DE2951906A1 - Flammverzoegerte masse - Google Patents
Flammverzoegerte masseInfo
- Publication number
- DE2951906A1 DE2951906A1 DE19792951906 DE2951906A DE2951906A1 DE 2951906 A1 DE2951906 A1 DE 2951906A1 DE 19792951906 DE19792951906 DE 19792951906 DE 2951906 A DE2951906 A DE 2951906A DE 2951906 A1 DE2951906 A1 DE 2951906A1
- Authority
- DE
- Germany
- Prior art keywords
- stands
- composition according
- resin
- parts
- halogenated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000011347 resin Substances 0.000 claims description 26
- 229920005989 resin Polymers 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 21
- 239000004014 plasticizer Substances 0.000 claims description 17
- 239000000779 smoke Substances 0.000 claims description 17
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 14
- 239000003063 flame retardant Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 14
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 12
- 239000004800 polyvinyl chloride Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 6
- 229920001577 copolymer Polymers 0.000 claims description 5
- 239000003381 stabilizer Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- -1 Flame-retardant compound Chemical class 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 239000000945 filler Substances 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 102100033070 Histone acetyltransferase KAT6B Human genes 0.000 claims description 2
- 101100019690 Homo sapiens KAT6B gene Proteins 0.000 claims description 2
- 229910000410 antimony oxide Inorganic materials 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 claims description 2
- 125000005498 phthalate group Chemical group 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims 1
- 101150065749 Churc1 gene Proteins 0.000 claims 1
- 239000004698 Polyethylene Substances 0.000 claims 1
- 102100038239 Protein Churchill Human genes 0.000 claims 1
- 239000002253 acid Substances 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 230000004927 fusion Effects 0.000 claims 1
- 238000007731 hot pressing Methods 0.000 claims 1
- 229920000573 polyethylene Polymers 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 14
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229920002681 hypalon Polymers 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 2
- JJXNVYMIYBNZQX-UHFFFAOYSA-N diphenyl (2-propan-2-ylphenyl) phosphate Chemical compound CC(C)C1=CC=CC=C1OP(=O)(OC=1C=CC=CC=1)OC1=CC=CC=C1 JJXNVYMIYBNZQX-UHFFFAOYSA-N 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920001291 polyvinyl halide Polymers 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 102100027708 Astrotactin-1 Human genes 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- 229920006385 Geon Polymers 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 101000936741 Homo sapiens Astrotactin-1 Proteins 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- 229920012485 Plasticized Polyvinyl chloride Polymers 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QHWKHLYUUZGSCW-UHFFFAOYSA-N Tetrabromophthalic anhydride Chemical compound BrC1=C(Br)C(Br)=C2C(=O)OC(=O)C2=C1Br QHWKHLYUUZGSCW-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- HLRNWZLPRFTCIO-YSMBQZINSA-N chloroethene diethyl (Z)-but-2-enedioate Chemical compound ClC=C.CCOC(=O)\C=C/C(=O)OCC HLRNWZLPRFTCIO-YSMBQZINSA-N 0.000 description 1
- DHZSIQDUYCWNSB-UHFFFAOYSA-N chloroethene;1,1-dichloroethene Chemical compound ClC=C.ClC(Cl)=C DHZSIQDUYCWNSB-UHFFFAOYSA-N 0.000 description 1
- PKERFCBWBFEXPH-UHFFFAOYSA-N chloroethene;1,1-difluoroethene Chemical compound ClC=C.FC(F)=C PKERFCBWBFEXPH-UHFFFAOYSA-N 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- UOCIZHQMWNPGEN-UHFFFAOYSA-N dialuminum;oxygen(2-);trihydrate Chemical compound O.O.O.[O-2].[O-2].[O-2].[Al+3].[Al+3] UOCIZHQMWNPGEN-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920013716 polyethylene resin Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 239000006077 pvc stabilizer Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011342 resin composition Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/20—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/12—Esters; Ether-esters of cyclic polycarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US97260178A | 1978-12-22 | 1978-12-22 | |
| US06/068,987 US4298517A (en) | 1978-12-22 | 1979-08-23 | Tetrahalophthalates as flame retardant plasticizers for halogenated resins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2951906A1 true DE2951906A1 (de) | 1980-07-10 |
| DE2951906C2 DE2951906C2 (OSRAM) | 1991-08-29 |
Family
ID=26749573
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792951906 Granted DE2951906A1 (de) | 1978-12-22 | 1979-12-21 | Flammverzoegerte masse |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4298517A (OSRAM) |
| DE (1) | DE2951906A1 (OSRAM) |
| FR (1) | FR2444695B1 (OSRAM) |
| GB (1) | GB2039493B (OSRAM) |
| IT (1) | IT1126838B (OSRAM) |
| NL (1) | NL185571C (OSRAM) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5857459B2 (ja) * | 1979-07-31 | 1983-12-20 | 大日本インキ化学工業株式会社 | 耐熱性可塑剤 |
| US4764550A (en) * | 1985-09-17 | 1988-08-16 | Pennwalt Corporation | Tetrahalophthalate esters as flame retardants for polyphenylene ether resins |
| US5049697A (en) * | 1987-09-21 | 1991-09-17 | Atochem North America, Inc. | High yield method for preparation of dialkyl esters of polyhaloaromatic acids |
| US5008323A (en) * | 1987-10-09 | 1991-04-16 | Great Lakes Chemical Corporation | Flame retardant PVC resin compositions |
| US4923916A (en) * | 1987-10-30 | 1990-05-08 | Pennwalt Corporation | Tetrahalophthalate esters as flame retardants for polystyrene resins |
| US4762861A (en) * | 1987-10-30 | 1988-08-09 | Pennwalt Corporation | Tetrahalophthalate esters as flame retardants for polystyrene resins |
| US4954542A (en) * | 1988-03-25 | 1990-09-04 | Pennwalt Corporation | Tetrahalophthalate esters as flame retardants for polybutylene terephthalate resins (PBT) |
| US5086098A (en) * | 1987-10-30 | 1992-02-04 | Atochem North America, Inc. | Polyhaloaromatic ester flame retardants for polyolefin resins |
| US4912158A (en) * | 1988-03-25 | 1990-03-27 | Pennwalt Corporation | Tetrahalophthalate esters as flame retardants for polycarbonate resins |
| US4938894A (en) * | 1987-10-30 | 1990-07-03 | Pennwalt Corporation | Tetrahalophthalate esters as flame retardants for ABS (acrylonitrile-butadiene styrene terpolymer) resins |
| US4904795A (en) * | 1988-03-25 | 1990-02-27 | Pennwalt Corporation | Halogen substituted phthalimide flame retardants |
| US4927873A (en) * | 1988-03-25 | 1990-05-22 | Pennwalt Corporation | Halophenyl ester flame retardants for polyphenylene ether resins |
| US5043374A (en) * | 1988-03-25 | 1991-08-27 | Atochem North America, Inc. | Halogenated polyester flame retardants for polyphenylene ether, polyolefin and polyethylene terephthalate resins |
| US4999391A (en) * | 1988-03-25 | 1991-03-12 | Atochem North America, Inc. | Halogen substituted phthalimide flame retardants |
| US5036121A (en) * | 1988-09-06 | 1991-07-30 | The B. F. Goodrich Company | Flame and smoke retardant cable insulation and jacketing compositions |
| US5328627A (en) * | 1988-10-14 | 1994-07-12 | Elf Atochem North America, Inc. | Fire resistant hydraulic fluids |
| JPH0726005B2 (ja) * | 1989-04-04 | 1995-03-22 | 帝人株式会社 | 難燃性ポリエステル樹脂組成物 |
| US6190581B1 (en) * | 1994-05-12 | 2001-02-20 | Laurel Industries, Inc. | Dehydrated antimonate/polymer pelletizing process |
| WO1998057920A2 (en) * | 1997-06-18 | 1998-12-23 | Great Lakes Chemical Corporation | Novel flame retardant plasticizers |
| US6337419B1 (en) | 1997-07-17 | 2002-01-08 | Unitex Chemical Corporation | Plasticized polyvinyl chloride compound |
| US6114425A (en) * | 1997-07-17 | 2000-09-05 | Unitex Chemical Corporation | Plasticized polyvinyl chloride compound |
| US6150552A (en) * | 1998-06-30 | 2000-11-21 | Great Lakes Chemical Corporation | Efficient methods for making tetrahalophthalate esters having excellent purity |
| US6448310B1 (en) | 2001-01-16 | 2002-09-10 | Laurel Industries, Inc. | Flame retardant composition |
| KR20090060288A (ko) * | 2006-09-08 | 2009-06-11 | 알베마를 코포레이션 | 난연 텍스타일 제품 및 이의 제조 방법 |
| CN115466471A (zh) * | 2022-10-19 | 2022-12-13 | 四川天邑康和通信股份有限公司 | 一种高流动性阻燃pvc材料及其制备方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1505450A (en) * | 1975-12-22 | 1978-03-30 | Monsanto Co | Bromoalkyl ester plasticizers |
| US4098704A (en) * | 1977-02-25 | 1978-07-04 | Pennwalt Corporation | Polyoxyalkylene tetrahalophthalate ester as textile finishing agent |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2073937A (en) * | 1932-06-20 | 1937-03-16 | Monsanto Chemicals | Esters of polycarboxylic aromatic acids |
| US2460574A (en) * | 1945-04-05 | 1949-02-01 | Goodrich Co B F | Vinyl chloride polymers plasticized with dialkyl chlorophthalates |
| US2588512A (en) * | 1950-05-13 | 1952-03-11 | Monsanto Chemicals | Vinyl chloride polymers plasticized with alkyl benzyl tetrachlorophthalates |
| NL80600B (OSRAM) * | 1951-08-23 | |||
| US2985612A (en) * | 1958-09-15 | 1961-05-23 | Monsanto Chemicals | Alkyl phenacetonyl phthalates and vinyl chloride polymer compositions plasticized therewith |
| US3642646A (en) * | 1968-04-23 | 1972-02-15 | Standard Oil Co | Carboxy-bearing adduct polyol composition containing tetrabromophthalic anhydride |
| US3775165A (en) * | 1971-07-19 | 1973-11-27 | Deering Milliken Res Corp | Polymers of improved flame retardance |
| US4113689A (en) * | 1973-04-24 | 1978-09-12 | Montedison S.P.A. | Halogenated esters of polycarboxylic acids and plasticizers for chloro-vinyl polymers based on said esters |
| DE2719431C2 (de) * | 1977-04-30 | 1986-06-19 | Neynaber Chemie Gmbh, 2854 Loxstedt | Halogenhaltige Dicarbonsäureester als Gleitmittel für PVC |
-
1979
- 1979-08-23 US US06/068,987 patent/US4298517A/en not_active Expired - Lifetime
- 1979-12-20 IT IT51152/79A patent/IT1126838B/it active
- 1979-12-20 NL NLAANVRAGE7909187,A patent/NL185571C/xx not_active IP Right Cessation
- 1979-12-21 FR FR7931524A patent/FR2444695B1/fr not_active Expired
- 1979-12-21 GB GB7944081A patent/GB2039493B/en not_active Expired
- 1979-12-21 DE DE19792951906 patent/DE2951906A1/de active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1505450A (en) * | 1975-12-22 | 1978-03-30 | Monsanto Co | Bromoalkyl ester plasticizers |
| US4098704A (en) * | 1977-02-25 | 1978-07-04 | Pennwalt Corporation | Polyoxyalkylene tetrahalophthalate ester as textile finishing agent |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2444695A1 (fr) | 1980-07-18 |
| NL185571B (nl) | 1989-12-18 |
| FR2444695B1 (fr) | 1986-03-21 |
| GB2039493B (en) | 1983-03-02 |
| NL7909187A (nl) | 1980-06-24 |
| US4298517A (en) | 1981-11-03 |
| NL185571C (nl) | 1990-05-16 |
| DE2951906C2 (OSRAM) | 1991-08-29 |
| IT1126838B (it) | 1986-05-21 |
| GB2039493A (en) | 1980-08-13 |
| IT7951152A0 (it) | 1979-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2951906A1 (de) | Flammverzoegerte masse | |
| US4397977A (en) | Tetrahalophthalates as flame retardant plasticizers for halogenated resins | |
| DE2822508C2 (OSRAM) | ||
| DE2733695A1 (de) | Stabilisierte feuerhemmende styrolpolymermischungen | |
| DE1232740B (de) | Stabilisieren von Polymerisaten oder Misch-polymerisaten halogenhaltiger Vinylverbindungen oder von chlorierten Paraffinen | |
| DE2316940C3 (de) | Ester von 1,1,3-Trimethyl-3-phenyl-indan und deren Verwendung | |
| DE2460194A1 (de) | Verfahren zur unterdrueckung der rauchentwicklung brennender halogenhaltiger polymerisatmassen | |
| DE1669989B2 (de) | Stabilisierte Massen auf der Basis von halogenenthaltenden Polymerisaten und Organozinnverbindungen | |
| US3296289A (en) | Dialkyl tin bis (cyclohexyl maleate) compounds | |
| DE69700677T2 (de) | Thermostabilisierte Zusammensetzungen von Vinylidenfluorid-Polymeren | |
| DE1022003B (de) | Verfahren zur Hitzestabilisierung von Polymerisate oder Mischpolymerisate des Vinylchlorids enthaltenden Massen | |
| DE1219223B (de) | Stabilisierung von Vinylhalogenidpolymerisaten und -mischpolymerisaten | |
| DE2005290A1 (de) | Neue Organo-Zinnverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren für Vinylhalogenidpolymerisate | |
| DE1569019B2 (de) | Hitzestabilisierte, asbest enthaltende massen aus vinylhalogenidhomopolymerisaten fuer form-, press- und ueberzugszwecke | |
| DE3850453T2 (de) | Antistatikum für Polyvinylchlorid. | |
| EP0063768A1 (de) | Eine Kupferverbindung enthaltende Polyvinylchloridmischung | |
| DE1544960B2 (de) | Stabilisierte halogenhaltige vinylpolymensate | |
| US3019205A (en) | Stabilized asbestos filled polyvinyl chloride resins | |
| US3354176A (en) | Vinyl chloride resins containing plasticizers stabilized with hydroxy phenyl pentanoic acid esters | |
| DE1569014C3 (de) | Wärme- und lichtbeständige Form- und Überzugsmassen | |
| DE1494171B2 (de) | Stabilisieren von chlorhaltigen polymerisaten | |
| DE2006711A1 (de) | Stabilisatorsystem und seine Verwendung | |
| DE2646970A1 (de) | Vinylchloridpolymerzusammensetzung und verfahren zu ihrer herstellung | |
| DE1926949B2 (de) | Wärmestabilisierte Vinylchloridpolymerisat-Masse mit einem Gehalt an Organozinnverbindungen als Wärmestabilisatoren | |
| CH623340A5 (en) | Polymer mixture |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |