DE558646A - - Google Patents
Info
- Publication number
- DE558646A DE558646A DE558646A DE 558646 A DE558646 A DE 558646A DE 558646 A DE558646 A DE 558646A
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- ethylene oxide
- boiling
- glycol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 4
- 150000001298 alcohols Chemical class 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 238000009835 boiling Methods 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 210000002741 palatine tonsil Anatomy 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000004061 bleaching Methods 0.000 description 4
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000004508 fractional distillation Methods 0.000 description 3
- -1 glycol monoalkyl ether Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- JOLQKTGDSGKSKJ-UHFFFAOYSA-N 1-ethoxypropan-2-ol Chemical compound CCOCC(C)O JOLQKTGDSGKSKJ-UHFFFAOYSA-N 0.000 description 1
- LECMBPWEOVZHKN-UHFFFAOYSA-N 2-(2-chloroethoxy)ethanol Chemical compound OCCOCCCl LECMBPWEOVZHKN-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- HUWFDQSAXOIUNP-UHFFFAOYSA-N 2-butan-2-yloxyethanol Chemical compound CCC(C)OCCO HUWFDQSAXOIUNP-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- GBSGXZBOFKJGMG-UHFFFAOYSA-N 3-propan-2-yloxypropan-1-ol Chemical compound CC(C)OCCCO GBSGXZBOFKJGMG-UHFFFAOYSA-N 0.000 description 1
- QRUOTIJTSNETKW-UHFFFAOYSA-N 4-ethoxybutan-1-ol Chemical compound CCOCCCCO QRUOTIJTSNETKW-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Family
ID=
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1112636B (de) | 1957-05-17 | 1961-08-10 | Union Carbide Corp | Verfahren zur Herstellung von haertbaren Polyaetherharzen |
| DE1112637B (de) | 1956-06-01 | 1961-08-10 | Union Carbide Corp | Verfahren zur Herstellung haertbarer Polyaetherharze |
| DE1113575B (de) | 1956-06-01 | 1961-09-07 | Union Carbide Corp | Verfahren zur Herstellung haertbarer, Epoxydgruppen aufweisender Polyaetherharze |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1112637B (de) | 1956-06-01 | 1961-08-10 | Union Carbide Corp | Verfahren zur Herstellung haertbarer Polyaetherharze |
| DE1113575B (de) | 1956-06-01 | 1961-09-07 | Union Carbide Corp | Verfahren zur Herstellung haertbarer, Epoxydgruppen aufweisender Polyaetherharze |
| DE1112636B (de) | 1957-05-17 | 1961-08-10 | Union Carbide Corp | Verfahren zur Herstellung von haertbaren Polyaetherharzen |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2811480C2 (de) | Verfahren zur Gewinnung von Glyoxylsäure-hemiacetalestern aus Destillationsrückständen | |
| DE69006356T2 (de) | Verfahren zur herstellung von citral. | |
| DE2642519A1 (de) | Verfahren zur herstellung von tricyclo-eckige klammer auf 5.2.1.0 hoch 2.6 eckige klammer zu-dec-3-en- 9(8)-yl-alkyl- oder -alkenylaethern | |
| DE558646A (show.php) | ||
| DE2606830C3 (de) | Verfahren zur Herstellung von Tocopherol | |
| DE2657335B2 (de) | Verfahren zur Herstellung von Citral | |
| AT398969B (de) | 4-trans-(n-isopropyliden-amino)-cyclohexanol und verfahren zu seiner herstellung | |
| DE2640026C2 (de) | Verfahren zur Herstellung von 6,10,14-Trimethylpentadecan-2-on | |
| DE840844C (de) | Verfahren zur Herstellung eines Gemisches isomerer cyclischer AEther | |
| DE3219915A1 (de) | 2-methoxyethyl-cyclododecenylether, verfahren zu seiner herstellung sowie seine verwendung zur herstellung von 2-methoxyethyl-cyclododecylether | |
| DE1068696B (de) | Verfahren zur Herstellung von in d-Stellung verzweigten, /, ö-olefindsch-ungesättigten Ketonen | |
| DE1135491B (de) | Verfahren zur Herstellung von Trioxan | |
| AT224626B (de) | Verfahren zur Herstellung von Peroxyden | |
| CH640816A5 (en) | Process for preparing 2-vinyllactic acid | |
| CH255097A (de) | Verfahren zur Darstellung eines Aldehyds aus B-Jonon. | |
| DE2305628C2 (de) | Verfahren zur Herstellung von Piperitenon | |
| DE566033C (de) | Verfahren zur Herstellung von Alkyl- bzw. Aryloxyaethylidenestern und Acetalen | |
| AT230349B (de) | Verfahren zur Herstellung von Methylakrylat | |
| AT165306B (de) | Verfahren zur Darstellung eines Aldehyds der Summenformel C14H22O aus beta-Jonon | |
| DE967515C (de) | Verfahren zur Herstellung von wasserloeslichen Kondensationsprodukten | |
| AT205018B (de) | Verfahren zum Reinigen von insbesondere mit Methylvinylketon und Acetaldehyd verunreinigtem Acrylnitril | |
| DE819400C (de) | Verfahren zur Herstellung von 1-Phenyl-2-aminopropan bzw. seinen N-substituierten Derivaten | |
| DE863795C (de) | Verfahren zur Herstellung von 1, 2, 6-Hexantriol | |
| DE951362C (de) | Verfahren zur Herstellung von aetherartigen Kohlenstoffverbindungen | |
| DE2426863A1 (de) | Verfahren zur spaltung von cycloaliphatischen hdroperoxiden |