DE2834535A1 - Copolyester - Google Patents
CopolyesterInfo
- Publication number
- DE2834535A1 DE2834535A1 DE19782834535 DE2834535A DE2834535A1 DE 2834535 A1 DE2834535 A1 DE 2834535A1 DE 19782834535 DE19782834535 DE 19782834535 DE 2834535 A DE2834535 A DE 2834535A DE 2834535 A1 DE2834535 A1 DE 2834535A1
- Authority
- DE
- Germany
- Prior art keywords
- radicals
- copolyester
- copolyesters
- acid
- chlorine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 229920001634 Copolyester Polymers 0.000 title claims description 49
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- -1 alkyl radical Chemical group 0.000 claims description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 150000003254 radicals Chemical class 0.000 claims 7
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 229920000728 polyester Polymers 0.000 description 33
- 239000002253 acid Substances 0.000 description 15
- 238000000034 method Methods 0.000 description 14
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 12
- 238000004519 manufacturing process Methods 0.000 description 10
- 239000004973 liquid crystal related substance Substances 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- NGMYCWFGNSXLMP-UHFFFAOYSA-N 3-acetyloxybenzoic acid Chemical compound CC(=O)OC1=CC=CC(C(O)=O)=C1 NGMYCWFGNSXLMP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- SGWZVZZVXOJRAQ-UHFFFAOYSA-N 2,6-Dimethyl-1,4-benzenediol Chemical compound CC1=CC(O)=CC(C)=C1O SGWZVZZVXOJRAQ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- KUZVIVNLNXNLAQ-UHFFFAOYSA-N (4-acetyloxy-3-methylphenyl) acetate Chemical compound CC(=O)OC1=CC=C(OC(C)=O)C(C)=C1 KUZVIVNLNXNLAQ-UHFFFAOYSA-N 0.000 description 1
- UNQWKAVGUZNMJZ-UHFFFAOYSA-N 2,3-dibromoterephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(Br)=C1Br UNQWKAVGUZNMJZ-UHFFFAOYSA-N 0.000 description 1
- KEWJLXYQHAFCKG-UHFFFAOYSA-N 2,5-dichlorobenzene-1,4-diol;propanoic acid Chemical compound CCC(O)=O.CCC(O)=O.OC1=CC(Cl)=C(O)C=C1Cl KEWJLXYQHAFCKG-UHFFFAOYSA-N 0.000 description 1
- ZPXGNBIFHQKREO-UHFFFAOYSA-N 2-chloroterephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(Cl)=C1 ZPXGNBIFHQKREO-UHFFFAOYSA-N 0.000 description 1
- XEJVSZRYSQEHKS-UHFFFAOYSA-N 2-methylbenzene-1,4-diol;propanoic acid Chemical compound CCC(O)=O.CCC(O)=O.CC1=CC(O)=CC=C1O XEJVSZRYSQEHKS-UHFFFAOYSA-N 0.000 description 1
- UFMBOFGKHIXOTA-UHFFFAOYSA-N 2-methylterephthalic acid Chemical compound CC1=CC(C(O)=O)=CC=C1C(O)=O UFMBOFGKHIXOTA-UHFFFAOYSA-N 0.000 description 1
- NAIGRTFQKPRBJX-UHFFFAOYSA-N 2-propylterephthalic acid Chemical compound CCCC1=CC(C(O)=O)=CC=C1C(O)=O NAIGRTFQKPRBJX-UHFFFAOYSA-N 0.000 description 1
- CFLNIDORJOSPDV-UHFFFAOYSA-N 3-butanoyloxybenzoic acid Chemical compound CCCC(=O)OC1=CC=CC(C(O)=O)=C1 CFLNIDORJOSPDV-UHFFFAOYSA-N 0.000 description 1
- NXTDJHZGHOFSQG-UHFFFAOYSA-N 3-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 NXTDJHZGHOFSQG-UHFFFAOYSA-N 0.000 description 1
- KDSHSYUJJSWWNU-UHFFFAOYSA-N 3-propanoyloxybenzoic acid Chemical compound CCC(=O)OC1=CC=CC(C(O)=O)=C1 KDSHSYUJJSWWNU-UHFFFAOYSA-N 0.000 description 1
- DOPYOZDXRDIAQO-UHFFFAOYSA-N 4-methylnaphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(C)=CC(C(O)=O)=CC2=C1 DOPYOZDXRDIAQO-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- QNSQGSQXCYJWMD-UHFFFAOYSA-N acetic acid;2-chlorobenzene-1,4-diol Chemical compound CC(O)=O.CC(O)=O.OC1=CC=C(O)C(Cl)=C1 QNSQGSQXCYJWMD-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical class C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/682—Polyesters containing atoms other than carbon, hydrogen and oxygen containing halogens
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/60—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from the reaction of a mixture of hydroxy carboxylic acids, polycarboxylic acids and polyhydroxy compounds
- C08G63/605—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from the reaction of a mixture of hydroxy carboxylic acids, polycarboxylic acids and polyhydroxy compounds the hydroxy and carboxylic groups being bound to aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/822,985 US4146702A (en) | 1977-08-08 | 1977-08-08 | Liquid crystal copolyesters prepared from an aromatic dicarboxylic acid, a substituted hydroquinone and a m-acyloxybenzoic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2834535A1 true DE2834535A1 (de) | 1979-02-22 |
Family
ID=25237479
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782834535 Ceased DE2834535A1 (de) | 1977-08-08 | 1978-08-07 | Copolyester |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4146702A (enExample) |
| JP (1) | JPS5430289A (enExample) |
| DE (1) | DE2834535A1 (enExample) |
| FR (1) | FR2400044A1 (enExample) |
| GB (1) | GB2002012B (enExample) |
| IT (1) | IT1111673B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0018145A1 (en) * | 1979-04-06 | 1980-10-29 | E.I. Du Pont De Nemours And Company | Aromatic polyester and filaments of improved heat-strengthening response |
| US6403504B1 (en) | 1984-03-15 | 2002-06-11 | Cytec Technology Corp. | Composite fiber blends |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4313870B1 (en) * | 1977-09-21 | 1996-06-18 | Sumitomo Chemical Co | Process for producing polycondensates |
| US4181792A (en) * | 1978-03-20 | 1980-01-01 | Eastman Kodak Company | Liquid crystal copolyesters containing terephthalic acid, isophthalic acid, 2,6-naphthalenedicarboxylic acid and hydroquinone |
| JPS6333490B2 (enExample) * | 1978-05-05 | 1988-07-05 | Eastman Kodak Co | |
| JPS55149321A (en) * | 1979-05-11 | 1980-11-20 | Sumitomo Chem Co Ltd | Preparation of oxybenzoylcopolyester |
| US4337191A (en) * | 1979-11-05 | 1982-06-29 | Fiber Industries, Inc. | Polyester of para-hydroxy benzoic acid, 2,6-naphthalene dicarboxylic acid, terephthalic acid and methylhydroquinone exhibiting improved hydrolytic stability and which is capable of forming an anisotropic melt |
| US4347349A (en) * | 1980-07-28 | 1982-08-31 | E. I. Du Pont De Nemours And Company | Aromatic polyester and filaments |
| US4342862A (en) * | 1981-03-27 | 1982-08-03 | Eastman Kodak Company | Polyesters of trans-1,4-cyclohexanedicarboxylic acid and 2-phenylhydroquinone and modifications thereof |
| US4335232A (en) * | 1981-07-07 | 1982-06-15 | E. I. Du Pont De Nemours And Company | Optically anisotropic melt forming polyesters |
| US4374228A (en) * | 1981-08-03 | 1983-02-15 | Fiber Industries, Inc. | Wholly aromatic polyester capable of forming an anisotropic melt phase consisting essentially of para-oxybenzoyl moiety, bromo-substituted-para-oxybenzoyl moiety, and meta-oxybenzoyl moiety |
| US4412058A (en) * | 1982-06-02 | 1983-10-25 | E. I. Du Pont De Nemours And Company | Aromatic polyesters and high strength filaments thereof |
| DE3325787A1 (de) * | 1983-07-16 | 1985-01-24 | Bayer Ag, 5090 Leverkusen | Mesomorphe aromatische polyester mit hoher steifigkeit und zaehigkeit, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von formkoerpern, filamenten, fasern und folien |
| US4603190A (en) * | 1983-07-16 | 1986-07-29 | Bayer Aktiengesellschaft | Thermotropic aromatic polyesters having high rigidity and toughness, process for the production thereof and the use thereof for the production of moulded articles, filaments, fibres and films |
| US4818812A (en) * | 1983-08-22 | 1989-04-04 | International Business Machines Corporation | Sealant for integrated circuit modules, polyester suitable therefor and preparation of polyester |
| FR2576027B1 (fr) * | 1985-01-11 | 1987-02-06 | Rhone Poulenc Rech | Copolyesters aromatiques thermotropes |
| JPS61197629A (ja) * | 1985-02-28 | 1986-09-01 | Nippon Oil Co Ltd | コレステリック液晶性ポリエステルの製造法 |
| JPS6254724A (ja) * | 1985-09-04 | 1987-03-10 | Nippon Oil Co Ltd | コレステリツク液晶性共重合ポリエステルの製造法 |
| DE3542832A1 (de) * | 1985-12-04 | 1987-06-11 | Basf Ag | Vollaromatische fluessigkristalline polykondensate, deren herstellung und verwendung |
| JPS63152625A (ja) * | 1986-07-07 | 1988-06-25 | Idemitsu Kosan Co Ltd | 新規ポリエステルおよびその製造法 |
| US5221730A (en) * | 1990-11-16 | 1993-06-22 | Eastman Kodak Company | Polyesters from terephthalic acid, 2,6-naphthalenedicarboxylic acid and hydroquinone |
| US5237038A (en) * | 1990-11-16 | 1993-08-17 | Eastman Kodak Company | Polyesters from terephthalic acid, 2,6-naphthalenedicarboxylic acid, hydroquinone and 4,4'-biphenol |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3368998A (en) * | 1962-05-22 | 1968-02-13 | Ici Ltd | Crystalline polyester polymer |
| US3778410A (en) * | 1972-09-28 | 1973-12-11 | Eastman Kodak Co | Process for preparing a final copolyester by reacting a starting polyester with an acyloxy aromatic carboxylic acid |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3773858A (en) * | 1969-05-28 | 1973-11-20 | Carborundum Co | Substantially void-free impact molded article of infusible oxybenzoyl polyesters |
| SE416814B (sv) * | 1974-05-10 | 1981-02-09 | Du Pont | Nya syntetiska polyestrar och sett for deras framstellning |
| US4035356A (en) * | 1976-05-07 | 1977-07-12 | Eastman Kodak Company | Copolyester prepared from an acyloxybenzoic acid and polyethylene terephthalate modified with p-hydroxyethoxybenzoic acid |
| JPS5931531B2 (ja) * | 1976-08-10 | 1984-08-02 | 帝人株式会社 | ポリエステル成形品 |
-
1977
- 1977-08-08 US US05/822,985 patent/US4146702A/en not_active Expired - Lifetime
-
1978
- 1978-08-04 IT IT26528/78A patent/IT1111673B/it active
- 1978-08-07 DE DE19782834535 patent/DE2834535A1/de not_active Ceased
- 1978-08-08 JP JP9657478A patent/JPS5430289A/ja active Granted
- 1978-08-08 FR FR7823310A patent/FR2400044A1/fr active Granted
- 1978-08-08 GB GB7832628A patent/GB2002012B/en not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3368998A (en) * | 1962-05-22 | 1968-02-13 | Ici Ltd | Crystalline polyester polymer |
| US3778410A (en) * | 1972-09-28 | 1973-12-11 | Eastman Kodak Co | Process for preparing a final copolyester by reacting a starting polyester with an acyloxy aromatic carboxylic acid |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0018145A1 (en) * | 1979-04-06 | 1980-10-29 | E.I. Du Pont De Nemours And Company | Aromatic polyester and filaments of improved heat-strengthening response |
| US6403504B1 (en) | 1984-03-15 | 2002-06-11 | Cytec Technology Corp. | Composite fiber blends |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2002012A (en) | 1979-02-14 |
| FR2400044A1 (fr) | 1979-03-09 |
| GB2002012B (en) | 1982-04-21 |
| JPS635416B2 (enExample) | 1988-02-03 |
| FR2400044B1 (enExample) | 1982-06-04 |
| JPS5430289A (en) | 1979-03-06 |
| US4146702A (en) | 1979-03-27 |
| IT7826528A0 (it) | 1978-08-04 |
| IT1111673B (it) | 1986-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2834535A1 (de) | Copolyester | |
| DE2834537C2 (enExample) | ||
| DE2834536A1 (de) | Copolyester | |
| DE68929259T2 (de) | Aromatische Polyester, aromatische Polyesteramide und Verfahren zu deren Herstellung | |
| DE2348697A1 (de) | Verfahren zur herstellung eines copolyesters | |
| EP0230545B1 (de) | Vollaromatische Polyesteramide, deren Herstellung und Verwendung. | |
| DE3750485T2 (de) | Harzzusammensetzung mit anisotropischen Schmelzeigenschaften. | |
| DE69704852T2 (de) | Verfahren zum herstellen thermotroper, hydrochinon enthaltender flüssigkristallpolymere | |
| DE3108664A1 (de) | Aus der schmelze verarbeitbare, vollaromatische polyester und ihre verwendung | |
| EP0225537B1 (de) | Vollaromatische mesomorphe Polyesterimide, deren Herstellung sowie Verwendung | |
| DE2844817A1 (de) | Aus der schmelze verarbeitbare, vollaromatische polyester und ihre verwendung | |
| EP0251113B1 (de) | Vollaromatische mesomorphe Polyester, deren Herstellung sowie Verwendung | |
| DE2525092A1 (de) | Neue copolyester sowie verfahren zu ihrer herstellung | |
| DE69125501T2 (de) | Polyester aus Terephtalsäure, 2,6-Naphthalendicarbonsäure und Hydrochinon | |
| DE3878815T2 (de) | Harz mit ausgezeichneter waermebestaendigkeit und anisotropischen eigenschaften in der schmelze. | |
| DE69706277T2 (de) | Flüssigkristalline polymer zusammensetzungen | |
| EP0398052A2 (de) | Leichtfliessende Polyarylensulfid-Formmassen | |
| DE2720004A1 (de) | Copolyester sowie verfahren zu ihrer herstellung | |
| DE69317557T2 (de) | Thermotrope flüssigkristalline polyesterzusammensetzungen, die gegebenenfalls glasverstärkungsmaterial/füllstoff enthalten | |
| DE3787066T2 (de) | Flüssig-Kristallpolymer. | |
| DE3789994T2 (de) | Polyester-Polymere. | |
| EP0054807B1 (de) | Thermoplastische Blockcopolyester | |
| DE3856042T2 (de) | Optisch anisotrope schmelzenbildende aromatische Copolyester auf der Basis von t-Butyl-4-hydroxy-benzoesäure | |
| DE3787336T2 (de) | Verfahren zur Herstellung von Copolyesters, die Anisotropie in geschmolzenem Zustand zeigen. | |
| EP0231462B1 (de) | Vollaromatische mesomorphe Polyetheresterimide, deren Herstellung und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |