DE2842938A1 - Verfahren zum polymerisieren mittels uv-licht - Google Patents
Verfahren zum polymerisieren mittels uv-lichtInfo
- Publication number
- DE2842938A1 DE2842938A1 DE19782842938 DE2842938A DE2842938A1 DE 2842938 A1 DE2842938 A1 DE 2842938A1 DE 19782842938 DE19782842938 DE 19782842938 DE 2842938 A DE2842938 A DE 2842938A DE 2842938 A1 DE2842938 A1 DE 2842938A1
- Authority
- DE
- Germany
- Prior art keywords
- light
- irradiated
- polymerization
- inert
- intensity
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 31
- 230000000379 polymerizing effect Effects 0.000 title claims description 13
- 238000006116 polymerization reaction Methods 0.000 claims description 56
- 239000000178 monomer Substances 0.000 claims description 42
- 239000006096 absorbing agent Substances 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 14
- 239000003999 initiator Substances 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 239000000463 material Substances 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 150000004056 anthraquinones Chemical class 0.000 claims description 8
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 claims description 4
- LXLIHSVHDYSQLO-UHFFFAOYSA-L disodium;[6-ethoxy-2-(6-ethoxy-3-sulfonatooxy-1-benzothiophen-2-yl)-1-benzothiophen-3-yl] sulfate Chemical compound [Na+].[Na+].S1C2=CC(OCC)=CC=C2C(OS([O-])(=O)=O)=C1C1=C(OS([O-])(=O)=O)C2=CC=C(OCC)C=C2S1 LXLIHSVHDYSQLO-UHFFFAOYSA-L 0.000 claims description 4
- 230000001678 irradiating effect Effects 0.000 claims description 4
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000000641 acridinyl group Chemical class C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 claims description 2
- 229940027998 antiseptic and disinfectant acridine derivative Drugs 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000001048 orange dye Substances 0.000 claims description 2
- 230000001960 triggered effect Effects 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims 4
- 238000007254 oxidation reaction Methods 0.000 claims 4
- -1 sulfuric acid ester Chemical class 0.000 description 10
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- 238000001816 cooling Methods 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 238000013459 approach Methods 0.000 description 5
- 125000000391 vinyl group Chemical class [H]C([*])=C([H])[H] 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- RHBSVLZWJMBUBQ-UHFFFAOYSA-N 1-ethenyl-1h-imidazol-1-ium;chloride Chemical compound [Cl-].C=C[N+]=1C=CNC=1 RHBSVLZWJMBUBQ-UHFFFAOYSA-N 0.000 description 2
- HXVJQEGYAYABRY-UHFFFAOYSA-N 1-ethenyl-4,5-dihydroimidazole Chemical compound C=CN1CCN=C1 HXVJQEGYAYABRY-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 2
- OZTBHAGJSKTDGM-UHFFFAOYSA-N 9,10-dioxoanthracene-1,5-disulfonic acid Chemical compound O=C1C=2C(S(=O)(=O)O)=CC=CC=2C(=O)C2=C1C=CC=C2S(O)(=O)=O OZTBHAGJSKTDGM-UHFFFAOYSA-N 0.000 description 2
- ASDLSKCKYGVMAI-UHFFFAOYSA-N 9,10-dioxoanthracene-2-carboxylic acid Chemical compound C1=CC=C2C(=O)C3=CC(C(=O)O)=CC=C3C(=O)C2=C1 ASDLSKCKYGVMAI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 238000007872 degassing Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 2
- VMXWZRNWXZSSCE-FMQUCBEESA-N (2e)-6-ethoxy-2-(6-ethoxy-3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one Chemical compound S\1C2=CC(OCC)=CC=C2C(=O)C/1=C1/C(=O)C2=CC=C(OCC)C=C2S1 VMXWZRNWXZSSCE-FMQUCBEESA-N 0.000 description 1
- QJJDJWUCRAPCOL-UHFFFAOYSA-N 1-ethenoxyoctadecane Chemical class CCCCCCCCCCCCCCCCCCOC=C QJJDJWUCRAPCOL-UHFFFAOYSA-N 0.000 description 1
- OSSNTDFYBPYIEC-UHFFFAOYSA-N 1-ethenylimidazole Chemical compound C=CN1C=CN=C1 OSSNTDFYBPYIEC-UHFFFAOYSA-N 0.000 description 1
- CERJZAHSUZVMCH-UHFFFAOYSA-N 2,2-dichloro-1-phenylethanone Chemical compound ClC(Cl)C(=O)C1=CC=CC=C1 CERJZAHSUZVMCH-UHFFFAOYSA-N 0.000 description 1
- PIZHFBODNLEQBL-UHFFFAOYSA-N 2,2-diethoxy-1-phenylethanone Chemical compound CCOC(OCC)C(=O)C1=CC=CC=C1 PIZHFBODNLEQBL-UHFFFAOYSA-N 0.000 description 1
- KWVGIHKZDCUPEU-UHFFFAOYSA-N 2,2-dimethoxy-2-phenylacetophenone Chemical compound C=1C=CC=CC=1C(OC)(OC)C(=O)C1=CC=CC=C1 KWVGIHKZDCUPEU-UHFFFAOYSA-N 0.000 description 1
- XNQDKIWPZVPVQD-UHFFFAOYSA-N 2-(2-methylprop-2-enoylamino)ethanesulfonic acid Chemical compound CC(=C)C(=O)NCCS(O)(=O)=O XNQDKIWPZVPVQD-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- QHVBLSNVXDSMEB-UHFFFAOYSA-N 2-(diethylamino)ethyl prop-2-enoate Chemical compound CCN(CC)CCOC(=O)C=C QHVBLSNVXDSMEB-UHFFFAOYSA-N 0.000 description 1
- DPBJAVGHACCNRL-UHFFFAOYSA-N 2-(dimethylamino)ethyl prop-2-enoate Chemical compound CN(C)CCOC(=O)C=C DPBJAVGHACCNRL-UHFFFAOYSA-N 0.000 description 1
- DZZAHLOABNWIFA-UHFFFAOYSA-N 2-butoxy-1,2-diphenylethanone Chemical class C=1C=CC=CC=1C(OCCCC)C(=O)C1=CC=CC=C1 DZZAHLOABNWIFA-UHFFFAOYSA-N 0.000 description 1
- ZCDADJXRUCOCJE-UHFFFAOYSA-N 2-chlorothioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(Cl)=CC=C3SC2=C1 ZCDADJXRUCOCJE-UHFFFAOYSA-N 0.000 description 1
- KMNCBSZOIQAUFX-UHFFFAOYSA-N 2-ethoxy-1,2-diphenylethanone Chemical group C=1C=CC=CC=1C(OCC)C(=O)C1=CC=CC=C1 KMNCBSZOIQAUFX-UHFFFAOYSA-N 0.000 description 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 1
- GWZMWHWAWHPNHN-UHFFFAOYSA-N 2-hydroxypropyl prop-2-enoate Chemical compound CC(O)COC(=O)C=C GWZMWHWAWHPNHN-UHFFFAOYSA-N 0.000 description 1
- MYISVPVWAQRUTL-UHFFFAOYSA-N 2-methylthioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC(C)=CC=C3SC2=C1 MYISVPVWAQRUTL-UHFFFAOYSA-N 0.000 description 1
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 1
- PDBBPTZZXWTBOA-UHFFFAOYSA-N 4-(2-benzyliminohydrazinyl)benzenesulfonic acid Chemical compound C1=CC(S(=O)(=O)O)=CC=C1NN=NCC1=CC=CC=C1 PDBBPTZZXWTBOA-UHFFFAOYSA-N 0.000 description 1
- LRDIEHDJWYRVPT-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 LRDIEHDJWYRVPT-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- BMVWCPGVLSILMU-UHFFFAOYSA-N 5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-one Chemical compound C1CC2=CC=CC=C2C(=O)C2=CC=CC=C21 BMVWCPGVLSILMU-UHFFFAOYSA-N 0.000 description 1
- MMNWSHJJPDXKCH-UHFFFAOYSA-N 9,10-dioxoanthracene-2-sulfonic acid Chemical compound C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 MMNWSHJJPDXKCH-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000012724 UV-induced polymerization Methods 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- RUDUCNPHDIMQCY-UHFFFAOYSA-N [3-(2-sulfanylacetyl)oxy-2,2-bis[(2-sulfanylacetyl)oxymethyl]propyl] 2-sulfanylacetate Chemical compound SCC(=O)OCC(COC(=O)CS)(COC(=O)CS)COC(=O)CS RUDUCNPHDIMQCY-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- MSSUFHMGCXOVBZ-UHFFFAOYSA-N anthraquinone-2,6-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 MSSUFHMGCXOVBZ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical class C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000004185 ester group Chemical class 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- 125000005678 ethenylene group Chemical class [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000002573 ethenylidene group Chemical class [*]=C=C([H])[H] 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000003504 photosensitizing agent Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- JGCBNZLRTUKUAQ-UHFFFAOYSA-M sodium 4-[[4-(benzylamino)phenyl]diazenyl]benzenesulfonate Chemical compound [Na+].C1=CC(S(=O)(=O)[O-])=CC=C1N=NC(C=C1)=CC=C1NCC1=CC=CC=C1 JGCBNZLRTUKUAQ-UHFFFAOYSA-M 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- YRHRIQCWCFGUEQ-UHFFFAOYSA-N thioxanthen-9-one Chemical class C1=CC=C2C(=O)C3=CC=CC=C3SC2=C1 YRHRIQCWCFGUEQ-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/46—Polymerisation initiated by wave energy or particle radiation
- C08F2/48—Polymerisation initiated by wave energy or particle radiation by ultraviolet or visible light
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S522/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S522/91—Treatment through an external filter or mask, nonphotograghic process
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
- Paints Or Removers (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Separation Of Suspended Particles By Flocculating Agents (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782842938 DE2842938A1 (de) | 1978-10-02 | 1978-10-02 | Verfahren zum polymerisieren mittels uv-licht |
| FR7923078A FR2438057B1 (fr) | 1978-10-02 | 1979-09-17 | Procede de polymerisation ou copolymerisation radicalaire au moyen de radiations ultraviolettes |
| US06/076,941 US4308120A (en) | 1978-10-02 | 1979-09-19 | Polymerization method using ultraviolet light |
| GB7934013A GB2034333B (en) | 1978-10-02 | 1979-10-01 | Uv polymerisation process |
| NL7907286A NL7907286A (nl) | 1978-10-02 | 1979-10-01 | Werkwijze voor het polymeriseren door middel van ultraviolet licht. |
| JP12649879A JPS5550002A (en) | 1978-10-02 | 1979-10-02 | Method of radical polymerization or radical copolymerization using ultraviolet ray |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782842938 DE2842938A1 (de) | 1978-10-02 | 1978-10-02 | Verfahren zum polymerisieren mittels uv-licht |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2842938A1 true DE2842938A1 (de) | 1980-04-17 |
| DE2842938C2 DE2842938C2 (enExample) | 1989-03-16 |
Family
ID=6051171
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782842938 Granted DE2842938A1 (de) | 1978-10-02 | 1978-10-02 | Verfahren zum polymerisieren mittels uv-licht |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4308120A (enExample) |
| JP (1) | JPS5550002A (enExample) |
| DE (1) | DE2842938A1 (enExample) |
| FR (1) | FR2438057B1 (enExample) |
| GB (1) | GB2034333B (enExample) |
| NL (1) | NL7907286A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9072572B2 (en) | 2009-04-02 | 2015-07-07 | Kerr Corporation | Dental light device |
| US9572643B2 (en) | 1998-01-20 | 2017-02-21 | Kerr Corporation | Apparatus and method for curing materials with radiation |
| US9730778B2 (en) | 2009-04-02 | 2017-08-15 | Kerr Corporation | Curing light device |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62235305A (ja) * | 1986-04-04 | 1987-10-15 | Dai Ichi Kogyo Seiyaku Co Ltd | 高分子量アクリル系重合体の製法 |
| DE3814135A1 (de) * | 1987-05-06 | 1988-11-24 | Wilkinson Sword Gmbh | Verfahren zur herstellung einer hydrophilen beschichtung auf einem formteil und unter anwendung des verfahrens hergestellter rasierapparat |
| US5013924A (en) * | 1988-03-03 | 1991-05-07 | Sierracin Corporation | Curing compositions with ultraviolet light |
| US6436532B1 (en) | 1991-02-28 | 2002-08-20 | 3M Innovative Properties Company | Multi-stage irradiation process for production of acrylic based adhesives and adhesives made thereby |
| AU1641492A (en) | 1991-02-28 | 1992-10-06 | Minnesota Mining And Manufacturing Company | Multi-stage irradiation process for production of acrylic based adhesives and adhesives made thereby |
| DE4336748C3 (de) * | 1992-11-17 | 2001-09-06 | Ciba Sc Holding Ag | Verfahren zur Blitztrocknung und Blitzhärtung, Verwendung des Verfahrens und dafür geeignete Vorrichtungen |
| RU2138070C1 (ru) * | 1994-05-05 | 1999-09-20 | Акционерное общество закрытого типа Совместное Российско-американское предприятие "Теком" | Способ блочной фотополимеризации, фотополимеризующаяся композиция |
| AU1198199A (en) | 1997-10-29 | 1999-05-17 | Bisco, Inc. | Dental composite light curing system |
| US6929472B2 (en) | 1999-09-24 | 2005-08-16 | Cao Group, Inc. | Curing light |
| US6824294B2 (en) * | 1999-09-24 | 2004-11-30 | Cao Group, Inc. | Light for use in activating light-activated materials, the light having a plurality of chips mounted in a gross well of a heat sink, and a dome covering the chips |
| US6955537B2 (en) * | 1999-09-24 | 2005-10-18 | Cao Group, Inc. | Light for use in activating light-activated materials, the light having a plurality of light emitting semiconductor chips emitting light of differing peak wavelengths to provide a wide light spectrum profile |
| US6988890B2 (en) | 1999-09-24 | 2006-01-24 | Cao Group, Inc. | Curing light |
| US6971876B2 (en) | 1999-09-24 | 2005-12-06 | Cao Group, Inc. | Curing light |
| US6910886B2 (en) | 1999-09-24 | 2005-06-28 | Cao Group, Inc. | Curing light |
| US6755648B2 (en) | 1999-09-24 | 2004-06-29 | Cao Group, Inc. | Curing light |
| US6719558B2 (en) | 1999-09-24 | 2004-04-13 | Densen Cao | Curing light |
| US7066732B2 (en) * | 1999-09-24 | 2006-06-27 | Cao Group, Inc. | Method for curing light-curable materials |
| US6979193B2 (en) | 1999-09-24 | 2005-12-27 | Cao Group, Inc. | Curing light |
| US6932600B2 (en) * | 1999-09-24 | 2005-08-23 | Cao Group, Inc. | Curing light |
| US6719559B2 (en) | 1999-09-24 | 2004-04-13 | Densen Cao | Curing light |
| US6974319B2 (en) * | 1999-09-24 | 2005-12-13 | Cao Group, Inc. | Curing light |
| US6755649B2 (en) | 1999-09-24 | 2004-06-29 | Cao Group, Inc. | Curing light |
| US7077648B2 (en) * | 1999-09-24 | 2006-07-18 | Cao Group, Inc. | Curing light |
| US6971875B2 (en) | 1999-09-24 | 2005-12-06 | Cao Group, Inc. | Dental curing light |
| US6926524B2 (en) * | 1999-09-24 | 2005-08-09 | Cao Group, Inc. | Curing light |
| US7294364B2 (en) * | 1999-09-24 | 2007-11-13 | Cao Group, Inc. | Method for curing composite materials |
| US6981867B2 (en) | 1999-09-24 | 2006-01-03 | Cao Group, Inc. | Curing light |
| US6988891B2 (en) * | 1999-09-24 | 2006-01-24 | Cao Group, Inc. | Curing light |
| US6780010B2 (en) | 1999-09-24 | 2004-08-24 | Cao Group, Inc. | Curing light |
| JP5299935B2 (ja) * | 2001-05-17 | 2013-09-25 | 三菱レイヨン株式会社 | ノニオン性又はアニオン性の水溶性アクリルアミド系重合体およびその製造方法 |
| US7108504B2 (en) | 2001-07-10 | 2006-09-19 | Cao Group, Inc. | Light for use in activating light-activated materials, the light having insulators and an air jacket |
| US6799967B2 (en) | 2001-07-10 | 2004-10-05 | Cao Group, Inc. | Light for use in activating light-activated materials, the light having a plurality of light emitting single chip arrays |
| US7485672B2 (en) | 2001-08-02 | 2009-02-03 | Johnson & Johnson Vision Care, Inc. | Process for the synthesis of soluble, high molecular weight polymers |
| TWI239340B (en) * | 2001-12-06 | 2005-09-11 | Nippon Catalytic Chem Ind | Process for production of water-soluble (meth)acrylic polymers, water-soluble (meth)acrylic polymers, and use thereof |
| US7182597B2 (en) * | 2002-08-08 | 2007-02-27 | Kerr Corporation | Curing light instrument |
| US9592324B2 (en) | 2006-11-06 | 2017-03-14 | Atrium Medical Corporation | Tissue separating device with reinforced support for anchoring mechanisms |
| US9012506B2 (en) | 2004-09-28 | 2015-04-21 | Atrium Medical Corporation | Cross-linked fatty acid-based biomaterials |
| US9801982B2 (en) | 2004-09-28 | 2017-10-31 | Atrium Medical Corporation | Implantable barrier device |
| WO2006037049A2 (en) | 2004-09-28 | 2006-04-06 | Atrium Medical Corporation | Application of a coating on a medical device |
| US8312836B2 (en) | 2004-09-28 | 2012-11-20 | Atrium Medical Corporation | Method and apparatus for application of a fresh coating on a medical device |
| US8124127B2 (en) | 2005-10-15 | 2012-02-28 | Atrium Medical Corporation | Hydrophobic cross-linked gels for bioabsorbable drug carrier coatings |
| US9000040B2 (en) | 2004-09-28 | 2015-04-07 | Atrium Medical Corporation | Cross-linked fatty acid-based biomaterials |
| US8367099B2 (en) | 2004-09-28 | 2013-02-05 | Atrium Medical Corporation | Perforated fatty acid films |
| WO2007011385A2 (en) | 2004-09-28 | 2007-01-25 | Atrium Medical Corporation | Heat cured gel and method of making |
| US8113830B2 (en) * | 2005-05-27 | 2012-02-14 | Kerr Corporation | Curing light instrument |
| US9427423B2 (en) | 2009-03-10 | 2016-08-30 | Atrium Medical Corporation | Fatty-acid based particles |
| US9278161B2 (en) * | 2005-09-28 | 2016-03-08 | Atrium Medical Corporation | Tissue-separating fatty acid adhesion barrier |
| US9492596B2 (en) | 2006-11-06 | 2016-11-15 | Atrium Medical Corporation | Barrier layer with underlying medical device and one or more reinforcing support structures |
| KR101109474B1 (ko) * | 2009-04-27 | 2012-01-31 | 현대제철 주식회사 | 컨베이어 벨트의 크리닝 장치 |
| US20110038910A1 (en) | 2009-08-11 | 2011-02-17 | Atrium Medical Corporation | Anti-infective antimicrobial-containing biomaterials |
| EP2593141B1 (en) | 2010-07-16 | 2018-07-04 | Atrium Medical Corporation | Composition and methods for altering the rate of hydrolysis of cured oil-based materials |
| US9867880B2 (en) | 2012-06-13 | 2018-01-16 | Atrium Medical Corporation | Cured oil-hydrogel biomaterial compositions for controlled drug delivery |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2248715A1 (de) * | 1971-11-08 | 1973-05-24 | Rhone Progil | Verfahren zur herstellung von wasserloeslichen acrylpolymerisaten und -copolymerisaten mit hohem molekulargewicht |
| DE2545290A1 (de) * | 1975-10-09 | 1977-04-21 | Roehm Gmbh | Verfahren zum polymerisieren mittels uv-licht |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB860067A (en) * | 1956-06-05 | 1961-02-01 | Dunlop Rubber Co | Polymerisation of unsaturated organic compounds |
| US2941934A (en) * | 1957-01-16 | 1960-06-21 | Gen Aniline & Film Corp | Polymerization by temperature controlled irradiation |
| FR2045640A1 (enExample) * | 1969-06-12 | 1971-03-05 | Progil | |
| US3912607A (en) * | 1969-10-22 | 1975-10-14 | Rhone Progil | Process for obtaining high molecular weight water-soluble acrylic polymers and copolymers using radiation |
| CA938915A (en) | 1970-11-30 | 1973-12-25 | S. Miller Lewis | Curing of film surfaces by exposure to ultraviolet light |
| US3943046A (en) * | 1973-06-25 | 1976-03-09 | Scm Corporation | UV curing process employing flash photolysis |
| US4165265A (en) * | 1973-07-17 | 1979-08-21 | Nippon Paint Co., Ltd. | Multi-stage irradiation method of curing a photocurable coating composition |
| DE2442879C3 (de) | 1973-09-17 | 1978-12-14 | Nippon Paint Co., Ltd., Osaka (Japan) | Verfahren zum Härten von lichthärtbaren Anstrichmitteln und Überzugsmassen |
| GB1509312A (en) | 1974-04-01 | 1978-05-04 | Nippon Paint Co Ltd | Method and apparatus for curing photo-curable composition |
| FR2348227A1 (fr) * | 1976-04-14 | 1977-11-10 | Rhone Poulenc Ind | Perfectionnement aux procedes de preparation de polymeres acryliques hydrosolubles par photopolymerisation |
-
1978
- 1978-10-02 DE DE19782842938 patent/DE2842938A1/de active Granted
-
1979
- 1979-09-17 FR FR7923078A patent/FR2438057B1/fr not_active Expired
- 1979-09-19 US US06/076,941 patent/US4308120A/en not_active Expired - Lifetime
- 1979-10-01 GB GB7934013A patent/GB2034333B/en not_active Expired
- 1979-10-01 NL NL7907286A patent/NL7907286A/nl not_active Application Discontinuation
- 1979-10-02 JP JP12649879A patent/JPS5550002A/ja active Pending
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2248715A1 (de) * | 1971-11-08 | 1973-05-24 | Rhone Progil | Verfahren zur herstellung von wasserloeslichen acrylpolymerisaten und -copolymerisaten mit hohem molekulargewicht |
| DE2545290A1 (de) * | 1975-10-09 | 1977-04-21 | Roehm Gmbh | Verfahren zum polymerisieren mittels uv-licht |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9572643B2 (en) | 1998-01-20 | 2017-02-21 | Kerr Corporation | Apparatus and method for curing materials with radiation |
| US9622839B2 (en) | 1998-01-20 | 2017-04-18 | Kerr Corporation | Apparatus and method for curing materials with radiation |
| US9072572B2 (en) | 2009-04-02 | 2015-07-07 | Kerr Corporation | Dental light device |
| US9693846B2 (en) | 2009-04-02 | 2017-07-04 | Kerr Corporation | Dental light device |
| US9730778B2 (en) | 2009-04-02 | 2017-08-15 | Kerr Corporation | Curing light device |
| US9987110B2 (en) | 2009-04-02 | 2018-06-05 | Kerr Corporation | Dental light device |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7907286A (nl) | 1980-04-08 |
| US4308120A (en) | 1981-12-29 |
| JPS5550002A (en) | 1980-04-11 |
| DE2842938C2 (enExample) | 1989-03-16 |
| FR2438057B1 (fr) | 1985-07-05 |
| GB2034333A (en) | 1980-06-04 |
| FR2438057A1 (fr) | 1980-04-30 |
| GB2034333B (en) | 1983-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2842938C2 (enExample) | ||
| EP1624974B1 (de) | Polymerdispersion mit farbeffekt | |
| DE4435422A1 (de) | Verfahren zur Herstellung einer wäßrigen Polymerisatdispersion | |
| DE2508346A1 (de) | Verfahren zur herstellung von wasserloeslichen, praktisch linearen polymerisaten mit hohem molekulargewicht und nach dem verfahren hergestelltes polymerisat | |
| EP0678534A1 (de) | Gele mit thermotropen Eigenschaften | |
| DE2545290A1 (de) | Verfahren zum polymerisieren mittels uv-licht | |
| DE60121340T2 (de) | Verfahren zur herstellung eines photochromen formteils | |
| DE60122117T2 (de) | Polymerisationsverfahren | |
| DE894321C (de) | Verfahren zum Polymerisieren von Acrylsaeureamiden, insbesondere N-di-substituiertenAcrylsaeureamiden | |
| EP0031005B1 (de) | Verfahren zur Herstellung wasserlöslicher Polymer-Festprodukte | |
| DE2043172A1 (de) | Verfahren zur Herstellung von Mischpolymeren | |
| DE19748153A1 (de) | Verfahren zur Herstellung kationischer Polyelektrolyte | |
| EP1370590A2 (de) | Verfahren zur herstellung von vernetzten acrylatschmelzhaftklebemassen | |
| DE2502283C3 (de) | Verfahren zur Regelung des Polymerisationsgrades bei der Herstellung von Polymerisaten oder Mischpolymerisaten aus Vinyl- und/oder Vinylidenverbindungen | |
| DE4105354A1 (de) | Waessrige polymerdispersionen, enthaltend organische verbindungen mit carbonat- und carbonylgruppen, sowie damit hergestellte anstrich- und beschichtungssysteme | |
| EP2066702A1 (de) | Teilchen enthaltend polymeradditive | |
| DE2831263A1 (de) | Benzoinderivate mit quartaerer ammoniumgruppe | |
| DE2009748A1 (de) | Verfahren zur Herstellung von wasser löslichen Polymerisaten | |
| DE2050988B2 (de) | Verfahren zur Herstellung von in festem Zustand wasserlöslichen Acrylpolymerisaten und -copolymerisaten mit hohem Molekulargewicht | |
| DE10139003A1 (de) | Verfahren zur Herstellung eines N-Vinyl-Verbindungs-Polymers | |
| DE2142617A1 (de) | Verfahren zur Herstellung von Copoly mensaten | |
| EP1500689A1 (de) | Beschichtungszusammensetzung und Verfahren zu deren Herstellung | |
| DE1770578A1 (de) | Nicht vergilbende Copolymerisate aus Butadien und/oder Nitrilen copolymerisierbarer Carbonsaeuren sowie weiteren Comonomeren | |
| DE4119097A1 (de) | In organischen loesungsmitteln loeslicher chlorierter kautschuk und verfahren zu seiner herstellung | |
| EP1885761B1 (de) | Farbiges polymersystem mit verbesserter farbbrillianz |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |