DE3619823A1 - Zuendkerzensteckverbindung - Google Patents
ZuendkerzensteckverbindungInfo
- Publication number
- DE3619823A1 DE3619823A1 DE19863619823 DE3619823A DE3619823A1 DE 3619823 A1 DE3619823 A1 DE 3619823A1 DE 19863619823 DE19863619823 DE 19863619823 DE 3619823 A DE3619823 A DE 3619823A DE 3619823 A1 DE3619823 A1 DE 3619823A1
- Authority
- DE
- Germany
- Prior art keywords
- spark plug
- protective cap
- socket
- insulator
- plug connector
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 230000001681 protective effect Effects 0.000 claims description 23
- 239000012212 insulator Substances 0.000 claims description 19
- 229920001971 elastomer Polymers 0.000 claims description 12
- 229910052573 porcelain Inorganic materials 0.000 claims description 12
- 239000000463 material Substances 0.000 claims description 5
- 229920002050 silicone resin Polymers 0.000 claims description 4
- 229920001187 thermosetting polymer Polymers 0.000 claims description 4
- 239000000853 adhesive Substances 0.000 claims description 2
- 230000001070 adhesive effect Effects 0.000 claims description 2
- 239000000806 elastomer Substances 0.000 claims description 2
- 238000000465 moulding Methods 0.000 claims description 2
- 238000009413 insulation Methods 0.000 description 12
- 238000007789 sealing Methods 0.000 description 10
- 230000015556 catabolic process Effects 0.000 description 5
- 229920002379 silicone rubber Polymers 0.000 description 4
- 239000004945 silicone rubber Substances 0.000 description 4
- POIUWJQBRNEFGX-XAMSXPGMSA-N cathelicidin Chemical compound C([C@@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(O)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C)C1=CC=CC=C1 POIUWJQBRNEFGX-XAMSXPGMSA-N 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000006978 adaptation Effects 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 239000013536 elastomeric material Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 230000001050 lubricating effect Effects 0.000 description 2
- 229920002943 EPDM rubber Polymers 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01T—SPARK GAPS; OVERVOLTAGE ARRESTERS USING SPARK GAPS; SPARKING PLUGS; CORONA DEVICES; GENERATING IONS TO BE INTRODUCED INTO NON-ENCLOSED GASES
- H01T13/00—Sparking plugs
- H01T13/02—Details
- H01T13/04—Means providing electrical connection to sparking plugs
Landscapes
- Spark Plugs (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1985087621U JPS61204386U (enExample) | 1985-06-12 | 1985-06-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3619823A1 true DE3619823A1 (de) | 1986-12-18 |
Family
ID=13920040
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863619823 Granted DE3619823A1 (de) | 1985-06-12 | 1986-06-12 | Zuendkerzensteckverbindung |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4701662A (enExample) |
| JP (1) | JPS61204386U (enExample) |
| DE (1) | DE3619823A1 (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3835984A1 (de) * | 1987-11-13 | 1989-05-24 | Prestolite Wire Corp | Starre huelle fuer ein zuendkerzenkabel und den damit verbundenen schuh |
| EP0324552A1 (en) * | 1988-01-09 | 1989-07-19 | LUCAS INDUSTRIES public limited company | Spark plug connector |
| EP0388024A1 (en) * | 1989-03-13 | 1990-09-19 | General Motors Corporation | Ignition cable terminal assembly |
| DE4134274A1 (de) * | 1991-10-17 | 1993-04-22 | Reinshagen Kabelwerk Gmbh | Zuendkerzenstecker |
| DE4214816C1 (de) * | 1992-05-05 | 1993-10-21 | Daimler Benz Ag | Zündkerzenstecker für einen Verbrennungsmotor |
| EP0660474A1 (en) * | 1993-12-23 | 1995-06-28 | General Motors Corporation | Ignition cable assembly |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH06267639A (ja) * | 1993-03-12 | 1994-09-22 | Sumitomo Wiring Syst Ltd | 内燃機関用プラグキャップ装置 |
| JPH0765890A (ja) * | 1993-08-26 | 1995-03-10 | Sumitomo Wiring Syst Ltd | コネクタ |
| US6302712B1 (en) * | 1997-08-25 | 2001-10-16 | Robert J. Delsole | Spark plug wire boot securing system |
| US6475002B2 (en) * | 1997-08-25 | 2002-11-05 | Robert Delsole | Spark plug wire boot securing system |
| ITUB20161242A1 (it) * | 2016-03-02 | 2017-09-02 | Eldor Corp Spa | Prolunga siliconica per una bobina di accensione per motori endotermici, bobina di accensione contenente detta prolunga siliconica e metodo di assemblaggio di detta bobina di accensione |
| US10205306B2 (en) * | 2016-09-07 | 2019-02-12 | Ngk Spark Plug Co., Ltd. | Method for producing spark plug |
| DE102018108292B4 (de) * | 2017-11-17 | 2023-05-11 | Borgwarner Ludwigsburg Gmbh | Verbindungsstecker zum Anschließen einer Zündspule an eine Zündkerze sowie Schutzrohr für einen Verbindungsstecker |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1287451A (fr) * | 1961-01-31 | 1962-03-16 | Perfectionnements aux têtes de connexion pour bougies d'allumage | |
| US3716038A (en) * | 1971-03-31 | 1973-02-13 | Motorola Inc | High voltage coil boot |
| GB2013989A (en) * | 1978-02-03 | 1979-08-15 | Nissan Motor | Device for electrically connecting spark plug to high-voltage cable |
| DE3601027A1 (de) * | 1985-01-22 | 1986-07-24 | Volkswagen Ag, 38440 Wolfsburg | Zusatzisolator fuer eine zuendkerze |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3002126A (en) * | 1957-06-20 | 1961-09-26 | Indufi S A De Participations | Mechanical members connected to form an electrical circuit |
| JPS592178A (ja) * | 1982-06-29 | 1984-01-07 | Fujitsu Ltd | 投票システムに用いる端末装置 |
-
1985
- 1985-06-12 JP JP1985087621U patent/JPS61204386U/ja active Pending
-
1986
- 1986-06-06 US US06/871,277 patent/US4701662A/en not_active Expired - Lifetime
- 1986-06-12 DE DE19863619823 patent/DE3619823A1/de active Granted
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1287451A (fr) * | 1961-01-31 | 1962-03-16 | Perfectionnements aux têtes de connexion pour bougies d'allumage | |
| US3716038A (en) * | 1971-03-31 | 1973-02-13 | Motorola Inc | High voltage coil boot |
| GB2013989A (en) * | 1978-02-03 | 1979-08-15 | Nissan Motor | Device for electrically connecting spark plug to high-voltage cable |
| DE3601027A1 (de) * | 1985-01-22 | 1986-07-24 | Volkswagen Ag, 38440 Wolfsburg | Zusatzisolator fuer eine zuendkerze |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3835984A1 (de) * | 1987-11-13 | 1989-05-24 | Prestolite Wire Corp | Starre huelle fuer ein zuendkerzenkabel und den damit verbundenen schuh |
| EP0324552A1 (en) * | 1988-01-09 | 1989-07-19 | LUCAS INDUSTRIES public limited company | Spark plug connector |
| EP0388024A1 (en) * | 1989-03-13 | 1990-09-19 | General Motors Corporation | Ignition cable terminal assembly |
| DE4134274A1 (de) * | 1991-10-17 | 1993-04-22 | Reinshagen Kabelwerk Gmbh | Zuendkerzenstecker |
| DE4214816C1 (de) * | 1992-05-05 | 1993-10-21 | Daimler Benz Ag | Zündkerzenstecker für einen Verbrennungsmotor |
| EP0660474A1 (en) * | 1993-12-23 | 1995-06-28 | General Motors Corporation | Ignition cable assembly |
Also Published As
| Publication number | Publication date |
|---|---|
| US4701662A (en) | 1987-10-20 |
| JPS61204386U (enExample) | 1986-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69705178T2 (de) | Zündspulenvorrichtung für Brennkraftmaschine | |
| DE3619823A1 (de) | Zuendkerzensteckverbindung | |
| DE102005043044B4 (de) | Zündvorrichtung für einen Verbrennungsmotor | |
| DE3211262C2 (de) | Glühkerze zur Verwendung in einem Dieselmotor und Verfahren zu ihrer Herstellung | |
| DE102005030890A1 (de) | Zündvorrichtung für eine Brennkraftmaschine | |
| DE2631969A1 (de) | Vorrichtung zur dielektrischen spannungsentlastung an einem hochspannungskabelendverschluss | |
| DE2261103A1 (de) | Zuendkerzenstecker fuer verbrennungsmotoren | |
| DE3110660C2 (de) | Garnitur für das Ende eines Mittelspannnungs- oder Hochspannunskabels | |
| DE202011050966U1 (de) | Zündkerzenstecker | |
| DE921511C (de) | Fluessigkeitsdichte Durchfuehrung fuer elektrische Leiter | |
| DE4240646A1 (de) | Zündkerze für Brennkraftmaschinen | |
| DE3021845A1 (de) | Kabelstecker | |
| DE69033410T2 (de) | Zündkerzstecker | |
| DE19623399A1 (de) | Zündung für Brennkraftmaschinen | |
| EP0139908B1 (de) | Zur Zündverteilung in einer Brennkraftmaschine bestimmter Verteilerläufer | |
| DE2015988C3 (de) | Endenabschluß für mit einem thermoplastischen oder thermoelastischen Kunststoffisolierte Starkstromkabel | |
| DE3024667C2 (de) | Zündkerzenstecker | |
| DE1105018B (de) | Verfahren zur Herstellung einer dichten Verbindung zwischen einem Giessharzisolierkoerper und einem darin eingegossenen starken Durchfuehrungsbolzen bei einer Hochspannungsdurchfuehrung | |
| DE2739600A1 (de) | Kabelendverschluss | |
| DE102020200072A1 (de) | Isolator für eine Zündkerze und Zündkerze | |
| DE432999C (de) | Zuendkerze | |
| DE10256802B3 (de) | Stabzündspule | |
| DE2922836C3 (de) | Vorrichtung zum Verbinden von Leitern eines Mittelspannungs- oder Hochspannungsenergieversorgungsnetzes und zum Isolieren der Verbindungsstelle | |
| DE850968C (de) | Vollstaendig abgeschirmte elektrische Zuendanlage fuer Brennkraftmaschinen | |
| DE19849505A1 (de) | Hochspannungsverbindungselement |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |