DE3003542A1 - Verfahren zur herstellung von trimethylbrenztraubensaeureamid - Google Patents
Verfahren zur herstellung von trimethylbrenztraubensaeureamidInfo
- Publication number
- DE3003542A1 DE3003542A1 DE19803003542 DE3003542A DE3003542A1 DE 3003542 A1 DE3003542 A1 DE 3003542A1 DE 19803003542 DE19803003542 DE 19803003542 DE 3003542 A DE3003542 A DE 3003542A DE 3003542 A1 DE3003542 A1 DE 3003542A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- solvent
- water
- moles
- inorganic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 22
- 150000001408 amides Chemical class 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 18
- NPBLQPWAISGYEU-UHFFFAOYSA-N 2,2-dimethylpropanoyl cyanide Chemical compound CC(C)(C)C(=O)C#N NPBLQPWAISGYEU-UHFFFAOYSA-N 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 150000007522 mineralic acids Chemical class 0.000 claims description 12
- SEABOFSECBZAHR-UHFFFAOYSA-N 3,3-dimethyl-2-oxobutanamide Chemical compound CC(C)(C)C(=O)C(N)=O SEABOFSECBZAHR-UHFFFAOYSA-N 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 9
- 229960000583 acetic acid Drugs 0.000 claims description 9
- 239000012362 glacial acetic acid Substances 0.000 claims description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 5
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 235000009754 Vitis X bourquina Nutrition 0.000 claims 1
- 235000012333 Vitis X labruscana Nutrition 0.000 claims 1
- 240000006365 Vitis vinifera Species 0.000 claims 1
- 235000014787 Vitis vinifera Nutrition 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- IAWVHZJZHDSEOC-UHFFFAOYSA-N 3,3-dimethyl-2-oxobutanoic acid Chemical compound CC(C)(C)C(=O)C(O)=O IAWVHZJZHDSEOC-UHFFFAOYSA-N 0.000 description 4
- 150000001264 acyl cyanides Chemical class 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- LJTFFORYSFGNCT-UHFFFAOYSA-N Thiocarbohydrazide Chemical compound NNC(=S)NN LJTFFORYSFGNCT-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 description 3
- 239000012433 hydrogen halide Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- OFKAVNQBCRJBJE-UHFFFAOYSA-N 4-amino-6-tert-butyl-3-sulfanylidene-2h-1,2,4-triazin-5-one Chemical compound CC(C)(C)C1=NNC(=S)N(N)C1=O OFKAVNQBCRJBJE-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical group N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 238000006434 Ritter amidation reaction Methods 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- QLDHWVVRQCGZLE-UHFFFAOYSA-N acetyl cyanide Chemical compound CC(=O)C#N QLDHWVVRQCGZLE-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- -1 hydrogen halides Chemical class 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- FPOLWERNILTNDK-UHFFFAOYSA-N pyruvamide Chemical compound CC(=O)C(N)=O FPOLWERNILTNDK-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- GLXLIDAUNKPDQE-UHFFFAOYSA-N CC(C)(C)C(=O)C(O)=O.CC(C)(C)C(=O)C(O)=O Chemical compound CC(C)(C)C(=O)C(O)=O.CC(C)(C)C(=O)C(O)=O GLXLIDAUNKPDQE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- JUXCNSQRTAVSNU-UHFFFAOYSA-N n-tert-butyl-3,3-dimethyl-2-oxobutanamide Chemical compound CC(C)(C)NC(=O)C(=O)C(C)(C)C JUXCNSQRTAVSNU-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D253/075—Two hetero atoms, in positions 3 and 5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803003542 DE3003542A1 (de) | 1980-01-31 | 1980-01-31 | Verfahren zur herstellung von trimethylbrenztraubensaeureamid |
| DE8181100406T DE3160978D1 (en) | 1980-01-31 | 1981-01-21 | Process for the preparation of trimethylpyruvic acid amide |
| EP81100406A EP0034703B1 (de) | 1980-01-31 | 1981-01-21 | Verfahren zur Herstellung von Trimethylbrenztraubensäureamid |
| US06/227,442 US4309538A (en) | 1980-01-31 | 1981-01-22 | Preparation of 4-amino-6-tert.-butyl-3-alkylthio-1,2,4-triazin-5(4H)-ones |
| IL62013A IL62013A (en) | 1980-01-31 | 1981-01-29 | Trimethylpyruvic acid amide and its preparation |
| JP1092581A JPS56120653A (en) | 1980-01-31 | 1981-01-29 | Trimethylpyruvic acid amide and its manufacture |
| DK41981A DK149195C (da) | 1980-01-31 | 1981-01-30 | Fremgangsmaade til fremstilling af trimethyl-pyrodruesyreamid |
| BR8100567A BR8100567A (pt) | 1980-01-31 | 1981-01-30 | Processo para a preparacao de amida do acido trimetilpiruvico |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803003542 DE3003542A1 (de) | 1980-01-31 | 1980-01-31 | Verfahren zur herstellung von trimethylbrenztraubensaeureamid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3003542A1 true DE3003542A1 (de) | 1981-08-06 |
Family
ID=6093410
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803003542 Withdrawn DE3003542A1 (de) | 1980-01-31 | 1980-01-31 | Verfahren zur herstellung von trimethylbrenztraubensaeureamid |
| DE8181100406T Expired DE3160978D1 (en) | 1980-01-31 | 1981-01-21 | Process for the preparation of trimethylpyruvic acid amide |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181100406T Expired DE3160978D1 (en) | 1980-01-31 | 1981-01-21 | Process for the preparation of trimethylpyruvic acid amide |
Country Status (6)
| Country | Link |
|---|---|
| EP (1) | EP0034703B1 (enExample) |
| JP (1) | JPS56120653A (enExample) |
| BR (1) | BR8100567A (enExample) |
| DE (2) | DE3003542A1 (enExample) |
| DK (1) | DK149195C (enExample) |
| IL (1) | IL62013A (enExample) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2459686A (en) * | 1947-06-13 | 1949-01-18 | American Cyanamid Co | Acetoxy-aliphatic amides |
| DE2708184C3 (de) * | 1977-02-25 | 1980-02-07 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von a -Ketocarbonsäureamide!! (A) |
| DE2733181B2 (de) * | 1977-07-22 | 1979-08-30 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von N-substituierten a -Ketocarbonsäureamiden |
-
1980
- 1980-01-31 DE DE19803003542 patent/DE3003542A1/de not_active Withdrawn
-
1981
- 1981-01-21 DE DE8181100406T patent/DE3160978D1/de not_active Expired
- 1981-01-21 EP EP81100406A patent/EP0034703B1/de not_active Expired
- 1981-01-29 IL IL62013A patent/IL62013A/xx unknown
- 1981-01-29 JP JP1092581A patent/JPS56120653A/ja active Granted
- 1981-01-30 BR BR8100567A patent/BR8100567A/pt unknown
- 1981-01-30 DK DK41981A patent/DK149195C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BR8100567A (pt) | 1981-08-18 |
| DK41981A (da) | 1981-08-01 |
| EP0034703A3 (en) | 1981-09-16 |
| IL62013A0 (en) | 1981-02-27 |
| DK149195C (da) | 1986-08-04 |
| DK149195B (da) | 1986-03-10 |
| EP0034703A2 (de) | 1981-09-02 |
| DE3160978D1 (en) | 1983-11-03 |
| EP0034703B1 (de) | 1983-09-28 |
| IL62013A (en) | 1984-04-30 |
| JPS64943B2 (enExample) | 1989-01-10 |
| JPS56120653A (en) | 1981-09-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795808C2 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethyl-4-oxopiperidin | |
| DE69710052T2 (de) | Verfahren zur herstellung von zwischenprodukten für pestizide | |
| DE1135915B (de) | Verfahren zur Herstellung neuer, antikonvulsiv wirksamer Spirohydantoine | |
| DE2327648C2 (de) | Verfahren zur Herstellung von Thiamphenicolglycinat und dessen pharmazeutisch verwendbaren Salzen | |
| DE3212170A1 (de) | Verfahren zur herstellung der d-2-(6-methoxy-2-naphthyl)- propionsaeure | |
| DE2740331C3 (de) | 2-(-4-Cyano-piperanzino)-4-amino-6,7-dimethoxy-chinazolin und dessen Verwendung zur Herstellung von 2-[4-(2-Furoyl)piperazin-o]-4-amino-6,7-dimethoxychinazolin | |
| EP0035708A2 (de) | Verfahren zur Herstellung von 4-Amino-6-tert.-butyl-3-methylthio-1,2,4-triazin-5(4H)-on | |
| DE3435392A1 (de) | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoesaeure | |
| EP0034703B1 (de) | Verfahren zur Herstellung von Trimethylbrenztraubensäureamid | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| EP0041177B1 (de) | Verfahren zur Herstellung von 4-Amino-6-tert.butyl-3-mercapto-1,2,4-triazin-5-on | |
| EP0063349B1 (de) | 5-Acyloxy-4 (5H)-oxazolonium-Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Zwischenprodukte zur Synthese von herbizid wirksamen Triazinonen | |
| EP0033476B1 (de) | Verfahren zur Herstellung von 4-Amino-6-tert.-butyl-3-methylthio-1,2,4-triazin-5(4H)-on | |
| DE2503736A1 (de) | Verfahren zur herstellung von 2-oxo- 1,2-dihydro-chinazolinen | |
| DE2165109A1 (de) | Verfahren zur Herstellung von alpha-Methyl-beta-(3,4-dihydroxyphenyl)-alanin | |
| DE2708185B2 (de) | Verfahren zur Herstellung von a -Ketocarbonsäuren (B) | |
| DE2640616C3 (de) | Verfahren zur Herstellung von N-Acyl-2-aiylglycinen | |
| DE2326308A1 (de) | Verfahren zur herstellung von tetramisol | |
| DE3538873A1 (de) | Verfahren zur herstellung von imidazolyl-methan-derivaten | |
| DE2008874A1 (en) | Pyrimidine derivs from urea and beta-keto - esters | |
| DE2400419B2 (de) | Verfahren zur herstellung von 2-alkyl- sulfinyl-6-nitrobenzothiazolen | |
| DE842064C (de) | Verfahren zur Herstellung des 2-Diphenylmethoxymethyl-imidazolins | |
| AT206444B (de) | Verfahren zur Herstellung von neuen Pyridazinderivaten | |
| DE2538399A1 (de) | Verfahren zur herstellung von substituiertem und unsubstituiertem 2-phenyl-1.2.3-triazol-4-carboxaldehyd | |
| DE1493619C (de) | Verfahren zur Herstellung von 3-(3,4-Dihydroxyphenyl)-2-methylalanin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |