DE3421060C2 - - Google Patents
Info
- Publication number
- DE3421060C2 DE3421060C2 DE3421060A DE3421060A DE3421060C2 DE 3421060 C2 DE3421060 C2 DE 3421060C2 DE 3421060 A DE3421060 A DE 3421060A DE 3421060 A DE3421060 A DE 3421060A DE 3421060 C2 DE3421060 C2 DE 3421060C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- meth
- iii
- polymer
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229920000642 polymer Polymers 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 17
- -1 phosphonitrile chlorides Chemical class 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 9
- HWSSEYVMGDIFMH-UHFFFAOYSA-N 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C HWSSEYVMGDIFMH-UHFFFAOYSA-N 0.000 claims description 8
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 6
- 239000000377 silicon dioxide Substances 0.000 claims description 6
- UXJHQBVRZUANLK-UHFFFAOYSA-N azanylidyne(dichloro)-$l^{5}-phosphane Chemical compound ClP(Cl)#N UXJHQBVRZUANLK-UHFFFAOYSA-N 0.000 claims description 5
- 239000000843 powder Substances 0.000 claims description 5
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 4
- AMFGWXWBFGVCKG-UHFFFAOYSA-N Panavia opaque Chemical compound C1=CC(OCC(O)COC(=O)C(=C)C)=CC=C1C(C)(C)C1=CC=C(OCC(O)COC(=O)C(C)=C)C=C1 AMFGWXWBFGVCKG-UHFFFAOYSA-N 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 claims description 3
- GZBSIABKXVPBFY-UHFFFAOYSA-N 2,2-bis(hydroxymethyl)propane-1,3-diol;prop-2-enoic acid Chemical compound OC(=O)C=C.OC(=O)C=C.OC(=O)C=C.OC(=O)C=C.OCC(CO)(CO)CO GZBSIABKXVPBFY-UHFFFAOYSA-N 0.000 claims description 3
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 claims description 3
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 claims description 3
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M acrylate group Chemical group C(C=C)(=O)[O-] NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 3
- 239000000654 additive Substances 0.000 claims description 3
- 150000002734 metacrylic acid derivatives Chemical class 0.000 claims description 3
- 230000000379 polymerizing effect Effects 0.000 claims description 3
- 238000006467 substitution reaction Methods 0.000 claims description 3
- 229910052916 barium silicate Inorganic materials 0.000 claims description 2
- HMOQPOVBDRFNIU-UHFFFAOYSA-N barium(2+);dioxido(oxo)silane Chemical compound [Ba+2].[O-][Si]([O-])=O HMOQPOVBDRFNIU-UHFFFAOYSA-N 0.000 claims description 2
- 229940075614 colloidal silicon dioxide Drugs 0.000 claims description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 2
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910010271 silicon carbide Inorganic materials 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000006116 polymerization reaction Methods 0.000 description 14
- 239000000178 monomer Substances 0.000 description 12
- 239000000463 material Substances 0.000 description 11
- 230000000704 physical effect Effects 0.000 description 10
- 238000011049 filling Methods 0.000 description 9
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 239000004342 Benzoyl peroxide Substances 0.000 description 5
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 235000019400 benzoyl peroxide Nutrition 0.000 description 5
- GKTNLYAAZKKMTQ-UHFFFAOYSA-N n-[bis(dimethylamino)phosphinimyl]-n-methylmethanamine Chemical compound CN(C)P(=N)(N(C)C)N(C)C GKTNLYAAZKKMTQ-UHFFFAOYSA-N 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 239000000945 filler Substances 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 3
- 208000002925 dental caries Diseases 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical group C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 150000002148 esters Chemical group 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- GYVGXEWAOAAJEU-UHFFFAOYSA-N n,n,4-trimethylaniline Chemical compound CN(C)C1=CC=C(C)C=C1 GYVGXEWAOAAJEU-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 229920002627 poly(phosphazenes) Polymers 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- 210000004872 soft tissue Anatomy 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000013638 trimer Substances 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PEJQKHLWXHKKGS-UHFFFAOYSA-N 2,2,4,4,6,6,8,8-octachloro-1,3,5,7-tetraza-2$l^{5},4$l^{5},6$l^{5},8$l^{5}-tetraphosphacycloocta-1,3,5,7-tetraene Chemical compound ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1 PEJQKHLWXHKKGS-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- JUVSRZCUMWZBFK-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)-4-methylanilino]ethanol Chemical compound CC1=CC=C(N(CCO)CCO)C=C1 JUVSRZCUMWZBFK-UHFFFAOYSA-N 0.000 description 1
- LKVFCSWBKOVHAH-UHFFFAOYSA-N 4-Ethoxyphenol Chemical compound CCOC1=CC=C(O)C=C1 LKVFCSWBKOVHAH-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N Bisphenol A Natural products C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000035622 drinking Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- MKVYSRNJLWTVIK-UHFFFAOYSA-N ethyl carbamate;2-methylprop-2-enoic acid Chemical compound CCOC(N)=O.CC(=C)C(O)=O.CC(=C)C(O)=O MKVYSRNJLWTVIK-UHFFFAOYSA-N 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- UBIJTWDKTYCPMQ-UHFFFAOYSA-N hexachlorophosphazene Chemical compound ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1 UBIJTWDKTYCPMQ-UHFFFAOYSA-N 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- DIAIBWNEUYXDNL-UHFFFAOYSA-N n,n-dihexylhexan-1-amine Chemical compound CCCCCCN(CCCCCC)CCCCCC DIAIBWNEUYXDNL-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229920002632 poly(dichlorophosphazene) polymer Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000003469 silicate cement Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G79/00—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule
- C08G79/02—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule a linkage containing phosphorus
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K6/00—Preparations for dentistry
- A61K6/70—Preparations for dentistry comprising inorganic additives
- A61K6/71—Fillers
- A61K6/76—Fillers comprising silicon-containing compounds
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Inorganic Chemistry (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Dental Preparations (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP58147690A JPS6038307A (ja) | 1983-08-11 | 1983-08-11 | 充填用複合材 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3421060A1 DE3421060A1 (de) | 1985-02-28 |
| DE3421060C2 true DE3421060C2 (show.php) | 1992-08-20 |
Family
ID=15436071
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843421060 Granted DE3421060A1 (de) | 1983-08-11 | 1984-06-06 | Fuellungsmaterial |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4579880A (show.php) |
| JP (1) | JPS6038307A (show.php) |
| BE (1) | BE899654A (show.php) |
| CA (1) | CA1219403A (show.php) |
| DE (1) | DE3421060A1 (show.php) |
| FR (1) | FR2555440B1 (show.php) |
| GB (1) | GB2144754B (show.php) |
| NL (1) | NL8401961A (show.php) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4659751A (en) * | 1983-01-10 | 1987-04-21 | American Dental Association Health Foundation | Simplified method for obtained strong adhesive bonding of composites to dentin, enamel and other substrates |
| JPH0633295B2 (ja) * | 1985-07-29 | 1994-05-02 | 学校法人日本大学 | 単量体複合組成物 |
| US4661065A (en) * | 1985-12-04 | 1987-04-28 | Gulf South Research Institute | Soft denture liner |
| US4874828A (en) * | 1987-10-01 | 1989-10-17 | Hercules Incorporated | Heat resistant thermosetting phosphazene-imide copolymers |
| US5001203A (en) * | 1988-04-11 | 1991-03-19 | Ethyl Corporation | UV curable polyorganophosphazene composition |
| US5997301A (en) * | 1998-10-20 | 1999-12-07 | Linden; Lars Ake | Treatment of tooth surfaces and substances therefor |
| US20030099683A1 (en) * | 2000-03-18 | 2003-05-29 | Michael Grunze | Polyphosphazene derivatives |
| DK1274471T3 (da) * | 2000-04-11 | 2007-04-02 | Polyzenix Gmbh | Anvendelse af folier af polytrifluorethoxyphosphazener til omhylning af medicinsk udstyr |
| US20090004240A1 (en) * | 2000-08-11 | 2009-01-01 | Celonova Biosciences, Inc. | Implants with a phosphazene-containing coating |
| EP1179353A1 (de) * | 2000-08-11 | 2002-02-13 | B. Braun Melsungen Ag | Antithrombogene Implantate mit Beschichtung aus Polyphosphazenen und einem pharmakologisch aktiven Wirkstoff |
| US9080146B2 (en) * | 2001-01-11 | 2015-07-14 | Celonova Biosciences, Inc. | Substrates containing polyphosphazene as matrices and substrates containing polyphosphazene with a micro-structured surface |
| DE10100961B4 (de) * | 2001-01-11 | 2005-08-04 | Polyzenix Gmbh | Körperverträglicher Werkstoff und mit diesem Werkstoff beschichtetes Substrat für die Züchtung von Zellen und künstlichen aus Zellen aufgebauten oder gewachsenen organischen Implantaten |
| EP1432380B1 (de) * | 2001-08-17 | 2006-09-27 | Polyzenix GmbH | Vorrichtung auf basis von nitinol mit polyphosphazenüberzug |
| US20080138377A1 (en) * | 2002-07-05 | 2008-06-12 | Celonova Biosciences, Inc. | Vasodilator Eluting Luminal Stent Devices With A Specific Polyphosphazene Coating and Methods for Their Manufacture and Use |
| US20080138433A1 (en) * | 2002-07-05 | 2008-06-12 | Celonova Biosciences, Inc. | Vasodilator eluting blood storage and administration devices with a specific polyphosphazene coating and methods for their manufacture and use |
| US9107850B2 (en) | 2004-10-25 | 2015-08-18 | Celonova Biosciences, Inc. | Color-coded and sized loadable polymeric particles for therapeutic and/or diagnostic applications and methods of preparing and using the same |
| US9114162B2 (en) | 2004-10-25 | 2015-08-25 | Celonova Biosciences, Inc. | Loadable polymeric particles for enhanced imaging in clinical applications and methods of preparing and using the same |
| US20210299056A9 (en) | 2004-10-25 | 2021-09-30 | Varian Medical Systems, Inc. | Color-Coded Polymeric Particles of Predetermined Size for Therapeutic and/or Diagnostic Applications and Related Methods |
| AU2007307715B2 (en) * | 2006-10-10 | 2012-08-30 | Celonova Biosciences, Inc. | Bioprosthetic heart valve with polyphosphazene |
| KR20090084847A (ko) * | 2006-10-10 | 2009-08-05 | 셀로노바 바이오사이언시즈, 인코포레이티드 | 실리콘 및 특정 폴리포스파젠을 포함하는 조성물 및 장치 |
| US20090110730A1 (en) * | 2007-10-30 | 2009-04-30 | Celonova Biosciences, Inc. | Loadable Polymeric Particles for Marking or Masking Individuals and Methods of Preparing and Using the Same |
| RU2375039C2 (ru) * | 2008-01-30 | 2009-12-10 | Закрытое акционерное общество "Опытно-экспериментальный завод "ВладМиВа" | Стоматологическая полимерная композиция |
| RU2509551C2 (ru) * | 2012-05-25 | 2014-03-20 | Общество с ограниченной ответственностью "ВЕСТЭОС" | Стоматологическая полимерная композиция с повышенной адгезией к тканям зуба |
| RU2692686C1 (ru) * | 2019-02-04 | 2019-06-26 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Российский химико-технологический университет имени Д.И. Менделеева" (РХТУ им. Д.И. Менделеева) | Способ получения 4-аллил-2-метоксифенокси-бета-карбоксиэтенилфенокси-циклотрифосфазенов |
| RU2743697C1 (ru) * | 2019-12-30 | 2021-02-24 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Российский химико-технологический университет имени Д.И. Менделеева" (РХТУ им. Д.И. Менделеева) | Фосфазенсодержащий олигоэфиракрилат и способ его получения |
Family Cites Families (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1545180B1 (de) * | 1961-01-27 | 1970-07-02 | Walker Chemical Co Ltd | Verfahren zur Herstellung von phosphor- und stickstoffhaltigen Polymerisaten |
| US3311622A (en) * | 1961-05-17 | 1967-03-28 | Shulton Inc | Substituted phosphonitrilic trimers |
| GB992377A (en) * | 1963-05-06 | 1965-05-19 | Grace W R & Co | Process for the production of phosphonitriles |
| DE1222499B (de) * | 1963-06-11 | 1966-08-11 | Grace W R & Co | Verfahren zur Herstellung von Phosphonitrilpolymeren |
| US3394177A (en) * | 1964-05-25 | 1968-07-23 | Grace W R & Co | Selective preparation of 2, 4, 6, 8-tetrachloro-2, 4, 6, 8-tetraphenyltetraphosphonitrile |
| US3370089A (en) * | 1964-07-09 | 1968-02-20 | Grace W R & Co | Phosphonitrile |
| US3457196A (en) * | 1966-10-17 | 1969-07-22 | Us Navy | Polymerization of cyclic phosphonitriles with orthophosphate esters |
| US3591530A (en) * | 1968-10-16 | 1971-07-06 | Sandoz Ltd | Process for the production of polymers containing phosphorus and nitrogen |
| US3702833A (en) * | 1970-05-01 | 1972-11-14 | Horizons Research Inc | Curable fluorophosphazene polymers |
| US3888799A (en) * | 1970-05-01 | 1975-06-10 | Horizons Inc | Fluorophosphazene polymers curable at room temperature |
| BE790016A (fr) * | 1971-10-13 | 1973-04-12 | Horizons Research Inc | Preparation de polyphosphazenes |
| DE2153104C2 (de) * | 1971-10-25 | 1985-09-26 | The Firestone Tire & Rubber Co., Akron, Ohio | Terpolymere mit willkürlich verteilten, sich wiederholenden Einheiten |
| GB1436352A (en) * | 1972-03-06 | 1976-05-19 | Fmc Corp | Oligometric phosphazene derivatives having flame-retardant properties |
| US3838073A (en) * | 1972-08-28 | 1974-09-24 | Horizons Research Inc | Poly(fluoroalkoxyphosphazene)homopolymers |
| US3883451A (en) * | 1973-06-11 | 1975-05-13 | Horizons Inc | Flame-retardant poly (aryloxyphosphazene) copolymers |
| US3856712A (en) * | 1973-06-11 | 1974-12-24 | Horizons Inc | Poly(alkoxyaryloxyphosphazene) elastomers |
| US3853794A (en) * | 1973-06-11 | 1974-12-10 | Horizons Inc | Alkylaryloxyphosphazene polymers |
| CA1038545A (en) * | 1973-06-11 | 1978-09-12 | Horizons Research Incorporated | Process for the preparation of poly (haloaryloxyphosphazene) homopolymers |
| US3856713A (en) * | 1973-06-11 | 1974-12-24 | Horizons Inc | Elastomeric poly(aryloxyphosphazene) copolymers |
| CA1028339A (en) * | 1973-06-12 | 1978-03-21 | Carroll W. Lanier | Process for producing phosphazene fire retardant |
| GB1468799A (en) * | 1973-06-19 | 1977-03-30 | Courtaulds Ltd | Phosphazene polymers useful as flame retardants |
| US3994838A (en) * | 1974-12-09 | 1976-11-30 | Horizons Incorporated, A Division Of Horizons Research Incorporated | Poly(phosphazene) vulcanizates and foams |
| US3972841A (en) * | 1975-01-29 | 1976-08-03 | The Firestone Tire & Rubber Company | Polyphosphazene elastomer with up to 35 mole per cent non-fluorinated alkoxy groups having improved low temperature flexibility |
| CA1105477A (en) * | 1976-03-22 | 1981-07-21 | Edwin J. Quinn | Structurally regulated polyphosphazene copolymers |
| US4092278A (en) * | 1976-06-11 | 1978-05-30 | Armstrong Cork Company | Molecular-weight modification of polyphosphazenes |
| US4055520A (en) * | 1976-07-14 | 1977-10-25 | Armstrong Cork Company | Polyphosphazene blends |
| US4200721A (en) * | 1976-07-19 | 1980-04-29 | Nasa | Heat resistant polymers of oxidized styrylphosphine |
| US4055523A (en) * | 1976-08-16 | 1977-10-25 | Armstrong Cork Company | Poly(dialkylaminoaryloxyphosphazene) polymers and foams |
| US4110421A (en) * | 1976-10-12 | 1978-08-29 | Armstrong Cork Company | Catalytic process for the preparation of phosphazene polymers |
| US4061606A (en) * | 1976-12-27 | 1977-12-06 | Armstrong Cork Company | Polyphosphazene polymer/organic polymer foams |
| US4107146A (en) * | 1977-02-14 | 1978-08-15 | Armstrong Cork Company | Curable aryloxyphosphazene polymers |
| US4101507A (en) * | 1977-03-21 | 1978-07-18 | The Firestone Tire & Rubber Company | Stabilization of polyphosphazenes |
| JPS6019724B2 (ja) * | 1978-08-03 | 1985-05-17 | 英一 増原 | 義歯床 |
| AU531816B2 (en) * | 1978-09-08 | 1983-09-08 | Firestone Tire And Rubber Co., The | Polyphosphazene copolymer |
| US4242491A (en) * | 1978-09-08 | 1980-12-30 | The Firestone Tire & Rubber Company | Polyphosphazene polymers containing substituents of acrylate functionality |
| US4251215A (en) * | 1979-09-10 | 1981-02-17 | Gulf South Research Institute | Phosphonitrilic fluoroelastomer lined denture |
| US4264531A (en) * | 1979-11-14 | 1981-04-28 | Ethyl Corporation | Liquid, linear phosphazene prepolymers and process for preparing same |
| US4321217A (en) * | 1980-06-05 | 1982-03-23 | The United States Of America As Represented By The Secretary Of The Navy | Dialkylated phosphazene oligomers and method of preparation thereof |
| DE3025573A1 (de) * | 1980-07-05 | 1982-02-11 | Hoechst Ag, 6000 Frankfurt | Substituierte cyclische methylphosphazene und verfahren zu ihrer herstellung |
| DE3042061A1 (de) * | 1980-11-07 | 1982-06-24 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung cyclischer phosphazene |
| US4432730A (en) * | 1982-10-01 | 1984-02-21 | Gulf South Research Institute | Soft and firm denture liner for a composite denture and method for fabricating |
-
1983
- 1983-08-11 JP JP58147690A patent/JPS6038307A/ja active Granted
-
1984
- 1984-04-24 US US06/603,648 patent/US4579880A/en not_active Expired - Lifetime
- 1984-04-26 CA CA000452920A patent/CA1219403A/en not_active Expired
- 1984-05-14 FR FR8407420A patent/FR2555440B1/fr not_active Expired
- 1984-05-14 BE BE0/212932A patent/BE899654A/fr not_active IP Right Cessation
- 1984-05-16 GB GB08412441A patent/GB2144754B/en not_active Expired
- 1984-06-06 DE DE19843421060 patent/DE3421060A1/de active Granted
- 1984-06-20 NL NL8401961A patent/NL8401961A/nl not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| BE899654A (fr) | 1984-08-31 |
| DE3421060A1 (de) | 1985-02-28 |
| GB2144754B (en) | 1986-12-17 |
| NL8401961A (nl) | 1985-03-01 |
| CA1219403A (en) | 1987-03-24 |
| FR2555440A1 (fr) | 1985-05-31 |
| FR2555440B1 (fr) | 1988-09-16 |
| GB2144754A (en) | 1985-03-13 |
| JPS6038307A (ja) | 1985-02-27 |
| GB8412441D0 (en) | 1984-06-20 |
| JPH0350726B2 (show.php) | 1991-08-02 |
| US4579880A (en) | 1986-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3421060C2 (show.php) | ||
| DE3117006C2 (de) | Zahnreparaturmaterial | |
| EP0366977B1 (de) | Mit sichtbarem Licht aushärtbare Dentalmassen | |
| EP0264551B1 (de) | Urethangruppen enthaltende (Meth)-acrylsäurederivate | |
| DE2406557C3 (de) | Hydroxyl-Gruppen enthaltende Diester von Acrylsäuren und diese enthaltendes Zahnfüllungsmaterial | |
| EP0254185B1 (de) | Urethangruppen enthaltende (Meth)-acrylsäurederivate von Tricyclo [5.2.1.02.6]decanen | |
| EP0254950B1 (de) | (Meth)-acrylsäureester | |
| DE3205030C2 (show.php) | ||
| DE3536077A1 (de) | Polymerisierbare saeure und saeurederivate enthaltende verbindungen, dieselben enthaltende mischungen und ihre verwendung | |
| EP1374829B1 (de) | Dentalmaterialien auf der Basis von Acrylesterphosphonsäuren | |
| CH645655A5 (de) | Oligomeres siloxan-prepolymer, seine herstellung sowie das prepolymer enthaltende zahnfuellmasse. | |
| DE3844619A1 (de) | Verwendung von perfluoroalkylgruppen aufweisenden (meth-)acrylsaeureestern in der dentaltechnik | |
| DE1520615A1 (de) | Verfahren zum Polymerisieren von Loesungen von Polymethylmethacrylat in Methylmethacrylat | |
| DE3743782A1 (de) | Ester-urethan-(meth)-acrylsaeurederivate | |
| EP0782591B1 (de) | Polymerisierbare oligo- und/oder polyalkensäuren | |
| EP1148060B1 (de) | Hydrolysestabile und polymerisierbare Acrylphosphonsäure | |
| EP3861976B1 (de) | Dentalmaterialien auf basis von cyclopolymerisierbaren vernetzern | |
| EP0943601B1 (de) | Vinylcyclopropan-(Meth) acrylate und deren Verwendung | |
| EP3212694B1 (de) | Mit aromatischen resten und mit hydroxygruppen substituierte silane und kieselsäure(hetero)polykondensate sowie derivate davon, die sich als solche oder als komposite für (matrix-)systeme mit hoher transluzenz und guter mechanik eignen | |
| EP1148071B1 (de) | Hydrolysestabile und polymerisierbare Acrylphosphonsäuremonoester | |
| DE10234326B3 (de) | Dentalmaterialien auf der Basis von Acrylesterphosphonsäuren | |
| DE10242106A1 (de) | Phosphorgruppenhaltige Carbonsäurederivate mit organisch polymerisierbaren Gruppen | |
| DE4323617A1 (de) | Polymerisierbare Enamine | |
| CH617346A5 (en) | Curable cement composition | |
| DE19749349A1 (de) | Polymerisierbare Zusammensetzung und ihre Verwendung als Haftvermittler |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OR8 | Request for search as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8105 | Search report available | ||
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |