DE3402599C2 - Verfahren zur Herstellung von N-substituierten α,ß-ungesättigten Carbonsäureamiden - Google Patents
Verfahren zur Herstellung von N-substituierten α,ß-ungesättigten CarbonsäureamidenInfo
- Publication number
- DE3402599C2 DE3402599C2 DE3402599A DE3402599A DE3402599C2 DE 3402599 C2 DE3402599 C2 DE 3402599C2 DE 3402599 A DE3402599 A DE 3402599A DE 3402599 A DE3402599 A DE 3402599A DE 3402599 C2 DE3402599 C2 DE 3402599C2
- Authority
- DE
- Germany
- Prior art keywords
- substituted
- unsaturated
- michael addition
- mol
- carboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 23
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000003857 carboxamides Chemical class 0.000 title description 17
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 14
- -1 amido nitrogen Chemical compound 0.000 claims abstract description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 6
- 238000009835 boiling Methods 0.000 claims abstract description 6
- 230000008030 elimination Effects 0.000 claims abstract description 5
- 238000003379 elimination reaction Methods 0.000 claims abstract description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 3
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims abstract description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 13
- 238000006845 Michael addition reaction Methods 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000005846 sugar alcohols Polymers 0.000 claims description 6
- 238000007056 transamidation reaction Methods 0.000 claims description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 4
- 230000001476 alcoholic effect Effects 0.000 claims description 4
- 150000001414 amino alcohols Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 claims description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 claims description 2
- 238000005815 base catalysis Methods 0.000 claims description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 2
- 235000011187 glycerol Nutrition 0.000 claims description 2
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 claims description 2
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 claims 3
- 125000001033 ether group Chemical group 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 14
- 230000015572 biosynthetic process Effects 0.000 abstract description 4
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- 150000007934 α,β-unsaturated carboxylic acids Chemical class 0.000 abstract 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- 238000000197 pyrolysis Methods 0.000 description 15
- 150000001412 amines Chemical class 0.000 description 14
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- 239000000047 product Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- 125000006239 protecting group Chemical class 0.000 description 6
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 5
- 150000001298 alcohols Chemical class 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 4
- 150000003141 primary amines Chemical class 0.000 description 4
- 150000003335 secondary amines Chemical class 0.000 description 4
- 238000007086 side reaction Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 150000003926 acrylamides Chemical class 0.000 description 3
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- ADTJPOBHAXXXFS-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]prop-2-enamide Chemical compound CN(C)CCCNC(=O)C=C ADTJPOBHAXXXFS-UHFFFAOYSA-N 0.000 description 3
- WDFKEEALECCKTJ-UHFFFAOYSA-N n-propylprop-2-enamide Chemical compound CCCNC(=O)C=C WDFKEEALECCKTJ-UHFFFAOYSA-N 0.000 description 3
- LTHNHFOGQMKPOV-UHFFFAOYSA-N 2-ethylhexan-1-amine Chemical compound CCCCC(CC)CN LTHNHFOGQMKPOV-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- WEWMLPXWLVIVNW-UHFFFAOYSA-N n-(2-ethylhexyl)prop-2-enamide Chemical compound CCCCC(CC)CNC(=O)C=C WEWMLPXWLVIVNW-UHFFFAOYSA-N 0.000 description 2
- SBOJXQVPLKSXOG-UHFFFAOYSA-N o-amino-hydroxylamine Chemical class NON SBOJXQVPLKSXOG-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- 229940105325 3-dimethylaminopropylamine Drugs 0.000 description 1
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 238000006728 Cope elimination reaction Methods 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical class [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- 238000005985 Hofmann elimination reaction Methods 0.000 description 1
- 229920006063 Lamide® Polymers 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- ZZSGYARVLIMPBM-UHFFFAOYSA-N n-[3-(dimethylamino)-2,2-dimethylpropyl]prop-2-enamide Chemical compound CN(C)CC(C)(C)CNC(=O)C=C ZZSGYARVLIMPBM-UHFFFAOYSA-N 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical class CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 229920003176 water-insoluble polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3402599A DE3402599C2 (de) | 1984-01-26 | 1984-01-26 | Verfahren zur Herstellung von N-substituierten α,ß-ungesättigten Carbonsäureamiden |
| EP85100604A EP0151967B1 (de) | 1984-01-26 | 1985-01-22 | Verfahren zur Herstellung von N-substituierten, alpha, beta-ungesättigten Carbonsäureamiden |
| CA000472562A CA1236485A (en) | 1984-01-26 | 1985-01-22 | PROCESS FOR THE PRODUCTION OF N-SUBSTITUTED .alpha.,.beta.- UNSATURATED CARBOXYLIC ACID AMIDES |
| AT85100604T ATE45727T1 (de) | 1984-01-26 | 1985-01-22 | Verfahren zur herstellung von n-substituierten, alpha, beta-ungesaettigten carbonsaeureamiden. |
| DE8585100604T DE3572476D1 (en) | 1984-01-26 | 1985-01-22 | Process for the preparation of n-substituted alpha, beta-unsaturated carboxylic acid amides |
| DD85272696A DD228543A5 (de) | 1984-01-26 | 1985-01-22 | Verfahren zur herstellung von n-substituierten alpha, beta- ungesaettigten carbonsaeureamiden |
| JP60010009A JPS60163851A (ja) | 1984-01-26 | 1985-01-24 | N‐置換α,β‐不飽和カルボン酸アミドの製造方法 |
| US06/695,125 US4644083A (en) | 1984-01-26 | 1985-01-25 | Process for the production of N-substituted α,β-unsaturated carboxylic acid amides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3402599A DE3402599C2 (de) | 1984-01-26 | 1984-01-26 | Verfahren zur Herstellung von N-substituierten α,ß-ungesättigten Carbonsäureamiden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3402599A1 DE3402599A1 (de) | 1985-09-05 |
| DE3402599C2 true DE3402599C2 (de) | 1986-02-27 |
Family
ID=6225938
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3402599A Expired DE3402599C2 (de) | 1984-01-26 | 1984-01-26 | Verfahren zur Herstellung von N-substituierten α,ß-ungesättigten Carbonsäureamiden |
| DE8585100604T Expired DE3572476D1 (en) | 1984-01-26 | 1985-01-22 | Process for the preparation of n-substituted alpha, beta-unsaturated carboxylic acid amides |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8585100604T Expired DE3572476D1 (en) | 1984-01-26 | 1985-01-22 | Process for the preparation of n-substituted alpha, beta-unsaturated carboxylic acid amides |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4644083A (enExample) |
| EP (1) | EP0151967B1 (enExample) |
| JP (1) | JPS60163851A (enExample) |
| AT (1) | ATE45727T1 (enExample) |
| CA (1) | CA1236485A (enExample) |
| DD (1) | DD228543A5 (enExample) |
| DE (2) | DE3402599C2 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL89371A (en) * | 1988-02-24 | 1993-07-08 | Us Commerce | Polyacrylamide gels, their preparation and their use for detection and separation of proteins |
| US4846130A (en) * | 1988-07-05 | 1989-07-11 | General Motors Corporation | Engine ignition timing with knock control by combustion pressure harmonic amplitude ratio |
| US4959489A (en) * | 1989-10-02 | 1990-09-25 | Air Products And Chemicals, Inc. | Process for making an acrylamide containing a dialkyl acetal group |
| US5631003A (en) * | 1991-09-25 | 1997-05-20 | Henkel Kommanditgesellschaft Auf Aktien | Hair treatment prepartation |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2623838A1 (de) * | 1976-05-28 | 1977-12-15 | Basf Ag | Verfahren zur herstellung von n-substituierten acrylamiden |
| US4288390A (en) * | 1977-12-02 | 1981-09-08 | The Dow Chemical Co. | Preparation of N-(aminomethyl)-α,β-ethylenically unsaturated carboxamides and their polymers |
| DE2809102C2 (de) * | 1978-03-03 | 1986-12-04 | Röhm GmbH, 6100 Darmstadt | Verfahren zur Herstellung von α,β-ungesättigen Carbonsäureamiden |
| DE2836520C2 (de) * | 1978-08-21 | 1984-03-22 | Chemische Fabrik Stockhausen GmbH, 4150 Krefeld | Verfahren zur Herstellung von alpha , beta -ungesättigten, N-substituierten Carbonsäureamiden |
| ATE15377T1 (de) * | 1978-12-27 | 1985-09-15 | Stockhausen Chem Fab Gmbh | Polymerisate von alpha,beta-ungesaettigten nsubstituierten carbonsaeureamiden und ihre verwendung als sedimentations-, flockungs-, entwaesserungs- und retentionshilfsmittel. |
| DE3128574C2 (de) * | 1981-07-20 | 1984-03-29 | Deutsche Texaco Ag, 2000 Hamburg | Verfahren zur Herstellung von N-substituierten Acryl- und Methacrylamiden |
-
1984
- 1984-01-26 DE DE3402599A patent/DE3402599C2/de not_active Expired
-
1985
- 1985-01-22 DE DE8585100604T patent/DE3572476D1/de not_active Expired
- 1985-01-22 EP EP85100604A patent/EP0151967B1/de not_active Expired
- 1985-01-22 CA CA000472562A patent/CA1236485A/en not_active Expired
- 1985-01-22 DD DD85272696A patent/DD228543A5/de unknown
- 1985-01-22 AT AT85100604T patent/ATE45727T1/de not_active IP Right Cessation
- 1985-01-24 JP JP60010009A patent/JPS60163851A/ja active Granted
- 1985-01-25 US US06/695,125 patent/US4644083A/en not_active Expired - Lifetime
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0434982B2 (enExample) | 1992-06-09 |
| EP0151967A2 (de) | 1985-08-21 |
| EP0151967A3 (en) | 1986-07-30 |
| US4644083A (en) | 1987-02-17 |
| ATE45727T1 (de) | 1989-09-15 |
| DD228543A5 (de) | 1985-10-16 |
| DE3402599A1 (de) | 1985-09-05 |
| EP0151967B1 (de) | 1989-08-23 |
| JPS60163851A (ja) | 1985-08-26 |
| DE3572476D1 (en) | 1989-09-28 |
| CA1236485A (en) | 1988-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2816516A1 (de) | Verfahren zur herstellung n-substituierter acryl- und methcrylamide | |
| EP0583695B1 (de) | Verfahren zur Herstellung von Ameisensäure aus Kohlenmonoxid und Wasser | |
| DD207198A5 (de) | Verfahren zur herstellung von n-(tert.aminoalkyl)acrylamiden | |
| WO2004103952A1 (de) | Verfahren zur kontinuierlichen herstellung von alkylamino(meth)acrylamiden | |
| DE2826676A1 (de) | Verfahren zur herstellung von n-acyl-derivaten von aminosaeuren | |
| EP1814844B1 (de) | Verfahren zur kontinuierlichen herstellung von alkylaminoacrylamiden | |
| DE3402599C2 (de) | Verfahren zur Herstellung von N-substituierten α,ß-ungesättigten Carbonsäureamiden | |
| DE3048020C2 (enExample) | ||
| EP2417098A1 (de) | Verfahren zur kontinuierlichen herstellung von alkylamino(meth)acrylamiden | |
| EP0070425B1 (de) | Verfahren zur Herstellung von N-substituierten Acryl- und Methacrylamiden | |
| DE3028792A1 (de) | Verfahren zur herstellung von (beta)-aminopropionamiden. | |
| EP0089417A1 (de) | Verfahren zur Herstellung von Phthalid | |
| DE3039572A1 (de) | Verfahren zur herstellung von (beta) -aminopropionamiden | |
| EP0449777A1 (de) | Verfahren zur Herstellung von Hydroxyphenylpropionaten | |
| EP0070424B1 (de) | Verfahren zur Herstellung von N,N'-disubstituierten 3-Aminopropanamiden | |
| DE2527157C2 (de) | Verfahren zur Herstellung von 2-Formylchinoxalin-N↑1↑,N↑4↑-dioxyddimethylacetal | |
| EP0171046B1 (de) | Verfahren zur Herstellung von Pantolacton | |
| DE2749415C2 (de) | Verfahren zur Herstellung von Aminen aus Formamiden | |
| DE3402997A1 (de) | Verfahren zur herstellung von 3-n-dialkylaminophenolen | |
| DE69620162T2 (de) | Reduktives verfahren zur herstellung von ethylendiamindibernsteinsäure | |
| DE1543317C3 (de) | Verfahren zur Herstellung von Aminen | |
| DE2058237C (enExample) | ||
| EP1078916A1 (de) | Verfahren zur Herstellung von N-Acyl-aminosäureestern und N-Acyl-aminoacetalen | |
| AT222104B (de) | Verfahren zur Herstellung von neuen Cyclobutanderivaten | |
| DE2832760C2 (de) | Verfahren zur Herstellung von Methacrylsäureestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |