DE2938939C2 - - Google Patents
Info
- Publication number
- DE2938939C2 DE2938939C2 DE2938939A DE2938939A DE2938939C2 DE 2938939 C2 DE2938939 C2 DE 2938939C2 DE 2938939 A DE2938939 A DE 2938939A DE 2938939 A DE2938939 A DE 2938939A DE 2938939 C2 DE2938939 C2 DE 2938939C2
- Authority
- DE
- Germany
- Prior art keywords
- chloronitrobenzene
- alkali metal
- catalyst
- range
- metal fluoride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical group [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 claims description 20
- BFCFYVKQTRLZHA-UHFFFAOYSA-N 1-chloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1Cl BFCFYVKQTRLZHA-UHFFFAOYSA-N 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 15
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 claims description 11
- 235000003270 potassium fluoride Nutrition 0.000 claims description 10
- 239000011698 potassium fluoride Substances 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 229910001515 alkali metal fluoride Inorganic materials 0.000 claims description 5
- CXRFDZFCGOPDTD-UHFFFAOYSA-M Cetrimide Chemical group [Br-].CCCCCCCCCCCCCC[N+](C)(C)C CXRFDZFCGOPDTD-UHFFFAOYSA-M 0.000 claims description 4
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 claims description 3
- -1 aralkyl ammonium salt Chemical class 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 2
- GEZYJXGVVUMDHH-UHFFFAOYSA-N [Cl].[O-][N+](=O)C1=CC=CC=C1 Chemical compound [Cl].[O-][N+](=O)C1=CC=CC=C1 GEZYJXGVVUMDHH-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 5
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- NTBYINQTYWZXLH-UHFFFAOYSA-N 1,2-dichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1 NTBYINQTYWZXLH-UHFFFAOYSA-N 0.000 description 2
- 241000158147 Sator Species 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000005181 nitrobenzenes Chemical class 0.000 description 2
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 1
- DPHCXXYPSYMICK-UHFFFAOYSA-N 2-chloro-1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(Cl)=C1 DPHCXXYPSYMICK-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- GLCYMSPOJRDUEE-UHFFFAOYSA-N [N+](=O)([O-])C1=CC=CC=C1.[F] Chemical class [N+](=O)([O-])C1=CC=CC=C1.[F] GLCYMSPOJRDUEE-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- RYVBINGWVJJDPU-UHFFFAOYSA-M tributyl(hexadecyl)phosphanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[P+](CCCC)(CCCC)CCCC RYVBINGWVJJDPU-UHFFFAOYSA-M 0.000 description 1
- CUJOZWAJXUIYAT-UHFFFAOYSA-M tributyl(undecyl)azanium;bromide Chemical compound [Br-].CCCCCCCCCCC[N+](CCCC)(CCCC)CCCC CUJOZWAJXUIYAT-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7839512 | 1978-10-05 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2938939A1 DE2938939A1 (de) | 1980-04-17 |
| DE2938939C2 true DE2938939C2 (enExample) | 1989-10-05 |
Family
ID=10500154
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792938939 Granted DE2938939A1 (de) | 1978-10-05 | 1979-09-26 | Verfahren zur herstellung von fluornitrobenzolen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4287374A (enExample) |
| JP (1) | JPS5589249A (enExample) |
| DE (1) | DE2938939A1 (enExample) |
| GB (1) | GB2042507B (enExample) |
| IT (1) | IT1206991B (enExample) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4418229A (en) * | 1981-04-15 | 1983-11-29 | Mallinckrodt, Inc. | Method for producing fluoronitrobenzene compounds |
| JPS57197226A (en) * | 1981-05-30 | 1982-12-03 | Dainippon Ink & Chem Inc | Preparation of aromatic fluorine compound |
| DE3400418A1 (de) * | 1984-01-07 | 1985-07-18 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung fluorsubstituierter aromatischer verbindungen |
| US4704483A (en) * | 1984-04-27 | 1987-11-03 | Occidental Chemical Corporation | 3,4-difluoro-5-nitrobenzotrifluoride and preparation of fluoro-nitro-benzotrifluorides |
| JPS6150945A (ja) * | 1984-08-21 | 1986-03-13 | Seimi Chem Kk | フツ素化方法 |
| US4642399A (en) * | 1984-11-29 | 1987-02-10 | Mallinckrodt, Inc. | Method for producing fluoronitrobenzene compounds |
| US4849552A (en) * | 1986-01-06 | 1989-07-18 | Mallinckrodt, Inc. | Preparation of fluoroaromatic compounds in dispersion of potassium fluoride |
| EP0253837B1 (en) * | 1986-01-06 | 1991-10-09 | Mallinckrodt Specialty Chemicals Company | Catalytic method for producing fluoroaromatic compounds using branched alkyl pyridinium salts |
| DE3681033D1 (de) * | 1986-01-06 | 1991-09-26 | Mallinckrodt Inc | Katalytisches verfahren zur herstellung von fluoraomatischen verbindungen mittels n-sek-alkylpyridiniumsalze. |
| WO1987004150A1 (en) * | 1986-01-06 | 1987-07-16 | Mallinckrodt, Inc. | Catalytic method for producing fluoroaromatic compounds using substituted pyridinium salts |
| US4642398A (en) * | 1986-01-06 | 1987-02-10 | Mallinckrodt, Inc. | Preparation of fluoronitrobenzene compounds in dispersion of potassium fluoride |
| US4973772A (en) * | 1987-02-07 | 1990-11-27 | Mallinckrodt, Inc. | Catalytic method for producing fluoroarmatic compounds using substituted pyridinium salts |
| DE3827436A1 (de) * | 1988-08-12 | 1990-02-15 | Bayer Ag | Verfahren zum einfuehren von fluoratomen an aromatische kerne durch nucleophilen austausch |
| WO1992000270A1 (de) * | 1990-06-25 | 1992-01-09 | Hoechst Aktiengesellschaft | Verfahren zur herstellung von chlorfluornitrobenzolen und difluornitrobenzolen |
| ES2083631T3 (es) * | 1991-07-17 | 1996-04-16 | Hoechst Ag | Procedimiento para la preparacion de clorofluoronitrobencenos. |
| DE4324366C1 (de) * | 1993-07-21 | 1994-09-22 | Hoechst Ag | Katalysator für nukleophile aromatische Substitutionen |
| DE4324365A1 (de) * | 1993-07-21 | 1995-01-26 | Hoechst Ag | Verfahren zur Herstellung von mehrfach fluorierten Nitrobenzolen |
| DE4324367A1 (de) * | 1993-07-21 | 1995-01-26 | Hoechst Ag | Verfahren zur Herstellung von Fluornitrobenzolen |
| US5502235A (en) * | 1994-12-28 | 1996-03-26 | Dowelanco | Solventless process for making 2,6 difluorobenzonitrile |
| DE19631854C1 (de) * | 1996-08-07 | 1998-04-30 | Hoechst Ag | Verfahren zur Herstellung von Fluor enthaltenden Verbindungen |
| WO1998022413A1 (en) | 1996-11-22 | 1998-05-28 | Albemarle Corporation | Halogen exchange reactions and uses thereof |
| US5824827A (en) * | 1996-11-22 | 1998-10-20 | Albemarle Corporation | Halogen exchange reactions |
| US5965781A (en) * | 1997-11-21 | 1999-10-12 | Albemarle Corporation | Catalysis in halogen exchange reactions |
| US6187931B1 (en) | 1999-04-06 | 2001-02-13 | Albemarle Corporation | Process for making fluorophthalimides |
| DE10129057A1 (de) * | 2001-06-15 | 2002-12-19 | Bayer Ag | Verbessertes Verfahren zur Herstellung kernfluorierter Aromaten |
| DE102004033525A1 (de) * | 2004-07-08 | 2006-02-02 | Lanxess Deutschland Gmbh | Verbessertes Verfahren zur Herstellung kernfluorierter Aromaten |
| DE102008051412A1 (de) | 2008-10-11 | 2010-04-15 | Saltigo Gmbh | Katalysatoren zur Herstellung von Fluoraromaten |
| WO2010058421A2 (en) * | 2008-11-18 | 2010-05-27 | Aditya Birla Science & Technology Co. Ltd. | A process for synthesis of 2, 4-dichloro-5- fluoroacetophenone (dcfa) |
| CN108586257B (zh) * | 2018-05-03 | 2020-12-22 | 浙江解氏新材料股份有限公司 | 一种对氟硝基苯的制备方法 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3064058A (en) * | 1961-04-07 | 1962-11-13 | Nepera Chemical Co Inc | Method of preparing fluorinated compounds |
| US3240824A (en) * | 1965-01-28 | 1966-03-15 | Olin Mathieson | Process for preparing fluoronitrobenzenes |
| US3480667A (en) * | 1965-04-28 | 1969-11-25 | Texaco Inc | Method of producing fluorinated compounds |
| GB1360327A (en) * | 1972-11-13 | 1974-07-17 | Daikin Ind Ltd | Process for the nuclear fluorination of a compound having a benzene ring |
| GB1469700A (en) * | 1974-06-25 | 1977-04-06 | Isc Chem Ltd | Process for the production of 2-fluoronitrobenzene |
| GB1514082A (en) * | 1974-06-25 | 1978-06-14 | Isc Chem Ltd | Preparation of fluoronitrobenzenes |
| US4069262A (en) * | 1977-03-07 | 1978-01-17 | E. I. Du Pont De Nemours And Company | Preparation of 2-fluoronitrobenzene |
| US4229365A (en) * | 1977-05-28 | 1980-10-21 | Basf Aktiengesellschaft | Manufacture of substituted fluorobenzenes |
| DE2724367C2 (de) * | 1977-05-28 | 1985-12-19 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Nitrofluorbenzolen |
| US4140719A (en) * | 1977-10-31 | 1979-02-20 | Merck & Co., Inc. | Solid-liquid phase transfer catalysis improved method of preparing 2,4-difluoroaniline |
| IE47471B1 (en) * | 1977-10-31 | 1984-03-21 | Merck & Co Inc | Method of preparing 2,4-difluoroaniline |
| US4164517A (en) * | 1977-12-30 | 1979-08-14 | I.S.C. Chemicals Limited | Preparation of fluoronitrobenzene |
| DE2803259A1 (de) * | 1978-01-26 | 1979-08-02 | Basf Ag | Verfahren zur herstellung von fluorbenzolen |
-
1979
- 1979-09-26 DE DE19792938939 patent/DE2938939A1/de active Granted
- 1979-10-01 US US06/080,616 patent/US4287374A/en not_active Expired - Lifetime
- 1979-10-03 IT IT7950436A patent/IT1206991B/it active
- 1979-10-03 GB GB7934224A patent/GB2042507B/en not_active Expired
- 1979-10-04 JP JP12841779A patent/JPS5589249A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2042507B (en) | 1982-12-08 |
| IT1206991B (it) | 1989-05-17 |
| US4287374A (en) | 1981-09-01 |
| GB2042507A (en) | 1980-09-24 |
| IT7950436A0 (it) | 1979-10-03 |
| DE2938939A1 (de) | 1980-04-17 |
| JPS5589249A (en) | 1980-07-05 |
| JPS6251260B2 (enExample) | 1987-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2938939C2 (enExample) | ||
| DE69813312T2 (de) | Verfahren zur herstellung von cyclopropylethyn sowie zwischenprodukte zur herstellung von cyclopropylethyn | |
| EP0319767B1 (de) | Verfahren zur Herstellung von Trifluormethansulfonsäurechlorid | |
| EP0523671B1 (de) | Verfahren zur Herstellung von Chlorfluornitrobenzolen | |
| EP0116886B1 (de) | Verfahren zur Herstellung von fluorierten Nitroalkanen | |
| EP1928839B1 (de) | Verfahren zum herstellen von 5-fluor-1,3-dialkyl-1h-pyrazol-4-carbonsäurefluoriden | |
| DE1012914B (de) | Verfahren zur Herstellung von Benzthiazolyl-2-sulfen-morpholid | |
| DE3315147A1 (de) | Verfahren zur herstellung von aromatischen verbindungen, die ueber ein heteroatom gebundene perfluorierte seitenketten enthalten | |
| DE19720341C1 (de) | Verfahren zur Herstellung von 3,5-Difluoranilin | |
| DE3836175A1 (de) | Fluor enthaltende phenole | |
| DE3885823T2 (de) | Verfahren zur herstellung von 3-chlor-4-fluornitrobenzol. | |
| DE2604276C2 (de) | Verfahren zur α-Monochlorierung kernchlorierter Toluole | |
| DE2644641C2 (de) | Verfahren zur Herstellung von bestimmten kernchlorierten Benzotrichloriden | |
| DE3104388A1 (de) | Verfahren zur herstellung von 1-alkyl-2-chlor-5-nitro-4-benzol-sulfonsaeuren | |
| DE2548970A1 (de) | Trichlormethyl-trifluormethyl-benzole | |
| DE1123663B (de) | Verfahren zur Herstellung von hochchlorierten Arylsulfiden | |
| EP0653412B1 (de) | Verfahren zur Herstellung von 4,5-Difluorbenzaldehyden | |
| EP0251041B1 (de) | Verfahren zur Herstellung von 2,3,5,6-Tetrafluorbenzoesäure und die Verbindungen 2,3,5,6-Tetrachlor-4-trifluormethyl-benzoylchlorid und 2,3,5,6-Tetrafluor-4-trifluormethyl-benzoylfluorid | |
| EP0136566A2 (de) | Verfahren zur Herstellung von 3,4-Dichlorbenzotrihalogeniden | |
| EP0500639B1 (de) | Verfahren zur herstellung von alkyl-[3-chlorphenyl]-sulfonen | |
| EP0523668B1 (de) | Verfahren zur Herstellung von Difluorbenzaldehyden | |
| EP0019789A1 (de) | Verfahren zur Herstellung von 1,3,5-Trichlorbenzol | |
| DE1966434A1 (de) | Verfahren zur herstellung von organischen isocyanaten | |
| DE3025910A1 (de) | Verfahren zur herstellung von 2,6-dichlorbenzthiazol | |
| CH630593A5 (de) | Verfahren zur herstellung von 4-brom-2-chlorphenol. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: THE BOOTS CO. PLC, NOTTINGHAM, GB |
|
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |