DE594491A - - Google Patents
Info
- Publication number
- DE594491A DE594491A DE594491A DE 594491 A DE594491 A DE 594491A DE 594491 A DE594491 A DE 594491A
- Authority
- DE
- Germany
- Prior art keywords
- forces
- counter electrode
- sulfide
- basic substance
- metal compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XLOMVQKBTHCTTD-UHFFFAOYSA-N zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 22
- 239000000126 substance Substances 0.000 claims description 11
- 239000011787 zinc oxide Substances 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 8
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 6
- QPLDLSVMHZLSFG-UHFFFAOYSA-N copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 5
- 239000007789 gas Substances 0.000 claims description 5
- 150000002736 metal compounds Chemical class 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 229920001225 Polyester resin Polymers 0.000 claims description 3
- 239000000853 adhesive Substances 0.000 claims description 3
- 230000001070 adhesive Effects 0.000 claims description 3
- 150000004763 sulfides Chemical class 0.000 claims description 3
- UJZJSFZBAKDUFC-UHFFFAOYSA-N Bismuth sulfide Chemical compound [S-2].[S-2].[S-2].[BiH3+3].[BiH3+3] UJZJSFZBAKDUFC-UHFFFAOYSA-N 0.000 claims description 2
- BWFPGXWASODCHM-UHFFFAOYSA-N Copper monosulfide Chemical compound [Cu]=S BWFPGXWASODCHM-UHFFFAOYSA-N 0.000 claims description 2
- XCAUINMIESBTBL-UHFFFAOYSA-N Lead(II) sulfide Chemical compound [Pb]=S XCAUINMIESBTBL-UHFFFAOYSA-N 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- REDXJYDRNCIFBQ-UHFFFAOYSA-N aluminium(3+) Chemical class [Al+3] REDXJYDRNCIFBQ-UHFFFAOYSA-N 0.000 claims description 2
- 229940056932 lead sulfide Drugs 0.000 claims description 2
- 229910052981 lead sulfide Inorganic materials 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 230000001264 neutralization Effects 0.000 claims description 2
- QXKXDIKCIPXUPL-UHFFFAOYSA-N sulfanylidenemercury Chemical compound [Hg]=S QXKXDIKCIPXUPL-UHFFFAOYSA-N 0.000 claims description 2
- 239000005751 Copper oxide Substances 0.000 claims 1
- 229910000431 copper oxide Inorganic materials 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000000203 mixture Substances 0.000 claims 1
- 239000002994 raw material Substances 0.000 claims 1
- 230000000694 effects Effects 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 239000010439 graphite Substances 0.000 description 6
- 229910002804 graphite Inorganic materials 0.000 description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 description 6
- 239000011707 mineral Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- ONDPHDOFVYQSGI-UHFFFAOYSA-N Zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 3
- 210000003491 Skin Anatomy 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 1
- 230000000274 adsorptive Effects 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- -1 brass Chemical compound 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002349 favourable Effects 0.000 description 1
- 238000003197 gene knockdown Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 238000010309 melting process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1194539B (de) | Widerstandsglasurmasse | |
| DE2637807C3 (de) | Verwendung einer Gold-Legierung für Schwachstrom-Kontakte | |
| DE3007504A1 (de) | Verfahren zur herstellung eines glasartigen ueberzugswiderstandes | |
| DE1204738B (de) | Elektrischer Schichtwiderstand | |
| EP0145924B1 (fr) | Matériau pour contacts à courant faible | |
| DE594491A (fr) | ||
| DE1113407B (de) | Verfahren zur Herstellung eines keramischen, dielektrischen Materials | |
| DE7418086U (de) | Kontakt für elektrische Schalter | |
| DE1275221B (de) | Verfahren zur Herstellung eines einen Tunneleffekt aufweisenden elektronischen Festkoerperbauelementes | |
| DE1911703C3 (de) | Widerstand-Masse | |
| DE3203893A1 (de) | Elektrischer kontakt | |
| EP0040767B1 (fr) | Utilisation de matériaux frittés, contenant du nickel-cobalt, pour contacts | |
| DE2415349A1 (de) | Sauerstoffalle und verwendung einer solchen sauerstoffalle insbesondere zur reinigung eines schutzgases | |
| DE3515742A1 (de) | Elektrode zur verwendung in elektrolytischen prozessen | |
| DE2540999C3 (de) | Elektrischer Steckkontakt mit einer Kontaktschicht aus einer Silber-Palladium-Legierung | |
| DE803919C (de) | Verfahren zur Herstellung einer Kathode einer elektrischen Entladungsroehre | |
| DE1234397B (de) | Verwendung von Gold- und/oder Silber-Legierungen als Werkstoff fuer elektrische Kontakte und Verfahren zur Herstellung von Kontakten | |
| AT127120B (de) | Kontakteinrichtung mit der Eigenschaft eines negativen Widerstandes. | |
| DE932139C (de) | Verfahren zur direkten Umwandlung der chemischen Energie des Kohlenstoffs oder brennbarer Gase in elektrische Energie auf elektro-chemischem Wege | |
| EP0163904B1 (fr) | Matière argentifère pour contacts à courant faible | |
| DE2115814A1 (de) | Widerstandspaste und verfahren zur herstellung eines elektrischen dickfilmbauelementes | |
| DE1614730C3 (de) | Schutzrohrankerkontakt | |
| AT237992B (de) | Verfahren zum chemischen Plattieren von Unterlagen mit Metallen der Platingruppe | |
| DE138135C (fr) | ||
| DD157773A1 (de) | Verfahren zur herstellung von metallpulver fuer pasten |