DE3135972C2 - - Google Patents
Info
- Publication number
- DE3135972C2 DE3135972C2 DE3135972A DE3135972A DE3135972C2 DE 3135972 C2 DE3135972 C2 DE 3135972C2 DE 3135972 A DE3135972 A DE 3135972A DE 3135972 A DE3135972 A DE 3135972A DE 3135972 C2 DE3135972 C2 DE 3135972C2
- Authority
- DE
- Germany
- Prior art keywords
- display
- display unit
- glass tube
- display device
- discharge lamp
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000011521 glass Substances 0.000 claims description 41
- 238000004804 winding Methods 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 2
- 239000012799 electrically-conductive coating Substances 0.000 claims 1
- 239000007888 film coating Substances 0.000 claims 1
- 238000009501 film coating Methods 0.000 claims 1
- 239000000463 material Substances 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 229910052754 neon Inorganic materials 0.000 description 5
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 5
- 238000010586 diagram Methods 0.000 description 4
- 230000001070 adhesive effect Effects 0.000 description 3
- 230000005540 biological transmission Effects 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 229910052743 krypton Inorganic materials 0.000 description 2
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- GABQNAFEZZDSCM-RMKNXTFCSA-N Cinnamyl anthranilate Chemical compound NC1=CC=CC=C1C(=O)OC\C=C\C1=CC=CC=C1 GABQNAFEZZDSCM-RMKNXTFCSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000004110 Zinc silicate Substances 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000004397 blinking Effects 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- UGKDIUIOSMUOAW-UHFFFAOYSA-N iron nickel Chemical compound [Fe].[Ni] UGKDIUIOSMUOAW-UHFFFAOYSA-N 0.000 description 1
- 239000012858 resilient material Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- -1 tin halide Chemical class 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 239000005028 tinplate Substances 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- PBYZMCDFOULPGH-UHFFFAOYSA-N tungstate Chemical compound [O-][W]([O-])(=O)=O PBYZMCDFOULPGH-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- XSMMCTCMFDWXIX-UHFFFAOYSA-N zinc silicate Chemical compound [Zn+2].[O-][Si]([O-])=O XSMMCTCMFDWXIX-UHFFFAOYSA-N 0.000 description 1
- 235000019352 zinc silicate Nutrition 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G09—EDUCATION; CRYPTOGRAPHY; DISPLAY; ADVERTISING; SEALS
- G09F—DISPLAYING; ADVERTISING; SIGNS; LABELS OR NAME-PLATES; SEALS
- G09F13/00—Illuminated signs; Luminous advertising
- G09F13/26—Signs formed by electric discharge tubes
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Theoretical Computer Science (AREA)
- Control Of Indicators Other Than Cathode Ray Tubes (AREA)
- Electroluminescent Light Sources (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12784280A JPS5763756A (en) | 1980-09-12 | 1980-09-12 | Discharge lamp |
| JP15284580U JPS6120615Y2 (cg-RX-API-DMAC7.html) | 1980-10-24 | 1980-10-24 | |
| JP10475481A JPS5810789A (ja) | 1981-07-04 | 1981-07-04 | ディスプレイ装置 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3135972A1 DE3135972A1 (de) | 1982-04-29 |
| DE3135972C2 true DE3135972C2 (cg-RX-API-DMAC7.html) | 1991-06-27 |
Family
ID=27310311
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813135972 Granted DE3135972A1 (de) | 1980-09-12 | 1981-09-08 | Mit einer entladungslampe ausgestattete optische anzeigevorrichtung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4471350A (cg-RX-API-DMAC7.html) |
| AU (1) | AU553724B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1185791A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3135972A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2490378B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2087137B (cg-RX-API-DMAC7.html) |
| NL (1) | NL192160C (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4233861A1 (de) * | 1992-10-08 | 1994-04-14 | Aqua Signal Ag | Einrichtung zur Ansteuerung von Hochspannungsentladungslampen sowie ein Verfahren hierfür |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2164189A (en) * | 1984-09-05 | 1986-03-12 | Dr Khodayar Rashidi | Modular-display-system |
| GB2180383A (en) * | 1985-09-14 | 1987-03-25 | Paul William Baker | Illuminated display panel |
| JPS63146343A (ja) * | 1986-07-15 | 1988-06-18 | Toshiba Corp | 放電灯 |
| US4949487A (en) * | 1988-11-03 | 1990-08-21 | Fadil Kibarer | Illuminated display |
| US4988986A (en) * | 1988-12-22 | 1991-01-29 | Inventio Ag | Display module and multiple unit display constructed of such display modules |
| US5003233A (en) * | 1989-01-03 | 1991-03-26 | Gte Laboratories Incorporated | Radio frequency powered large scale display |
| DE3912299A1 (de) * | 1989-04-14 | 1990-11-29 | Joerg Michael Uhl | Leuchtroehrenanordnungs- und betriebssystem |
| CA2107987A1 (en) * | 1992-10-08 | 1994-04-09 | David R. Pacholok | Reduced tension modular neon sign system |
| US6069444A (en) * | 1992-12-16 | 2000-05-30 | Durel Corporation | Electroluminescent lamp devices and their manufacture |
| EP0678216B1 (en) * | 1992-12-16 | 2003-03-19 | Durel Corporation | Electroluminescent lamp devices and their manufacture |
| US5598065A (en) * | 1994-01-25 | 1997-01-28 | Lakosky; Allen J. | Lighting system for snowmobiles and the like |
| US5565741A (en) * | 1994-03-16 | 1996-10-15 | Osram Sylvania Inc. | Method of operating a neon discharge lamp particularly useful on a vehicle |
| US6175342B1 (en) * | 1996-04-15 | 2001-01-16 | Aadco, Inc. | Enhanced modular message board |
| US6150996A (en) * | 1998-08-26 | 2000-11-21 | Addco, Inc. | Changeable message sign system with reconfigurable sign screen |
| US6414650B1 (en) | 1996-04-15 | 2002-07-02 | Addco | Sign system with field changeable screen size and message |
| US5914698A (en) * | 1996-04-15 | 1999-06-22 | Addco Manufacturing, Inc. | Modular message board |
| US6305110B1 (en) * | 1998-11-13 | 2001-10-23 | Sheldon Chang | Interchangable modular programmable neon sign |
| RU2185665C1 (ru) * | 2000-10-31 | 2002-07-20 | Открытое акционерное общество "Научно-исследовательский институт газоразрядных приборов "Плазма" | Газоразрядная индикаторная панель |
| RU2185664C1 (ru) * | 2000-10-31 | 2002-07-20 | Открытое акционерное общество "Научно-исследовательский институт газоразрядных приборов "Плазма" | Газоразрядная индикаторная панель |
| RU2188461C1 (ru) * | 2000-12-05 | 2002-08-27 | Открытое акционерное общество "Научно-исследовательский институт газоразрядных приборов "Плазма" | Газоразрядная индикаторная панель |
| US6836259B2 (en) * | 2002-03-26 | 2004-12-28 | Visson Ip, Llc | Electrooptical display with changeable pictures |
| RU2221282C1 (ru) * | 2002-06-03 | 2004-01-10 | Открытое акционерное общество "Научно-исследовательский институт газоразрядных приборов "Плазма" | Газоразрядная индикаторная панель |
| RU2254619C2 (ru) * | 2003-03-31 | 2005-06-20 | Общество с ограниченной ответственностью "ДиС ПЛЮС" | Плазменная панель наборного экрана |
| US7467486B2 (en) * | 2006-05-22 | 2008-12-23 | Kaoh Andy K F | Method and apparatus for simulating the appearance of a neon sign |
| GB2473639A (en) * | 2009-09-18 | 2011-03-23 | Litelogic Ip Ltd | Display with multiple PCBs mounted to bus-bars |
| WO2013022952A2 (en) * | 2011-08-08 | 2013-02-14 | Ilight Technologies, Inc. | Apparatus pertaining to physically-discrete sign components |
| USD726258S1 (en) | 2012-10-03 | 2015-04-07 | Ilight Technologies, Inc. | Alphanumeric sign component |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3124712A (en) * | 1964-03-10 | Luminous high tension indicator | ||
| FR403208A (fr) * | 1908-06-30 | 1909-10-28 | Farbenfab Vorm Bayer F & Co | Procédé de production de matières colorantes disazoÏques et les produits qui en résultent |
| US2068741A (en) * | 1933-11-11 | 1937-01-26 | Radio Patents Corp | Gas-filled discharge tube |
| GB457797A (en) * | 1934-06-08 | 1936-12-07 | Rene Andre Coustal | Improvements in electric lamps for lighting purposes |
| GB490415A (en) * | 1937-02-05 | 1938-08-05 | Ilse Barasch | Improvements in luminous signs |
| US2291467A (en) * | 1941-01-21 | 1942-07-28 | Floray Corp | Luminescent sign |
| US2488169A (en) * | 1946-02-20 | 1949-11-15 | Benjamin B Schneider | Neon-type sign |
| US2731585A (en) * | 1951-06-15 | 1956-01-17 | Andres Soriano | Luminous display apparatus |
| US2801483A (en) * | 1954-12-29 | 1957-08-06 | Mercu Ray Ind Inc | Luminous signs |
| US3157823A (en) * | 1962-01-09 | 1964-11-17 | Etzon Corp | Luminous bodies energized by standing waves |
| US3947722A (en) * | 1974-06-19 | 1976-03-30 | Control Data Corporation | Electronic scan methods for plasma displays |
| US4153861A (en) * | 1977-10-17 | 1979-05-08 | Warner Arthur R | Electric discharge tube apparatus |
| US4277728A (en) * | 1978-05-08 | 1981-07-07 | Stevens Luminoptics | Power supply for a high intensity discharge or fluorescent lamp |
-
1981
- 1981-09-04 US US06/299,613 patent/US4471350A/en not_active Expired - Lifetime
- 1981-09-04 NL NL8104100A patent/NL192160C/nl not_active IP Right Cessation
- 1981-09-04 GB GB8126893A patent/GB2087137B/en not_active Expired
- 1981-09-08 DE DE19813135972 patent/DE3135972A1/de active Granted
- 1981-09-11 FR FR8117203A patent/FR2490378B1/fr not_active Expired
- 1981-12-03 AU AU78245/81A patent/AU553724B2/en not_active Expired
- 1981-12-15 CA CA000392360A patent/CA1185791A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4233861A1 (de) * | 1992-10-08 | 1994-04-14 | Aqua Signal Ag | Einrichtung zur Ansteuerung von Hochspannungsentladungslampen sowie ein Verfahren hierfür |
Also Published As
| Publication number | Publication date |
|---|---|
| AU7824581A (en) | 1983-06-09 |
| US4471350A (en) | 1984-09-11 |
| GB2087137B (en) | 1984-08-30 |
| CA1185791A (en) | 1985-04-23 |
| DE3135972A1 (de) | 1982-04-29 |
| NL8104100A (nl) | 1982-04-01 |
| FR2490378A1 (cg-RX-API-DMAC7.html) | 1982-03-19 |
| FR2490378B1 (cg-RX-API-DMAC7.html) | 1985-02-22 |
| AU553724B2 (en) | 1986-07-24 |
| NL192160C (nl) | 1997-02-04 |
| GB2087137A (en) | 1982-05-19 |
| NL192160B (nl) | 1996-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3135972C2 (cg-RX-API-DMAC7.html) | ||
| DE68915022T2 (de) | Entladungslampe. | |
| EP0824761B1 (de) | Verfahren zum betreiben von entladungslampen | |
| DE69106890T2 (de) | Steuerungsschaltung mit weitem einstellungsbereich für eine gasentladungslampe. | |
| DE3106892A1 (de) | Leuchtstofflampenanordnung und verfahren zum herstellen derselben | |
| DE19526211A1 (de) | Verfahren zum Betreiben von Entladungslampen bzw. -strahler | |
| DE2221719C2 (de) | Vorrichtung mit einer Niederdruckquecksilberdampfentladungslampe | |
| DE29900320U1 (de) | Bausatz für eine Beleuchtungsvorrichtung | |
| DE69125704T2 (de) | Integrierte hochfrequenzlichtquelle für grossbildanzeigevorrichtung | |
| EP0393449B1 (de) | Leuchtstofflampe | |
| EP0901687A1 (de) | Flachstrahler | |
| DE3212276C2 (de) | U-förmige Leuchtstofflampe mit Zündhilfen | |
| EP0912992A2 (de) | Flachstrahler | |
| DE3338464C2 (de) | Schaltungsanordnung zum Betrieb mindestens einer Leuchtstofflampe mit einstellbarer Helligkeit an einem selbstschwingenden Wechselrichter | |
| EP1276137B1 (de) | Dielektrische Barrieren-Entladungslampe mit Zündhilfe | |
| EP1124406B1 (de) | Betriebsverfahren für eine Entladungslampe mit mindestens einer dielektrisch behinderten Elektrode | |
| EP1430511A2 (de) | Dielektrische barriere-entladungslampe und verfahren sowie schaltungsanordnung zum zünden und betreiben dieser lampe | |
| DE19933405A1 (de) | Längliche Lichtquelle | |
| DE2729052A1 (de) | Verfahren zum betreiben von gasentladungslampen | |
| DE102005027431B4 (de) | Vorrichtung und Verfahren zum Ansteuern einer Lampe einer Flüssigkristall-Anzeigevorrichtung | |
| DE3141427C2 (cg-RX-API-DMAC7.html) | ||
| DE19524386A1 (de) | Stabförmige elektrische Leuchte | |
| DE112005003174B4 (de) | Entladungslampenvorrichtung mit geerdetem Spiegel | |
| DE2119472A1 (de) | Gleichstromgespeiste Gasentladungslampe | |
| DE19944575B4 (de) | Beleuchtungsvorrichtung mit mindestens einer elektrodenlosen Entladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: PFENNING, J., DIPL.-ING. MEINIG, K., DIPL.-PHYS., |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |