DE3602731C2 - Zusammensetzung zur Erzeugung von Stickstoffgas - Google Patents
Zusammensetzung zur Erzeugung von StickstoffgasInfo
- Publication number
- DE3602731C2 DE3602731C2 DE3602731A DE3602731A DE3602731C2 DE 3602731 C2 DE3602731 C2 DE 3602731C2 DE 3602731 A DE3602731 A DE 3602731A DE 3602731 A DE3602731 A DE 3602731A DE 3602731 C2 DE3602731 C2 DE 3602731C2
- Authority
- DE
- Germany
- Prior art keywords
- composition
- amount
- azide
- composition according
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 title claims description 148
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 title claims description 21
- 229910001873 dinitrogen Inorganic materials 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title description 2
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 claims description 53
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical group [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 claims description 50
- 238000002485 combustion reaction Methods 0.000 claims description 37
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 32
- 229910052783 alkali metal Inorganic materials 0.000 claims description 29
- 229910044991 metal oxide Inorganic materials 0.000 claims description 28
- 150000004706 metal oxides Chemical class 0.000 claims description 28
- -1 alkali metal azide Chemical class 0.000 claims description 25
- 150000001540 azides Chemical class 0.000 claims description 17
- 239000007800 oxidant agent Substances 0.000 claims description 17
- 150000001340 alkali metals Chemical class 0.000 claims description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 7
- 231100000331 toxic Toxicity 0.000 claims description 6
- 230000002588 toxic effect Effects 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- 239000000356 contaminant Substances 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 239000012535 impurity Substances 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 239000010936 titanium Substances 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims 4
- 239000008247 solid mixture Substances 0.000 claims 3
- 230000001133 acceleration Effects 0.000 claims 2
- 229910000480 nickel oxide Inorganic materials 0.000 claims 1
- 239000007789 gas Substances 0.000 description 29
- 239000008188 pellet Substances 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 12
- 238000009472 formulation Methods 0.000 description 11
- 238000000034 method Methods 0.000 description 11
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 239000003380 propellant Substances 0.000 description 9
- 239000004604 Blowing Agent Substances 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 239000003513 alkali Substances 0.000 description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- 229910006404 SnO 2 Inorganic materials 0.000 description 3
- 229910010413 TiO 2 Inorganic materials 0.000 description 3
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- 239000000446 fuel Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 229910003455 mixed metal oxide Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 229910001485 alkali metal perchlorate Inorganic materials 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000005453 pelletization Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 238000005979 thermal decomposition reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- SPAGIJMPHSUYSE-UHFFFAOYSA-N Magnesium peroxide Chemical compound [Mg+2].[O-][O-] SPAGIJMPHSUYSE-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001964 alkaline earth metal nitrate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000000975 co-precipitation Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- KAGOZRSGIYZEKW-UHFFFAOYSA-N cobalt(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Co+3].[Co+3] KAGOZRSGIYZEKW-UHFFFAOYSA-N 0.000 description 1
- 230000019771 cognition Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical compound [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910001510 metal chloride Inorganic materials 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- 229910001487 potassium perchlorate Inorganic materials 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06D—MEANS FOR GENERATING SMOKE OR MIST; GAS-ATTACK COMPOSITIONS; GENERATION OF GAS FOR BLASTING OR PROPULSION (CHEMICAL PART)
