DE3133795C2 - - Google Patents
Info
- Publication number
- DE3133795C2 DE3133795C2 DE3133795A DE3133795A DE3133795C2 DE 3133795 C2 DE3133795 C2 DE 3133795C2 DE 3133795 A DE3133795 A DE 3133795A DE 3133795 A DE3133795 A DE 3133795A DE 3133795 C2 DE3133795 C2 DE 3133795C2
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- electrode
- discharge vessel
- discharge
- operating state
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000011734 sodium Substances 0.000 claims description 18
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 17
- 229910052708 sodium Inorganic materials 0.000 claims description 17
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 12
- 229910052721 tungsten Inorganic materials 0.000 claims description 12
- 239000010937 tungsten Substances 0.000 claims description 12
- 239000004020 conductor Substances 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 5
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 5
- 229910052756 noble gas Inorganic materials 0.000 claims description 5
- 229910052724 xenon Inorganic materials 0.000 claims description 4
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000000919 ceramic Substances 0.000 claims description 3
- 239000003870 refractory metal Substances 0.000 claims description 3
- 239000007772 electrode material Substances 0.000 description 4
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 230000008034 disappearance Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 239000007792 gaseous phase Substances 0.000 description 2
- 230000017525 heat dissipation Effects 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 1
- SIWVEOZUMHYXCS-UHFFFAOYSA-N oxo(oxoyttriooxy)yttrium Chemical compound O=[Y]O[Y]=O SIWVEOZUMHYXCS-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229910052594 sapphire Inorganic materials 0.000 description 1
- 239000010980 sapphire Substances 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- 229910001930 tungsten oxide Inorganic materials 0.000 description 1
- 239000011364 vaporized material Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/04—Electrodes; Screens; Shields
- H01J61/06—Main electrodes
- H01J61/073—Main electrodes for high-pressure discharge lamps
Landscapes
- Discharge Lamps And Accessories Thereof (AREA)
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE8005025,A NL185478C (nl) | 1980-09-05 | 1980-09-05 | Hogedruknatriumdampontladingslamp. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3133795A1 DE3133795A1 (de) | 1982-05-13 |
| DE3133795C2 true DE3133795C2 (enFirst) | 1992-06-25 |
Family
ID=19835832
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813133795 Granted DE3133795A1 (de) | 1980-09-05 | 1981-08-26 | "hochdrucknatriumdampfentladungslampe" |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4910433A (enFirst) |
| JP (1) | JPS5776743A (enFirst) |
| BE (1) | BE890204A (enFirst) |
| CA (1) | CA1163306A (enFirst) |
| DE (1) | DE3133795A1 (enFirst) |
| FR (1) | FR2490005A1 (enFirst) |
| GB (1) | GB2083692B (enFirst) |
| HU (1) | HU189529B (enFirst) |
| NL (1) | NL185478C (enFirst) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10245000B4 (de) * | 2001-09-28 | 2009-12-03 | Koito Manufacturing Co., Ltd. | Quecksilberfreie Lichtbogenröhre für Entladungslampeneinheit |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3373591D1 (en) * | 1982-12-30 | 1987-10-15 | Philips Nv | High-pressure sodium discharge lamp |
| JPS59118262U (ja) * | 1983-12-27 | 1984-08-09 | エヌ・ベ−・フイリツプス・フル−イランペンフアブリケン | 高圧ナトリウム放電灯 |
| JPH0353481A (ja) * | 1989-07-19 | 1991-03-07 | Yazaki Corp | 放電管 |
| DE69205228T2 (de) * | 1991-07-12 | 1996-05-02 | Philips Electronics Nv | Hochdrucknatriumlampe. |
| DE10129229A1 (de) * | 2001-06-19 | 2003-01-02 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL109963C (enFirst) * | 1959-07-08 | |||
| US3134924A (en) * | 1960-07-05 | 1964-05-26 | Monsanto Co | Emissive materials of a metal matrix with molecularly dispersed additives |
| US3476969A (en) * | 1967-02-16 | 1969-11-04 | Westinghouse Electric Corp | Capillary ceramic discharge lamp with closure means therefor |
| US3621322A (en) * | 1968-09-12 | 1971-11-16 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | High-pressure compact arc lamp with electrodes containing tantalum carbide |
| JPS4844350A (enFirst) * | 1971-10-07 | 1973-06-26 | ||
| JPS5367972A (en) * | 1976-11-30 | 1978-06-16 | Mitsubishi Electric Corp | Electrode for elctric discharge lamp |
| NL177058C (nl) * | 1977-04-15 | 1985-07-16 | Philips Nv | Hogedruknatriumdampontladingslamp. |
| NL177455C (nl) * | 1977-12-02 | 1985-09-16 | Philips Nv | Hogedrukmetaaldampontladingslamp. |
-
1980
- 1980-09-05 NL NLAANVRAGE8005025,A patent/NL185478C/xx not_active IP Right Cessation
-
1981
- 1981-08-26 DE DE19813133795 patent/DE3133795A1/de active Granted
- 1981-08-31 FR FR8116561A patent/FR2490005A1/fr active Granted
- 1981-09-01 GB GB8126485A patent/GB2083692B/en not_active Expired
- 1981-09-01 HU HU812525A patent/HU189529B/hu not_active IP Right Cessation
- 1981-09-02 JP JP56137124A patent/JPS5776743A/ja active Granted
- 1981-09-03 CA CA000385157A patent/CA1163306A/en not_active Expired
- 1981-09-03 BE BE0/205857A patent/BE890204A/fr not_active IP Right Cessation
-
1984
- 1984-12-20 US US06/684,155 patent/US4910433A/en not_active Expired - Fee Related
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10245000B4 (de) * | 2001-09-28 | 2009-12-03 | Koito Manufacturing Co., Ltd. | Quecksilberfreie Lichtbogenröhre für Entladungslampeneinheit |
Also Published As
| Publication number | Publication date |
|---|---|
| NL185478B (nl) | 1989-11-16 |
| GB2083692B (en) | 1984-12-12 |
| FR2490005A1 (fr) | 1982-03-12 |
| HU189529B (en) | 1986-07-28 |
| NL8005025A (nl) | 1982-04-01 |
| JPS5776743A (en) | 1982-05-13 |
| FR2490005B1 (enFirst) | 1984-10-19 |
| DE3133795A1 (de) | 1982-05-13 |
| NL185478C (nl) | 1990-04-17 |
| JPH048896B2 (enFirst) | 1992-02-18 |
| BE890204A (fr) | 1982-03-03 |
| GB2083692A (en) | 1982-03-24 |
| US4910433A (en) | 1990-03-20 |
| CA1163306A (en) | 1984-03-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3133642C2 (enFirst) | ||
| DE2815014C2 (de) | Hochdrucknatriumdampfentladungslampe | |
| DE2906383C2 (de) | Hochdrucknatriumdampfentladungslampe | |
| WO1988009565A1 (fr) | Lampe a decharge xenon a arc court | |
| DE2718642C2 (de) | Elektrode für eine Hochdruck-Metallhalogenidlampe | |
| DE19963278A1 (de) | Kompaktentladungslampe und Leuchtstofflampe mit Vorschaltgerät | |
| DE69731374T2 (de) | Niederdruckentladunglampe | |
| DE3027536A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE3133795C2 (enFirst) | ||
| DE2951740A1 (de) | Beleuchtungseinrichtung | |
| DE2118828A1 (de) | Hochdruck-Natriumdampf-Entladungslampe | |
| DE4008375A1 (de) | Hochdruckentladungslampe | |
| DE1065092B (de) | Blitzlichtentladungslampe | |
| DE1120016B (de) | Nicht geheizte Elektrode, insbesondere fuer Niederspannungsleuchtstofflampen, sowie Lampe mit solchen Elektroden | |
| DE3640990A1 (de) | Einseitig gequetschte hochdruckentladungslampe | |
| DE976223C (de) | Elektrische Hochdruck-Gasentladungslampe fuer Gleichstrombetrieb mit festen Gluehelektroden | |
| DE2722694C2 (de) | Quecksilberdampf-Niederdruckentladungslampe | |
| EP0154383B1 (de) | Heizbare Elektrode für Hochdruck-Gasentladungslampen | |
| DE69205228T2 (de) | Hochdrucknatriumlampe. | |
| DE3307197C2 (enFirst) | ||
| DE3044121A1 (de) | Natriumhochdrucklampe | |
| DE442276C (de) | Gleichrichter, bestehend aus einem Entladungsgefaess mit Gluehkathode | |
| DE697428C (de) | Elektrische, einen Betriebsdruck von mehr als 5 Atmosphaeren aufweisende Quecksilberdampfentladungslampe mit entladungsgeheizten Betriebsgluehelektroden und Anlasselektroden | |
| DE1051974B (de) | Gasgefuellte elektrische Gluehlampe | |
| DE2718527A1 (de) | Spektrallampe zur erzeugung des eisenlinienspektrums |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: PHILIPS ELECTRONICS N.V., EINDHOVEN, NL |
|
| 8339 | Ceased/non-payment of the annual fee |