000001340 alkali metals Chemical class 0.000 abstract description 5
- -1 alkaline earth metal modified silica Chemical class 0.000 abstract description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 12
- 238000010992 reflux Methods 0.000 description 10
- NHHSUCWHDQEHTJ-UHFFFAOYSA-N 2-(tert-butyltetrasulfanyl)-2-methylpropane Chemical compound CC(C)(C)SSSSC(C)(C)C NHHSUCWHDQEHTJ-UHFFFAOYSA-N 0.000 description 9
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- BKCNDTDWDGQHSD-UHFFFAOYSA-N 2-(tert-butyldisulfanyl)-2-methylpropane Chemical compound CC(C)(C)SSC(C)(C)C BKCNDTDWDGQHSD-UHFFFAOYSA-N 0.000 description 8
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 238000004817 gas chromatography Methods 0.000 description 8
- 239000000395 magnesium oxide Substances 0.000 description 8
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 8
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 238000010923 batch production Methods 0.000 description 5
- 238000010924 continuous production Methods 0.000 description 5
- 239000012528 membrane Substances 0.000 description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 150000002019 disulfides Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- 239000011787 zinc oxide Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052728 basic metal Inorganic materials 0.000 description 2
- 150000003818 basic metals Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 125000002228 disulfide group Chemical group 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 150000008116 organic polysulfides Chemical class 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- RBORURQQJIQWBS-QVRNUERCSA-N (4ar,6r,7r,7as)-6-(6-amino-8-bromopurin-9-yl)-2-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4h-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol Chemical compound C([C@H]1O2)OP(O)(=S)O[C@H]1[C@@H](O)[C@@H]2N1C(N=CN=C2N)=C2N=C1Br RBORURQQJIQWBS-QVRNUERCSA-N 0.000 description 1
- PTYXPKUPXPWHSH-UHFFFAOYSA-N 1-(butyltetrasulfanyl)butane Chemical group CCCCSSSSCCCC PTYXPKUPXPWHSH-UHFFFAOYSA-N 0.000 description 1
- MFNTTYYYVNGQPW-UHFFFAOYSA-N 1-(butyltrisulfanyl)butane Chemical group CCCCSSSCCCC MFNTTYYYVNGQPW-UHFFFAOYSA-N 0.000 description 1
- YAJYJWXEWKRTPO-UHFFFAOYSA-N 2,3,3,4,4,5-hexamethylhexane-2-thiol Chemical compound CC(C)C(C)(C)C(C)(C)C(C)(C)S YAJYJWXEWKRTPO-UHFFFAOYSA-N 0.000 description 1
- MPBLPZLNKKGCGP-UHFFFAOYSA-N 2-methyloctane-2-thiol Chemical compound CCCCCCC(C)(C)S MPBLPZLNKKGCGP-UHFFFAOYSA-N 0.000 description 1
- LNMBCRKRCIMQLW-UHFFFAOYSA-N 2-tert-butylsulfanyl-2-methylpropane Chemical compound CC(C)(C)SC(C)(C)C LNMBCRKRCIMQLW-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CUDSBWGCGSUXDB-UHFFFAOYSA-N Dibutyl disulfide Chemical group CCCCSSCCCC CUDSBWGCGSUXDB-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- TXKMVPPZCYKFAC-UHFFFAOYSA-N disulfur monoxide Inorganic materials O=S=S TXKMVPPZCYKFAC-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000010722 industrial gear oil Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 239000003879 lubricant additive Substances 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000005555 metalworking Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000008427 organic disulfides Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000000066 reactive distillation Methods 0.000 description 1
- 238000013040 rubber vulcanization Methods 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical class ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/22—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of hydropolysulfides or polysulfides
- C07C319/24—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of hydropolysulfides or polysulfides by reactions involving the formation of sulfur-to-sulfur bonds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US74837791A | 1991-08-22 | 1991-08-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69209192D1 DE69209192D1 (de) | 1996-04-25 |
| DE69209192T2 true DE69209192T2 (de) | 1996-07-25 |
Family
ID=25009215
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69209192T Expired - Fee Related DE69209192T2 (de) | 1991-08-22 | 1992-08-10 | Verfahren zur selektiven Darstellung von organischen Trisulfiden |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US5442123A (pt) |
| EP (1) | EP0529388B1 (pt) |
| JP (1) | JPH05194372A (pt) |
| AT (1) | ATE135685T1 (pt) |
| BR (1) | BR9203241A (pt) |
| CA (1) | CA2076340A1 (pt) |
| DE (1) | DE69209192T2 (pt) |
| MX (1) | MX9204857A (pt) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5907064A (en) * | 1998-05-19 | 1999-05-25 | Phillips Petroleum Co. | Process for producing organic trisulfides |
| US6242652B1 (en) | 2000-03-03 | 2001-06-05 | Phillips Petroleum Company | Process for producing organic trisulfides |
| US6284926B1 (en) | 2000-06-06 | 2001-09-04 | Richmond, Hitchcock, Fish & Dollar | Process and apparatus for producing organic polysulfides |
| US6399832B1 (en) | 2000-06-29 | 2002-06-04 | Phillips Petroleum Company | Process for producing organic trisulfides |
| JP4810762B2 (ja) * | 2001-06-20 | 2011-11-09 | Ｄｉｃ株式会社 | ジアルキルトリスルフィドの製造方法 |
| US6689723B2 (en) * | 2002-03-05 | 2004-02-10 | Exxonmobil Chemical Patents Inc. | Sulfide- and polysulfide-containing lubricating oil additive compositions and lubricating compositions containing the same |
| EP2236211B1 (en) | 2009-03-31 | 2015-09-09 | Ford-Werke GmbH | Plasma transfer wire arc thermal spray system |
| RU2581364C2 (ru) | 2011-04-12 | 2016-04-20 | ШАНХАЙ АйСиАй РИСЕРЧ ЭНД ДЕВЕЛОПМЕНТ ЭНД МЕНЕДЖМЕНТ КО. ЛТД. | Способ получения полисульфида |
| CN103333199B (zh) * | 2013-07-22 | 2015-04-01 | 荆州市江汉精细化工有限公司 | 一种双-[3-(三乙氧基硅)丙基]-多硫化物硅烷偶联剂的制备方法 |
| EP3294707B1 (en) * | 2015-05-08 | 2024-06-26 | Arkema, Inc. | Manufacture of organopolysulfides and salts thereof |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2237625A (en) * | 1938-10-07 | 1941-04-08 | Sharples Solvents Corp | Sulphurization of sulphur-containing organic conpounds |
| US3022351A (en) * | 1957-03-07 | 1962-02-20 | Phillips Petroleum Co | Production of organic polysulfides |
| US3392201A (en) * | 1965-08-25 | 1968-07-09 | Phillips Petroleum Co | Process for making alkyl trisulfides |
| FR1553249A (pt) * | 1967-01-20 | 1969-01-10 | ||
| FR2130985A5 (pt) * | 1971-03-29 | 1972-11-10 | Aquitaine Petrole | |
| JPS58140064A (ja) * | 1982-02-13 | 1983-08-19 | Nippon Soda Co Ltd | ジアルキルトリスルフイド類の製造方法 |
| ATE59634T1 (de) * | 1985-05-13 | 1991-01-15 | Atochem North America | Verfahren zur herstellung von dialkyldisulfiden. |
| US5026915A (en) * | 1985-05-13 | 1991-06-25 | Atochem North America, Inc. | Process for the manufacture of dialkyl disulfides |
| FR2607496B1 (fr) * | 1986-11-28 | 1989-03-10 | Elf Aquitaine | Procede de production de polysulfures organiques et systeme catalytique pour sa realisation |
| DE68900007D1 (de) * | 1988-04-14 | 1990-10-04 | Elf Aquitaine | Verfahren zur herstellung von organischen di- und polysulfiden. |
| US4937385A (en) * | 1988-05-18 | 1990-06-26 | Pennwalt Corporation | Process for the manufacture of dialkyl disulfides and polysulfides |
| US5091593A (en) * | 1989-05-26 | 1992-02-25 | Atochem North America, Inc. | Process for removing sulfur from organic sulfides |
| US5146000A (en) * | 1991-03-25 | 1992-09-08 | Ethyl Corporation | Production of dihydrocarbyl polysulfides |
-
1992
- 1992-08-10 EP EP92113602A patent/EP0529388B1/en not_active Expired - Lifetime
- 1992-08-10 DE DE69209192T patent/DE69209192T2/de not_active Expired - Fee Related
- 1992-08-10 AT AT92113602T patent/ATE135685T1/de active
- 1992-08-20 BR BR929203241A patent/BR9203241A/pt not_active Application Discontinuation
- 1992-08-21 CA CA002076340A patent/CA2076340A1/en not_active Abandoned
- 1992-08-21 MX MX9204857A patent/MX9204857A/es unknown
- 1992-08-21 JP JP4244079A patent/JPH05194372A/ja not_active Withdrawn
-
1993
- 1993-01-13 US US08/004,209 patent/US5442123A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0529388B1 (en) | 1996-03-20 |
| ATE135685T1 (de) | 1996-04-15 |
| CA2076340A1 (en) | 1993-02-23 |
| JPH05194372A (ja) | 1993-08-03 |
| DE69209192D1 (de) | 1996-04-25 |
| MX9204857A (es) | 1993-05-01 |
| US5442123A (en) | 1995-08-15 |
| BR9203241A (pt) | 1993-03-30 |
| EP0529388A1 (en) | 1993-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68905519T2 (de) | Verfahren zur herstellung von dialkyldisulfiden und polysulfiden. | |
| DE3213628C2 (de) | Verfahren zur Herstellung von Arylensulfidpolymeren und Vorrichtung zur Durchführung des Verfahrens | |
| DE69209192T2 (de) | Verfahren zur selektiven Darstellung von organischen Trisulfiden | |
| DE3884451T2 (de) | Katalysatoren zur hydrierenden Behandlung von Kohlenwasserstoffen und deren Aktivierung. | |
| JPH0321023B2 (pt) | ||
| DE1568747A1 (de) | Verfahren zur Oxychlorierung organischer Verbindungen | |
| DE1668462B2 (de) | Verfahren zur herstellung von di- (tert.-alkyl)-trisulfiden | |
| EP2456756A1 (de) | Verfahren zur kontinuierlichen herstellung von methylmercaptan aus kohlenstoffhaltigen verbindungen, schwefel und wasserstoff | |
| EP3546468A1 (de) | Verfahren zur herstellung alkoxysilangruppen-haltiger isocyanate | |
| DE69305372T2 (de) | Verfahren zur Herstellung von Hydrocarbyltrisulfide-Produkt | |
| DE69706903T2 (de) | Verfahren für die Herstellung von Mercaptanen | |
| EP2118054B1 (de) | Verfahren zur herstellung von alkylmercaptan aus dialkylsulfiden und/oder dialkylpolysulfiden | |
| CA1180708A (en) | Process for preparing organic sulphides | |
| DE69225429T2 (de) | Herstellung von Dihydrocarbylpolysulfiden | |
| DE69100571T2 (de) | Verfahren zur Herstellung von Dimethyldisulfid. | |
| DE69010769T2 (de) | Verfahren zur Entfernung von Schwefel aus organischen Sulfiden. | |
| DE69610335T2 (de) | Verfahren zur herstellung von mercatocarbonsaeuren aus ungesaettigten carbonsaeuren | |
| DE2816407C3 (de) | Verfahren zur Herstellung von 2-Mercaptobenzthiazol | |
| DE69505331T2 (de) | Verfahren zur Herstellung von sehr reinen C4+-Alkylmercaptanen | |
| EP1671946B1 (de) | Verwendung von H2S-haltigen Abgasströmen zur Herstellung von schwefelhaltigen Produkten | |
| DE60001151T2 (de) | Lösungsmittelfreies verfahren zur herstellung von thiuram-disulfiden | |
| DE60100083T2 (de) | Verfahren zur Herstellung von sulfurierten Olefinen | |
| DE69108429T2 (de) | Verfahren zur Herstellung von Alkylthio- und Arylthio-substituierten Carbonsäuren und ihren Estern. | |
| DE740247C (de) | Verfahren zur Herstellung von Thioathern und bzw. oder Mercaptanen | |
| DE3541603A1 (de) | Verfahren zur herstellung von diorganomonothiophosphinaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: ARKEMA INC., PHILADELPHIA, PA., US |
|
| 8339 | Ceased/non-payment of the annual fee |