- C06D5/00—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets
- C06D5/06—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets by reaction of two or more solids
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/696,285 US4604151A (en) | 1985-01-30 | 1985-01-30 | Method and compositions for generating nitrogen gas |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3602731A1 DE3602731A1 (de) | 1986-10-30 |
| DE3602731C2 true DE3602731C2 (de) | 1994-08-18 |
Family
ID=24796438
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3602731A Expired - Lifetime DE3602731C2 (de) | 1985-01-30 | 1986-01-30 | Zusammensetzung zur Erzeugung von Stickstoffgas |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4604151A (enExample) |
| JP (1) | JPS61219785A (enExample) |
| DE (1) | DE3602731C2 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4318883A1 (de) * | 1992-06-05 | 1993-12-09 | Trw Inc | Mehrfachgeschichtete Gaserzeugungsscheibe zur Verwendung in Gasgeneratoren |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4698107A (en) * | 1986-12-24 | 1987-10-06 | Trw Automotive Products, Inc. | Gas generating material |
| US4734141A (en) * | 1987-03-27 | 1988-03-29 | Hercules Incorporated | Crash bag propellant compositions for generating high quality nitrogen gas |
| US4758287A (en) * | 1987-06-15 | 1988-07-19 | Talley Industries, Inc. | Porous propellant grain and method of making same |
| US4920743A (en) * | 1988-07-25 | 1990-05-01 | Hercules Incorporated | Crash bag propellant composition and method for generating nitrogen gas |
| US4929290A (en) * | 1988-07-25 | 1990-05-29 | Hercules Incorporated | Crash bag propellant composition and method for generating nitrogen gas |
| US4948439A (en) * | 1988-12-02 | 1990-08-14 | Automotive Systems Laboratory, Inc. | Composition and process for inflating a safety crash bag |
| US5286054A (en) * | 1989-12-04 | 1994-02-15 | Talley Automotive Products, Inc. | Aspirating/venting motor vehicle passenger airbag module |
| US5074940A (en) * | 1990-06-19 | 1991-12-24 | Nippon Oil And Fats Co., Ltd. | Composition for gas generating |
| US5223184A (en) * | 1990-08-06 | 1993-06-29 | Morton International, Inc. | Enhanced thermal and ignition stability azide gas generant |
| US5019220A (en) * | 1990-08-06 | 1991-05-28 | Morton International, Inc. | Process for making an enhanced thermal and ignition stability azide gas generant |
| US5387296A (en) * | 1991-08-23 | 1995-02-07 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| US5143567A (en) * | 1991-08-23 | 1992-09-01 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| DE4218531C1 (enExample) * | 1991-10-11 | 1993-07-15 | Bayern-Chemie Gesellschaft Fuer Flugchemische Antriebe Mbh, 8261 Aschau, De | |
| EP0584899A3 (en) * | 1992-08-05 | 1995-08-02 | Morton Int Inc | Approach by incorporating additives into azide-based gas-generating compositions to adjust the melting point of slag and the rate of combustion. |
| US5382050A (en) * | 1993-04-08 | 1995-01-17 | Trw Inc. | Gas generator for vehicle occupant restraint |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
| US5429691A (en) * | 1993-08-10 | 1995-07-04 | Thiokol Corporation | Thermite compositions for use as gas generants comprising basic metal carbonates and/or basic metal nitrates |
| US5439537A (en) * | 1993-08-10 | 1995-08-08 | Thiokol Corporation | Thermite compositions for use as gas generants |
| US5401340A (en) * | 1993-08-10 | 1995-03-28 | Thiokol Corporation | Borohydride fuels in gas generant compositions |
| US20050067074A1 (en) | 1994-01-19 | 2005-03-31 | Hinshaw Jerald C. | Metal complexes for use as gas generants |
| US6969435B1 (en) | 1994-01-19 | 2005-11-29 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US5725699A (en) * | 1994-01-19 | 1998-03-10 | Thiokol Corporation | Metal complexes for use as gas generants |
| JP4109317B2 (ja) * | 1994-01-19 | 2008-07-02 | アライアント・テクシステムズ・インコーポレーテッド | ガス発生剤として用いる金属錯体 |
| DE4402047C2 (de) * | 1994-01-25 | 1995-12-07 | Bayern Chemie Gmbh Flugchemie | Verfahren zur Herstellung einer gaserzeugenden Masse |
| DE4423088A1 (de) * | 1994-07-01 | 1996-01-04 | Temic Bayern Chem Airbag Gmbh | Gaserzeugendes, azidfreies Stoffgemisch |
| US5593640A (en) * | 1995-06-07 | 1997-01-14 | Ball Corporation | Portable hydrogen generator |
| DE749946T1 (de) * | 1995-06-22 | 1997-09-04 | Nippon Koki Kk | Gaserzeugende Zusammensetzung |
| US5817972A (en) * | 1995-11-13 | 1998-10-06 | Trw Inc. | Iron oxide as a coolant and residue former in an organic propellant |
| RU2105750C1 (ru) * | 1996-02-09 | 1998-02-27 | Предприятие "Источник" | Газогенерирующий состав |
| US6007736A (en) * | 1996-05-15 | 1999-12-28 | Be Intellectual Property | Oxygen generating compositions catalyzed by copper and nickel oxides |
| DE19742203A1 (de) * | 1997-09-24 | 1999-03-25 | Trw Airbag Sys Gmbh | Partikelfreies gaserzeugendes Gemisch |
| US6274093B1 (en) | 1998-08-06 | 2001-08-14 | Ball Aerospace & Technologies Corp. | Self-regulating hydrogen generator |
| FR2818636B1 (fr) | 2000-12-22 | 2003-02-28 | Poudres & Explosifs Ste Nale | Compositions pyrotechniques generatrices de gaz a liant hydrocarbone et procede de fabrication en continu |
| US20040094250A1 (en) * | 2002-11-14 | 2004-05-20 | Estes-Cox Corporation | Composite propellant compositions |
| RU2243959C1 (ru) * | 2003-05-27 | 2005-01-10 | Российская Федерация, от имени которой выступает государственный заказчик - Министерство Российской Федерации по атомной энергии, Федеральное государственное унитарное предприятие " федеральный ядерный центр - Всероссийский научно-исследовательский институт экспериментальной физики" | Пиротехнический состав для получения азота |
| RU2694773C1 (ru) * | 2018-09-21 | 2019-07-16 | Естиконде Инвестмент Лимитед | Азотогенерирующий состав для пожаротушения и способ его получения |
Family Cites Families (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3715131A (en) * | 1971-06-04 | 1973-02-06 | Hercules Inc | Chemical gas generating device for an automobile safety system |
| US3785674A (en) * | 1971-06-14 | 1974-01-15 | Rocket Research Corp | Crash restraint nitrogen generating inflation system |
| US3741585A (en) * | 1971-06-29 | 1973-06-26 | Thiokol Chemical Corp | Low temperature nitrogen gas generating composition |
| US3814694A (en) * | 1971-08-09 | 1974-06-04 | Aerojet General Co | Non-toxic gas generation |
| US4157648A (en) * | 1971-11-17 | 1979-06-12 | The Dow Chemical Company | Composition and method for inflation of passive restraint systems |
| CA981465A (en) * | 1971-11-17 | 1976-01-13 | Richard L. Brennan | Composition and method for inflation of passive restraint systems |
| US3779823A (en) * | 1971-11-18 | 1973-12-18 | R Price | Abrasion resistant gas generating compositions for use in inflating safety crash bags |
| JPS4876485A (enExample) * | 1971-12-02 | 1973-10-15 | ||
| US3755182A (en) * | 1972-01-27 | 1973-08-28 | Mine Safety Appliances Co | Nitrogen generating compositions |
| US3904221A (en) * | 1972-05-19 | 1975-09-09 | Asahi Chemical Ind | Gas generating system for the inflation of a protective bag |
| DE2236175C3 (de) * | 1972-07-24 | 1975-07-10 | Bayern-Chemie Gesellschaft Fuer Flugchemische Antriebe Mbh, 8261 Aschau | Treibmittel zur Erzeugung ungiftiger Treibgase |
| GB1391310A (en) * | 1972-07-24 | 1975-04-23 | Canadian Ind | Gas generating compositions |
| US3773947A (en) * | 1972-10-13 | 1973-11-20 | Us Navy | Process of generating nitrogen using metal azide |
| FR2228043B1 (enExample) * | 1972-10-17 | 1977-03-04 | Poudres & Explosifs Ste Nale | |
| US3920575A (en) * | 1973-03-03 | 1975-11-18 | Asahi Chemical Ind | Gas generating composition and method of preparing compression molded articles therefrom |
| US3865660A (en) * | 1973-03-12 | 1975-02-11 | Thiokol Chemical Corp | Non-toxic, non-corrosive, odorless gas generating composition |
| US3931040A (en) * | 1973-08-09 | 1976-01-06 | United Technologies Corporation | Gas generating composition |
| US3901747A (en) * | 1973-09-10 | 1975-08-26 | Allied Chem | Pyrotechnic composition with combined binder-coolant |
| GB1443547A (en) * | 1973-12-17 | 1976-07-21 | Canadian Ind | Metal oxide/azide gas generating compositions |
| FR2278662A1 (fr) * | 1974-02-01 | 1976-02-13 | Aerojet General Co | Composition produisant des gaz non toxiques par reaction chimique |
| DE2551921A1 (de) * | 1974-11-29 | 1976-08-12 | Eaton Corp | Gaserzeugendes azid-verbindungsgemisch |
| US4066415A (en) * | 1975-02-03 | 1978-01-03 | Nippon Oil And Fats Co., Ltd. | Gas generator for inflatable life raft |
| GB1520497A (en) * | 1975-04-23 | 1978-08-09 | Daicel Ltd | Gas-generating agent for air bag |
| GB1590023A (en) * | 1976-08-24 | 1981-05-28 | Johnson Matthey Co Ltd | Catalytic decomposition of nitrogen oxides |
| US4244758A (en) * | 1978-05-15 | 1981-01-13 | Allied Chemical Corporation | Ignition enhancer coating compositions for azide propellant |
| US4339288A (en) * | 1978-05-16 | 1982-07-13 | Peter Stang | Gas generating composition |
| US4296084A (en) * | 1979-10-29 | 1981-10-20 | Thiokol Corporation | Method of and apparatus for gas generation |
| US4203787A (en) * | 1978-12-18 | 1980-05-20 | Thiokol Corporation | Pelletizable, rapid and cool burning solid nitrogen gas generant |
| US4390380A (en) * | 1980-03-31 | 1983-06-28 | Camp Albert T | Coated azide gas generating composition |
| CA1146756A (en) * | 1980-06-20 | 1983-05-24 | Lechoslaw A.M. Utracki | Multi-ingredient gas generants |
| JPS5753216A (en) * | 1980-09-16 | 1982-03-30 | Tetsuro Hayakawa | Filtering method |
| JPS5834438A (ja) * | 1981-08-24 | 1983-02-28 | Seiko Instr & Electronics Ltd | エレクトロクロミツク表示装置 |
-
1985
- 1985-01-30 US US06/696,285 patent/US4604151A/en not_active Expired - Lifetime
-
1986
- 1986-01-30 JP JP61016971A patent/JPS61219785A/ja active Granted
- 1986-01-30 DE DE3602731A patent/DE3602731C2/de not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4318883A1 (de) * | 1992-06-05 | 1993-12-09 | Trw Inc | Mehrfachgeschichtete Gaserzeugungsscheibe zur Verwendung in Gasgeneratoren |
Also Published As
| Publication number | Publication date |
|---|---|
| US4604151A (en) | 1986-08-05 |
| DE3602731A1 (de) | 1986-10-30 |
| JPH0459279B2 (enExample) | 1992-09-21 |
| JPS61219785A (ja) | 1986-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3602731C2 (de) | Zusammensetzung zur Erzeugung von Stickstoffgas | |
| DE69004787T2 (de) | Gaserzeugende Azid enthaltende Zusammensetzung für aufblasbare Vorrichtungen. | |
| DE69106667T2 (de) | Gaserzeugende, azidfreie Zusammensetzung, die leicht zu filternde Verbrennungsprodukte ergibt. | |
| DE4412871C2 (de) | Zusammensetzungen für Gasgeneratoren | |
| DE69216532T2 (de) | Azidfreie gaserzeugende Zusammensetzungen | |
| DE69220412T2 (de) | Verfahren zur Kontrolle der Menge von Stickoxiden im generierten Gas für Airbags | |
| DE69001893T2 (de) | Zusammensetzung und Verfahren zum Aufblasen eines Sicherheitsluftsackes. | |
| DE3733177C1 (de) | Gaserzeugende Masse | |
| DE69730202T2 (de) | Azidfreie, gaserzeugende zusammensetzungen | |
| DE69423631T2 (de) | Thermit-zusammensetzungen zur verwendung als gaserzeugende körper | |
| DE2551921C2 (enExample) | ||
| EP0666248B1 (de) | Gaserzeugende Mischung | |
| DE69609791T2 (de) | Katalysator enthaltende, azidfreie gaserzeugende zusammensetzungen | |
| DE2439771A1 (de) | Pyrotechnisches gemisch | |
| DE2229039A1 (de) | Stickstofferzeugendes Aufblassystem zur Stoßdammung | |
| DE4120539A1 (de) | Zusammensetzung zur gaserzeugung fuer airbags | |
| DE2459667B2 (de) | Verfahren zur herstellung einer gaserzeugungszusammensetzung | |
| DE69323410T2 (de) | Gaserzeugungsmittel für airbags | |
| DE19646931B4 (de) | Eisenoxid als Kühlmittel und Restebildner in einer organischen gaserzeugenden Zusammensetzung | |
| US5656793A (en) | Gas generator compositions | |
| DE3733176C2 (enExample) | ||
| DE10034287C2 (de) | Gaserzeugende Zusammensetzung, die Guanylharnstoff-Dinitramid aufweist und deren Verwendung | |
| DE4218531C1 (enExample) | ||
| DE3935869C1 (enExample) | ||
| EP1162183B1 (de) | Anzündmischung zur Verwendung in Gasgeneratoren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |