DE3049446A1 - Verfahren zur herstellung von 1,5-didesoxy-1,5-imino-d-glucitol und dessen n-derivaten - Google Patents
Verfahren zur herstellung von 1,5-didesoxy-1,5-imino-d-glucitol und dessen n-derivatenInfo
- Publication number
- DE3049446A1 DE3049446A1 DE19803049446 DE3049446A DE3049446A1 DE 3049446 A1 DE3049446 A1 DE 3049446A1 DE 19803049446 DE19803049446 DE 19803049446 DE 3049446 A DE3049446 A DE 3049446A DE 3049446 A1 DE3049446 A1 DE 3049446A1
- Authority
- DE
- Germany
- Prior art keywords
- imino
- glucitol
- borohydride
- complex
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- LXBIFEVIBLOUGU-JGWLITMVSA-N duvoglustat Chemical compound OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O LXBIFEVIBLOUGU-JGWLITMVSA-N 0.000 title claims abstract description 14
- 238000004519 manufacturing process Methods 0.000 title abstract description 3
- 238000000034 method Methods 0.000 claims abstract description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 16
- LXBIFEVIBLOUGU-UHFFFAOYSA-N Deoxymannojirimycin Natural products OCC1NCC(O)C(O)C1O LXBIFEVIBLOUGU-UHFFFAOYSA-N 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000003112 inhibitor Substances 0.000 abstract description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- -1 substituted alkyl radical Chemical class 0.000 description 12
- 239000006188 syrup Substances 0.000 description 7
- 235000020357 syrup Nutrition 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000001291 vacuum drying Methods 0.000 description 3
- LXBIFEVIBLOUGU-UNTFVMJOSA-N (2s,3r,4r,5s)-2-(hydroxymethyl)piperidine-3,4,5-triol Chemical compound OC[C@@H]1NC[C@H](O)[C@@H](O)[C@@H]1O LXBIFEVIBLOUGU-UNTFVMJOSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 150000002337 glycosamines Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- BTEHIRWQUADKFP-DUVQVXGLSA-N (4r,5r,6r)-6-(hydroxymethyl)piperidine-2,4,5-triol Chemical compound OC[C@H]1NC(O)C[C@@H](O)[C@@H]1O BTEHIRWQUADKFP-DUVQVXGLSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 108010001394 Disaccharidases Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010031186 Glycoside Hydrolases Proteins 0.000 description 1
- 102000005744 Glycoside Hydrolases Human genes 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- RJTANRZEWTUVMA-UHFFFAOYSA-N boron;n-methylmethanamine Chemical compound [B].CNC RJTANRZEWTUVMA-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 150000005218 dimethyl ethers Chemical class 0.000 description 1
- YPTUAQWMBNZZRN-UHFFFAOYSA-N dimethylaminoboron Chemical compound [B]N(C)C YPTUAQWMBNZZRN-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 125000005640 glucopyranosyl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/46—Oxygen atoms attached in position 4 having a hydrogen atom as the second substituent in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803049446 DE3049446A1 (de) | 1980-12-30 | 1980-12-30 | Verfahren zur herstellung von 1,5-didesoxy-1,5-imino-d-glucitol und dessen n-derivaten |
| AT81110570T ATE7138T1 (de) | 1980-12-30 | 1981-12-18 | Verfahren zur herstellung von 1,5-didesoxy-1,5imino-d-glucitol und dessen n-derivaten. |
| DE8181110570T DE3163240D1 (en) | 1980-12-30 | 1981-12-18 | Process for the preparation of 1,5-dideoxy-1,5-imino-d-glucitol and its n-derivatives |
| EP81110570A EP0055431B1 (de) | 1980-12-30 | 1981-12-18 | Verfahren zur Herstellung von 1,5-Didesoxy-1,5-imino-D-glucitol und dessen N-Derivaten |
| JP56208267A JPS57134465A (en) | 1980-12-30 | 1981-12-24 | Manufacture of 1,5-didesoxy-1,5-imino-d- glucitol or n-derivative thereof |
| US06/734,362 US4611058A (en) | 1980-12-30 | 1985-05-14 | Process for the preparation of 1,5-didesoxy-1,5-imino-D-glucitol and N-derivatives thereof |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803049446 DE3049446A1 (de) | 1980-12-30 | 1980-12-30 | Verfahren zur herstellung von 1,5-didesoxy-1,5-imino-d-glucitol und dessen n-derivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3049446A1 true DE3049446A1 (de) | 1982-07-29 |
Family
ID=6120518
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803049446 Withdrawn DE3049446A1 (de) | 1980-12-30 | 1980-12-30 | Verfahren zur herstellung von 1,5-didesoxy-1,5-imino-d-glucitol und dessen n-derivaten |
| DE8181110570T Expired DE3163240D1 (en) | 1980-12-30 | 1981-12-18 | Process for the preparation of 1,5-dideoxy-1,5-imino-d-glucitol and its n-derivatives |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181110570T Expired DE3163240D1 (en) | 1980-12-30 | 1981-12-18 | Process for the preparation of 1,5-dideoxy-1,5-imino-d-glucitol and its n-derivatives |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4611058A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0055431B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS57134465A (cg-RX-API-DMAC10.html) |
| AT (1) | ATE7138T1 (cg-RX-API-DMAC10.html) |
| DE (2) | DE3049446A1 (cg-RX-API-DMAC10.html) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3620645A1 (de) * | 1985-12-20 | 1987-07-02 | Bayer Ag | 3-amino-4,5-dihydroxypiperidine, verfahren zu ihrer herstellung und ihre verwendung |
| DE3611841A1 (de) * | 1986-04-09 | 1987-10-15 | Bayer Ag | Verfahren zur herstellung von 1-desoxynojirimycin und dessen n-derivaten |
| DE3936295A1 (de) * | 1989-11-01 | 1991-05-02 | Bayer Ag | Verfahren zur herstellung von zwischenprodukten und zur synthese von n-(2-hydroxyethyl)-2-hydroxymethyl-3,4,5-trihydroxypiperidine |
| US5013842A (en) * | 1990-01-22 | 1991-05-07 | Monsanto Company | Synthesis of chiral pyrrolidine and piperidine glycosidase inhibitors |
| US5252587A (en) * | 1990-04-27 | 1993-10-12 | Merrell Dow Pharmaceuticals, Inc. | N-derivatives of 1-deoxy nojirimycin |
| US5536732A (en) * | 1990-04-27 | 1996-07-16 | Merrell Pharmaceuticals Inc. | N-derivatives of 1-deoxy nojirimycin |
| CA2086413A1 (en) * | 1990-06-29 | 1991-12-30 | Yohji Ezure | Piperidine derivatives |
| US5290948A (en) * | 1990-09-17 | 1994-03-01 | Mcneilab, Inc. | Process for producing polyhydroxylated piperidines and pyrrolidines and compounds thereof |
| DK0477160T3 (da) * | 1990-09-20 | 1996-05-20 | Monsanto Co | Fremgangsmåde til fremstilling af N-substitueret 1-deoxynojirimycin |
| US5401645A (en) * | 1992-03-16 | 1995-03-28 | Monsanto Company | Process for producing n-substituted polyhydroxy nitrogen-containing heterocycles utilizing acetobacteraceae and corynebacterium |
| US20030100532A1 (en) * | 1997-02-14 | 2003-05-29 | Gary S. Jacob | Use of n-substituted-1,5-dideoxy-1,5-imino-d-glucitol compounds in combination therapy for treating hepatitis virus infections |
| CA2309321A1 (en) | 1997-11-10 | 1999-05-20 | G.D. Searle & Co. | Use of alkylated iminosugars to treat multidrug resistance |
| KR20010040937A (ko) | 1998-02-12 | 2001-05-15 | 윌리암스 로저 에이 | 간염 바이러스 감염의 치료를 위한 n-치환된1,5-디데옥시-1,5-이미노-d-글루시톨 화합물의 용도 |
| US6689759B1 (en) | 1998-02-12 | 2004-02-10 | G. D. Searle & Co. | Methods of Treating hepatitis virus infections with N-substituted-1,5-dideoxy-1,5-imino-d-glucitol compounds in combination therapy |
| CA2362914C (en) * | 1999-02-12 | 2009-04-14 | G.D. Searle & Co. | Use of substituted-1,5-dideoxy-1,5-imino-d-glucitol compounds for treating hepatitis virus infections |
| WO2001008672A2 (en) | 1999-02-12 | 2001-02-08 | G.D. Searle & Co. | Glucamine compounds for treating hepatitis virus infections |
| WO2001060366A1 (en) * | 2000-02-14 | 2001-08-23 | Pharmacia Corporation | Use of n-substituted-1,5-dideoxy-1,5-imino-d-glucitol compounds for treating hepatitis virus infections |
| US6462197B2 (en) | 2000-03-31 | 2002-10-08 | Board Of Trustees Of Michigan State University | Process for the preparation of 1,5-dideoxy-1,5-imino hexitols from oximes or imines |
| CN1328270C (zh) * | 2005-09-26 | 2007-07-25 | 鲁南制药集团股份有限公司 | 一种工业化生产米格列醇的方法 |
| US8097728B2 (en) * | 2007-04-30 | 2012-01-17 | Philadelphia Health & Education Corporation | Iminosugar compounds with antiflavirus activity |
| ITUB20150176A1 (it) * | 2015-04-17 | 2016-10-17 | Dipharma Francis Srl | Sintesi di un azazucchero e i suoi intermedi |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2898379A (en) * | 1957-06-18 | 1959-08-04 | Callery Chemical Co | Reduction of compounds with amine boranes |
| DE2758025A1 (de) * | 1977-12-24 | 1979-07-12 | Bayer Ag | Neue derivate von 3,4,5-trihydroxypiperidin, verfahren zu ihrer herstellung und ihre verwendung |
| DE2738717A1 (de) * | 1977-08-27 | 1979-03-08 | Bayer Ag | N-alkylierte derivate der 5-amino- 5-deoxy-d-glucose, verfahren zu ihrer herstellung und ihre verwendung |
| DE2830469A1 (de) * | 1978-07-11 | 1980-01-24 | Bayer Ag | Herstellung von l-desoxy-nojirimycin und n-substituierten derivaten |
-
1980
- 1980-12-30 DE DE19803049446 patent/DE3049446A1/de not_active Withdrawn
-
1981
- 1981-12-18 EP EP81110570A patent/EP0055431B1/de not_active Expired
- 1981-12-18 AT AT81110570T patent/ATE7138T1/de not_active IP Right Cessation
- 1981-12-18 DE DE8181110570T patent/DE3163240D1/de not_active Expired
- 1981-12-24 JP JP56208267A patent/JPS57134465A/ja active Granted
-
1985
- 1985-05-14 US US06/734,362 patent/US4611058A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE3163240D1 (en) | 1984-05-24 |
| JPS57134465A (en) | 1982-08-19 |
| ATE7138T1 (de) | 1984-05-15 |
| JPH0245624B2 (cg-RX-API-DMAC10.html) | 1990-10-11 |
| EP0055431A1 (de) | 1982-07-07 |
| EP0055431B1 (de) | 1984-04-18 |
| US4611058A (en) | 1986-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3049446A1 (de) | Verfahren zur herstellung von 1,5-didesoxy-1,5-imino-d-glucitol und dessen n-derivaten | |
| DE69623532T2 (de) | Verfahren zur Herstellung von 4-Trifluormethylnicotinsäure | |
| DE1795808C2 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethyl-4-oxopiperidin | |
| EP0237902A2 (de) | Verfahren zur Herstellung des (-)-Antipoden des (E)-1-Cyclohexyl-4,4-dimethyl-3-hydroxy-2-(1,2,4-triazol-1-yl)-pent-1-ens | |
| DE69909165T2 (de) | Verfahren zur Herstellung von N-Glycyltyrosin | |
| DE2740331C3 (de) | 2-(-4-Cyano-piperanzino)-4-amino-6,7-dimethoxy-chinazolin und dessen Verwendung zur Herstellung von 2-[4-(2-Furoyl)piperazin-o]-4-amino-6,7-dimethoxychinazolin | |
| DE2245560A1 (de) | Verfahren zur herstellung von 4alkoxycarbonyl-2-thiazolinen | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| DD231786A5 (de) | Verfahren zur herstellung von 2-hydrazino-1,3-diazacycloalk-2-en hydrohaliden | |
| DE4341605C2 (de) | Verfahren zur Herstellung homochiraler Aminoalkohole | |
| DE2936240A1 (de) | Verfahren zur herstellung bekannter und neuer 6-amino-6-desoxy-2,3-0-isopropyliden-(alpha)-l-sorbofuranose-derivate sowie neue zwischenprodukte des verfahrens | |
| DD263986A5 (de) | Verfahren zur herstellung von pyrimidinderivaten | |
| DE2855279C2 (de) | Cheliertes 1,8-Naphthyridinderivat, Verfahren zu seiner Herstellung und Verfahren zur Herstellung von 1,8-Naphthyridinderivaten | |
| EP0064953B1 (de) | Stilbenverbindungen | |
| DE2505143A1 (de) | Verfahren zur herstellung von spiro-(4,5)-decanderivaten | |
| DE2063384A1 (de) | l-(l,2-Diphenyl-2-formylvinyl)-4methylpiperazin und seine physiologisch verträglichen Salze und Verfahren zu seiner Herstellung | |
| DE3784817T2 (de) | Chemisches verfahren. | |
| DE1445184C (de) | Verfahren zur Herstellung von alpha-Pyrrolidino-n-valerophenonen und ihren Salzen | |
| WO1998043958A1 (de) | Verfahren zur herstellung von 2,6-dichlor-5-fluornicotinonitril und die chemische verbindung 3-cyano-2-hydroxy-5-fluorpyrid-6-on-mononatriumsalz sowie dessen tautomere | |
| AT229285B (de) | Verfahren zur Reduktion von Carbonylverbindungen | |
| DE2113254C3 (de) | Verfahren zur Herstellung von γ-Piperidinoburyrophenonderivaten | |
| DE2361493A1 (de) | N-halogenalkylderivate cyclischer ureide | |
| CH631168A5 (en) | Process for preparing substituted imidazole compounds. | |
| DE1095833B (de) | Verfahren zur Herstellung von Azlactonen | |
| DE1643487B2 (de) | Cysteaminderivate, Verfahren zur Herstellung und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |