DE2933979A1 - Neue 4-fluor-3-phenoxy-benzaldehydacetale und verfahren zu deren herstellung sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung. - Google Patents
Neue 4-fluor-3-phenoxy-benzaldehydacetale und verfahren zu deren herstellung sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung.Info
- Publication number
- DE2933979A1 DE2933979A1 DE19792933979 DE2933979A DE2933979A1 DE 2933979 A1 DE2933979 A1 DE 2933979A1 DE 19792933979 DE19792933979 DE 19792933979 DE 2933979 A DE2933979 A DE 2933979A DE 2933979 A1 DE2933979 A1 DE 2933979A1
- Authority
- DE
- Germany
- Prior art keywords
- fluoro
- benzaldehyde
- formula
- bromo
- phenoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 42
- 238000004519 manufacturing process Methods 0.000 title claims description 11
- 239000013067 intermediate product Substances 0.000 title 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- -1 3-Bromo-4-fluoro-benzaldehyde acetals Chemical class 0.000 claims description 17
- FAHZIKXYYRGSHF-UHFFFAOYSA-N 3-bromo-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1Br FAHZIKXYYRGSHF-UHFFFAOYSA-N 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 12
- 239000003085 diluting agent Substances 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- JDICMOLUAHZVDS-UHFFFAOYSA-N 4-fluoro-3-phenoxybenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1OC1=CC=CC=C1 JDICMOLUAHZVDS-UHFFFAOYSA-N 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 7
- 239000000543 intermediate Substances 0.000 claims description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 6
- 239000005749 Copper compound Substances 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 6
- 229910052802 copper Inorganic materials 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 5
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 5
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 claims description 4
- 238000005798 acetal elimination reaction Methods 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 229910001508 alkali metal halide Inorganic materials 0.000 claims description 4
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 150000001880 copper compounds Chemical class 0.000 claims description 3
- 150000001299 aldehydes Chemical class 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- 239000000203 mixture Substances 0.000 description 17
- 239000012074 organic phase Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- HNVVROFWONXXGO-UHFFFAOYSA-N (3-bromo-4-fluorophenyl)methanol Chemical compound OCC1=CC=C(F)C(Br)=C1 HNVVROFWONXXGO-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000007858 starting material Substances 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(i) oxide Chemical compound [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- GIQURHRJQIPDKM-UHFFFAOYSA-N 4-fluorobenzoyl fluoride Chemical compound FC(=O)C1=CC=C(F)C=C1 GIQURHRJQIPDKM-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000012024 dehydrating agents Substances 0.000 description 3
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- OATOZCSPTSMOIY-UHFFFAOYSA-N 2-(3-bromo-4-fluorophenyl)-1,3-dioxolane Chemical compound C1=C(Br)C(F)=CC=C1C1OCCO1 OATOZCSPTSMOIY-UHFFFAOYSA-N 0.000 description 2
- AIOKJVVAYNKWQP-UHFFFAOYSA-N 3-bromo-4-fluorobenzoyl fluoride Chemical compound FC(=O)C1=CC=C(F)C(Br)=C1 AIOKJVVAYNKWQP-UHFFFAOYSA-N 0.000 description 2
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 2
- 229940031826 phenolate Drugs 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 239000011698 potassium fluoride Substances 0.000 description 2
- 235000003270 potassium fluoride Nutrition 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- GEZMEIHVFSWOCA-UHFFFAOYSA-N (4-fluorophenyl)methanol Chemical compound OCC1=CC=C(F)C=C1 GEZMEIHVFSWOCA-UHFFFAOYSA-N 0.000 description 1
- IPWBFGUBXWMIPR-UHFFFAOYSA-N 1-bromo-2-fluorobenzene Chemical class FC1=CC=CC=C1Br IPWBFGUBXWMIPR-UHFFFAOYSA-N 0.000 description 1
- ILKFYEKKPVEUOK-UHFFFAOYSA-N 1-fluoro-4-methyl-2-phenoxybenzene Chemical compound CC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 ILKFYEKKPVEUOK-UHFFFAOYSA-N 0.000 description 1
- GVMSVIAUCZLFIQ-UHFFFAOYSA-N 2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-dioxolane Chemical compound O1C(C)COC1C1=CC=C(F)C(Br)=C1 GVMSVIAUCZLFIQ-UHFFFAOYSA-N 0.000 description 1
- BOIKPJKVWFRGMY-UHFFFAOYSA-N 2-(4-fluoro-3-phenoxyphenyl)-1,3-dioxolane Chemical compound FC1=CC=C(C2OCCO2)C=C1OC1=CC=CC=C1 BOIKPJKVWFRGMY-UHFFFAOYSA-N 0.000 description 1
- FYORNQRVVRUCOV-UHFFFAOYSA-N 2-(4-fluoro-3-phenoxyphenyl)-4-methyl-1,3-dioxolane Chemical compound O1C(C)COC1C1=CC=C(F)C(OC=2C=CC=CC=2)=C1 FYORNQRVVRUCOV-UHFFFAOYSA-N 0.000 description 1
- QLRKALMVPCQTMU-UHFFFAOYSA-N 2-bromo-1-fluoro-4-methylbenzene Chemical compound CC1=CC=C(F)C(Br)=C1 QLRKALMVPCQTMU-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- QDKIFIYGNKHERN-UHFFFAOYSA-N 4-(bromomethyl)-1-fluoro-2-phenoxybenzene Chemical compound FC1=CC=C(CBr)C=C1OC1=CC=CC=C1 QDKIFIYGNKHERN-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000006359 acetalization reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- HPMLGNIUXVXALD-UHFFFAOYSA-N benzoyl fluoride Chemical compound FC(=O)C1=CC=CC=C1 HPMLGNIUXVXALD-UHFFFAOYSA-N 0.000 description 1
- MEPLDDAONLVHEF-UHFFFAOYSA-M benzyl(triethyl)azanium;hydrogen sulfate Chemical compound OS([O-])(=O)=O.CC[N+](CC)(CC)CC1=CC=CC=C1 MEPLDDAONLVHEF-UHFFFAOYSA-M 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- HERWQQFSESWGRK-UHFFFAOYSA-N chromium(6+) oxygen(2-) pyridin-1-ium chloride Chemical compound Cl.N1=CC=CC=C1.[O-2].[O-2].[O-2].[Cr+6] HERWQQFSESWGRK-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- XLNZHTHIPQGEMX-UHFFFAOYSA-N ethane propane Chemical compound CCC.CCC.CC.CC XLNZHTHIPQGEMX-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- KRPXAHXWPZLBKL-UHFFFAOYSA-L magnesium;diphenoxide Chemical compound [Mg+2].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 KRPXAHXWPZLBKL-UHFFFAOYSA-L 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/22—Radicals substituted by singly bound oxygen or sulfur atoms etherified
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
- C07C45/292—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups with chromium derivatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/30—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with halogen containing compounds, e.g. hypohalogenation
- C07C45/305—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with halogen containing compounds, e.g. hypohalogenation with halogenochromate reagents, e.g. pyridinium chlorochromate
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
- C07C45/57—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom
- C07C45/59—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom in five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/16—Radicals substituted by halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792933979 DE2933979A1 (de) | 1979-08-22 | 1979-08-22 | Neue 4-fluor-3-phenoxy-benzaldehydacetale und verfahren zu deren herstellung sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung. |
| EP80104747A EP0024624B1 (de) | 1979-08-22 | 1980-08-12 | 4-Fluor-3-phenoxy-benzaldehyd-acetale und Verfahren zu deren Herstellung sowie Zwischenprodukte hierfür |
| EP82101333A EP0061004A1 (de) | 1979-08-22 | 1980-08-12 | 3-Brom-4-fluorbenzaldehyd und seine Acetale und Verfahren zu deren Herstellung |
| DE8080104747T DE3068432D1 (en) | 1979-08-22 | 1980-08-12 | 4-fluoro-3-phenoxy-benzaldehyde acetals, process for their preparation and intermediate products therefor |
| IL60874A IL60874A (en) | 1979-08-22 | 1980-08-19 | Preparation of 4-fluoro-3-phenoxy-benzaldehyde,intermediates therefor and their preparation |
| IL60873A IL60873A0 (en) | 1979-08-22 | 1980-08-19 | 4-fluoro-3-phenoxy-benzylethers and their preparation |
| JP11355080A JPS5632427A (en) | 1979-08-22 | 1980-08-20 | Novel 44fluoroo33phenoxyybenzaldehydeacetal* its manufacture* novel intermediate therefor and its manufacture |
| DD80223413A DD153823A5 (de) | 1979-08-22 | 1980-08-20 | Verfahren zur herstellung von neuen 4-fluor-3-phenoxy-benzaldehyd-acetalen |
| HU803070A HU188369B (en) | 1979-08-22 | 1980-08-21 | Process for preparing 3-bromo-4-fluoro-benzaldehyde |
| BR8005293A BR8005293A (pt) | 1979-08-22 | 1980-08-21 | Processo para a preparacao de 4-fluor-3-fenoxi-benzaldeido-acetais, sua aplicacao e processo para a preparacao de produtos intermediarios |
| HU803069A HU188368B (en) | 1979-08-22 | 1980-08-21 | Process for preparing new 3-bromo-4-fluoro-benzaldehyde-acetal derivatives |
| HU802071A HU185789B (en) | 1979-08-22 | 1980-08-21 | Process for preparing new 3-phenoxy-4-fluoro-benzaldehyde-acetal derivatives |
| DK359280A DK359280A (da) | 1979-08-22 | 1980-08-21 | 4-fluor-3-phenoxy-benzaldehyd-acetaler og fremgangsmaade til fremstilling heraf samt mellemprodukter til brug herved og fremgangsmaade til disses fremstilling |
| US06/303,657 US4626601A (en) | 1979-08-22 | 1981-09-18 | Preparation of 4-fluoro-3-phenoxy-benzal-dehyde acetals and intermediates therefor |
| US06/887,471 US4748257A (en) | 1979-08-22 | 1986-07-21 | 4-fluoro-3-phenoxy-benzaldehyde acetals |
| JP62275930A JPS63119434A (ja) | 1979-08-22 | 1987-11-02 | 3−ブロモ−4−フルオロ−ベンズアルデヒドアセタールおよびその製法 |
| JP62275931A JPS63119435A (ja) | 1979-08-22 | 1987-11-02 | 3―ブロモ―4―フルオロ―ベンズアルデヒド |
| US07/162,788 US4845249A (en) | 1979-08-22 | 1988-03-02 | 4-fluoro-3-bromo benzaldehyde acetals |
| DK293690A DK163815C (da) | 1979-08-22 | 1990-12-11 | 3-brom-4-fluor-benzaldehyd |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792933979 DE2933979A1 (de) | 1979-08-22 | 1979-08-22 | Neue 4-fluor-3-phenoxy-benzaldehydacetale und verfahren zu deren herstellung sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2933979A1 true DE2933979A1 (de) | 1981-03-12 |
Family
ID=6079042
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792933979 Withdrawn DE2933979A1 (de) | 1979-08-22 | 1979-08-22 | Neue 4-fluor-3-phenoxy-benzaldehydacetale und verfahren zu deren herstellung sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung. |
| DE8080104747T Expired DE3068432D1 (en) | 1979-08-22 | 1980-08-12 | 4-fluoro-3-phenoxy-benzaldehyde acetals, process for their preparation and intermediate products therefor |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8080104747T Expired DE3068432D1 (en) | 1979-08-22 | 1980-08-12 | 4-fluoro-3-phenoxy-benzaldehyde acetals, process for their preparation and intermediate products therefor |
Country Status (9)
| Country | Link |
|---|---|
| US (3) | US4626601A (enExample) |
| EP (2) | EP0024624B1 (enExample) |
| JP (3) | JPS5632427A (enExample) |
| BR (1) | BR8005293A (enExample) |
| DD (1) | DD153823A5 (enExample) |
| DE (2) | DE2933979A1 (enExample) |
| DK (2) | DK359280A (enExample) |
| HU (3) | HU185789B (enExample) |
| IL (2) | IL60873A0 (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0048914A1 (de) * | 1980-10-01 | 1982-04-07 | Bayer Ag | Verfahren zur Herstellung von 3-Brom-4-fluor-benzylalkohol, neue Zwischenprodukte hierfür und Verfahren zur Herstellung dieser Zwischenprodukte |
| EP0071135A1 (de) * | 1981-07-28 | 1983-02-09 | Bayer Ag | Verfahren zur Herstellung von 3-Brom-4-fluor-benzaldehyd |
| EP0074571A1 (de) * | 1981-09-15 | 1983-03-23 | Bayer Ag | Verfahren zur Herstellung von para-substituierten 3-Brombenzaldehyden |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2933985A1 (de) * | 1979-08-22 | 1981-04-09 | Bayer Ag, 5090 Leverkusen | Neue 4-fluor-3-phenoxy-benzyl-ether und verfahren zu deren herstellung sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| DE3006685C2 (de) * | 1980-02-22 | 1982-09-09 | Riedel-De Haen Ag, 3016 Seelze | 3-Brom-4-fluorbenzonitril und Verfahren zur Herstellung eines substituierten 3-Brom-4-fluorbenzols |
| DE3035921A1 (de) * | 1980-09-24 | 1982-05-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 3-brom-4fluor-benzaldehyd-acetalen, neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| JPS5939842A (ja) * | 1982-08-31 | 1984-03-05 | Mitsui Petrochem Ind Ltd | アセタ−ル類の製造方法 |
| US5212211A (en) * | 1990-11-19 | 1993-05-18 | Loctite Corporation | Polymodal-cure silicone composition, and method of making the same |
| US5179134A (en) * | 1990-11-19 | 1993-01-12 | Loctite Corporation | Photocurable silicone composition, and method of making the same |
| US5182315A (en) * | 1990-11-19 | 1993-01-26 | Loctite Corporation | Photocurable silicone gel composition, and method of making the same |
| FR2669925B1 (fr) * | 1990-11-30 | 1993-01-29 | Rhone Poulenc Chimie | Procede de preparation de composes aromatiques polyalkoxyles. |
| DE4106908A1 (de) * | 1991-03-05 | 1992-09-10 | Basf Ag | Verfahren zur herstellung (alpha),(beta)-ungesaettigter aldehyde und ketone |
| IL123137A0 (en) * | 1998-02-02 | 1998-09-24 | Bromine Compounds Ltd | Process for the halogenation of aldehydes and ketones |
| US8258349B2 (en) * | 2008-02-14 | 2012-09-04 | Suitomo Chemical Company, Limited | Process for production of benzaldehyde compound |
| JP5314330B2 (ja) * | 2008-06-16 | 2013-10-16 | 住友化学株式会社 | 2−(アリールオキシメチル)ベンズアルデヒドの製造方法およびその中間体 |
| WO2010086876A2 (en) * | 2009-01-09 | 2010-08-05 | Aditya Birla Science & Technology Co. Ltd. | Ether synthesis |
| TWI418535B (zh) * | 2009-04-07 | 2013-12-11 | Sumitomo Chemical Co | Preparation of benzaldehyde compounds |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3965127A (en) * | 1973-08-06 | 1976-06-22 | Monsanto Company | Urea-phosphorus compounds |
| US3904654A (en) * | 1973-08-06 | 1975-09-09 | Monsanto Co | Urea-phosphorus compounds |
| FR2245630B1 (enExample) * | 1973-10-02 | 1977-03-11 | Ile De France | |
| DE2934034A1 (de) * | 1979-08-22 | 1981-03-26 | Bayer Ag, 51373 Leverkusen | Verfahren zur herstellung von substituierten benzaldehyden, neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| DE3006685C2 (de) * | 1980-02-22 | 1982-09-09 | Riedel-De Haen Ag, 3016 Seelze | 3-Brom-4-fluorbenzonitril und Verfahren zur Herstellung eines substituierten 3-Brom-4-fluorbenzols |
| DE3026959A1 (de) * | 1980-07-16 | 1982-02-04 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 3-brom-4-fluor-benzaldehyd-(-acetalen) und neue zwischenprodukte hierfuer |
-
1979
- 1979-08-22 DE DE19792933979 patent/DE2933979A1/de not_active Withdrawn
-
1980
- 1980-08-12 EP EP80104747A patent/EP0024624B1/de not_active Expired
- 1980-08-12 EP EP82101333A patent/EP0061004A1/de active Pending
- 1980-08-12 DE DE8080104747T patent/DE3068432D1/de not_active Expired
- 1980-08-19 IL IL60873A patent/IL60873A0/xx unknown
- 1980-08-19 IL IL60874A patent/IL60874A/xx unknown
- 1980-08-20 DD DD80223413A patent/DD153823A5/de unknown
- 1980-08-20 JP JP11355080A patent/JPS5632427A/ja active Granted
- 1980-08-21 HU HU802071A patent/HU185789B/hu unknown
- 1980-08-21 HU HU803069A patent/HU188368B/hu unknown
- 1980-08-21 DK DK359280A patent/DK359280A/da not_active Application Discontinuation
- 1980-08-21 BR BR8005293A patent/BR8005293A/pt not_active IP Right Cessation
- 1980-08-21 HU HU803070A patent/HU188369B/hu unknown
-
1981
- 1981-09-18 US US06/303,657 patent/US4626601A/en not_active Expired - Lifetime
-
1986
- 1986-07-21 US US06/887,471 patent/US4748257A/en not_active Expired - Lifetime
-
1987
- 1987-11-02 JP JP62275930A patent/JPS63119434A/ja active Granted
- 1987-11-02 JP JP62275931A patent/JPS63119435A/ja active Granted
-
1988
- 1988-03-02 US US07/162,788 patent/US4845249A/en not_active Expired - Lifetime
-
1990
- 1990-12-11 DK DK293690A patent/DK163815C/da not_active IP Right Cessation
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0048914A1 (de) * | 1980-10-01 | 1982-04-07 | Bayer Ag | Verfahren zur Herstellung von 3-Brom-4-fluor-benzylalkohol, neue Zwischenprodukte hierfür und Verfahren zur Herstellung dieser Zwischenprodukte |
| EP0071135A1 (de) * | 1981-07-28 | 1983-02-09 | Bayer Ag | Verfahren zur Herstellung von 3-Brom-4-fluor-benzaldehyd |
| EP0074571A1 (de) * | 1981-09-15 | 1983-03-23 | Bayer Ag | Verfahren zur Herstellung von para-substituierten 3-Brombenzaldehyden |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0024624B1 (de) | 1984-07-04 |
| DD153823A5 (de) | 1982-02-03 |
| JPS5632427A (en) | 1981-04-01 |
| IL60873A0 (en) | 1980-10-26 |
| US4748257A (en) | 1988-05-31 |
| US4845249A (en) | 1989-07-04 |
| EP0024624A3 (en) | 1981-06-17 |
| DE3068432D1 (en) | 1984-08-09 |
| US4626601A (en) | 1986-12-02 |
| IL60874A0 (en) | 1980-10-26 |
| EP0024624A2 (de) | 1981-03-11 |
| JPS6338007B2 (enExample) | 1988-07-28 |
| BR8005293A (pt) | 1981-03-04 |
| DK163815B (da) | 1992-04-06 |
| JPH0255412B2 (enExample) | 1990-11-27 |
| EP0061004A1 (de) | 1982-09-29 |
| JPS64380B2 (enExample) | 1989-01-06 |
| DK359280A (da) | 1981-02-23 |
| JPS63119434A (ja) | 1988-05-24 |
| JPS63119435A (ja) | 1988-05-24 |
| HU188369B (en) | 1986-04-28 |
| DK293690D0 (da) | 1990-12-11 |
| DK163815C (da) | 1992-09-07 |
| IL60874A (en) | 1985-08-30 |
| HU185789B (en) | 1985-03-28 |
| HU188368B (en) | 1986-04-28 |
| DK293690A (da) | 1990-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0024624B1 (de) | 4-Fluor-3-phenoxy-benzaldehyd-acetale und Verfahren zu deren Herstellung sowie Zwischenprodukte hierfür | |
| EP0024612B1 (de) | Neue 4-Fluor-3-phenoxy-benzyl-ether und Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2837525A1 (de) | Verfahren zur herstellung von 4- fluoro-3-phenoxy-toluol | |
| DE3304202A1 (de) | Verfahren zur herstellung von aromatischen aldehyden | |
| DE2906296A1 (de) | Verfahren zur herstellung von bicyclischen enolaethern sowie aether von 2-(3-hydroxyprop-1-yl)-cycloalkanonen | |
| DE2952719A1 (de) | Verfahren zur herstellung von p-substituierten phenylpropanolen und deren estern | |
| EP0024611B1 (de) | Verfahren zur Herstellung von substituierten Benzaldehyden | |
| EP0044002B1 (de) | Verfahren zur Herstellung von 3-Brom-4-fluor-benzaldehyd-(-acetalen), 3-Brom-4-fluor-benzoesäurenitril und seine Herstellung | |
| DE2804597C2 (de) | Verfahren zur Herstellung von β-Damascon und β-Damascenon | |
| EP0048914A1 (de) | Verfahren zur Herstellung von 3-Brom-4-fluor-benzylalkohol, neue Zwischenprodukte hierfür und Verfahren zur Herstellung dieser Zwischenprodukte | |
| DE2925176C2 (enExample) | ||
| EP0071135A1 (de) | Verfahren zur Herstellung von 3-Brom-4-fluor-benzaldehyd | |
| EP0019112B1 (de) | Verfahren zur Herstellung von cyclischen Acetalen von trans-4-Chlor-3-methyl-2-buten-1-al sowie von trans-3-Methyl-2-buten-1,4-dial-1-monoacetalen | |
| EP0302331A2 (de) | Ester von Arylbisperfluoralkylcarbinolen, Verfahren zur Herstellung dieser Verbindungen und der zugrundeliegenden Arylbisperfluoralkylcarbinole | |
| EP0035635B1 (de) | Verfahren zur Herstellung von Trimethylbenzochinon | |
| EP0780362A1 (de) | 3,3-Dioxy-4,4,4-trifluorbuttersäure-Derivate | |
| EP0251115B1 (de) | Verfahren zur Herstellung von beta-Halogenvinyl- und beta,beta-Dihalogenethylarylketonen | |
| EP0096813B1 (de) | Verfahren zur Herstellung von 5-Aryloxy-1-chlor-3,3-dimethyl-pentan-2-onen | |
| DE2524836C2 (de) | Verfahren zur Herstellung von 3-Chlor-4-hydroxyphenylessigsäure | |
| DE3136561A1 (de) | Verfahren zur herstellung von para-substituierten 3-brombenzaldehyden | |
| DE1934460C3 (de) | Verfahren zur Herstellung von 2-(6'-Methoxynaphth-2'-yl)-propion-säure | |
| EP0017882A1 (de) | Verfahren zur Herstellung von 3-Phenoxy-4-fluor-benzoesäure | |
| EP0048411A2 (de) | Verfahren zur Herstellung von 3-Brom-4-fluor-benzaldehydacetalen, neue Zwischenprodukte hierfür und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |