DE3323804A1 - Verfahren zur herstellung waessriger polymerdispersionen und ihre verwendung - Google Patents
Verfahren zur herstellung waessriger polymerdispersionen und ihre verwendungInfo
- Publication number
- DE3323804A1 DE3323804A1 DE19833323804 DE3323804A DE3323804A1 DE 3323804 A1 DE3323804 A1 DE 3323804A1 DE 19833323804 DE19833323804 DE 19833323804 DE 3323804 A DE3323804 A DE 3323804A DE 3323804 A1 DE3323804 A1 DE 3323804A1
- Authority
- DE
- Germany
- Prior art keywords
- starch
- polymerization
- monomers
- water
- initiators
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000006185 dispersion Substances 0.000 title claims description 21
- 229920000642 polymer Polymers 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title description 8
- 229920002472 Starch Polymers 0.000 claims description 36
- 235000019698 starch Nutrition 0.000 claims description 35
- 239000000178 monomer Substances 0.000 claims description 34
- 238000006116 polymerization reaction Methods 0.000 claims description 24
- 239000008107 starch Substances 0.000 claims description 21
- 239000003999 initiator Substances 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 229920000881 Modified starch Polymers 0.000 claims description 11
- -1 ketone peroxides Chemical class 0.000 claims description 11
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 8
- 239000003638 chemical reducing agent Substances 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 235000019426 modified starch Nutrition 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 239000000654 additive Substances 0.000 claims description 6
- 229920000856 Amylose Polymers 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000000843 powder Substances 0.000 claims description 4
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 claims description 3
- 150000002432 hydroperoxides Chemical class 0.000 claims description 3
- 150000003464 sulfur compounds Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 235000010323 ascorbic acid Nutrition 0.000 claims description 2
- 229960005070 ascorbic acid Drugs 0.000 claims description 2
- 239000011668 ascorbic acid Substances 0.000 claims description 2
- 229920003023 plastic Polymers 0.000 claims description 2
- 239000004033 plastic Substances 0.000 claims description 2
- TYQCGQRIZGCHNB-JLAZNSOCSA-N l-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(O)=C(O)C1=O TYQCGQRIZGCHNB-JLAZNSOCSA-N 0.000 claims 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 26
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 11
- 239000005977 Ethylene Substances 0.000 description 11
- 239000000084 colloidal system Substances 0.000 description 10
- 230000001681 protective effect Effects 0.000 description 10
- 229920001353 Dextrin Polymers 0.000 description 9
- 239000004375 Dextrin Substances 0.000 description 9
- 235000019425 dextrin Nutrition 0.000 description 9
- 244000024675 Eruca sativa Species 0.000 description 8
- 235000014755 Eruca sativa Nutrition 0.000 description 8
- 229920002554 vinyl polymer Polymers 0.000 description 8
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 6
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical group CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 4
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 4
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 229920001592 potato starch Polymers 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229920000945 Amylopectin Polymers 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Natural products OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 230000008961 swelling Effects 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 2
- FYGDTMLNYKFZSV-MRCIVHHJSA-N dextrin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)OC1O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@H](O[C@H](O)[C@H](O)[C@H]2O)CO)[C@H](O)[C@H]1O FYGDTMLNYKFZSV-MRCIVHHJSA-N 0.000 description 2
- 239000012969 di-tertiary-butyl peroxide Substances 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- CCNDGKOREYKPJK-UHFFFAOYSA-N 1-hydroperoxy-2,3-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=CC(OO)=C1C(C)C CCNDGKOREYKPJK-UHFFFAOYSA-N 0.000 description 1
- LRMVVNSHAPBLDH-UHFFFAOYSA-N 1-tert-butyl-4-hydroperoxybenzene Chemical compound CC(C)(C)C1=CC=C(OO)C=C1 LRMVVNSHAPBLDH-UHFFFAOYSA-N 0.000 description 1
- JGBAASVQPMTVHO-UHFFFAOYSA-N 2,5-dihydroperoxy-2,5-dimethylhexane Chemical compound OOC(C)(C)CCC(C)(C)OO JGBAASVQPMTVHO-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- LIZVXGBYTGTTTI-UHFFFAOYSA-N 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(C(O)=O)C1=CC=CC=C1 LIZVXGBYTGTTTI-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- XRXANEMIFVRKLN-UHFFFAOYSA-N 2-hydroperoxy-2-methylbutane Chemical compound CCC(C)(C)OO XRXANEMIFVRKLN-UHFFFAOYSA-N 0.000 description 1
- COYVUQLAMAWYQP-UHFFFAOYSA-N 2-hydroperoxy-4-nitro-1-propan-2-ylbenzene Chemical compound CC(C)c1ccc(cc1OO)[N+]([O-])=O COYVUQLAMAWYQP-UHFFFAOYSA-N 0.000 description 1
- SGJUFIMCHSLMRJ-UHFFFAOYSA-N 2-hydroperoxypropane Chemical compound CC(C)OO SGJUFIMCHSLMRJ-UHFFFAOYSA-N 0.000 description 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- IHDBZCJYSHDCKF-UHFFFAOYSA-N 4,6-dichlorotriazine Chemical class ClC1=CC(Cl)=NN=N1 IHDBZCJYSHDCKF-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- RREANTFLPGEWEN-MBLPBCRHSA-N 7-[4-[[(3z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-fluoro-2-oxoindol-1-yl]methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(=NC(\N=C/3C4=CC(F)=CC=C4N(CN4CCN(CC4)C=4C(=CC=5C(=O)C(C(O)=O)=CN(C=5C=4)C4CC4)F)C\3=O)=NC=2)N)=C1 RREANTFLPGEWEN-MBLPBCRHSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 239000002000 Electrolyte additive Substances 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Natural products CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- ROPXFXOUUANXRR-BUHFOSPRSA-N bis(2-ethylhexyl) (e)-but-2-enedioate Chemical compound CCCCC(CC)COC(=O)\C=C\C(=O)OCC(CC)CCCC ROPXFXOUUANXRR-BUHFOSPRSA-N 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- HWEQKSVYKBUIIK-UHFFFAOYSA-N cyclobuta-1,3-diene Chemical compound C1=CC=C1 HWEQKSVYKBUIIK-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical class OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000002036 drum drying Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-M ethenesulfonate Chemical compound [O-]S(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-M 0.000 description 1
- GLVVKKSPKXTQRB-UHFFFAOYSA-N ethenyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OC=C GLVVKKSPKXTQRB-UHFFFAOYSA-N 0.000 description 1
- GFJVXXWOPWLRNU-UHFFFAOYSA-N ethenyl formate Chemical compound C=COC=O GFJVXXWOPWLRNU-UHFFFAOYSA-N 0.000 description 1
- LZWYWAIOTBEZFN-UHFFFAOYSA-N ethenyl hexanoate Chemical compound CCCCCC(=O)OC=C LZWYWAIOTBEZFN-UHFFFAOYSA-N 0.000 description 1
- AFSIMBWBBOJPJG-UHFFFAOYSA-N ethenyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC=C AFSIMBWBBOJPJG-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- NKSJNEHGWDZZQF-UHFFFAOYSA-N ethenyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)C=C NKSJNEHGWDZZQF-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- QGKLCGVVGGFZBS-UHFFFAOYSA-N formaldehyde;zinc Chemical compound [Zn].O=C QGKLCGVVGGFZBS-UHFFFAOYSA-N 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 239000001341 hydroxy propyl starch Substances 0.000 description 1
- 235000013828 hydroxypropyl starch Nutrition 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- XMYQHJDBLRZMLW-UHFFFAOYSA-N methanolamine Chemical class NCO XMYQHJDBLRZMLW-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 235000013808 oxidized starch Nutrition 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 description 1
- GOPSAMYJSPYXPL-UHFFFAOYSA-N prop-2-enyl n-(hydroxymethyl)carbamate Chemical compound OCNC(=O)OCC=C GOPSAMYJSPYXPL-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012966 redox initiator Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- XWGJFPHUCFXLBL-UHFFFAOYSA-M rongalite Chemical compound [Na+].OCS([O-])=O XWGJFPHUCFXLBL-UHFFFAOYSA-M 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- GRJISGHXMUQUMC-UHFFFAOYSA-N silyl prop-2-enoate Chemical class [SiH3]OC(=O)C=C GRJISGHXMUQUMC-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical class OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/12—Polymerisation in non-solvents
- C08F2/16—Aqueous medium
- C08F2/20—Aqueous medium with the aid of macromolecular dispersing agents
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Graft Or Block Polymers (AREA)
- Paper (AREA)
- Polymerization Catalysts (AREA)
- Adhesives Or Adhesive Processes (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833323804 DE3323804A1 (de) | 1983-07-01 | 1983-07-01 | Verfahren zur herstellung waessriger polymerdispersionen und ihre verwendung |
| JP59130228A JPS6015401A (ja) | 1983-07-01 | 1984-06-26 | 水性ポリマ−分散液の製法 |
| JP59130230A JPS6015430A (ja) | 1983-07-01 | 1984-06-26 | 流動性で、良好に再分散可能な分散粉末の製法 |
| DE8484107404T DE3476548D1 (en) | 1983-07-01 | 1984-06-28 | Process for preparing redispersable powder based on dispersions stabilised with natural substances as protective colloids |
| EP84107402A EP0134449B1 (de) | 1983-07-01 | 1984-06-28 | Verfahren zur Herstellung wässriger Polymerdispersionen und ihre Verwendung |
| DE8484107402T DE3476544D1 (en) | 1983-07-01 | 1984-06-28 | Process for preparing aqueous polymer dispersions, and their use |
| EP84107404A EP0134451B1 (de) | 1983-07-01 | 1984-06-28 | Verfahren zur Herstellung von redispergierbarem Pulver auf Basis von mit als Schutzkolloid verwendeten Naturstoffen stabilisierten Dispersionen |
| US06/625,669 US4560724A (en) | 1983-07-01 | 1984-06-28 | Aqueous polymer dispersions preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833323804 DE3323804A1 (de) | 1983-07-01 | 1983-07-01 | Verfahren zur herstellung waessriger polymerdispersionen und ihre verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3323804A1 true DE3323804A1 (de) | 1985-01-03 |
Family
ID=6202934
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833323804 Withdrawn DE3323804A1 (de) | 1983-07-01 | 1983-07-01 | Verfahren zur herstellung waessriger polymerdispersionen und ihre verwendung |
| DE8484107402T Expired DE3476544D1 (en) | 1983-07-01 | 1984-06-28 | Process for preparing aqueous polymer dispersions, and their use |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484107402T Expired DE3476544D1 (en) | 1983-07-01 | 1984-06-28 | Process for preparing aqueous polymer dispersions, and their use |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4560724A (OSRAM) |
| EP (1) | EP0134449B1 (OSRAM) |
| JP (2) | JPS6015401A (OSRAM) |
| DE (2) | DE3323804A1 (OSRAM) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4845152A (en) * | 1986-05-12 | 1989-07-04 | National Starch And Chemical Corporation | Tape joint compounds utilizing starch stabilized emulsions as binders |
| EP0334515A1 (en) * | 1988-03-21 | 1989-09-27 | Cerestar Holding Bv | Polymer compositions |
| EP0408099A1 (de) * | 1989-07-11 | 1991-01-16 | Synthomer Chemie Gmbh | Verfahren zur Herstellung wässriger Polymerisatdispersionen |
| US5358998A (en) * | 1991-10-07 | 1994-10-25 | Basf Aktiengesellschaft | Aqueous polymer dispersions |
| US5667848A (en) * | 1992-10-06 | 1997-09-16 | Basf Aktiengesellschaft | Use of aqueous polymer dispersions as textile auxiliaries for easy-care finishing of textiles |
| US5705563A (en) * | 1991-10-07 | 1998-01-06 | Basf Aktiengesellschaft | Aqueous polymer dispersions |
| EP0818498A2 (en) * | 1991-02-05 | 1998-01-14 | Penford Products Company | Reinforced films made from water soluble polymers |
| WO1998013411A1 (de) * | 1996-09-24 | 1998-04-02 | bcd Rohstoffe für Bauchemie HandelsgmbH | Sprühgetrocknete dispersionen, verfahren zu ihrer herstellung und deren anwendung |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4945017A (en) * | 1986-07-09 | 1990-07-31 | Pennzoil Products Company | Rust conversion composition |
| US5015507A (en) * | 1986-07-09 | 1991-05-14 | Pennzoil Products Company | Method of converting rusted surface to a durable one |
| DE3627594A1 (de) | 1986-08-14 | 1988-02-18 | Basf Ag | Leimungsmittel fuer papier auf basis feinteiliger waessriger dispersionen |
| DE3702712A1 (de) * | 1987-01-30 | 1988-08-11 | Basf Ag | Leimungsmittel fuer papier auf basis feinteiliger waessriger dispersionen |
| RU2067831C1 (ru) * | 1987-06-24 | 1996-10-20 | Мицуи Тоацу Кемикалз Инк. | Жидкая пестицидная композиция |
| US4940741A (en) * | 1988-06-17 | 1990-07-10 | National Starch And Chemical Investment Holding Corporation | Process for the production of hardboard |
| US5003022A (en) * | 1989-02-10 | 1991-03-26 | Penford Products Company | Starch graft polymers |
| US5223569A (en) * | 1989-05-24 | 1993-06-29 | Zimmer Elektromedizin Gmbh | Self-adhesive conductive elastic gel |
| AT395244B (de) * | 1989-05-31 | 1992-10-27 | Hoffenreich Ludwig & Sohn | Verfahren zur herstellung von waessrigen polymerdispersionen, deren verwendung und eine haertbare mischung |
| IT1241443B (it) * | 1990-12-05 | 1994-01-17 | S E I P I Societa Esportazione | Procedimento per ottenere fasi monomeriche in forma di microsfere, omogeneamente sospese in una fase continua costituita da gel di polisaccaridi, polimerizzazione delle stesse ed applicazione dei materiali ottenuti nei settori dei biomateriali, ottico,dell'industriamanifatturiera e dell'ingegneria civile |
| US5269980A (en) * | 1991-08-05 | 1993-12-14 | Northeastern University | Production of polymer particles in powder form using an atomization technique |
| DE4133191A1 (de) * | 1991-10-07 | 1993-04-08 | Basf Ag | Schleifmittel |
| JP2567790B2 (ja) * | 1992-09-11 | 1996-12-25 | アイカ工業株式会社 | ポリ酢酸ビニル系エマルジョン |
| DE59305131D1 (de) * | 1992-10-06 | 1997-02-27 | Basf Ag | Zur Kompostierung geeigneter Vliesstoff, gebunden mit einem Saccharidpfropfpolymerisat |
| DE69420378T2 (de) * | 1993-12-23 | 1999-12-30 | Nitto Denko Corp., Ibaraki | Verfahren zur Herstellung einer wässrigen Dispersion eines Acrylpolymeren, Acrylpolymer so hergestellt, und druckempfindlicher Klebstoff, der dieses Polymer enthält |
| DE4431344A1 (de) * | 1994-09-02 | 1996-03-07 | Hoechst Ag | Wäßrige Dispersionen für Klebstoffe |
| US6090892A (en) | 1995-07-17 | 2000-07-18 | Mitsui Toatsu Chemicals, Inc. | Redispersible polymer and production process thereof |
| IT1276816B1 (it) * | 1995-10-04 | 1997-11-03 | Atochem Elf Italia | Emulsione a basso voc |
| DE19613931A1 (de) * | 1996-04-06 | 1997-10-09 | Hoechst Ag | Pulverförmige Klebstoffzusammensetzung |
| WO1999009251A1 (en) * | 1997-08-15 | 1999-02-25 | Penford Corporation | Starch copolymer products and process |
| US6245838B1 (en) | 1998-02-03 | 2001-06-12 | 3M Innovative Properties Company | Method of suspension polymerization of (meth)acrylic monomers using dextrin, and polymer beads resulting from that method |
| US6090884A (en) * | 1998-05-07 | 2000-07-18 | S. C. Johnson Commercial Markets, Inc. | Starch degradation/graft polymerization composition, process, and uses thereof |
| US6114417A (en) * | 1998-10-16 | 2000-09-05 | Cytec Technology Corp. | Paper sizing agents and methods |
| US6800675B1 (en) * | 1999-10-19 | 2004-10-05 | Südzucker Aktiengesellschaft Mannheim/Ochsenfurt | Emulsion polymerization method |
| US6414055B1 (en) | 2000-04-25 | 2002-07-02 | Hercules Incorporated | Method for preparing aqueous size composition |
| CN103732645A (zh) * | 2011-08-11 | 2014-04-16 | 亨斯迈石油化学有限责任公司 | 增稠剂作为聚氨酯胺催化剂稀释剂的用途 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB854191A (en) * | 1958-02-05 | 1960-11-16 | British Celanese | Improvements in or relating to the production of resinous compositions |
| US3632535A (en) * | 1967-09-20 | 1972-01-04 | Cpc International Inc | Emulsion polymerization method and resultant aqueous latex |
| US3769248A (en) * | 1971-10-06 | 1973-10-30 | Anheuser Busch | Starch derivative protective colloids in emulsion polymer systems |
| DE2456576C3 (de) * | 1974-11-29 | 1983-03-10 | Wacker-Chemie GmbH, 8000 München | Verfahren zur kontinuierlichen Herstellung von Äthylen-Vinylacetat-Copolymerdispersionen |
| JPS603087B2 (ja) * | 1976-06-17 | 1985-01-25 | 住友化学工業株式会社 | 水性分散液の製造方法 |
| US4219454A (en) * | 1978-09-05 | 1980-08-26 | Air Products And Chemicals, Inc. | Vinyl acetate copolymer emulsions for paint |
| DE2915887A1 (de) * | 1979-04-19 | 1980-11-06 | Wacker Chemie Gmbh | Copolymerisate auf der basis von acrylestern, vinylacetat und aethylen |
-
1983
- 1983-07-01 DE DE19833323804 patent/DE3323804A1/de not_active Withdrawn
-
1984
- 1984-06-26 JP JP59130228A patent/JPS6015401A/ja active Pending
- 1984-06-26 JP JP59130230A patent/JPS6015430A/ja active Granted
- 1984-06-28 EP EP84107402A patent/EP0134449B1/de not_active Expired
- 1984-06-28 US US06/625,669 patent/US4560724A/en not_active Expired - Fee Related
- 1984-06-28 DE DE8484107402T patent/DE3476544D1/de not_active Expired
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4845152A (en) * | 1986-05-12 | 1989-07-04 | National Starch And Chemical Corporation | Tape joint compounds utilizing starch stabilized emulsions as binders |
| EP0334515A1 (en) * | 1988-03-21 | 1989-09-27 | Cerestar Holding Bv | Polymer compositions |
| EP0408099A1 (de) * | 1989-07-11 | 1991-01-16 | Synthomer Chemie Gmbh | Verfahren zur Herstellung wässriger Polymerisatdispersionen |
| EP0818498A2 (en) * | 1991-02-05 | 1998-01-14 | Penford Products Company | Reinforced films made from water soluble polymers |
| US5358998A (en) * | 1991-10-07 | 1994-10-25 | Basf Aktiengesellschaft | Aqueous polymer dispersions |
| US5536779A (en) * | 1991-10-07 | 1996-07-16 | Basf Aktiengesellschaft | Aqueous polymer dispersions |
| US5705563A (en) * | 1991-10-07 | 1998-01-06 | Basf Aktiengesellschaft | Aqueous polymer dispersions |
| US5667848A (en) * | 1992-10-06 | 1997-09-16 | Basf Aktiengesellschaft | Use of aqueous polymer dispersions as textile auxiliaries for easy-care finishing of textiles |
| WO1998013411A1 (de) * | 1996-09-24 | 1998-04-02 | bcd Rohstoffe für Bauchemie HandelsgmbH | Sprühgetrocknete dispersionen, verfahren zu ihrer herstellung und deren anwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0134449A3 (en) | 1985-05-29 |
| EP0134449A2 (de) | 1985-03-20 |
| DE3476544D1 (en) | 1989-03-09 |
| JPH0354973B2 (OSRAM) | 1991-08-21 |
| EP0134449B1 (de) | 1989-02-01 |
| US4560724A (en) | 1985-12-24 |
| JPS6015401A (ja) | 1985-01-26 |
| JPS6015430A (ja) | 1985-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0134449B1 (de) | Verfahren zur Herstellung wässriger Polymerdispersionen und ihre Verwendung | |
| EP0133899B1 (de) | Verfahren zur Herstellung wässriger Polymerdispersionen und ihre Verwendung | |
| EP0062106B1 (de) | Verfahren zur Herstellung von Copolymerisaten erhöhter Wasserfestigkeit und ihre Verwendung | |
| DE69115448T2 (de) | Vinylacetat/Äthylen-Copolymeremulsionen mit verbesserten nasshaftenden Eigenschaften | |
| WO1984000369A1 (fr) | Procede pour la preparation de dispersions de polymeres et leur utilisation | |
| EP1232189B1 (de) | Emulsionspolymerisationsverfahren | |
| DE1570312B2 (de) | Verfahren zur Herstellung von Polymerisatdispersionen | |
| EP0603746B1 (de) | Biologisch abbaubare, wässrige Dispersionen | |
| DE68914859T2 (de) | Vinylpolymere. | |
| EP0134451B1 (de) | Verfahren zur Herstellung von redispergierbarem Pulver auf Basis von mit als Schutzkolloid verwendeten Naturstoffen stabilisierten Dispersionen | |
| EP0538571B2 (de) | Verfahren zur Herstellung von schutzkolloidstabilisierten, emulgatorfreien, wässrigen Kunststoffdispersionen | |
| EP0134450B1 (de) | Verfahren zur Herstellung wässriger Polymerdispersionen und ihre Verwendung | |
| DE60015285T2 (de) | Verfahren zur Herstellung von Vinylacetat-Ethylen-Copolymer Emulsionen stabilisiert mit einer Polyethylenglykol-Polyvinylacetat- Mischung | |
| DE69700518T2 (de) | Acrylemulsionen hergestellt in gegenwart von vollständig hydrolysiertem Poly(vinylalcohol) | |
| EP0072900A1 (de) | Verfahren zur Herstellung von Polymeren und Copolymeren des Vinylchlorids durch Suspensionspolymerisation und Verwendung für den Einsatz als Viskositätserniedriger in der Plastisolverarbeitung | |
| EP0655464B1 (de) | Verfahren zur Herstellung von Schutzkolloid-stabilisierten Dispersionen | |
| DE60204270T3 (de) | Scherfluidisierende Polymer-Latexzusammensetzung auf Basis von Vinylacetat insbesondere für Klebstoffe | |
| DE68904328T2 (de) | Polyacrylat dispersionen hergestellt mit einem wasserloeslichen, conjugiert ungesaettigten monomer in abwesenheit eines schutzkolloids. | |
| EP1021487B1 (de) | Verfahren zur herstellung von wässrigen, schutzkolloid-stabilisierten vinylester-homo- und -co-polymerdispersionen | |
| DE2905121C2 (de) | Verfahren zur Herstellung einer wäßrigen Polymerdispersion | |
| DE102012205455A1 (de) | Verfahren zur Herstellung von Vinylesterpolymeren mit gezielt einstellbarer Dispersität bei geringer Polydispersität | |
| DE69206197T2 (de) | Polymer Dispersionen von Vinylpivalat, Vinylacetat und Alkylen. | |
| DE1925353B2 (de) | Verfahren zur Herstellung von Polyvinylesterdispersionen | |
| DE3724331C2 (OSRAM) | ||
| DE3417388A1 (de) | Verfahren zur herstellung von redispergierbarem pulver auf basis von mit als schutzkolloid verwendeten naturstoffen stabilisierten dispersionen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |