IL60873A0 - 4-fluoro-3-phenoxy-benzylethers and their preparation - Google Patents
4-fluoro-3-phenoxy-benzylethers and their preparationInfo
- Publication number
- IL60873A0 IL60873A0 IL60873A IL6087380A IL60873A0 IL 60873 A0 IL60873 A0 IL 60873A0 IL 60873 A IL60873 A IL 60873A IL 6087380 A IL6087380 A IL 6087380A IL 60873 A0 IL60873 A0 IL 60873A0
- Authority
- IL
- Israel
- Prior art keywords
- benzylethers
- phenoxy
- fluoro
- preparation
- Prior art date
Links
- DIIWCXHABNUDCX-UHFFFAOYSA-N 1-fluoro-4-[(4-fluoro-3-phenoxyphenyl)methoxymethyl]-2-phenoxybenzene Chemical class C1=C(OC=2C=CC=CC=2)C(F)=CC=C1COCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 DIIWCXHABNUDCX-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/22—Radicals substituted by singly bound oxygen or sulfur atoms etherified
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
- C07C45/292—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups with chromium derivatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/30—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with halogen containing compounds, e.g. hypohalogenation
- C07C45/305—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with halogen containing compounds, e.g. hypohalogenation with halogenochromate reagents, e.g. pyridinium chlorochromate
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
- C07C45/57—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom
- C07C45/59—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom in five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/16—Radicals substituted by halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792933979 DE2933979A1 (de) | 1979-08-22 | 1979-08-22 | Neue 4-fluor-3-phenoxy-benzaldehydacetale und verfahren zu deren herstellung sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL60873A0 true IL60873A0 (en) | 1980-10-26 |
Family
ID=6079042
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL60873A IL60873A0 (en) | 1979-08-22 | 1980-08-19 | 4-fluoro-3-phenoxy-benzylethers and their preparation |
| IL60874A IL60874A (en) | 1979-08-22 | 1980-08-19 | Preparation of 4-fluoro-3-phenoxy-benzaldehyde,intermediates therefor and their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL60874A IL60874A (en) | 1979-08-22 | 1980-08-19 | Preparation of 4-fluoro-3-phenoxy-benzaldehyde,intermediates therefor and their preparation |
Country Status (9)
| Country | Link |
|---|---|
| US (3) | US4626601A (enExample) |
| EP (2) | EP0024624B1 (enExample) |
| JP (3) | JPS5632427A (enExample) |
| BR (1) | BR8005293A (enExample) |
| DD (1) | DD153823A5 (enExample) |
| DE (2) | DE2933979A1 (enExample) |
| DK (2) | DK359280A (enExample) |
| HU (3) | HU185789B (enExample) |
| IL (2) | IL60873A0 (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2933985A1 (de) * | 1979-08-22 | 1981-04-09 | Bayer Ag, 5090 Leverkusen | Neue 4-fluor-3-phenoxy-benzyl-ether und verfahren zu deren herstellung sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| DE3006685C2 (de) * | 1980-02-22 | 1982-09-09 | Riedel-De Haen Ag, 3016 Seelze | 3-Brom-4-fluorbenzonitril und Verfahren zur Herstellung eines substituierten 3-Brom-4-fluorbenzols |
| DE3035921A1 (de) * | 1980-09-24 | 1982-05-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 3-brom-4fluor-benzaldehyd-acetalen, neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| DE3036967A1 (de) * | 1980-10-01 | 1982-05-13 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 3-brom-4-fluor-benzylalkohol und neue zwischenprodukte hierfuer |
| DE3129651A1 (de) * | 1981-07-28 | 1983-02-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 3-brom-4-fluor-benzaldehyd |
| DE3136561A1 (de) * | 1981-09-15 | 1983-03-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von para-substituierten 3-brombenzaldehyden |
| JPS5939842A (ja) * | 1982-08-31 | 1984-03-05 | Mitsui Petrochem Ind Ltd | アセタ−ル類の製造方法 |
| US5212211A (en) * | 1990-11-19 | 1993-05-18 | Loctite Corporation | Polymodal-cure silicone composition, and method of making the same |
| US5179134A (en) * | 1990-11-19 | 1993-01-12 | Loctite Corporation | Photocurable silicone composition, and method of making the same |
| US5182315A (en) * | 1990-11-19 | 1993-01-26 | Loctite Corporation | Photocurable silicone gel composition, and method of making the same |
| FR2669925B1 (fr) * | 1990-11-30 | 1993-01-29 | Rhone Poulenc Chimie | Procede de preparation de composes aromatiques polyalkoxyles. |
| DE4106908A1 (de) * | 1991-03-05 | 1992-09-10 | Basf Ag | Verfahren zur herstellung (alpha),(beta)-ungesaettigter aldehyde und ketone |
| IL123137A0 (en) * | 1998-02-02 | 1998-09-24 | Bromine Compounds Ltd | Process for the halogenation of aldehydes and ketones |
| US8258349B2 (en) * | 2008-02-14 | 2012-09-04 | Suitomo Chemical Company, Limited | Process for production of benzaldehyde compound |
| JP5314330B2 (ja) * | 2008-06-16 | 2013-10-16 | 住友化学株式会社 | 2−(アリールオキシメチル)ベンズアルデヒドの製造方法およびその中間体 |
| WO2010086876A2 (en) * | 2009-01-09 | 2010-08-05 | Aditya Birla Science & Technology Co. Ltd. | Ether synthesis |
| TWI418535B (zh) * | 2009-04-07 | 2013-12-11 | Sumitomo Chemical Co | Preparation of benzaldehyde compounds |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3965127A (en) * | 1973-08-06 | 1976-06-22 | Monsanto Company | Urea-phosphorus compounds |
| US3904654A (en) * | 1973-08-06 | 1975-09-09 | Monsanto Co | Urea-phosphorus compounds |
| FR2245630B1 (enExample) * | 1973-10-02 | 1977-03-11 | Ile De France | |
| DE2934034A1 (de) * | 1979-08-22 | 1981-03-26 | Bayer Ag, 51373 Leverkusen | Verfahren zur herstellung von substituierten benzaldehyden, neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| DE3006685C2 (de) * | 1980-02-22 | 1982-09-09 | Riedel-De Haen Ag, 3016 Seelze | 3-Brom-4-fluorbenzonitril und Verfahren zur Herstellung eines substituierten 3-Brom-4-fluorbenzols |
| DE3026959A1 (de) * | 1980-07-16 | 1982-02-04 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 3-brom-4-fluor-benzaldehyd-(-acetalen) und neue zwischenprodukte hierfuer |
-
1979
- 1979-08-22 DE DE19792933979 patent/DE2933979A1/de not_active Withdrawn
-
1980
- 1980-08-12 EP EP80104747A patent/EP0024624B1/de not_active Expired
- 1980-08-12 EP EP82101333A patent/EP0061004A1/de active Pending
- 1980-08-12 DE DE8080104747T patent/DE3068432D1/de not_active Expired
- 1980-08-19 IL IL60873A patent/IL60873A0/xx unknown
- 1980-08-19 IL IL60874A patent/IL60874A/xx unknown
- 1980-08-20 DD DD80223413A patent/DD153823A5/de unknown
- 1980-08-20 JP JP11355080A patent/JPS5632427A/ja active Granted
- 1980-08-21 HU HU802071A patent/HU185789B/hu unknown
- 1980-08-21 HU HU803069A patent/HU188368B/hu unknown
- 1980-08-21 DK DK359280A patent/DK359280A/da not_active Application Discontinuation
- 1980-08-21 BR BR8005293A patent/BR8005293A/pt not_active IP Right Cessation
- 1980-08-21 HU HU803070A patent/HU188369B/hu unknown
-
1981
- 1981-09-18 US US06/303,657 patent/US4626601A/en not_active Expired - Lifetime
-
1986
- 1986-07-21 US US06/887,471 patent/US4748257A/en not_active Expired - Lifetime
-
1987
- 1987-11-02 JP JP62275930A patent/JPS63119434A/ja active Granted
- 1987-11-02 JP JP62275931A patent/JPS63119435A/ja active Granted
-
1988
- 1988-03-02 US US07/162,788 patent/US4845249A/en not_active Expired - Lifetime
-
1990
- 1990-12-11 DK DK293690A patent/DK163815C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| EP0024624B1 (de) | 1984-07-04 |
| DD153823A5 (de) | 1982-02-03 |
| JPS5632427A (en) | 1981-04-01 |
| US4748257A (en) | 1988-05-31 |
| US4845249A (en) | 1989-07-04 |
| EP0024624A3 (en) | 1981-06-17 |
| DE3068432D1 (en) | 1984-08-09 |
| US4626601A (en) | 1986-12-02 |
| IL60874A0 (en) | 1980-10-26 |
| EP0024624A2 (de) | 1981-03-11 |
| JPS6338007B2 (enExample) | 1988-07-28 |
| BR8005293A (pt) | 1981-03-04 |
| DK163815B (da) | 1992-04-06 |
| DE2933979A1 (de) | 1981-03-12 |
| JPH0255412B2 (enExample) | 1990-11-27 |
| EP0061004A1 (de) | 1982-09-29 |
| JPS64380B2 (enExample) | 1989-01-06 |
| DK359280A (da) | 1981-02-23 |
| JPS63119434A (ja) | 1988-05-24 |
| JPS63119435A (ja) | 1988-05-24 |
| HU188369B (en) | 1986-04-28 |
| DK293690D0 (da) | 1990-12-11 |
| DK163815C (da) | 1992-09-07 |
| IL60874A (en) | 1985-08-30 |
| HU185789B (en) | 1985-03-28 |
| HU188368B (en) | 1986-04-28 |
| DK293690A (da) | 1990-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2055800B (en) | Guanidinothiazoles and their preparation and use | |
| JPS5695331A (en) | Ferroofluid and its manufacture | |
| PH18683A (en) | Novel 4-aroylimidazol-2-ones and their use | |
| GB2053210B (en) | Substituted 3-arylpyrazoles and 5-arylisoxazoles | |
| IL60873A0 (en) | 4-fluoro-3-phenoxy-benzylethers and their preparation | |
| GB2052488B (en) | 3 - vinyl - cephalosporins and their preparation | |
| JPS565207A (en) | Tireeliner and its preparation | |
| JPS5690086A (en) | 11piperidinesulfonylurea and its manufacture | |
| JPS56124651A (en) | Lockerrhousing and lockerrcover | |
| GB2051062B (en) | 3-vinyl-cephalosporin derivatives and their preparation | |
| JPS5640680A (en) | 33methyleneflavanone and 33methylenechromanone and their use | |
| JPS55154994A (en) | Amtibiotic aa6888c and aa6888x | |
| DE3064789D1 (en) | New 25-hydroxy-24-oxocholestane derivatives and preparation thereof | |
| JPS5690094A (en) | Hydantoinylsilane and its manufacture | |
| IL56615A0 (en) | N-azolylalkyl-anilines and their preparation | |
| JPS55130950A (en) | Betaaalkoxyyacrylonitrile*33aminooacryonitrile and 22cyanoovinylester manufacture | |
| IL60541A0 (en) | Tallysomicin derivatives and their preparation | |
| CY1334A (en) | 17-cycloalkylmethyl-6-methylene-morphinane derivatives and their preparation | |
| JPS5629556A (en) | Substituted trichloropropylureas and their use | |
| JPS55127363A (en) | Carbamoylsulfides* their manufacture and use | |
| JPS5692287A (en) | Benzenesulfonylurea and its manufacture | |
| JPS55157528A (en) | *isocamphh55yl*guaiacylether and its manufacture | |
| GB2065651B (en) | Substituted-phenylpyridines and preparation | |
| JPS5665886A (en) | Pyridinesulfonylisothioureas and their use | |
| GB2050356B (en) | A-halomethylamino compounds and their preparation |