DE69204472T2 - Fluessige waschmittel mit zitronensaeure, cellulase und bor-diol-komplex um proteolytisches enzym zu inhibieren. - Google Patents
Fluessige waschmittel mit zitronensaeure, cellulase und bor-diol-komplex um proteolytisches enzym zu inhibieren.Info
- Publication number
- DE69204472T2 DE69204472T2 DE69204472T DE69204472T DE69204472T2 DE 69204472 T2 DE69204472 T2 DE 69204472T2 DE 69204472 T DE69204472 T DE 69204472T DE 69204472 T DE69204472 T DE 69204472T DE 69204472 T2 DE69204472 T2 DE 69204472T2
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- acid
- liquid detergent
- cellulase
- detergent composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 title claims description 80
- 108010059892 Cellulase Proteins 0.000 title claims description 47
- 239000003599 detergent Substances 0.000 title claims description 42
- 108091005804 Peptidases Proteins 0.000 title claims description 33
- 102000035195 Peptidases Human genes 0.000 title claims description 33
- 239000007788 liquid Substances 0.000 title claims description 33
- 229940106157 cellulase Drugs 0.000 title claims description 31
- 150000002009 diols Chemical class 0.000 title description 14
- 239000000203 mixture Substances 0.000 claims description 87
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 39
- 239000004327 boric acid Substances 0.000 claims description 37
- 239000004094 surface-active agent Substances 0.000 claims description 35
- 150000003839 salts Chemical class 0.000 claims description 31
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 21
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 18
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 17
- 229930195729 fatty acid Natural products 0.000 claims description 17
- 239000000194 fatty acid Substances 0.000 claims description 17
- 239000007859 condensation product Substances 0.000 claims description 16
- 150000004665 fatty acids Chemical class 0.000 claims description 15
- 239000002736 nonionic surfactant Substances 0.000 claims description 15
- 235000013772 propylene glycol Nutrition 0.000 claims description 15
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 14
- 239000003945 anionic surfactant Substances 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 10
- 235000000346 sugar Nutrition 0.000 claims description 10
- 125000000129 anionic group Chemical group 0.000 claims description 9
- 230000000694 effects Effects 0.000 claims description 5
- 102000004169 proteins and genes Human genes 0.000 claims description 5
- 108090000623 proteins and genes Proteins 0.000 claims description 5
- 241001480714 Humicola insolens Species 0.000 claims description 3
- -1 carboxyl compound Chemical class 0.000 description 47
- 125000000217 alkyl group Chemical group 0.000 description 44
- 102000004190 Enzymes Human genes 0.000 description 17
- 108090000790 Enzymes Proteins 0.000 description 17
- 229940088598 enzyme Drugs 0.000 description 16
- 125000004432 carbon atom Chemical group C* 0.000 description 14
- 229920005646 polycarboxylate Polymers 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 13
- 239000011734 sodium Substances 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 9
- 239000004365 Protease Substances 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 9
- 150000001768 cations Chemical class 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 229910052700 potassium Inorganic materials 0.000 description 9
- 239000011591 potassium Substances 0.000 description 9
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 8
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical group OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 7
- 108010084185 Cellulases Proteins 0.000 description 7
- 102000005575 Cellulases Human genes 0.000 description 7
- 150000001720 carbohydrates Chemical group 0.000 description 7
- 239000008103 glucose Substances 0.000 description 7
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 150000007942 carboxylates Chemical group 0.000 description 6
- 230000002209 hydrophobic effect Effects 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 5
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 230000001580 bacterial effect Effects 0.000 description 5
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 5
- 229940044170 formate Drugs 0.000 description 5
- 125000001183 hydrocarbyl group Chemical group 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229920005862 polyol Polymers 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 229930182556 Polyacetal Natural products 0.000 description 4
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 150000003863 ammonium salts Chemical class 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- 229920006324 polyoxymethylene Polymers 0.000 description 4
- 230000002797 proteolythic effect Effects 0.000 description 4
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 108090000787 Subtilisin Proteins 0.000 description 3
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical group OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 150000001639 boron compounds Chemical class 0.000 description 3
- 235000014633 carbohydrates Nutrition 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 229930182830 galactose Natural products 0.000 description 3
- 125000003147 glycosyl group Chemical group 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 125000001165 hydrophobic group Chemical group 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 235000011044 succinic acid Nutrition 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 2
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 description 2
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 2
- LWYAUHJRUCQFCX-UHFFFAOYSA-N 4-dodecoxy-4-oxobutanoic acid Chemical compound CCCCCCCCCCCCOC(=O)CCC(O)=O LWYAUHJRUCQFCX-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- SRBFZHDQGSBBOR-IOVATXLUSA-N D-xylopyranose Chemical compound O[C@@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-IOVATXLUSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- 108010022999 Serine Proteases Proteins 0.000 description 2
- 102000012479 Serine Proteases Human genes 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- VVBXXVAFSPEIJQ-CVIPOMFBSA-N [(2r)-3-[[(2r)-1-[[(2s,5r,8r,11r,12s,15s,18s,21s)-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-5-[(4-hydroxyphenyl)methyl]-4,11-dimethyl-2-(2-methylpropyl)-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]am Chemical compound C([C@@H]1C(=O)N[C@@H](C(=O)O[C@H](C)[C@@H](C(N[C@@H](CCCN=C(N)N)C(=O)N[C@H]2CC[C@H](O)N(C2=O)[C@@H](CC(C)C)C(=O)N1C)=O)NC(=O)[C@H](NC(=O)[C@H](O)COS(O)(=O)=O)CC(C)C)C(C)C)C1=CC=C(O)C=C1 VVBXXVAFSPEIJQ-CVIPOMFBSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QUYVBRFLSA-N beta-maltose Chemical compound OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O GUBGYTABKSRVRQ-QUYVBRFLSA-N 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229940044172 calcium formate Drugs 0.000 description 2
- 108010085318 carboxymethylcellulase Proteins 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000004925 denaturation Methods 0.000 description 2
- 230000036425 denaturation Effects 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 229930182478 glucoside Natural products 0.000 description 2
- 150000008131 glucosides Chemical class 0.000 description 2
- 150000004676 glycans Polymers 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- HSEMFIZWXHQJAE-UHFFFAOYSA-N hexadecanamide Chemical compound CCCCCCCCCCCCCCCC(N)=O HSEMFIZWXHQJAE-UHFFFAOYSA-N 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 230000002366 lipolytic effect Effects 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- NNCAWEWCFVZOGF-UHFFFAOYSA-N mepiquat Chemical compound C[N+]1(C)CCCCC1 NNCAWEWCFVZOGF-UHFFFAOYSA-N 0.000 description 2
- LYRFLYHAGKPMFH-UHFFFAOYSA-N octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(N)=O LYRFLYHAGKPMFH-UHFFFAOYSA-N 0.000 description 2
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 150000004804 polysaccharides Polymers 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 2
- 150000008163 sugars Chemical class 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- ILAPVZVYHKSGFM-UHFFFAOYSA-N 1-(carboxymethoxy)ethane-1,1,2-tricarboxylic acid Chemical class OC(=O)COC(C(O)=O)(C(O)=O)CC(O)=O ILAPVZVYHKSGFM-UHFFFAOYSA-N 0.000 description 1
- VJSWLXWONORKLD-UHFFFAOYSA-N 2,4,6-trihydroxybenzene-1,3,5-trisulfonic acid Chemical compound OC1=C(S(O)(=O)=O)C(O)=C(S(O)(=O)=O)C(O)=C1S(O)(=O)=O VJSWLXWONORKLD-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- QDCPNGVVOWVKJG-VAWYXSNFSA-N 2-[(e)-dodec-1-enyl]butanedioic acid Chemical group CCCCCCCCCC\C=C\C(C(O)=O)CC(O)=O QDCPNGVVOWVKJG-VAWYXSNFSA-N 0.000 description 1
- GCVQVCAAUXFNGJ-UHFFFAOYSA-N 2-hexadecylbutanedioic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)CC(O)=O GCVQVCAAUXFNGJ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- PSZAEHPBBUYICS-UHFFFAOYSA-N 2-methylidenepropanedioic acid Chemical compound OC(=O)C(=C)C(O)=O PSZAEHPBBUYICS-UHFFFAOYSA-N 0.000 description 1
- AJJWBMVDEVRUCA-UHFFFAOYSA-N 4-dodec-2-enoxy-4-oxobutanoic acid Chemical compound CCCCCCCCCC=CCOC(=O)CCC(O)=O AJJWBMVDEVRUCA-UHFFFAOYSA-N 0.000 description 1
- YOZWRDKYFCOUMM-UHFFFAOYSA-N 4-oxo-4-pentadec-2-enoxybutanoic acid Chemical compound CCCCCCCCCCCCC=CCOC(=O)CCC(O)=O YOZWRDKYFCOUMM-UHFFFAOYSA-N 0.000 description 1
- LSWKXNPXIJXDHU-UHFFFAOYSA-N 4-oxo-4-tetradecoxybutanoic acid Chemical compound CCCCCCCCCCCCCCOC(=O)CCC(O)=O LSWKXNPXIJXDHU-UHFFFAOYSA-N 0.000 description 1
- 241000607534 Aeromonas Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 238000012935 Averaging Methods 0.000 description 1
- 229910011255 B2O3 Inorganic materials 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 241000194108 Bacillus licheniformis Species 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- CBOCVOKPQGJKKJ-UHFFFAOYSA-L Calcium formate Chemical group [Ca+2].[O-]C=O.[O-]C=O CBOCVOKPQGJKKJ-UHFFFAOYSA-L 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 241000237379 Dolabella Species 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 241000223198 Humicola Species 0.000 description 1
- 241000223200 Humicola grisea var. thermoidea Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 102000004157 Hydrolases Human genes 0.000 description 1
- 108090000604 Hydrolases Proteins 0.000 description 1
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical compound OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000237852 Mollusca Species 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019482 Palm oil Nutrition 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 241001088162 Primula auricula Species 0.000 description 1
- 235000006894 Primula auricula Nutrition 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 101710180012 Protease 7 Proteins 0.000 description 1
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- 102000004139 alpha-Amylases Human genes 0.000 description 1
- 108090000637 alpha-Amylases Proteins 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 229960002645 boric acid Drugs 0.000 description 1
- YFMUPHJGWWRKLX-UHFFFAOYSA-N boric acid;propane-1,2-diol Chemical compound OB(O)O.CC(O)CO YFMUPHJGWWRKLX-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- CMFFZBGFNICZIS-UHFFFAOYSA-N butanedioic acid;2,3-dihydroxybutanedioic acid Chemical compound OC(=O)CCC(O)=O.OC(=O)CCC(O)=O.OC(=O)C(O)C(O)C(O)=O CMFFZBGFNICZIS-UHFFFAOYSA-N 0.000 description 1
- HXDRSFFFXJISME-UHFFFAOYSA-N butanedioic acid;2,3-dihydroxybutanedioic acid Chemical compound OC(=O)CCC(O)=O.OC(=O)C(O)C(O)C(O)=O HXDRSFFFXJISME-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000004281 calcium formate Substances 0.000 description 1
- 235000019255 calcium formate Nutrition 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 229940003871 calcium ion Drugs 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- HJMZMZRCABDKKV-UHFFFAOYSA-N carbonocyanidic acid Chemical class OC(=O)C#N HJMZMZRCABDKKV-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- TUTWLYPCGCUWQI-UHFFFAOYSA-N decanamide Chemical compound CCCCCCCCCC(N)=O TUTWLYPCGCUWQI-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 229950010286 diolamine Drugs 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- JIBFYZIQZVPIBC-UHFFFAOYSA-L dipotassium;2-(carboxymethoxy)propanedioate Chemical compound [K+].[K+].OC(=O)COC(C([O-])=O)C([O-])=O JIBFYZIQZVPIBC-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 125000002519 galactosyl group Chemical group C1([C@H](O)[C@@H](O)[C@@H](O)[C@H](O1)CO)* 0.000 description 1
- 150000008195 galaktosides Chemical class 0.000 description 1
- 125000002791 glucosyl group Chemical group C1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 1
- 235000019534 high fructose corn syrup Nutrition 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229940116335 lauramide Drugs 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNEGQIOMVPPMNR-NSCUHMNNSA-N mesaconic acid Chemical compound OC(=O)C(/C)=C/C(O)=O HNEGQIOMVPPMNR-NSCUHMNNSA-N 0.000 description 1
- 108010003855 mesentericopeptidase Proteins 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- HNEGQIOMVPPMNR-UHFFFAOYSA-N methylfumaric acid Natural products OC(=O)C(C)=CC(O)=O HNEGQIOMVPPMNR-UHFFFAOYSA-N 0.000 description 1
- 108010020132 microbial serine proteinases Proteins 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- QEALYLRSRQDCRA-UHFFFAOYSA-N myristamide Chemical compound CCCCCCCCCCCCCC(N)=O QEALYLRSRQDCRA-UHFFFAOYSA-N 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- FATBGEAMYMYZAF-KTKRTIGZSA-N oleamide Chemical compound CCCCCCCC\C=C/CCCCCCCC(N)=O FATBGEAMYMYZAF-KTKRTIGZSA-N 0.000 description 1
- FATBGEAMYMYZAF-UHFFFAOYSA-N oleicacidamide-heptaglycolether Natural products CCCCCCCCC=CCCCCCCCC(N)=O FATBGEAMYMYZAF-UHFFFAOYSA-N 0.000 description 1
- 239000002540 palm oil Substances 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000000467 phytic acid Substances 0.000 description 1
- 229940068041 phytic acid Drugs 0.000 description 1
- 235000002949 phytic acid Nutrition 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920001444 polymaleic acid Polymers 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229960004063 propylene glycol Drugs 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical group [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000001433 sodium tartrate Substances 0.000 description 1
- 229960002167 sodium tartrate Drugs 0.000 description 1
- 235000011004 sodium tartrates Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229940037312 stearamide Drugs 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical group 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003784 tall oil Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-O trimethylammonium Chemical compound C[NH+](C)C GETQZCLCWQTVFV-UHFFFAOYSA-O 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 108010036927 trypsin-like serine protease Proteins 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38645—Preparations containing enzymes, e.g. protease or amylase containing cellulase
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US80331091A | 1991-12-04 | 1991-12-04 | |
| PCT/US1992/010363 WO1993011215A1 (en) | 1991-12-04 | 1992-12-01 | Liquid laundry detergents with citric acid, cellulase, and boric-diol complex to inhibit proteolytic enzyme |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69204472D1 DE69204472D1 (de) | 1995-10-05 |
| DE69204472T2 true DE69204472T2 (de) | 1996-05-02 |
Family
ID=25186194
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69204472T Expired - Fee Related DE69204472T2 (de) | 1991-12-04 | 1992-12-01 | Fluessige waschmittel mit zitronensaeure, cellulase und bor-diol-komplex um proteolytisches enzym zu inhibieren. |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US5476608A (enExample) |
| EP (1) | EP0615542B1 (enExample) |
| JP (1) | JP3244700B2 (enExample) |
| CN (1) | CN1040019C (enExample) |
| AU (1) | AU3151293A (enExample) |
| CA (1) | CA2124788C (enExample) |
| DE (1) | DE69204472T2 (enExample) |
| ES (1) | ES2076794T3 (enExample) |
| MX (1) | MX9206992A (enExample) |
| PH (1) | PH31148A (enExample) |
| TW (1) | TW232026B (enExample) |
| WO (1) | WO1993011215A1 (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0707642A1 (en) * | 1993-07-09 | 1996-04-24 | Novo Nordisk A/S | Boronic acid or borinic acid derivatives as enzyme stabilizers |
| GB2286596B (en) * | 1994-02-14 | 1998-03-11 | Boryung Pharm | A detergent composition |
| US5691295A (en) * | 1995-01-17 | 1997-11-25 | Cognis Gesellschaft Fuer Biotechnologie Mbh | Detergent compositions |
| USH1468H (en) * | 1994-04-28 | 1995-08-01 | Costa Jill B | Detergent compositions containing cellulase enzyme and selected perfumes for improved odor and stability |
| DE4422433A1 (de) * | 1994-06-28 | 1996-01-04 | Cognis Bio Umwelt | Mehrenzymgranulat |
| CA2208705A1 (en) * | 1995-01-09 | 1996-07-18 | Novo Nordisk A/S | Stabilization of liquid enzyme compositions |
| DE19605688A1 (de) * | 1996-02-16 | 1997-08-21 | Henkel Kgaa | Übergangsmetallkomplexe als Aktivatoren für Persauerstoffverbindungen |
| US6451063B1 (en) * | 1996-09-25 | 2002-09-17 | Genencor International, Inc. | Cellulase for use in industrial processes |
| US6060441A (en) * | 1997-04-10 | 2000-05-09 | Henkel Corporation | Cleaning compositions having enhanced enzyme activity |
| DE19725508A1 (de) | 1997-06-17 | 1998-12-24 | Clariant Gmbh | Wasch- und Reinigungsmittel |
| BR9810646A (pt) * | 1997-06-30 | 2000-08-01 | Henkel Corp | Composição limpadora, processo para remoção de sujeira de uma superfìcie, e, formulação aquosa limpadora de superfìcie dura |
| US6565613B1 (en) * | 1999-04-29 | 2003-05-20 | Genencor International, Inc. | Cellulase detergent matrix |
| WO2001029167A1 (en) * | 1999-10-15 | 2001-04-26 | The Procter & Gamble Company | Enzymatic liquid cleaning composition exhibiting enhanced amylase enzyme stability |
| GB2367065B (en) | 2000-09-20 | 2002-11-20 | Reckitt Benckiser Inc | Enzyme containing laundry booster compositions |
| GB0030671D0 (en) * | 2000-12-15 | 2001-01-31 | Unilever Plc | Detergent compositions |
| BR0116283A (pt) * | 2000-12-19 | 2005-12-13 | Unilever Nv | Grânulo de anticorpo, composições detergente, enzimática alvejante de manchas e enzimática de anti-transferência de corante, e, processo para a preparação de um grânulo de anticorpo |
| JP4567334B2 (ja) | 2001-10-22 | 2010-10-20 | ヘンケル・アクチェンゲゼルシャフト・ウント・コムパニー・コマンディットゲゼルシャフト・アウフ・アクチェン | 綿活性汚れ除去性ウレタン系ポリマー |
| US7351480B2 (en) * | 2002-06-11 | 2008-04-01 | Southwest Research Institute | Tubular structures with coated interior surfaces |
| ATE362511T1 (de) | 2003-02-10 | 2007-06-15 | Henkel Kgaa | Bleichmittelhaltige wasch- oder reinigungsmittel mit wasserlöslichem buildersystem und schmutzablösevermögendem cellulosederivat |
| DE10351325A1 (de) | 2003-02-10 | 2004-08-26 | Henkel Kgaa | Wasch- oder Reinigungsmittel mit wasserlöslichem Buildersystem und schmutzablösevermögendem Cellulosederivat |
| US8652193B2 (en) | 2005-05-09 | 2014-02-18 | Angiomed Gmbh & Co. Medizintechnik Kg | Implant delivery device |
| DE102005026522B4 (de) | 2005-06-08 | 2007-04-05 | Henkel Kgaa | Verstärkung der Reinigungsleistung von Waschmitteln durch Polymer |
| CN101421383B (zh) * | 2006-03-02 | 2011-12-14 | 金克克国际有限公司 | 表面活性漂白和动态pH |
| US20080032909A1 (en) * | 2006-05-05 | 2008-02-07 | De Buzzaccarini Francesco | Compact fluid laundry detergent composition |
| DE102007005419A1 (de) | 2007-01-30 | 2008-07-31 | Henkel Ag & Co. Kgaa | Enzym-haltiges Wasch- oder Reinigungsmittel mit verbesserter Stabilität |
| DE102007011236A1 (de) | 2007-03-06 | 2008-09-11 | Henkel Ag & Co. Kgaa | Carboxylgruppen tragende Benzophenon-oderBenzoesäureanilid-Derivate als Enzymstabilisatoren |
| DE102007041754A1 (de) | 2007-09-04 | 2009-03-05 | Henkel Ag & Co. Kgaa | Polycyclische Verbindungen als Enzymstabilisatoren |
| DE102008010429A1 (de) | 2008-02-21 | 2009-08-27 | Henkel Ag & Co. Kgaa | Harnstoff-Derivate als Enzymstabilisatoren |
| DE102008014760A1 (de) | 2008-03-18 | 2009-09-24 | Henkel Ag & Co. Kgaa | Imidazolium-Salze als Enzymstabilisatoren |
| CN101514306B (zh) * | 2008-12-31 | 2010-10-13 | 北京绿伞化学股份有限公司 | 一种含稳定生物酶络合物和低活性物的织物污垢预处理剂及其制备方法 |
| US8865638B2 (en) | 2013-03-15 | 2014-10-21 | Church & Dwight Co., Inc. | Unit dose laundry compositions |
| US9273270B2 (en) | 2014-02-20 | 2016-03-01 | Church & Dwight Co., Inc. | Unit dose cleaning products for delivering a peroxide-containing bleaching agent |
| DE102014218507A1 (de) | 2014-09-16 | 2016-03-17 | Henkel Ag & Co. Kgaa | Spinnenseidenproteine als Enzymstabilisatoren |
| CN113698998B (zh) * | 2021-09-26 | 2023-10-13 | 广州立白企业集团有限公司 | 一种稳定的具有抗菌功效的洗涤剂组合物 |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5028515B2 (enExample) * | 1971-09-30 | 1975-09-16 | ||
| FI61715C (fi) * | 1976-11-01 | 1982-09-10 | Unilever Nv | Enzymer innehaollande stabiliserad flytande detergentkomposition |
| IT1129814B (it) * | 1980-07-02 | 1986-06-11 | Unilever Nv | Composizione detergente enzimatica liquida |
| DK187280A (da) * | 1980-04-30 | 1981-10-31 | Novo Industri As | Ruhedsreducerende middel til et fuldvaskemiddel fuldvaskemiddel og fuldvaskemetode |
| GB2095275B (en) * | 1981-03-05 | 1985-08-07 | Kao Corp | Enzyme detergent composition |
| DE3264685D1 (en) * | 1981-11-13 | 1985-08-14 | Unilever Nv | Enzymatic liquid cleaning composition |
| US4462922A (en) * | 1981-11-19 | 1984-07-31 | Lever Brothers Company | Enzymatic liquid detergent composition |
| US4652394A (en) * | 1983-05-31 | 1987-03-24 | Colgate Palmolive Co. | Built single phase liquid anionic detergent compositions containing stabilized enzymes |
| NZ208156A (en) * | 1983-05-31 | 1986-11-12 | Colgate Palmolive Co | Built single-phase liquid detergent compositions containing stabilised enzymes |
| US4537707A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid and formate to stabilize enzymes |
| US4566985A (en) * | 1984-09-19 | 1986-01-28 | Applied Biochemists, Inc. | Method of cleaning using liquid compositions comprising stabilized mixtures of enzymes |
| US4842769A (en) * | 1985-07-26 | 1989-06-27 | Colgate-Palmolive Co. | Stabilized fabric softening built detergent composition containing enzymes |
| US4900475A (en) * | 1985-07-26 | 1990-02-13 | Colgate-Palmolive Co. | Stabilized built liquid detergent composition containing enzyme |
| US4842758A (en) * | 1986-10-31 | 1989-06-27 | Colgate-Palmolive Company | Stabilized enzyme system for use in aqueous liquid built detergent compositions |
| GB8627914D0 (en) * | 1986-11-21 | 1986-12-31 | Procter & Gamble | Softening detergent compositions |
| US5187157A (en) * | 1987-06-05 | 1993-02-16 | Du Pont Merck Pharmaceutical Company | Peptide boronic acid inhibitors of trypsin-like proteases |
| EP0406314B1 (en) * | 1988-03-24 | 1993-12-01 | Novo Nordisk A/S | A cellulase preparation |
| GB8810822D0 (en) * | 1988-05-06 | 1988-06-08 | Unilever Plc | Liquid detergent compositions |
| CA2006527A1 (en) * | 1988-12-30 | 1990-06-30 | Martin S. Cardinali | Enzymatic liquid detergent compositions |
| US4959179A (en) * | 1989-01-30 | 1990-09-25 | Lever Brothers Company | Stabilized enzymes liquid detergent composition containing lipase and protease |
| DE3918761C1 (enExample) * | 1989-06-08 | 1990-06-28 | Henkel Kgaa, 4000 Duesseldorf, De | |
| JP3110452B2 (ja) * | 1990-05-09 | 2000-11-20 | ノボ ノルディスク アクティーゼルスカブ | エンドグルカナーゼ酵素を含んでなるセルラーゼ調製物 |
| SK120893A3 (en) * | 1991-04-30 | 1994-08-10 | Procter & Gamble | Liquid detergent mixtures with boric-polyol complex for inhibition of proteolytic enzyme |
| US5174292A (en) * | 1991-10-11 | 1992-12-29 | Kursar Gerald H | Hand held intraocular pressure recording system |
-
1992
- 1992-12-01 TW TW081109616A patent/TW232026B/zh active
- 1992-12-01 CA CA002124788A patent/CA2124788C/en not_active Expired - Fee Related
- 1992-12-01 ES ES92925473T patent/ES2076794T3/es not_active Expired - Lifetime
- 1992-12-01 DE DE69204472T patent/DE69204472T2/de not_active Expired - Fee Related
- 1992-12-01 AU AU31512/93A patent/AU3151293A/en not_active Abandoned
- 1992-12-01 EP EP92925473A patent/EP0615542B1/en not_active Expired - Lifetime
- 1992-12-01 JP JP51031293A patent/JP3244700B2/ja not_active Expired - Fee Related
- 1992-12-01 WO PCT/US1992/010363 patent/WO1993011215A1/en not_active Ceased
- 1992-12-02 PH PH45370A patent/PH31148A/en unknown
- 1992-12-03 MX MX9206992A patent/MX9206992A/es not_active IP Right Cessation
- 1992-12-04 CN CN92115305A patent/CN1040019C/zh not_active Expired - Fee Related
-
1994
- 1994-05-16 US US08/243,024 patent/US5476608A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| MX9206992A (es) | 1993-06-01 |
| DE69204472D1 (de) | 1995-10-05 |
| EP0615542B1 (en) | 1995-08-30 |
| CN1040019C (zh) | 1998-09-30 |
| PH31148A (en) | 1998-03-20 |
| ES2076794T3 (es) | 1995-11-01 |
| WO1993011215A1 (en) | 1993-06-10 |
| CN1075331A (zh) | 1993-08-18 |
| JPH07501574A (ja) | 1995-02-16 |
| TW232026B (enExample) | 1994-10-11 |
| AU3151293A (en) | 1993-06-28 |
| US5476608A (en) | 1995-12-19 |
| EP0615542A1 (en) | 1994-09-21 |
| CA2124788C (en) | 1998-02-10 |
| CA2124788A1 (en) | 1993-06-10 |
| JP3244700B2 (ja) | 2002-01-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69204472T2 (de) | Fluessige waschmittel mit zitronensaeure, cellulase und bor-diol-komplex um proteolytisches enzym zu inhibieren. | |
| DE69206795T2 (de) | ARYLBORONSäURE ENTHALTENDE FLüSSIGWASCHMITTEL | |
| DE69217935T2 (de) | Alpha-aminoborsäurehaltige flüssige Waschmittel | |
| DE69209500T2 (de) | Gerüstsubstanzhaltige flüssigwaschmittel mit borsäure-polyolkomplex zur ptoteolytischen enzyminhibierung | |
| DE69217934T2 (de) | Peptidaldehydhaltige flüssige Waschmittel | |
| DE69717133T2 (de) | Flüssige reinigungsmittel, die proteolytisches enzyme, peptidaldehyd und kalziumionen enthalten | |
| DE69115707T2 (de) | Polyhydroxyfettsäureamid und alkylestersulfonattenside enthaltende waschmittelzusammensetzungen | |
| DE69717652T2 (de) | Flüssige reinigungsmittel, die proteolytisches enzym, peptidaldehyd und eine borsäurequelle enthalten | |
| DE69315079T2 (de) | Beta-aminoalkyl und beta-n-peptidylaminoalkylborsäure | |
| DE69118194T2 (de) | Polyhydroxyfettsäureamid und alkoxyliertes alkylsulfat enthaltende waschmittelzusammensetzungen | |
| DE69103276T2 (de) | Polyhydroxy fettsäureamide in aufheller enthaltenden flüssigen waschmittelzusammensetzungen. | |
| DE69311557T2 (de) | Protease und bestimmte beta-aminoalkylboronsauren oder -ester enthaltende flussigwaschmittel | |
| DE69113057T2 (de) | Aniontenside, polyhydroxyfettsäureamide und magnesium enthaltende waschmittelzusammensetzungen. | |
| DE69126879T2 (de) | Polyhydroxyfettsäureamidtenside zur erhöhung der enzymleistung | |
| DE69311323T2 (de) | Reinigungszusammensetzungen mit glycerolamiden | |
| DE69417755T2 (de) | Milde, flüssige oder gelförmige, protease enthaltende geschirrspülmittelzusammensetzungen | |
| DE69103531T2 (de) | Polyhydroxyfettsäureamide in zeolit/schichtsilicat als gerüststoff enthaltenden waschmitteln. | |
| DE69127449T2 (de) | Polyhydroxyfettsäureamide und ein oder mehrere zusätzliche nichtionische tenside enthaltende nichtionische tensidsysteme | |
| DE69114716T2 (de) | Polyhydroxyfettsäureamide in schmutzabweisungsmittel enthaltenden waschmittelzusammensetzungen. | |
| DE69901703T2 (de) | Geschirrspülmittelzusammentsetzungen enthaltend organische diamine | |
| DE69129152T2 (de) | Polyhydroxyfettsaureamidtenside in bleichmittelhaltigen waschmittelzusammensetzungen | |
| DE69509068T2 (de) | Langkettiges aminoxyd enthaltende, hoch schäumende, milde,flüssige oder gelförmige spülwaschmittelzusammensetzungen | |
| DE3781101T2 (de) | Reinigungsmittel, die cellulase enthalten. | |
| DE69113058T2 (de) | Polyhydroxyfettsäureamid und alkylbenzolsulfonat enthaltende waschmittelzusammensetzungen. | |
| AU8742591A (en) | Detergent compositions containing alkyl ethoxy carbozylates and polyhydroxy fatty acid amides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |