DE3041888C2 - - Google Patents
Info
- Publication number
- DE3041888C2 DE3041888C2 DE3041888A DE3041888A DE3041888C2 DE 3041888 C2 DE3041888 C2 DE 3041888C2 DE 3041888 A DE3041888 A DE 3041888A DE 3041888 A DE3041888 A DE 3041888A DE 3041888 C2 DE3041888 C2 DE 3041888C2
- Authority
- DE
- Germany
- Prior art keywords
- preparation according
- component
- weight
- parts
- block
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000002360 preparation method Methods 0.000 claims description 45
- 229920000515 polycarbonate Polymers 0.000 claims description 31
- 239000004417 polycarbonate Substances 0.000 claims description 30
- 125000003118 aryl group Chemical group 0.000 claims description 28
- -1 vinyl aromatic compound Chemical class 0.000 claims description 21
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 12
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 12
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 12
- 229920001577 copolymer Polymers 0.000 claims description 10
- 239000000049 pigment Substances 0.000 claims description 7
- 229920005668 polycarbonate resin Polymers 0.000 claims description 7
- 239000004431 polycarbonate resin Substances 0.000 claims description 7
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 7
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 7
- 239000012744 reinforcing agent Substances 0.000 claims description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 6
- 229920001169 thermoplastic Polymers 0.000 claims description 6
- 239000004416 thermosoftening plastic Substances 0.000 claims description 6
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 5
- 239000003365 glass fiber Substances 0.000 claims description 5
- 239000002243 precursor Substances 0.000 claims description 5
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- WAEOXIOXMKNFLQ-UHFFFAOYSA-N 1-methyl-4-prop-2-enylbenzene Chemical group CC1=CC=C(CC=C)C=C1 WAEOXIOXMKNFLQ-UHFFFAOYSA-N 0.000 claims description 3
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 claims description 3
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 3
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 3
- 229940106691 bisphenol a Drugs 0.000 claims description 3
- 229920006285 olefinic elastomer Polymers 0.000 claims description 3
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 claims description 2
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 claims description 2
- 229920001225 polyester resin Polymers 0.000 claims description 2
- 239000004645 polyester resin Substances 0.000 claims description 2
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims 1
- 239000011872 intimate mixture Substances 0.000 claims 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims 1
- 239000012763 reinforcing filler Substances 0.000 claims 1
- 229920000728 polyester Polymers 0.000 description 36
- 229920001400 block copolymer Polymers 0.000 description 25
- 229920000642 polymer Polymers 0.000 description 19
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- 238000000034 method Methods 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 8
- 238000005336 cracking Methods 0.000 description 7
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 239000003063 flame retardant Substances 0.000 description 5
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 5
- 150000002989 phenols Chemical class 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 230000035882 stress Effects 0.000 description 5
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 238000001125 extrusion Methods 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 238000000465 moulding Methods 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 230000008961 swelling Effects 0.000 description 4
- 229920001634 Copolyester Polymers 0.000 description 3
- 239000005062 Polybutadiene Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 150000002334 glycols Chemical class 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 230000001965 increasing effect Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 229920002857 polybutadiene Polymers 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LVLNPXCISNPHLE-UHFFFAOYSA-N 2-[(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1CC1=CC=CC=C1O LVLNPXCISNPHLE-UHFFFAOYSA-N 0.000 description 2
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004604 Blowing Agent Substances 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000748 compression moulding Methods 0.000 description 2
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000009863 impact test Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 238000009864 tensile test Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- ZGSHFDSKHTZINF-UHFFFAOYSA-N (2-methyl-6-phenylphenyl) hydrogen carbonate Chemical compound CC1=CC=CC(C=2C=CC=CC=2)=C1OC(O)=O ZGSHFDSKHTZINF-UHFFFAOYSA-N 0.000 description 1
- HCNHNBLSNVSJTJ-UHFFFAOYSA-N 1,1-Bis(4-hydroxyphenyl)ethane Chemical compound C=1C=C(O)C=CC=1C(C)C1=CC=C(O)C=C1 HCNHNBLSNVSJTJ-UHFFFAOYSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- RKSBPFMNOJWYSB-UHFFFAOYSA-N 3,3-Bis(4-hydroxyphenyl)pentane Chemical compound C=1C=C(O)C=CC=1C(CC)(CC)C1=CC=C(O)C=C1 RKSBPFMNOJWYSB-UHFFFAOYSA-N 0.000 description 1
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- NZGQHKSLKRFZFL-UHFFFAOYSA-N 4-(4-hydroxyphenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(O)C=C1 NZGQHKSLKRFZFL-UHFFFAOYSA-N 0.000 description 1
- DTOMAXGIWFLDMR-UHFFFAOYSA-N 4-[(4-hydroxy-3-nitrophenyl)methyl]-2-nitrophenol Chemical compound C1=C([N+]([O-])=O)C(O)=CC=C1CC1=CC=C(O)C([N+]([O-])=O)=C1 DTOMAXGIWFLDMR-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- WCUDAIJOADOKAW-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(CCC)C1=CC=C(O)C=C1 WCUDAIJOADOKAW-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- MARUHZGHZWCEQU-UHFFFAOYSA-N 5-phenyl-2h-tetrazole Chemical compound C1=CC=CC=C1C1=NNN=N1 MARUHZGHZWCEQU-UHFFFAOYSA-N 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- IMHDGJOMLMDPJN-UHFFFAOYSA-N biphenyl-2,2'-diol Chemical group OC1=CC=CC=C1C1=CC=CC=C1O IMHDGJOMLMDPJN-UHFFFAOYSA-N 0.000 description 1
- POZGCGJFBOZPCM-UHFFFAOYSA-N bis(2-methylphenyl) carbonate Chemical compound CC1=CC=CC=C1OC(=O)OC1=CC=CC=C1C POZGCGJFBOZPCM-UHFFFAOYSA-N 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- FACXGONDLDSNOE-UHFFFAOYSA-N buta-1,3-diene;styrene Chemical compound C=CC=C.C=CC1=CC=CC=C1.C=CC1=CC=CC=C1 FACXGONDLDSNOE-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- PWGQHOJABIQOOS-UHFFFAOYSA-N copper;dioxido(dioxo)chromium Chemical compound [Cu+2].[O-][Cr]([O-])(=O)=O PWGQHOJABIQOOS-UHFFFAOYSA-N 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical compound OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000005238 degreasing Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000006353 environmental stress Effects 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000010309 melting process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical class 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229920000468 styrene butadiene styrene block copolymer Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229920006230 thermoplastic polyester resin Polymers 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 229910052882 wollastonite Inorganic materials 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/093,129 US4267096A (en) | 1979-11-09 | 1979-11-09 | Composition of a selectively hydrogenated block copolymer of a vinyl aromatic compound and a diolefin, a polycarbonate and an amorphous polyester |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3041888A1 DE3041888A1 (de) | 1981-05-21 |
| DE3041888C2 true DE3041888C2 (enExample) | 1991-05-02 |
Family
ID=22237363
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803041888 Granted DE3041888A1 (de) | 1979-11-09 | 1980-11-06 | Thermoplastische zubereitung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4267096A (enExample) |
| JP (1) | JPS5692951A (enExample) |
| AU (1) | AU537332B2 (enExample) |
| BR (1) | BR8007290A (enExample) |
| CA (1) | CA1151337A (enExample) |
| DE (1) | DE3041888A1 (enExample) |
| FR (1) | FR2469433B1 (enExample) |
| GB (1) | GB2061973B (enExample) |
| NL (1) | NL8006082A (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4562222A (en) * | 1982-09-23 | 1985-12-31 | General Electric Company | Polycarbonate resin mixtures |
| EP0105388A1 (en) * | 1982-09-28 | 1984-04-18 | General Electric Company | Modified thermoplastic polyester molding compositions and articles molded therefrom |
| US4786692A (en) * | 1982-12-20 | 1988-11-22 | General Electric Company | High strength, reduced heat distortion temperature thermoplastic composition |
| EP0111810A3 (en) * | 1982-12-20 | 1986-10-22 | General Electric Company | High strength, reduced heat distortion temperature thermoplastic composition |
| US5116905A (en) * | 1983-08-30 | 1992-05-26 | General Electric Company | Polycarbonate resin mixtures |
| EP0137230A3 (en) * | 1983-08-30 | 1986-09-03 | General Electric Company | Thermoplastic molding compositions |
| US4778853A (en) * | 1983-10-03 | 1988-10-18 | General Electric Company | Polycarbonate resin mixtures |
| US4604423A (en) * | 1983-12-19 | 1986-08-05 | General Electric Company | Composition |
| US4536538A (en) * | 1983-12-19 | 1985-08-20 | General Electric Company | Impact modified polycarbonate composition |
| DE3575738D1 (en) * | 1984-12-19 | 1990-03-08 | Gen Electric | Copolyestercarbonatzusammensetzung. |
| US4684420A (en) * | 1985-08-16 | 1987-08-04 | The Firestone Tire & Rubber Company | Polymer transfer decals comprising saturated elastomers |
| US4710534A (en) * | 1985-12-09 | 1987-12-01 | General Electric Company | Low gloss, flame reterdant, impact resistant polycarbonate composition |
| US4804711A (en) * | 1987-10-26 | 1989-02-14 | General Electric Company | Melt blending of a carboxy terminated polystyrene oligomer with an aromatic polyester |
| EP0320647A3 (en) * | 1987-12-16 | 1990-09-19 | General Electric Company | Polycarbonate composition with low heat distortion |
| US4897448A (en) * | 1988-04-01 | 1990-01-30 | Eastman Kodak Company | Polyester/polycarbonate blends |
| USH1432H (en) * | 1988-08-15 | 1995-04-04 | The Dow Chemical Company | Polycarbonate-block copolymer blend with improved solvent and impact resistance |
| US5189091A (en) * | 1989-05-04 | 1993-02-23 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends modified with a grafted olefin copolymer |
| US5260126A (en) * | 1990-01-10 | 1993-11-09 | Kimberly-Clark Corporation | Low stress relaxation elastomeric nonwoven webs and fibers |
| US5308894A (en) * | 1990-04-12 | 1994-05-03 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends containing an olefinic modifier |
| BR9106347A (pt) * | 1990-04-12 | 1993-04-20 | Dow Chemical Co | Composicao de materia de poliester aromatico/policarbonato |
| US5369154A (en) * | 1990-04-12 | 1994-11-29 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends containing an olefinic modifier |
| US5082890A (en) * | 1990-08-21 | 1992-01-21 | The Dow Chemical Company | Filled thermoplastic molding compositions |
| US5124402A (en) * | 1990-08-21 | 1992-06-23 | The Dow Chemical Company | Thermoplastic molding compositions with improved solvent resistance and impact strength, and methods for preparation thereof |
| US5159003A (en) * | 1990-10-09 | 1992-10-27 | Ferro Corporation | Polyester-compatible alloys of polycarbonate |
| DE4229642A1 (de) * | 1992-09-04 | 1994-03-10 | Bayer Ag | Pulvermischungen für matte Polycarbonat-Formmassen |
| US5288800A (en) * | 1992-12-28 | 1994-02-22 | Shell Oil Company | Polymer blends |
| US5332613A (en) * | 1993-06-09 | 1994-07-26 | Kimberly-Clark Corporation | High performance elastomeric nonwoven fibrous webs |
| US5414021A (en) * | 1993-08-02 | 1995-05-09 | General Electric Company | Method for salvaging aromatic polycarbonate blend values |
| US5589542A (en) * | 1993-11-03 | 1996-12-31 | Shell Oil Company | Multiblock hydrogenated polymers for adhesives |
| US6043322A (en) * | 1996-12-28 | 2000-03-28 | Eastman Chemical Company | Clear polycarbonate and polyester blends |
| US6005059A (en) * | 1996-12-28 | 1999-12-21 | Eastman Chemical Company | Clear polycarbonate and polyester blends |
| US5942585A (en) * | 1996-12-28 | 1999-08-24 | Eastman Chemical Company | Polycarbonate and polyester blends |
| US6037424A (en) * | 1996-12-28 | 2000-03-14 | Eastman Chemical Company | Clear blends of polycarbonates and polyesters |
| US6011124A (en) * | 1996-12-28 | 2000-01-04 | Eastman Chemical Company | Blends of bisphenol a polycarbonate and polyesters |
| JP3578446B2 (ja) * | 1999-04-02 | 2004-10-20 | カネボウ合繊株式会社 | 熱可塑性樹脂組成物 |
| US20040209985A1 (en) * | 2003-04-18 | 2004-10-21 | Woei-Min Tsai | Resin composition for injection molding |
| CN101128537B (zh) * | 2005-04-28 | 2011-02-02 | 大科能树脂有限公司 | 热塑性树脂组合物以及成形品 |
| US20080103235A1 (en) * | 2006-11-01 | 2008-05-01 | Wesley Raymond Hale | Clear blends of bisphenol a polycarbonate and copolyesters |
| US10156352B2 (en) | 2013-04-19 | 2018-12-18 | Covestro Llc | In mold electronic printed circuit board encapsulation and assembly |
| WO2020076579A1 (en) | 2018-10-09 | 2020-04-16 | Covestro Llc | Insert-molded electronic modules using thermally conductive polycarbonate and molded interlocking features |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2839356A (en) * | 1954-06-14 | 1958-06-17 | Koppers Co Inc | Process of removing acidic constituents from gases utilizing screened low bulk weight lux means |
| GB951818A (en) * | 1961-08-18 | 1964-03-11 | Kunoshima Kagaku Kogyo Kabushi | Polyester moulding materials |
| NL294840A (enExample) * | 1962-07-04 | |||
| BE634842A (enExample) * | 1962-07-11 | |||
| US3281383A (en) * | 1962-08-09 | 1966-10-25 | Phillips Petroleum Co | Branched polymers prepared from monolithium-terminated polymers and compounds having at least three reactive sites |
| US3333024A (en) * | 1963-04-25 | 1967-07-25 | Shell Oil Co | Block polymers, compositions containing them and process of their preparation |
| US3753936A (en) * | 1970-02-18 | 1973-08-21 | Phillips Petroleum Co | Branched rubbery block copolymer adhesive |
| JPS5038130B2 (enExample) * | 1972-02-29 | 1975-12-08 | Asahi Chemical Ind | |
| US4081424A (en) * | 1976-06-07 | 1978-03-28 | Shell Oil Company | Multicomponent polyolefin - block copolymer - polymer blends |
| CA1098237A (en) * | 1977-05-05 | 1981-03-24 | William P. Gergen | Compositions containing hyrogenated block copolymers and engineering thermoplastic resins |
| GB2004284B (en) * | 1977-09-14 | 1982-04-07 | Gen Electric | Composition of a polycarbonate resin and a selectively hydrogenated block copolymer of a vinyl aromatic compound and an olefinic elastomer |
-
1979
- 1979-11-09 US US06/093,129 patent/US4267096A/en not_active Expired - Lifetime
-
1980
- 1980-10-13 AU AU63189/80A patent/AU537332B2/en not_active Ceased
- 1980-10-24 GB GB8034386A patent/GB2061973B/en not_active Expired
- 1980-10-31 CA CA000363812A patent/CA1151337A/en not_active Expired
- 1980-11-05 FR FR8023609A patent/FR2469433B1/fr not_active Expired
- 1980-11-06 DE DE19803041888 patent/DE3041888A1/de active Granted
- 1980-11-06 NL NL8006082A patent/NL8006082A/nl not_active Application Discontinuation
- 1980-11-06 BR BR8007290A patent/BR8007290A/pt unknown
- 1980-11-10 JP JP15713280A patent/JPS5692951A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU537332B2 (en) | 1984-06-21 |
| JPS5692951A (en) | 1981-07-28 |
| FR2469433B1 (fr) | 1986-05-09 |
| FR2469433A1 (fr) | 1981-05-22 |
| US4267096A (en) | 1981-05-12 |
| JPS648027B2 (enExample) | 1989-02-10 |
| GB2061973A (en) | 1981-05-20 |
| NL8006082A (nl) | 1981-06-01 |
| CA1151337A (en) | 1983-08-02 |
| GB2061973B (en) | 1983-06-02 |
| DE3041888A1 (de) | 1981-05-21 |
| BR8007290A (pt) | 1981-05-19 |
| AU6318980A (en) | 1981-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3041888C2 (enExample) | ||
| DE69322500T2 (de) | Mehrkomponent mischungen aus polyester-polykarbonat mit verbesserter schlagzähigkeit und verarbeitbarkeit | |
| DE69129475T2 (de) | Faserverstärkte thermoplastische Formmassen | |
| DE2920246C2 (de) | Polyestermasse für die Herstellung von Formkörpern und ihre Verwendung | |
| DE68919591T2 (de) | Gestreckte Formteile aus Polymermischungen auf Styrolbasis und Verfahren zu ihrer Herstellung. | |
| DE4091722C2 (de) | Kunstharz-Formkörper | |
| DE2948615A1 (de) | Polymermassen auf basis von aromatischen alkenylharzen und deren verwendung zur herstellung von formteilen | |
| DE2750733A1 (de) | Thermoplastische formmasse | |
| DE69913074T2 (de) | Biodegradierbare Polyester/Polyestercarbonat-Mischung | |
| DE3000290A1 (de) | Modifizierte polyester-zusammensetzungen | |
| DE3788885T2 (de) | Polycarbonat-Zusammensetzung. | |
| DE3782567T2 (de) | Mischungen auf basis von polycarbonaten mit verbesserten physikalischen und chemischen eigenschaften. | |
| DE2839356C2 (enExample) | ||
| DE3000282A1 (de) | Modifizierte polyester-zusammensetzungen | |
| DE2433189C3 (de) | Schwer entflammbare, glasfaserverstärkte Polytetramethylenterephthalatformmasse | |
| DE2535555A1 (de) | Verbesserte formmassen | |
| DE3002985A1 (de) | Modifizierte polyester-zusammensetzungen | |
| DE2446327C3 (de) | Schlagfeste, feuerhemmende Formmasse | |
| DE1569448C3 (de) | Form-, Imprägnier-, Klebe- oder Überzugsmassen | |
| DE3782188T2 (de) | Polyethylenterephthalat-harzmasse. | |
| DE3625950A1 (de) | Glasfaser-verstaerkte harzzusammensetzung auf propylen/ethylen-copolymer-basis | |
| DE2558290B2 (de) | Polyphenylenoxid enthaltende harzmasse | |
| DE2035147A1 (de) | Thermoplastische Harzmassen aus Polysulfon und einem Pfropfderivat eines Butadien ent haltenden Polymerengrundgerusts | |
| DE112019006408B4 (de) | Polycarbonatharzzusammensetzung, Verfahren zu ihrer Herstellung, Masterbatch-Pellet und Formkörper | |
| DE2712319C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |