DE3008812A1 - Mischungen von optischen aufhellern - Google Patents
Mischungen von optischen aufhellernInfo
- Publication number
- DE3008812A1 DE3008812A1 DE19803008812 DE3008812A DE3008812A1 DE 3008812 A1 DE3008812 A1 DE 3008812A1 DE 19803008812 DE19803008812 DE 19803008812 DE 3008812 A DE3008812 A DE 3008812A DE 3008812 A1 DE3008812 A1 DE 3008812A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- group
- formula
- sulfonic acid
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 22
- 230000003287 optical effect Effects 0.000 title claims abstract description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 30
- 229910052717 sulfur Chemical group 0.000 claims abstract description 8
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 7
- 239000001301 oxygen Substances 0.000 claims abstract description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000011593 sulfur Chemical group 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- -1 cyano, carboxy Chemical group 0.000 claims description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 12
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 150000003254 radicals Chemical class 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 8
- 150000003857 carboxamides Chemical class 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical group OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- HJMZMZRCABDKKV-UHFFFAOYSA-N carbonocyanidic acid Chemical compound OC(=O)C#N HJMZMZRCABDKKV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000003106 haloaryl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 claims 1
- 125000005208 trialkylammonium group Chemical group 0.000 claims 1
- 239000006185 dispersion Substances 0.000 description 7
- 239000000835 fiber Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000004744 fabric Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 230000002087 whitening effect Effects 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical group FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/65—Optical bleaching or brightening with mixtures of optical brighteners
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Coloring (AREA)
- Photoreceptors In Electrophotography (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Optical Fibers, Optical Fiber Cores, And Optical Fiber Bundles (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803008812 DE3008812A1 (de) | 1980-03-07 | 1980-03-07 | Mischungen von optischen aufhellern |
| AT81101345T ATE4554T1 (de) | 1980-03-07 | 1981-02-25 | Mischungen von optischen aufhellern. |
| EP81101345A EP0035694B1 (de) | 1980-03-07 | 1981-02-25 | Mischungen von optischen Aufhellern |
| DE8181101345T DE3160803D1 (en) | 1980-03-07 | 1981-02-25 | Mixtures of optical brighteners |
| PH25321A PH19044A (en) | 1980-03-07 | 1981-03-05 | Mixture of optical brightners |
| BR8101322A BR8101322A (pt) | 1980-03-07 | 1981-03-06 | Composicoes de aclaradores oticos |
| AU68142/81A AU540524B2 (en) | 1980-03-07 | 1981-03-06 | Mixtures of optical brighteners |
| CA000372440A CA1154910A (en) | 1980-03-07 | 1981-03-06 | Mixtures of optical brighteners |
| ZA00811513A ZA811513B (en) | 1980-03-07 | 1981-03-06 | Mixtures of optical brighteners |
| JP3140181A JPS56141360A (en) | 1980-03-07 | 1981-03-06 | Fluorescent whitner mixture |
| US06/439,946 US4400294A (en) | 1980-03-07 | 1982-11-08 | Mixtures of optical brighteners |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803008812 DE3008812A1 (de) | 1980-03-07 | 1980-03-07 | Mischungen von optischen aufhellern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3008812A1 true DE3008812A1 (de) | 1981-09-24 |
Family
ID=6096567
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803008812 Withdrawn DE3008812A1 (de) | 1980-03-07 | 1980-03-07 | Mischungen von optischen aufhellern |
| DE8181101345T Expired DE3160803D1 (en) | 1980-03-07 | 1981-02-25 | Mixtures of optical brighteners |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181101345T Expired DE3160803D1 (en) | 1980-03-07 | 1981-02-25 | Mixtures of optical brighteners |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4400294A (enExample) |
| EP (1) | EP0035694B1 (enExample) |
| JP (1) | JPS56141360A (enExample) |
| AT (1) | ATE4554T1 (enExample) |
| AU (1) | AU540524B2 (enExample) |
| BR (1) | BR8101322A (enExample) |
| CA (1) | CA1154910A (enExample) |
| DE (2) | DE3008812A1 (enExample) |
| PH (1) | PH19044A (enExample) |
| ZA (1) | ZA811513B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3027479A1 (de) * | 1980-07-19 | 1982-03-04 | Hoechst Ag, 6000 Frankfurt | Mischungen von optischen aufhellern und deren verwendung |
| US4830763A (en) * | 1987-02-26 | 1989-05-16 | Ciba-Geigy Corporation | Process for increasing the degree of whiteness of polyester-containing textile material |
| EP0323399B1 (de) * | 1987-11-27 | 1993-02-17 | Ciba-Geigy Ag | Aufhellerdispersion |
| DK64690D0 (da) * | 1990-03-12 | 1990-03-12 | Ntp Elektronik A S | Omkoblingssystem |
| WO1992012144A1 (en) * | 1990-12-28 | 1992-07-23 | Teijin Limited | Condensed benzoxa ring compound, production thereof, and pharmaceutical composition containing the same |
| DE19732109A1 (de) * | 1997-07-25 | 1999-01-28 | Clariant Gmbh | Mischungen von optischen Aufhellern |
| CN108291160A (zh) | 2015-11-30 | 2018-07-17 | 沙特基础工业全球技术有限公司 | 用于增强汽油辛烷值促进剂的方法、汽油促进剂及汽油 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1955310A1 (de) * | 1969-11-04 | 1971-05-13 | Hoechst Ag | Verwendung von waessrigen Dispersionen von Mischungen aus Benzoxazol- und Phenyloxazolderivaten zum optischen Aufhellen |
| US4105399A (en) * | 1973-09-05 | 1978-08-08 | Ciba-Geigy Corporation | Optically brightening with a synergistic mixture |
| CH598309A5 (enExample) * | 1974-08-14 | 1978-04-28 | Ciba Geigy Ag | |
| JPS5140090A (ja) * | 1974-09-30 | 1976-04-03 | Toyoda Chuo Kenkyusho Kk | Choonpahatsuseisochi |
| ES456483A0 (es) * | 1976-03-09 | 1978-02-16 | Hoechst Ag | Procedimiento para la preparacion de compuestos de estilbeno. |
| CH623705GA3 (en) * | 1976-03-09 | 1981-06-30 | Process for the preparation of stilbene compounds and their use as optical brighteners | |
| DE2721084C3 (de) * | 1977-05-11 | 1981-02-26 | Hoechst Ag, 6000 Frankfurt | Mischungen von optischen Aufhellern |
| LU78483A1 (de) * | 1977-11-10 | 1979-06-13 | Ciba Geigy Ag | Verfahren zur herstellung von benzoxazolyl-phenylstilbenen |
-
1980
- 1980-03-07 DE DE19803008812 patent/DE3008812A1/de not_active Withdrawn
-
1981
- 1981-02-25 DE DE8181101345T patent/DE3160803D1/de not_active Expired
- 1981-02-25 AT AT81101345T patent/ATE4554T1/de not_active IP Right Cessation
- 1981-02-25 EP EP81101345A patent/EP0035694B1/de not_active Expired
- 1981-03-05 PH PH25321A patent/PH19044A/en unknown
- 1981-03-06 CA CA000372440A patent/CA1154910A/en not_active Expired
- 1981-03-06 JP JP3140181A patent/JPS56141360A/ja active Granted
- 1981-03-06 ZA ZA00811513A patent/ZA811513B/xx unknown
- 1981-03-06 AU AU68142/81A patent/AU540524B2/en not_active Expired - Fee Related
- 1981-03-06 BR BR8101322A patent/BR8101322A/pt unknown
-
1982
- 1982-11-08 US US06/439,946 patent/US4400294A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0035694B1 (de) | 1983-08-31 |
| JPS56141360A (en) | 1981-11-05 |
| AU6814281A (en) | 1981-09-10 |
| JPH0153303B2 (enExample) | 1989-11-13 |
| ATE4554T1 (de) | 1983-09-15 |
| ZA811513B (en) | 1982-03-31 |
| CA1154910A (en) | 1983-10-11 |
| BR8101322A (pt) | 1981-09-08 |
| US4400294A (en) | 1983-08-23 |
| DE3160803D1 (en) | 1983-10-06 |
| PH19044A (en) | 1985-12-11 |
| AU540524B2 (en) | 1984-11-22 |
| EP0035694A1 (de) | 1981-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0023028B1 (de) | Mischungen von optischen Aufhellern und deren Verwendung | |
| DE1102695B (de) | Optische Aufheller | |
| DE2721084A1 (de) | Mischungen von optischen aufhellern | |
| EP0080642A1 (de) | Färbeverfahren | |
| DE3520287C2 (de) | Disazo-Reaktivfarbstoffe für Cellulosefasern | |
| EP0023026B1 (de) | Mischungen von optischen Aufhellern und deren Verwendung | |
| DE3008812A1 (de) | Mischungen von optischen aufhellern | |
| DE2629703C3 (de) | Aufhellermischungen und deren Verwendung | |
| EP0044996B1 (de) | Mischungen von optischen Aufhellern | |
| DE2743127A1 (de) | Verfahren zum flammfestmachen von synthetischem fasermaterial | |
| EP0058880B1 (de) | Mischungen von optischen Aufhellern | |
| DE19732109A1 (de) | Mischungen von optischen Aufhellern | |
| EP0099859A1 (de) | Verfahren zum Färben von differential-dyeing-Fasern | |
| EP0212562B1 (de) | Verfahren zum Färben von Polyesterfasern feinen Titers | |
| EP0346715A1 (de) | Mehrkomponenten-Mischungen blauer Dispersions-Azofarbstoffe für das Färben von synthetischen Fasern | |
| DE1955310A1 (de) | Verwendung von waessrigen Dispersionen von Mischungen aus Benzoxazol- und Phenyloxazolderivaten zum optischen Aufhellen | |
| DE2759217A1 (de) | Mischungen von optischen aufhellern | |
| DE2839936C2 (de) | Mischungen von optischen Aufhellern und deren Verwendung zum optischen Aufhellen | |
| DE2062163C3 (de) | Reinigungsmittelmischung mit einem Gehalt an Waschblau | |
| DE1594855B2 (de) | Verfahren zum optischen aufhellen von textilmaterialien und mittel zu dessen durchfuehrung | |
| DE1519486B2 (de) | Optisches Aufhellungsmittel | |
| CH349950A (de) | Haltbares Aufhellungs- und Bleichmittel für Fasergut | |
| DE1302051B (de) | Verwendung von Benzimidazolylstilben-Verbindungen als optische Aufhellungsmittel | |
| CH432462A (de) | Nichtstaubende Farbstoffe | |
| DE1220381B (de) | Verfahren zum Aufhellen von Polyesterfasermaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |