DE3433403A1 - Verfahren zur herstellung von 4,4-disubstituierten 5-methylen-1,3-dioxolan-2-onen - Google Patents
Verfahren zur herstellung von 4,4-disubstituierten 5-methylen-1,3-dioxolan-2-onenInfo
- Publication number
- DE3433403A1 DE3433403A1 DE19843433403 DE3433403A DE3433403A1 DE 3433403 A1 DE3433403 A1 DE 3433403A1 DE 19843433403 DE19843433403 DE 19843433403 DE 3433403 A DE3433403 A DE 3433403A DE 3433403 A1 DE3433403 A1 DE 3433403A1
- Authority
- DE
- Germany
- Prior art keywords
- mol
- dioxolan
- reaction
- methylene
- copper
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title description 6
- 238000000034 method Methods 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 12
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 10
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 claims description 9
- 150000001879 copper Chemical class 0.000 claims description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 5
- 150000004714 phosphonium salts Chemical class 0.000 claims description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 3
- 239000001569 carbon dioxide Substances 0.000 claims description 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 3
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical class OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 claims description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 claims 2
- 150000003254 radicals Chemical class 0.000 description 8
- 230000035484 reaction time Effects 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 6
- -1 4,4-disubstituted 5-methylene-1,3-dioxolan-2-ones Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- FWLKYEAOOIPJRL-UHFFFAOYSA-N prop-1-yn-1-ol Chemical compound CC#CO FWLKYEAOOIPJRL-UHFFFAOYSA-N 0.000 description 5
- 150000003839 salts Chemical group 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- CEBKHWWANWSNTI-UHFFFAOYSA-N 2-methylbut-3-yn-2-ol Chemical compound CC(C)(O)C#C CEBKHWWANWSNTI-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- JICGTNNQQNZRHZ-UHFFFAOYSA-N oct-1-yn-1-ol Chemical compound CCCCCCC#CO JICGTNNQQNZRHZ-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000001371 (5E)-3,5-dimethylocta-1,5,7-trien-3-ol Substances 0.000 description 2
- QYLFHLNFIHBCPR-UHFFFAOYSA-N 1-ethynylcyclohexan-1-ol Chemical compound C#CC1(O)CCCCC1 QYLFHLNFIHBCPR-UHFFFAOYSA-N 0.000 description 2
- WUGCPRNXGBZRMC-UHFFFAOYSA-N 4,4-dimethyl-5-methylidene-1,3-dioxolan-2-one Chemical compound CC1(C)OC(=O)OC1=C WUGCPRNXGBZRMC-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- DBAMUTGXJAWDEA-UHFFFAOYSA-N Butynol Chemical compound CCC#CO DBAMUTGXJAWDEA-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- ZJIQIJIQBTVTDY-SREVYHEPSA-N dehydrolinalool Chemical compound CC(=C)\C=C/CC(C)(O)C=C ZJIQIJIQBTVTDY-SREVYHEPSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- QXLPXWSKPNOQLE-UHFFFAOYSA-N methylpentynol Chemical compound CCC(C)(O)C#C QXLPXWSKPNOQLE-UHFFFAOYSA-N 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- VZPBTNPWFOMXPI-UHFFFAOYSA-N 3,7-dimethyloct-1-yn-3-ol Chemical compound CC(C)CCCC(C)(O)C#C VZPBTNPWFOMXPI-UHFFFAOYSA-N 0.000 description 1
- PUNRPAWKFTXZIW-UHFFFAOYSA-N 3-ethylpent-1-yn-3-ol Chemical compound CCC(O)(CC)C#C PUNRPAWKFTXZIW-UHFFFAOYSA-N 0.000 description 1
- JQZGUQIEPRIDMR-UHFFFAOYSA-N 3-methylbut-1-yn-1-ol Chemical compound CC(C)C#CO JQZGUQIEPRIDMR-UHFFFAOYSA-N 0.000 description 1
- NZNQXRMOAPYWRJ-UHFFFAOYSA-N 4-ethyl-4-methyl-5-methylidene-1,3-dioxolan-2-one Chemical compound CCC1(C)OC(=O)OC1=C NZNQXRMOAPYWRJ-UHFFFAOYSA-N 0.000 description 1
- VPNONJQYTREFCU-UHFFFAOYSA-N 4-methyl-5-methylidene-4-(4-methylpentyl)-1,3-dioxolan-2-one Chemical compound CC(C)CCCC1(C)OC(=O)OC1=C VPNONJQYTREFCU-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- YWTIDNZYLFTNQQ-UHFFFAOYSA-N Dehydrolinalool Chemical compound CC(C)=CCCC(C)(O)C#C YWTIDNZYLFTNQQ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- FNIATMYXUPOJRW-UHFFFAOYSA-N cyclohexylidene Chemical compound [C]1CCCCC1 FNIATMYXUPOJRW-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- JHYNXXDQQHTCHJ-UHFFFAOYSA-M ethyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 JHYNXXDQQHTCHJ-UHFFFAOYSA-M 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003003 phosphines Chemical group 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- FFNMBRCFFADNAO-UHFFFAOYSA-N pirenzepine hydrochloride Chemical compound [H+].[H+].[Cl-].[Cl-].C1CN(C)CCN1CC(=O)N1C2=NC=CC=C2NC(=O)C2=CC=CC=C21 FFNMBRCFFADNAO-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/72—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 spiro-condensed with carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/32—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D317/34—Oxygen atoms
- C07D317/40—Vinylene carbonate; Substituted vinylene carbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843433403 DE3433403A1 (de) | 1984-09-12 | 1984-09-12 | Verfahren zur herstellung von 4,4-disubstituierten 5-methylen-1,3-dioxolan-2-onen |
| JP60193262A JPS6176479A (ja) | 1984-09-12 | 1985-09-03 | 4,4‐ジ置換5‐メチレン‐1,3‐ジオキソラン‐2‐オンの製法 |
| EP85111315A EP0175241B1 (de) | 1984-09-12 | 1985-09-07 | Verfahren zur Herstellung von 4,4-disubstituierten 5-Methylen-1,3-dioxolan-2-onen |
| DE8585111315T DE3564112D1 (en) | 1984-09-12 | 1985-09-07 | Process for the production of 4,4-disubstituted 5-methylene-1,3-dioxolan-2-ones |
| CA000490420A CA1303051C (en) | 1984-09-12 | 1985-09-11 | Preparation of 4,4-disubstituted 5-methylene-1,3- dioxolan-2-ones |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843433403 DE3433403A1 (de) | 1984-09-12 | 1984-09-12 | Verfahren zur herstellung von 4,4-disubstituierten 5-methylen-1,3-dioxolan-2-onen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3433403A1 true DE3433403A1 (de) | 1986-03-20 |
Family
ID=6245175
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843433403 Withdrawn DE3433403A1 (de) | 1984-09-12 | 1984-09-12 | Verfahren zur herstellung von 4,4-disubstituierten 5-methylen-1,3-dioxolan-2-onen |
| DE8585111315T Expired DE3564112D1 (en) | 1984-09-12 | 1985-09-07 | Process for the production of 4,4-disubstituted 5-methylene-1,3-dioxolan-2-ones |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8585111315T Expired DE3564112D1 (en) | 1984-09-12 | 1985-09-07 | Process for the production of 4,4-disubstituted 5-methylene-1,3-dioxolan-2-ones |
Country Status (4)
| Country | Link |
|---|---|
| EP (1) | EP0175241B1 (enExample) |
| JP (1) | JPS6176479A (enExample) |
| CA (1) | CA1303051C (enExample) |
| DE (2) | DE3433403A1 (enExample) |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011157671A1 (de) | 2010-06-15 | 2011-12-22 | Basf Se | Verwendung von cyclischen carbonaten in epoxidharzzusammensetzungen |
| WO2013041398A1 (de) | 2011-09-19 | 2013-03-28 | Basf Se | Härtung von epoxidharz-zusammensetzungen, welche cyclische carbonate enthalten, mit gemischen von aminohärtern |
| WO2013041425A1 (de) | 2011-09-21 | 2013-03-28 | Basf Se | Härtung von epoxidharz-zusammensetzungen, welche cyclische carbonate enthalten, mit gemischen von aminohärtern und katalysatoren |
| WO2013144299A1 (de) | 2012-03-29 | 2013-10-03 | Basf Se | Polymerisierbare alkyliden-1,3-dioxolan-2-one und deren verwendung |
| US8586653B2 (en) | 2011-09-19 | 2013-11-19 | Basf Se | Curing of epoxy resin compositions comprising cyclic carbonates using mixtures of amino hardeners |
| US8877837B2 (en) | 2011-09-21 | 2014-11-04 | Basf Se | Curing of epoxy resin compositions comprising cyclic carbonates using mixtures of amino hardeners and catalysts |
| EP2851379A1 (de) | 2013-09-23 | 2015-03-25 | BASF Coatings GmbH | Beschichtungsmittelzusammensetzungen und daraus hergestelllte, bei niedrigen Temperaturen härtbare Beschichtungen und sowie deren Verwendung |
| EP2851403A1 (de) | 2013-09-23 | 2015-03-25 | BASF Coatings GmbH | Beschichtungsmittelzusammensetzungen und daraus hergestellte, bei niedrigen temperaturen härtbare beschichtungen und sowie deren verwendung |
| WO2015049229A1 (de) | 2013-10-01 | 2015-04-09 | Basf Se | Mehrkomponenten-epoxidharzzusammensetzung |
| US9062136B2 (en) | 2012-03-29 | 2015-06-23 | Basf Se | Polymerizable alkylidene-1,3-dioxolane-2-one and use thereof |
| WO2016162627A1 (fr) | 2015-04-10 | 2016-10-13 | Bostik Sa | Polymères hydrocarbonés comprenant deux groupements terminaux exo-vinylène cyclocarbonate |
| WO2018065715A1 (fr) | 2016-10-07 | 2018-04-12 | Bostik Sa | Nouveaux polymères hydrocarbonés à groupements terminaux exo-vinylène cyclocarbonate |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1092191C (zh) * | 1996-10-21 | 2002-10-09 | 霍夫曼-拉罗奇有限公司 | 环碳酸酯的制备方法 |
| CN106459658B (zh) | 2014-04-25 | 2019-04-23 | 宣伟投资管理有限公司 | 多环碳酸酯化合物以及由其形成的聚合物 |
| EP3134475B1 (en) | 2014-04-25 | 2021-09-15 | Swimc Llc | Polycyclocarbonate compounds and polymers and compositions formed therefrom |
| JP6443836B2 (ja) * | 2014-08-06 | 2018-12-26 | 国立大学法人徳島大学 | 位相差フィルム |
| JP7184873B2 (ja) * | 2017-08-14 | 2022-12-06 | ビーエーエスエフ ソシエタス・ヨーロピア | 環状カーボネートの製造方法 |
| EP3569597A1 (en) * | 2018-05-18 | 2019-11-20 | Basf Se | Monomers comprising at least one 4-(2-oxyethylidene)-1,3-dioxolan-2-one unit and use thereof |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1098953B (de) * | 1959-09-29 | 1961-02-09 | Basf Ag | Verfahren zur Herstellung von 5-Methylen-4, 4-dialkyl-1, 3-dioxolan-2-onen |
| US4231937A (en) * | 1978-08-28 | 1980-11-04 | Atlantic Richfield Company | Preparation of alkylene carbonates from alkylene iodohydrins |
| DE3123165A1 (de) * | 1981-06-11 | 1983-01-05 | Basf Ag, 6700 Ludwigshafen | "verfahren zur herstellung von 2-alkoxy-(1,3)-dioxolanen" |
-
1984
- 1984-09-12 DE DE19843433403 patent/DE3433403A1/de not_active Withdrawn
-
1985
- 1985-09-03 JP JP60193262A patent/JPS6176479A/ja active Granted
- 1985-09-07 DE DE8585111315T patent/DE3564112D1/de not_active Expired
- 1985-09-07 EP EP85111315A patent/EP0175241B1/de not_active Expired
- 1985-09-11 CA CA000490420A patent/CA1303051C/en not_active Expired - Lifetime
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011157671A1 (de) | 2010-06-15 | 2011-12-22 | Basf Se | Verwendung von cyclischen carbonaten in epoxidharzzusammensetzungen |
| WO2013041398A1 (de) | 2011-09-19 | 2013-03-28 | Basf Se | Härtung von epoxidharz-zusammensetzungen, welche cyclische carbonate enthalten, mit gemischen von aminohärtern |
| US8586653B2 (en) | 2011-09-19 | 2013-11-19 | Basf Se | Curing of epoxy resin compositions comprising cyclic carbonates using mixtures of amino hardeners |
| US8877837B2 (en) | 2011-09-21 | 2014-11-04 | Basf Se | Curing of epoxy resin compositions comprising cyclic carbonates using mixtures of amino hardeners and catalysts |
| WO2013041425A1 (de) | 2011-09-21 | 2013-03-28 | Basf Se | Härtung von epoxidharz-zusammensetzungen, welche cyclische carbonate enthalten, mit gemischen von aminohärtern und katalysatoren |
| US9062136B2 (en) | 2012-03-29 | 2015-06-23 | Basf Se | Polymerizable alkylidene-1,3-dioxolane-2-one and use thereof |
| WO2013144299A1 (de) | 2012-03-29 | 2013-10-03 | Basf Se | Polymerisierbare alkyliden-1,3-dioxolan-2-one und deren verwendung |
| EP2851379A1 (de) | 2013-09-23 | 2015-03-25 | BASF Coatings GmbH | Beschichtungsmittelzusammensetzungen und daraus hergestelllte, bei niedrigen Temperaturen härtbare Beschichtungen und sowie deren Verwendung |
| EP2851403A1 (de) | 2013-09-23 | 2015-03-25 | BASF Coatings GmbH | Beschichtungsmittelzusammensetzungen und daraus hergestellte, bei niedrigen temperaturen härtbare beschichtungen und sowie deren verwendung |
| US9920215B2 (en) | 2013-09-23 | 2018-03-20 | Basf Coatings Gmbh | Coating material compositions and low-temperature-curable coatings produced therefrom, and use thereof |
| US9951245B2 (en) | 2013-09-23 | 2018-04-24 | Basf Coatings Gmbh | Coating material compositions and low-temperature-curable coatings produced therefrom, and use thereof |
| WO2015049229A1 (de) | 2013-10-01 | 2015-04-09 | Basf Se | Mehrkomponenten-epoxidharzzusammensetzung |
| WO2016162627A1 (fr) | 2015-04-10 | 2016-10-13 | Bostik Sa | Polymères hydrocarbonés comprenant deux groupements terminaux exo-vinylène cyclocarbonate |
| WO2018065715A1 (fr) | 2016-10-07 | 2018-04-12 | Bostik Sa | Nouveaux polymères hydrocarbonés à groupements terminaux exo-vinylène cyclocarbonate |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3564112D1 (en) | 1988-09-08 |
| JPS6176479A (ja) | 1986-04-18 |
| CA1303051C (en) | 1992-06-09 |
| JPH0566950B2 (enExample) | 1993-09-22 |
| EP0175241A1 (de) | 1986-03-26 |
| EP0175241B1 (de) | 1988-08-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3433403A1 (de) | Verfahren zur herstellung von 4,4-disubstituierten 5-methylen-1,3-dioxolan-2-onen | |
| EP1076654A2 (de) | Verfahren zur kontinuierlichen herstellung von 1,3-dioxolan-2-onen | |
| DE3153115C2 (de) | Flüssigphasencarbonylierungskatalysator | |
| DE2844371C2 (de) | Verfahren zur Herstellung von Carbonsäureanhydriden | |
| DE3516930A1 (de) | Verfahren zur reduzierenden aldehydcarbonylierung ueber halbacetalester als zwischenprodukt und mit cobaltcarbonylkomplexen als katalysator | |
| DE2447069A1 (de) | Verfahren zur herstellung von carbonsaeuren und/oder carbonsaeureestern | |
| DE2913677C2 (de) | Verfahren zur Herstellung von Acetaldehyddimethylacetal | |
| DE2541745B2 (de) | Verfahren zur Herstellung von Anthracyclinderivaten | |
| DE3040432C2 (de) | Verfahren zur Herstellung von 3-Pentensäureestern | |
| DE69003579T2 (de) | Verfahren zur Herstellung von beta,gamma-ungesättigten Carbonsäuren. | |
| DE3201300A1 (de) | Verfahren zur herstellung von phthalid | |
| DE3220224C2 (de) | Verfahren zur Herstellung von Carbonsäureanhydriden | |
| DE2410782C2 (de) | Phenylendiessigsäuredialkylester und Verfahren zu deren Herstellung | |
| DE3034421C2 (enExample) | ||
| DE2430192A1 (de) | Verfahren zur herstellung von ungesaettigten ketonen | |
| DE3522906A1 (de) | Verfahren zur gemeinschaftlichen herstellung von ethylencyanhydrin und dessen ethern | |
| EP0171046B1 (de) | Verfahren zur Herstellung von Pantolacton | |
| EP0227057B1 (de) | Verfahren zur Herstellung von in 1-Stellung durch aromatische oder heterocyclische Reste substituierten Alkanolen | |
| DE3212535A1 (de) | Verfahren zur herstellung von kohlensaeureestern | |
| DE4425677A1 (de) | Herstellung von Carbaminsäurevinylestern | |
| EP0074561A2 (de) | Cyclische Keto-butyraldehyde, ein Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von cyclischen Diisocyanaten | |
| DE2329923B2 (de) | Verfahren zur Herstellung von 5-OxohexannitrU | |
| DE1243677B (de) | Verfahren zur Herstellung von Sulfonsaeureestern | |
| EP0432435B1 (de) | Verfahren zur Herstellung von 2-Formyl-2-methyl-bernsteinsäureestern | |
| DE1179929B (de) | Verfahren zur Herstellung von Acrylsaeureestern und Acrylsaeureamiden durch Decarboxylieren von Maleinsaeure- und Fumarsaeureverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |