DE3038899A1 - Phthaloperinon-farbstoffe - Google Patents
Phthaloperinon-farbstoffeInfo
- Publication number
- DE3038899A1 DE3038899A1 DE19803038899 DE3038899A DE3038899A1 DE 3038899 A1 DE3038899 A1 DE 3038899A1 DE 19803038899 DE19803038899 DE 19803038899 DE 3038899 A DE3038899 A DE 3038899A DE 3038899 A1 DE3038899 A1 DE 3038899A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compounds
- group
- dyes
- substituents
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000975 dye Substances 0.000 title claims description 37
- 239000000203 mixture Substances 0.000 claims description 28
- 229920000728 polyester Polymers 0.000 claims description 27
- 125000001424 substituent group Chemical group 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 12
- -1 methoxy, ethoxy Chemical group 0.000 claims description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 238000004043 dyeing Methods 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000004033 plastic Substances 0.000 claims description 3
- 229920003023 plastic Polymers 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000012141 concentrate Substances 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 238000002156 mixing Methods 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- YFOOEYJGMMJJLS-UHFFFAOYSA-N 1,8-diaminonaphthalene Chemical class C1=CC(N)=C2C(N)=CC=CC2=C1 YFOOEYJGMMJJLS-UHFFFAOYSA-N 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 238000006068 polycondensation reaction Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 2
- UERPUZBSSSAZJE-UHFFFAOYSA-N 3-chlorophthalic anhydride Chemical class ClC1=CC=CC2=C1C(=O)OC2=O UERPUZBSSSAZJE-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 239000010408 film Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- MLKMMRIRZHOWMH-UHFFFAOYSA-N 14,15,17,18-tetrachloro-2,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),3,5,7,9,11,13,15,17-nonaen-19-one Chemical compound C1=C(Cl)C(Cl)=C2C(Cl)=C(Cl)C(=O)C3=C2C1=NC1=C(C=CC=C2)C2=CN13 MLKMMRIRZHOWMH-UHFFFAOYSA-N 0.000 description 1
- XOEDMTWJHKZQNT-UHFFFAOYSA-N 17,18-dichloro-2,11-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),3,5,7,9,11,13,15,17-nonaen-19-one Chemical compound C1=CC=CC2=CN3C(C(=O)C(Cl)=C4Cl)=C5C4=CC=CC5=NC3=C21 XOEDMTWJHKZQNT-UHFFFAOYSA-N 0.000 description 1
- SLGGJMDAZSEJNG-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethanol;terephthalic acid Chemical compound OCCOCCO.OC(=O)C1=CC=C(C(O)=O)C=C1 SLGGJMDAZSEJNG-UHFFFAOYSA-N 0.000 description 1
- QGXQXRTVKOXDDC-UHFFFAOYSA-N 3,4,5-trichlorophthalic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1C(O)=O QGXQXRTVKOXDDC-UHFFFAOYSA-N 0.000 description 1
- YUDBKSANIWMLCU-UHFFFAOYSA-N 3,4-dichlorophthalic acid Chemical compound OC(=O)C1=CC=C(Cl)C(Cl)=C1C(O)=O YUDBKSANIWMLCU-UHFFFAOYSA-N 0.000 description 1
- FLKHCKPUJWBHCW-UHFFFAOYSA-N 3,6-dichlorophthalic acid Chemical compound OC(=O)C1=C(Cl)C=CC(Cl)=C1C(O)=O FLKHCKPUJWBHCW-UHFFFAOYSA-N 0.000 description 1
- GAIPRQZXSYSCRD-UHFFFAOYSA-N 4,5-dichloro-2-benzofuran-1,3-dione Chemical compound ClC1=CC=C2C(=O)OC(=O)C2=C1Cl GAIPRQZXSYSCRD-UHFFFAOYSA-N 0.000 description 1
- FDOQKGWUMUEJLX-UHFFFAOYSA-N 4,5-dichlorophthalic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)C=C1C(O)=O FDOQKGWUMUEJLX-UHFFFAOYSA-N 0.000 description 1
- DVIPPHSQIBKWSA-UHFFFAOYSA-N 4-chlorophthalic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1C(O)=O DVIPPHSQIBKWSA-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical compound OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- DGBWPZSGHAXYGK-UHFFFAOYSA-N perinone Chemical compound C12=NC3=CC=CC=C3N2C(=O)C2=CC=C3C4=C2C1=CC=C4C(=O)N1C2=CC=CC=C2N=C13 DGBWPZSGHAXYGK-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical class C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- MGMXGCZJYUCMGY-UHFFFAOYSA-N tris(4-nonylphenyl) phosphite Chemical compound C1=CC(CCCCCCCCC)=CC=C1OP(OC=1C=CC(CCCCCCCCC)=CC=1)OC1=CC=C(CCCCCCCCC)C=C1 MGMXGCZJYUCMGY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/12—Perinones, i.e. naphthoylene-aryl-imidazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Artificial Filaments (AREA)
- Polyesters Or Polycarbonates (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH9590/79A CH650523A5 (de) | 1979-10-25 | 1979-10-25 | Phthaloperinon-farbstoffe. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3038899A1 true DE3038899A1 (de) | 1981-05-07 |
Family
ID=4353559
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803038899 Withdrawn DE3038899A1 (de) | 1979-10-25 | 1980-10-15 | Phthaloperinon-farbstoffe |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4417014A (enExample) |
| JP (1) | JPS5667369A (enExample) |
| BR (1) | BR8006857A (enExample) |
| CH (1) | CH650523A5 (enExample) |
| DE (1) | DE3038899A1 (enExample) |
| ES (1) | ES8202048A1 (enExample) |
| FR (1) | FR2467871B1 (enExample) |
| GB (1) | GB2062665B (enExample) |
| HK (1) | HK29886A (enExample) |
| IT (1) | IT1128336B (enExample) |
| KE (1) | KE3612A (enExample) |
| MY (1) | MY8600531A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4027607A1 (de) * | 1990-08-31 | 1992-03-05 | Bayer Ag | Heterocyclische verbindungen |
| EP0639624A1 (de) * | 1993-08-19 | 1995-02-22 | Bayer Ag | Phthaloperinonfarbstoffe |
| DE4417746A1 (de) * | 1994-05-20 | 1995-11-23 | Bayer Ag | Neue Farbstoffe zum Massefärben von Kunststoffen |
| DE19548453A1 (de) * | 1995-12-22 | 1997-06-26 | Bayer Ag | Verfahren zur Herstellung polycyclischer Verbindungen |
| CN102421855A (zh) * | 2009-04-22 | 2012-04-18 | 德司达染料德国有限责任公司 | 用于聚合物着色的染料,其制备及其用途 |
| WO2014208748A1 (ja) * | 2013-06-28 | 2014-12-31 | 日本化薬株式会社 | 紫外線硬化型ハードコート樹脂組成物 |
| US20250304795A1 (en) * | 2024-03-27 | 2025-10-02 | Lanxess Deutschland Gmbh | Sulfonyl-bridged perinones |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1282817B (de) * | 1965-02-09 | 1968-11-14 | Basf Ag | Verfahren zur Herstellung von Phthaloperinonfarbstoffen |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1166701A (fr) | 1957-02-08 | 1958-11-14 | Cfmc | Procédé de teinture des fibres synthétiques à base de polyesters |
| FR1467734A (fr) * | 1965-02-09 | 1967-01-27 | Basf Ag | Nouveaux colorants de la phtalopérinone et procédé pour leur préparation |
| FR1472645A (enExample) * | 1965-03-26 | 1967-05-24 | ||
| DE1569664C3 (de) * | 1967-01-18 | 1975-12-04 | Basf Ag, 6700 Ludwigshafen | Phthaloperinonfarbstoffe und Verfahren zu ihrer Herstellung |
| CH512552A (de) | 1967-09-21 | 1971-09-15 | Hoechst Ag | Verfahren zum transparenten Färben von Polyestern mit in der Masse löslichen Pigmenten |
| AT318533B (de) * | 1970-07-10 | 1974-10-25 | Bayer Ag | Ausziehverfahren zum Färben von synthetischen Fasermaterialien aus organischen, mit Wasser unmischbaren Lösungsmitteln |
| US3909442A (en) | 1974-01-07 | 1975-09-30 | American Cyanamid Co | Solubilized orange dye (dialkylsulfonamide derivative) |
| DE2424542A1 (de) * | 1974-05-21 | 1975-12-11 | Bayer Ag | Polycyclische farbstoffe |
| DE2447228A1 (de) * | 1974-10-03 | 1976-04-22 | Hoechst Ag | Perinon-verbindungen, verfahren zu deren herstellung und ihre verwendung als farbmittel |
-
1979
- 1979-10-25 CH CH9590/79A patent/CH650523A5/de not_active IP Right Cessation
-
1980
- 1980-10-15 DE DE19803038899 patent/DE3038899A1/de not_active Withdrawn
- 1980-10-21 GB GB8033855A patent/GB2062665B/en not_active Expired
- 1980-10-22 IT IT49967/80A patent/IT1128336B/it active
- 1980-10-23 JP JP14768080A patent/JPS5667369A/ja active Granted
- 1980-10-24 BR BR8006857A patent/BR8006857A/pt unknown
- 1980-10-24 FR FR8022829A patent/FR2467871B1/fr not_active Expired
- 1980-10-24 ES ES496264A patent/ES8202048A1/es not_active Expired
-
1982
- 1982-08-18 US US06/409,112 patent/US4417014A/en not_active Expired - Lifetime
-
1986
- 1986-03-06 KE KE3612A patent/KE3612A/xx unknown
- 1986-04-24 HK HK298/86A patent/HK29886A/xx unknown
- 1986-12-30 MY MY531/86A patent/MY8600531A/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1282817B (de) * | 1965-02-09 | 1968-11-14 | Basf Ag | Verfahren zur Herstellung von Phthaloperinonfarbstoffen |
Also Published As
| Publication number | Publication date |
|---|---|
| CH650523A5 (de) | 1985-07-31 |
| HK29886A (en) | 1986-05-02 |
| MY8600531A (en) | 1986-12-31 |
| BR8006857A (pt) | 1981-04-28 |
| FR2467871B1 (fr) | 1985-10-18 |
| JPH0147499B2 (enExample) | 1989-10-13 |
| FR2467871A1 (fr) | 1981-04-30 |
| IT1128336B (it) | 1986-05-28 |
| US4417014A (en) | 1983-11-22 |
| KE3612A (en) | 1986-03-27 |
| ES496264A0 (es) | 1982-01-16 |
| ES8202048A1 (es) | 1982-01-16 |
| JPS5667369A (en) | 1981-06-06 |
| IT8049967A0 (it) | 1980-10-22 |
| GB2062665A (en) | 1981-05-28 |
| GB2062665B (en) | 1983-05-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2337855B2 (de) | Färben von organischen Materialien mit Naphthacenchinon-Derivaten | |
| DE3038899A1 (de) | Phthaloperinon-farbstoffe | |
| DE2646902C2 (de) | In der Masse gefärbte lineare, gesättigte, aromatische Polyester | |
| EP0001267B1 (de) | Verfahren zum Färben linearer Polyester in der Masse | |
| DE1916175C3 (de) | Verfahren zur Herstellung von gefärbten Polymeren und Copolymeren | |
| EP0114386B1 (de) | Farbmittelpräparation | |
| DE2801288B1 (de) | Verwendung von wasserunloeslichen Disazomethinverbindungen zum Faerben von thermoplastischen Polymerisaten und Polykondensaten in der Masse,die so gefaerbten Polymerisate und Polykondensate und Verfahren zum Spinnfaerben | |
| EP0012241B1 (de) | Verwendung von Disazomethinverbindungen zum Masse-Färben von thermoplastischen Polyestern | |
| DE1469868C3 (de) | Verwendung von heterocyclischen Farbstoffen zum Färben von Polyamiden in der Masse | |
| EP0859032A1 (de) | Verbrückte Anthrachinone | |
| DE69526430T2 (de) | Anthrachinonfarbstoffe enthaltend eine fluorosulfanylgruppe und ihre verwendung | |
| DE3339725A1 (de) | Verwendung von pyrrocolin-farbstoffen zum massefaerben von polyestern | |
| DE3413603A1 (de) | Metallkomplexfarbstoffe und ihre verwendung zum faerben von kunststoffmassen | |
| DE3230433A1 (de) | Die verwendung von metallkomplexfarbstoffen zum faerben von kunststoffmassen | |
| DE1903235C3 (de) | Verfahren zm Massefärben von linearen synthetischen Superpolyamiden | |
| CH656625A5 (de) | Verwendung von pyrrocolin-farbstoffen zum massefaerben von polyestern. | |
| DE1570796B2 (de) | Verfahren zur Herstellung von selbstgefärbten synthetischen linearen Polyestern | |
| EP0025008A1 (de) | Verfahren zum Färben linearer Polyester in der Schmelze mit Perylentetracarbonsäure-bis-Methylimid und lineare Polyester | |
| DE2557818A1 (de) | Verfahren zum spinnfaerben von polyestern | |
| DE3049215A1 (de) | Perylentetracarbonsaeurediimid und dessen verwendung | |
| AT214565B (de) | Verfahren zur Herstellung von gleichmäßig gefärbten Fasern, Filmen oder Bändern | |
| DE1903193C3 (de) | Färben von synthetischen Polyamiden in der Masse | |
| DE2556421A1 (de) | Verfahren zum faerben oder aufhellen linearer polyester in der masse | |
| CH624131A5 (enExample) | ||
| DE2502642B2 (de) | Fäden und Fasern mit erhöhter Anfärbbarkeit und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |