DE3442281A1 - Verfahren zur herstellung von tetrafluorethylenpolymerisathaltigen, flammwidrigen polycarbonatformmassen - Google Patents
Verfahren zur herstellung von tetrafluorethylenpolymerisathaltigen, flammwidrigen polycarbonatformmassenInfo
- Publication number
- DE3442281A1 DE3442281A1 DE19843442281 DE3442281A DE3442281A1 DE 3442281 A1 DE3442281 A1 DE 3442281A1 DE 19843442281 DE19843442281 DE 19843442281 DE 3442281 A DE3442281 A DE 3442281A DE 3442281 A1 DE3442281 A1 DE 3442281A1
- Authority
- DE
- Germany
- Prior art keywords
- weight
- component
- amounts
- free
- polymers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 24
- 239000004417 polycarbonate Substances 0.000 title claims description 24
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical compound FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 title claims description 24
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 229920000642 polymer Polymers 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 28
- 239000000839 emulsion Substances 0.000 claims description 24
- 229920000578 graft copolymer Polymers 0.000 claims description 24
- 238000000465 moulding Methods 0.000 claims description 20
- -1 N-substituted maleimide Chemical class 0.000 claims description 17
- 229920001971 elastomer Polymers 0.000 claims description 17
- 239000005060 rubber Substances 0.000 claims description 17
- 150000001447 alkali salts Chemical class 0.000 claims description 14
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 239000002245 particle Substances 0.000 claims description 11
- 239000003063 flame retardant Substances 0.000 claims description 8
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 7
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical class COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 6
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 5
- 238000002156 mixing Methods 0.000 claims description 5
- 229920001169 thermoplastic Polymers 0.000 claims description 5
- 239000004416 thermosoftening plastic Substances 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 3
- 150000003440 styrenes Chemical class 0.000 claims description 3
- 239000000975 dye Substances 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 230000009477 glass transition Effects 0.000 claims description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000049 pigment Substances 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- 230000000996 additive effect Effects 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 description 20
- 239000011734 sodium Substances 0.000 description 20
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 17
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 9
- 239000000178 monomer Substances 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- 229920001343 polytetrafluoroethylene Chemical class 0.000 description 6
- 239000004810 polytetrafluoroethylene Chemical class 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 125000005250 alkyl acrylate group Chemical group 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 238000012545 processing Methods 0.000 description 5
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 4
- 150000001993 dienes Chemical class 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- 239000005062 Polybutadiene Substances 0.000 description 3
- 229940106691 bisphenol a Drugs 0.000 description 3
- 238000005345 coagulation Methods 0.000 description 3
- 230000015271 coagulation Effects 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 230000007547 defect Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 229920002857 polybutadiene Polymers 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000000975 co-precipitation Methods 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- DRXDBDATOLWSNZ-UHFFFAOYSA-L dilithium;dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [Li+].[Li+].[O-]P([O-])(=O)C1=CC=CC=C1 DRXDBDATOLWSNZ-UHFFFAOYSA-L 0.000 description 2
- 238000007720 emulsion polymerization reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- 239000004816 latex Substances 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000003009 phosphonic acids Chemical class 0.000 description 2
- 229940098424 potassium pyrophosphate Drugs 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 2
- WVAFEFUPWRPQSY-UHFFFAOYSA-N 1,2,3-tris(ethenyl)benzene Chemical compound C=CC1=CC=CC(C=C)=C1C=C WVAFEFUPWRPQSY-UHFFFAOYSA-N 0.000 description 1
- OEVVKKAVYQFQNV-UHFFFAOYSA-N 1-ethenyl-2,4-dimethylbenzene Chemical compound CC1=CC=C(C=C)C(C)=C1 OEVVKKAVYQFQNV-UHFFFAOYSA-N 0.000 description 1
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 1
- BJELTSYBAHKXRW-UHFFFAOYSA-N 2,4,6-triallyloxy-1,3,5-triazine Chemical compound C=CCOC1=NC(OCC=C)=NC(OCC=C)=N1 BJELTSYBAHKXRW-UHFFFAOYSA-N 0.000 description 1
- BPRYUXCVCCNUFE-UHFFFAOYSA-N 2,4,6-trimethylphenol Chemical compound CC1=CC(C)=C(O)C(C)=C1 BPRYUXCVCCNUFE-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- ZPDKTVJZFVWAOC-UHFFFAOYSA-N 4-hydroxy-1,3,2,4lambda5-dioxathiaphosphetane 4-oxide Chemical class S1OP(O1)(O)=O ZPDKTVJZFVWAOC-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 125000003358 C2-C20 alkenyl group Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- 229920002943 EPDM rubber Polymers 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- GEXAHMBWDONKHL-UHFFFAOYSA-M P(OCCC1=CC=CC=C1)([O-])=O.[K+] Chemical compound P(OCCC1=CC=CC=C1)([O-])=O.[K+] GEXAHMBWDONKHL-UHFFFAOYSA-M 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- CHZYPMDQTIFXNV-UHFFFAOYSA-M [K+].COP([O-])=O Chemical compound [K+].COP([O-])=O CHZYPMDQTIFXNV-UHFFFAOYSA-M 0.000 description 1
- PWSVBRPNQZEPAS-UHFFFAOYSA-M [K+].[O-]P(=O)Oc1ccc(Cl)cc1 Chemical compound [K+].[O-]P(=O)Oc1ccc(Cl)cc1 PWSVBRPNQZEPAS-UHFFFAOYSA-M 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 229920003244 diene elastomer Polymers 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- BJZIJOLEWHWTJO-UHFFFAOYSA-H dipotassium;hexafluorozirconium(2-) Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[K+].[K+].[Zr+4] BJZIJOLEWHWTJO-UHFFFAOYSA-H 0.000 description 1
- KLKYJMASALXYQR-UHFFFAOYSA-L dipotassium;methyl-dioxido-oxo-$l^{5}-phosphane Chemical compound [K+].[K+].CP([O-])([O-])=O KLKYJMASALXYQR-UHFFFAOYSA-L 0.000 description 1
- RXCBCUJUGULOGC-UHFFFAOYSA-H dipotassium;tetrafluorotitanium;difluoride Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[K+].[K+].[Ti+4] RXCBCUJUGULOGC-UHFFFAOYSA-H 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000004761 hexafluorosilicates Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910001389 inorganic alkali salt Inorganic materials 0.000 description 1
- 235000000396 iron Nutrition 0.000 description 1
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910001386 lithium phosphate Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 239000012778 molding material Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- OQZCJRJRGMMSGK-UHFFFAOYSA-M potassium metaphosphate Chemical compound [K+].[O-]P(=O)=O OQZCJRJRGMMSGK-UHFFFAOYSA-M 0.000 description 1
- 229940099402 potassium metaphosphate Drugs 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- LVTHXRLARFLXNR-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F LVTHXRLARFLXNR-UHFFFAOYSA-M 0.000 description 1
- GBEAPGVTFRUJRU-UHFFFAOYSA-M potassium;2,3,4,5,6-pentachlorobenzoate Chemical compound [K+].[O-]C(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl GBEAPGVTFRUJRU-UHFFFAOYSA-M 0.000 description 1
- DRPLRPSXUUSFOB-UHFFFAOYSA-M potassium;2,4,5-trichlorobenzenesulfonate Chemical compound [K+].[O-]S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl DRPLRPSXUUSFOB-UHFFFAOYSA-M 0.000 description 1
- WEAGBZRZUQFQAU-UHFFFAOYSA-M potassium;2,4,6-trichlorobenzoate Chemical compound [K+].[O-]C(=O)C1=C(Cl)C=C(Cl)C=C1Cl WEAGBZRZUQFQAU-UHFFFAOYSA-M 0.000 description 1
- IDCFOFYKKXBZRS-UHFFFAOYSA-M potassium;2,4-dichlorobenzoate Chemical compound [K+].[O-]C(=O)C1=CC=C(Cl)C=C1Cl IDCFOFYKKXBZRS-UHFFFAOYSA-M 0.000 description 1
- IUTAHLUWHZYCKB-UHFFFAOYSA-M potassium;2,5-dichlorobenzenesulfonate Chemical compound [K+].[O-]S(=O)(=O)C1=CC(Cl)=CC=C1Cl IUTAHLUWHZYCKB-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229940005657 pyrophosphoric acid Drugs 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229940083542 sodium Drugs 0.000 description 1
- 229960003339 sodium phosphate Drugs 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000009757 thermoplastic moulding Methods 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- TWQULNDIKKJZPH-UHFFFAOYSA-K trilithium;phosphate Chemical compound [Li+].[Li+].[Li+].[O-]P([O-])([O-])=O TWQULNDIKKJZPH-UHFFFAOYSA-K 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 238000005199 ultracentrifugation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0008—Organic ingredients according to more than one of the "one dot" groups of C08K5/01 - C08K5/59
- C08K5/0066—Flame-proofing or flame-retarding additives
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843442281 DE3442281A1 (de) | 1984-11-20 | 1984-11-20 | Verfahren zur herstellung von tetrafluorethylenpolymerisathaltigen, flammwidrigen polycarbonatformmassen |
| CA000494361A CA1241140A (en) | 1984-11-20 | 1985-10-31 | Process for the preparation of flame-resistant polycarbonate moulding compositions containing tetrafluoroethylene polymers |
| DE8585114237T DE3577208D1 (de) | 1984-11-20 | 1985-11-08 | Verfahren zur herstellung von tetrafluorethylenpolymerisathaltigen, flammwidrigen polycarbonatformmassen. |
| EP85114237A EP0182226B1 (de) | 1984-11-20 | 1985-11-08 | Verfahren zur Herstellung von Tetrafluorethylenpolymerisathaltigen, flammwidrigen Polycarbonatformmassen |
| US06/797,531 US4649168A (en) | 1984-11-20 | 1985-11-13 | Process for the preparation of flame-resistant polycarbonate moulding compositions containing tetrafluoroethylene polymers |
| JP60256829A JPS61127759A (ja) | 1984-11-20 | 1985-11-18 | 難燃性ポリカーボネート成形組成物 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843442281 DE3442281A1 (de) | 1984-11-20 | 1984-11-20 | Verfahren zur herstellung von tetrafluorethylenpolymerisathaltigen, flammwidrigen polycarbonatformmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3442281A1 true DE3442281A1 (de) | 1986-05-22 |
Family
ID=6250691
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843442281 Withdrawn DE3442281A1 (de) | 1984-11-20 | 1984-11-20 | Verfahren zur herstellung von tetrafluorethylenpolymerisathaltigen, flammwidrigen polycarbonatformmassen |
| DE8585114237T Expired - Lifetime DE3577208D1 (de) | 1984-11-20 | 1985-11-08 | Verfahren zur herstellung von tetrafluorethylenpolymerisathaltigen, flammwidrigen polycarbonatformmassen. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8585114237T Expired - Lifetime DE3577208D1 (de) | 1984-11-20 | 1985-11-08 | Verfahren zur herstellung von tetrafluorethylenpolymerisathaltigen, flammwidrigen polycarbonatformmassen. |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4649168A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0182226B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS61127759A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1241140A (cg-RX-API-DMAC10.html) |
| DE (2) | DE3442281A1 (cg-RX-API-DMAC10.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4024667A1 (de) * | 1990-08-03 | 1992-02-06 | Bayer Ag | Mischungen und ihre verwendung als flammschutzmittel |
| DE4024670A1 (de) * | 1990-08-03 | 1992-02-06 | Bayer Ag | Mischungen und ihre verwendung als flammschutzmittel |
| EP0483628A3 (en) * | 1990-10-29 | 1992-10-28 | Basf Aktiengesellschaft | Flame-proof thermoplastic moulding compositions based on polycarbonates fee of chlorine or bromine, and copolymers of styrene and acrylonitrile |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4945018A (en) * | 1983-08-23 | 1990-07-31 | General Electric Company | Crosslinkable flame retardant composition of polyolefin and polyphenylene ether |
| EP0174493B1 (de) * | 1984-08-17 | 1988-05-25 | Bayer Ag | Thermoplastische Formmassen mit flammwidrigen Eigenschaften |
| DE3444868A1 (de) * | 1984-12-08 | 1986-06-12 | Bayer Ag, 5090 Leverkusen | Thermoplastische formmassen mit flammwidrigen eigenschaften |
| DE3516807A1 (de) * | 1985-05-10 | 1986-11-13 | Bayer Ag, 5090 Leverkusen | Flammwidrige, schlagzaehe polycarbonat-formmassen |
| DE3521388A1 (de) * | 1985-06-14 | 1986-12-18 | Bayer Ag, 5090 Leverkusen | Thermoplastische formmassen mit flammwidrigen eigenschaften |
| US4772655A (en) * | 1985-09-16 | 1988-09-20 | Mobay Corporation | Pigmented, flame resistant polycarbonate compositions |
| DE3544295A1 (de) * | 1985-12-14 | 1987-06-19 | Bayer Ag | Thermoplastische formmassen mit hoher kriechstromfestigkeit |
| US4873277A (en) * | 1986-10-31 | 1989-10-10 | General Electric Company | Aromatic carbonate resin exhibiting improved impact properties |
| US4753994A (en) * | 1986-12-02 | 1988-06-28 | Mobay Corporation | Flame retardant polycarbonate compositions |
| ES2031948T3 (es) * | 1987-04-17 | 1993-01-01 | Bayer Ag | Masas de moldeo de policarbonato antiestaticas ignifugas. |
| US4837258A (en) * | 1987-05-06 | 1989-06-06 | The Dow Chemical Company | Fire retardant impact modified carbonate polymer composition |
| US4786686A (en) * | 1987-05-06 | 1988-11-22 | The Dow Chemical Company | Fire retardant impact modified carbonate polymer composition |
| US5200454A (en) * | 1988-01-14 | 1993-04-06 | Idemitsu Kosan Company Limited | Flame-retardant resin composition |
| US5013776A (en) * | 1988-05-20 | 1991-05-07 | Teijin Chemicals, Ltd. | Flame-retardant polycarbonate resin composition |
| DE3819081A1 (de) * | 1988-06-04 | 1989-12-07 | Bayer Ag | Flammwidrige, schlagzaehe polycarbonat-formmassen |
| US4927870A (en) * | 1988-08-25 | 1990-05-22 | The Dow Chemical Company | Ignition resistant modified thermoplastic composition |
| EP0364729A1 (en) * | 1988-10-12 | 1990-04-25 | General Electric Company | Polymer-based material which comprises a flame-retardant and optionally a plasticizer and further conventionally used additives |
| US5102696A (en) * | 1990-03-27 | 1992-04-07 | General Electric Company | Method of dispersing fluoropolymers on polycarbonate resins |
| US5256493A (en) * | 1990-04-26 | 1993-10-26 | Szita Jeno G | Sulfonimide catalysts for coatings |
| EP0483510A3 (en) * | 1990-10-31 | 1992-09-02 | General Electric Company | Polycarbonate compositions with improved appearance and flammability characteristics |
| US5276077A (en) * | 1992-06-03 | 1994-01-04 | The Dow Chemical Company | Ignition resistant carbonate polymer blends |
| US6005025A (en) * | 1992-11-17 | 1999-12-21 | General Electric Company | Method of dispersing solid additives in polymers and products made therewith |
| US5521230A (en) * | 1992-11-17 | 1996-05-28 | General Electric Company | Method of dispersing solid additives in polymers and products made therewith |
| KR100466355B1 (ko) * | 1996-07-31 | 2005-06-16 | 미쯔비시 레이온 가부시끼가이샤 | 폴리테트라플루오로에틸렌함유혼합분체,이를함유하는열가소성수지조성물및그성형체 |
| EP0924259B1 (en) * | 1996-09-19 | 2005-11-16 | Asahi Kasei Chemicals Corporation | Polycarbonate resin compositions |
| JP3926938B2 (ja) * | 1998-12-03 | 2007-06-06 | 三菱エンジニアリングプラスチックス株式会社 | 難燃性ポリカーボネート樹脂組成物 |
| US6342550B1 (en) | 1999-02-03 | 2002-01-29 | Mitsubishi Engineering Plastics Corporation | Flame-retardent polycarbonate resin composition and a molded product using the same |
| JP2000290487A (ja) * | 1999-02-03 | 2000-10-17 | Mitsubishi Engineering Plastics Corp | 難燃性ポリカーボネート樹脂組成物及びそれを用いた成形品 |
| US6180702B1 (en) * | 1999-08-09 | 2001-01-30 | Bayer Corporation | Flame retardant polycarbonate composition |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| IL159196A (en) * | 2003-12-04 | 2009-09-01 | Bromine Compounds Ltd | Method for dispersing solid fluoropolymer additives in flame retardants and thermoplastic products made therewith |
| US20060116467A1 (en) * | 2004-11-30 | 2006-06-01 | Bayer Materialscience Llc | Flame retardant polycarbonate composition |
| JP4980676B2 (ja) * | 2006-08-28 | 2012-07-18 | 日本エイアンドエル株式会社 | 重合体の回収方法 |
| US7622504B2 (en) * | 2006-12-20 | 2009-11-24 | MCS Laboratories, Inc. | Esters of 2-phenylalkanenitriles and antifungal compositions containing them |
| DE102007040925A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Thermoplastische Zusammensetzungen mit geringer Trübung |
| KR100962389B1 (ko) * | 2008-05-14 | 2010-06-10 | 제일모직주식회사 | 난연성이 우수한 폴리카보네이트 수지 조성물 |
| US8691895B2 (en) * | 2008-06-30 | 2014-04-08 | Bayer Materialscience Llc | Flame retardant, optically clear thermoplastic molding composition |
| US9006333B2 (en) | 2010-09-30 | 2015-04-14 | Daikin Industries, Ltd. | Method for manufacturing fine polytetrafluoroethylene powder |
| US9309335B2 (en) | 2010-09-30 | 2016-04-12 | Daikin Industries, Ltd. | Process for producing polytetrafluoroethylene fine powder |
| JP5328864B2 (ja) | 2010-09-30 | 2013-10-30 | ダイキン工業株式会社 | ドリップ防止剤、並びに、樹脂組成物 |
| CN102933619B (zh) | 2011-05-25 | 2016-01-20 | 泰国Abs有限公司 | 含有聚四氟乙烯的组合物及其制备方法 |
| WO2025003257A1 (en) | 2023-06-30 | 2025-01-02 | Covestro Deutschland Ag | Polycarbonate composition |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3005795A (en) * | 1957-12-10 | 1961-10-24 | Du Pont | Thermoplastic resins containing finely divided, fibrous polytetrafluoroethylene |
| CA1051138A (en) * | 1974-08-09 | 1979-03-20 | Victor Mark | Flame retardant polycarbonate composition |
| US4231920A (en) * | 1979-01-25 | 1980-11-04 | General Electric Company | Transparent to translucent flame-retardant polycarbonate composition |
| DE2918883A1 (de) * | 1979-05-10 | 1980-11-20 | Bayer Ag | Flammwidrige pc-legierungen mit erhoehter spannungsrisskorrosionsbestaendigkeit |
| DE2918882A1 (de) * | 1979-05-10 | 1980-11-13 | Bayer Ag | Flammwidrige polycarbonat-legierungen mit erhoehter waermeformbestaendigkeit |
| EP0103230B1 (de) * | 1982-09-10 | 1988-06-22 | Bayer Ag | Flammwidrige Polymermischungen |
| DE3322260A1 (de) * | 1983-06-21 | 1985-01-03 | Bayer Ag, 5090 Leverkusen | Formmassen mit flammwidrigen eigenschaften |
| US4473685A (en) * | 1983-07-28 | 1984-09-25 | General Electric Company | Flame retardant non-dripping polycarbonate compositions exhibiting improved thick section impact |
-
1984
- 1984-11-20 DE DE19843442281 patent/DE3442281A1/de not_active Withdrawn
-
1985
- 1985-10-31 CA CA000494361A patent/CA1241140A/en not_active Expired
- 1985-11-08 EP EP85114237A patent/EP0182226B1/de not_active Expired - Lifetime
- 1985-11-08 DE DE8585114237T patent/DE3577208D1/de not_active Expired - Lifetime
- 1985-11-13 US US06/797,531 patent/US4649168A/en not_active Expired - Fee Related
- 1985-11-18 JP JP60256829A patent/JPS61127759A/ja active Granted
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4024667A1 (de) * | 1990-08-03 | 1992-02-06 | Bayer Ag | Mischungen und ihre verwendung als flammschutzmittel |
| DE4024670A1 (de) * | 1990-08-03 | 1992-02-06 | Bayer Ag | Mischungen und ihre verwendung als flammschutzmittel |
| EP0483628A3 (en) * | 1990-10-29 | 1992-10-28 | Basf Aktiengesellschaft | Flame-proof thermoplastic moulding compositions based on polycarbonates fee of chlorine or bromine, and copolymers of styrene and acrylonitrile |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0182226A3 (en) | 1987-08-26 |
| JPH0528270B2 (cg-RX-API-DMAC10.html) | 1993-04-23 |
| CA1241140A (en) | 1988-08-23 |
| DE3577208D1 (de) | 1990-05-23 |
| EP0182226B1 (de) | 1990-04-18 |
| JPS61127759A (ja) | 1986-06-16 |
| EP0182226A2 (de) | 1986-05-28 |
| US4649168A (en) | 1987-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0182226B1 (de) | Verfahren zur Herstellung von Tetrafluorethylenpolymerisathaltigen, flammwidrigen Polycarbonatformmassen | |
| EP0207369B1 (de) | Thermoplastische Polycarbonatformmassen | |
| EP0201795B1 (de) | Flammwidrige, schlagzähe Polycarbonat-Formmassen | |
| EP0174493B1 (de) | Thermoplastische Formmassen mit flammwidrigen Eigenschaften | |
| EP0345522B1 (de) | Flammwidrige, schlagzähe Polycarbonat-Formmassen | |
| EP0131751B1 (de) | Verfahren zur Herstellung flammwidriger Formmassen | |
| EP0206058A1 (de) | Thermoplastische Formmassen mit flammwidrigen Eigenschaften | |
| EP0144807B1 (de) | Neue Flammschutzmittelkombinationen und ihre Verwendung in thermoplastischen Formmassen aus Polycarbonaten und ABS-Polymerisaten | |
| EP0207359B1 (de) | Thermoplastische Formmassen mit flammwidrigen Eigenschaften | |
| DE69935817T2 (de) | Flammhemmende Polycarbonatzusammensetzung | |
| EP0482451A2 (de) | Lichtalterungsbeständige, flammwidrige Polycarbonat-, Polyestercarbonat- oder Polyarylat-Formmassen | |
| DE4027104A1 (de) | Thermoplastische polycarbonatformmassen mit flammwidrigen eigenschaften | |
| DE69325655T2 (de) | Zündbeständige polycarbonat-mischungen | |
| EP0432581B1 (de) | Thermoplastische Polycarbonatformmassen mit flammwidrigen Eigenschaften | |
| DE3545609A1 (de) | Verfahren zur herstellung thermoplastischer formmassen mit flammwidrigen eigenschaften | |
| EP0247430B1 (de) | Flammwidrige, thermoplastische Formmassen | |
| DE3629546A1 (de) | Schlagzaehe, flammwidrige formmassen | |
| DE19842713B4 (de) | Thermoplastische Harzzusammensetzung | |
| EP0034252A1 (de) | Flammwidrige thermoplastische Formmassen aus Polycarbonaten und ABS-Polymerisaten | |
| EP0534293A2 (de) | Flammwidrig ausgerüstete chlor- und bromfreie Formmasse | |
| DE69919422T2 (de) | Flammhemmende Polycarbonatabmischung | |
| DE4024667C2 (de) | Flammschutzmittel für Polycarbonate und Verfahren zur Einarbeitung in Polycarbonate | |
| DE3544296A1 (de) | Thermoplastische formmassen mit hoher kriechstromfestigkeit | |
| DE3512638A1 (de) | Thermoplastische formmassen mit flammwidrigen eigenschaften | |
| DE4115607A1 (de) | Chlor- und bromfreie, flammfeste thermoplastische formmassen auf der basis von polycarbonaten und styrol/acrylinitril-copolymerisaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |