DE3005682C2 - Schiffantriebsanlage - Google Patents
SchiffantriebsanlageInfo
- Publication number
- DE3005682C2 DE3005682C2 DE3005682A DE3005682A DE3005682C2 DE 3005682 C2 DE3005682 C2 DE 3005682C2 DE 3005682 A DE3005682 A DE 3005682A DE 3005682 A DE3005682 A DE 3005682A DE 3005682 C2 DE3005682 C2 DE 3005682C2
- Authority
- DE
- Germany
- Prior art keywords
- tunnel
- propeller
- ship
- section
- delimited
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000007704 transition Effects 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 2
- BCCGKQFZUUQSEX-WBPXWQEISA-N (2r,3r)-2,3-dihydroxybutanedioic acid;3,4-dimethyl-2-phenylmorpholine Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.OC(=O)[C@H](O)[C@@H](O)C(O)=O.O1CCN(C)C(C)C1C1=CC=CC=C1 BCCGKQFZUUQSEX-WBPXWQEISA-N 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000010006 flight Effects 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 230000000384 rearing effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000005641 tunneling Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B63—SHIPS OR OTHER WATERBORNE VESSELS; RELATED EQUIPMENT
- B63H—MARINE PROPULSION OR STEERING
- B63H5/00—Arrangements on vessels of propulsion elements directly acting on water
- B63H5/07—Arrangements on vessels of propulsion elements directly acting on water of propellers
- B63H5/16—Arrangements on vessels of propulsion elements directly acting on water of propellers characterised by being mounted in recesses; with stationary water-guiding elements; Means to prevent fouling of the propeller, e.g. guards, cages or screens
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- Ocean & Marine Engineering (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
- Underground Structures, Protecting, Testing And Restoring Foundations (AREA)
- Other Liquid Machine Or Engine Such As Wave Power Use (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH65680 | 1980-01-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3005682A1 DE3005682A1 (de) | 1981-07-30 |
| DE3005682C2 true DE3005682C2 (de) | 1982-11-11 |
Family
ID=4192084
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3005682A Expired DE3005682C2 (de) | 1980-01-28 | 1980-02-15 | Schiffantriebsanlage |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4371350A (enFirst) |
| JP (1) | JPS56108388A (enFirst) |
| DE (1) | DE3005682C2 (enFirst) |
| ES (1) | ES8200608A1 (enFirst) |
| FR (1) | FR2474436A1 (enFirst) |
| GB (1) | GB2067965B (enFirst) |
| IT (1) | IT1134269B (enFirst) |
| NL (1) | NL181348C (enFirst) |
| SE (1) | SE445541B (enFirst) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3730008A1 (de) * | 1987-09-08 | 1989-03-16 | Blohm Voss Ag | Wasserfahrzeug mit leitflossen |
| DE8911594U1 (de) * | 1989-09-28 | 1991-02-07 | Ostra GmbH & Co. KG, 46539 Dinslaken | Boot mit wenigstens einem Strahlantrieb |
| WO1996035612A1 (en) * | 1995-05-12 | 1996-11-14 | Marine Technology Development Ltd. | Deflection mechanism for ship hulls |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3120072C2 (de) * | 1981-04-22 | 1983-02-24 | Escher Wyss Gmbh, 7980 Ravensburg | Schiff mit mindestens einer Schiffschraube |
| US4661075A (en) * | 1983-07-20 | 1987-04-28 | Czerniak Marian K E | Self-propelled waterborne vessel |
| US4689026A (en) * | 1985-08-26 | 1987-08-25 | Small Mark S | Propeller tunnel baffle and method |
| DE3607942A1 (de) * | 1986-03-11 | 1987-09-17 | Escher Wyss Gmbh | Schiff mit mindestens einer schiffschraube |
| US4907994A (en) * | 1987-06-15 | 1990-03-13 | Us Marine Corporation | L-drive |
| US5505639A (en) | 1988-06-02 | 1996-04-09 | Burg; Donald E. | Hydro-air drive |
| US5720636A (en) * | 1990-02-28 | 1998-02-24 | Burg; Donald E. | Marine propulsor |
| US6024614A (en) * | 1992-03-09 | 2000-02-15 | Burg; Donald E. | High performance marine propulsion system |
| US5833502A (en) * | 1996-06-19 | 1998-11-10 | Anderson; Carl J. | Boat construction |
| USD384321S (en) * | 1996-06-19 | 1997-09-30 | Anderson Carl J | Boat hull |
| FR2762578B1 (fr) | 1997-04-29 | 1999-06-04 | France Etat | Navire porte-conteneurs autonome |
| FR2762579B1 (fr) | 1997-04-29 | 1999-06-04 | France Etat | Navire porte-conteneurs autonome a coque integrant un ensemble propulsif |
| US6045420A (en) * | 1999-01-19 | 2000-04-04 | Small; Mark S. | Semi-enclosed surfacing propeller driver system including air induction |
| US6213824B1 (en) | 2000-02-11 | 2001-04-10 | Power Vent Technologies, Inc. | Method for reducing vessel draft |
| SE516426C2 (sv) * | 2000-05-09 | 2002-01-15 | Torbjoern Eriksson | Skrov- och propelleranordning |
| AU2002211455B2 (en) * | 2000-10-12 | 2006-07-06 | Noyes Jr., Evan L | Boat propulsion system |
| GB2381514A (en) * | 2001-10-31 | 2003-05-07 | Roderick Douglas Pike | Device for controlling the flow of water to a marine propeller |
| WO2004050476A1 (de) | 2002-12-03 | 2004-06-17 | Supraventures Ag | Z-antrieb für ein wasserfahrzeug |
| US7311059B2 (en) * | 2004-12-27 | 2007-12-25 | Navatek, Ltd. | Watercraft hull with entrapment tunnel |
| US7299763B2 (en) * | 2004-12-22 | 2007-11-27 | Navatek, Ltd. | Hull with propulsion tunnel and leading edge interceptor |
| US7338336B2 (en) * | 2004-12-27 | 2008-03-04 | Navatek, Ltd. | Watercraft hull with adjustable keel |
| US8323063B2 (en) * | 2005-08-05 | 2012-12-04 | Mueller Peter A | Watercraft drive |
| US7845302B2 (en) * | 2005-12-06 | 2010-12-07 | Navatek, Ltd. | Ventilated flow interrupter stepped hull |
| US7845301B2 (en) * | 2005-12-06 | 2010-12-07 | Navatek, Ltd. | Ventilated aft swept flow interrupter hull |
| US8608441B2 (en) * | 2006-06-12 | 2013-12-17 | Energyield Llc | Rotatable blade apparatus with individually adjustable blades |
| DE102010044435A1 (de) * | 2010-09-06 | 2012-03-08 | Lais Gmbh | Antrieb |
| US9205891B2 (en) * | 2010-12-02 | 2015-12-08 | Mitsubishi Heavy Industries, Ltd. | Transom-stern-type stern shape of vessel |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1412517A (en) * | 1922-04-11 | goldson | ||
| US1059806A (en) * | 1912-01-20 | 1913-04-22 | Alfred F Yarrow | Propeller chamber or tunnel for shallow-draft vessels. |
| US1543082A (en) * | 1923-03-31 | 1925-06-23 | Albert L Ellsworth | Boat-control device |
| FR725240A (fr) * | 1931-09-19 | 1932-05-10 | Propulseur pour navires à faible tirant d'eau | |
| DE878001C (de) * | 1951-12-11 | 1954-12-13 | Ostermann & Co | Schraubenschirm |
| GB930558A (en) * | 1960-12-21 | 1963-07-03 | Falmouth Boat Construction Ltd | Improvements in or relating to propeller-driven boats |
| NL289030A (enFirst) * | 1962-04-20 | |||
| US3463109A (en) * | 1968-04-03 | 1969-08-26 | Howard E Weiler | Leveler trim tab for boat hulls |
| US3793980A (en) * | 1971-12-30 | 1974-02-26 | Hydrodynamic Dev Corp | Marine propulsion system |
| US4057027A (en) * | 1974-08-08 | 1977-11-08 | Foster Daniel S | Boat propulsion with surface-running propeller drive |
| US3938458A (en) * | 1974-12-23 | 1976-02-17 | Outboard Marine Corporation | Adjustable boat hull |
-
1980
- 1980-02-15 DE DE3005682A patent/DE3005682C2/de not_active Expired
- 1980-03-31 FR FR8007146A patent/FR2474436A1/fr active Granted
- 1980-09-29 US US06/191,381 patent/US4371350A/en not_active Expired - Lifetime
- 1980-10-23 ES ES496202A patent/ES8200608A1/es not_active Expired
- 1980-11-14 IT IT25977/80A patent/IT1134269B/it active
- 1980-12-23 JP JP18270980A patent/JPS56108388A/ja active Granted
-
1981
- 1981-01-13 GB GB8100913A patent/GB2067965B/en not_active Expired
- 1981-01-15 NL NLAANVRAGE8100172,A patent/NL181348C/xx not_active IP Right Cessation
- 1981-01-26 SE SE8100466A patent/SE445541B/sv not_active IP Right Cessation
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3730008A1 (de) * | 1987-09-08 | 1989-03-16 | Blohm Voss Ag | Wasserfahrzeug mit leitflossen |
| DE8911594U1 (de) * | 1989-09-28 | 1991-02-07 | Ostra GmbH & Co. KG, 46539 Dinslaken | Boot mit wenigstens einem Strahlantrieb |
| WO1996035612A1 (en) * | 1995-05-12 | 1996-11-14 | Marine Technology Development Ltd. | Deflection mechanism for ship hulls |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2067965B (en) | 1983-09-14 |
| FR2474436B1 (enFirst) | 1983-12-30 |
| ES496202A0 (es) | 1981-11-16 |
| JPS6127237B2 (enFirst) | 1986-06-24 |
| IT1134269B (it) | 1986-08-13 |
| DE3005682A1 (de) | 1981-07-30 |
| NL8100172A (nl) | 1981-08-17 |
| ES8200608A1 (es) | 1981-11-16 |
| GB2067965A (en) | 1981-08-05 |
| JPS56108388A (en) | 1981-08-27 |
| NL181348B (nl) | 1987-03-02 |
| FR2474436A1 (fr) | 1981-07-31 |
| SE8100466L (sv) | 1981-07-29 |
| NL181348C (nl) | 1987-08-03 |
| US4371350A (en) | 1983-02-01 |
| IT8025977A0 (it) | 1980-11-14 |
| SE445541B (sv) | 1986-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3005682C2 (de) | Schiffantriebsanlage | |
| DE3332868C2 (enFirst) | ||
| DE2934871A1 (de) | Schiffsschraube | |
| DE3332833C2 (enFirst) | ||
| DE2167236C2 (de) | Strahltriebwerk für ein Wasserfahrzeug | |
| DE3120072C2 (de) | Schiff mit mindestens einer Schiffschraube | |
| DE4440738A1 (de) | Schiffsantrieb mit einer Antriebsmaschine im Schiffsrumpf und einem von der Antriebsmaschine angetriebenen Propeller außerhalb des Schiffsrumpfes | |
| DE8207403U1 (de) | Fluegelsegel | |
| EP1508516A1 (de) | Kompaktes wasserstrahlantriebs und -lenksystem | |
| DE2751270A1 (de) | Seitensteuerung fuer wasserstrahlantriebe | |
| DE2303299B2 (de) | Ruder, insbesondere hinter einer Schiffsschraube, mit symmetrischem Profil und einem sich nach hinten erweiternden Schwanzteil | |
| DE3522621C2 (enFirst) | ||
| EP0017756B1 (de) | Auftriebsklappe an einem Flugzeugtragflügel | |
| DE3303554C2 (enFirst) | ||
| DE2225118C2 (de) | Trennvorrichtung zum Unterteilen von durchlaufendem langgestrecktem Gut | |
| DE2413199A1 (de) | Propeller bzw. turbinenrad | |
| DE3041140A1 (de) | Ein mit einem mit fluegelspitzen-sperrplatten versehenen schiffspropeller kombinierter leitkanal | |
| CH666869A5 (de) | Verstellvorrichtung fuer verstellpropeller von wasserfahrzeugen. | |
| DE2246766C3 (de) | Steuereinrichtung für Schiffe | |
| DE69923211T2 (de) | Einrichtung zum antrieb von schiffen und düse hierfür | |
| DE3607942A1 (de) | Schiff mit mindestens einer schiffschraube | |
| DE4115254C2 (de) | Bodeneffekt-Fahrzeug | |
| DE806098C (de) | Ruder fur Schiffe | |
| EP4173943B1 (de) | Katamaran mit flossenantrieb | |
| DE3490665C2 (de) | Schiffsruderanlage |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: SULZER-ESCHER WYSS GMBH, 7980 RAVENSBURG, DE |