DE2827414A1 - Verfahren zur herstellung von oxazolidin-2,4-dionen - Google Patents
Verfahren zur herstellung von oxazolidin-2,4-dionenInfo
- Publication number
- DE2827414A1 DE2827414A1 DE19782827414 DE2827414A DE2827414A1 DE 2827414 A1 DE2827414 A1 DE 2827414A1 DE 19782827414 DE19782827414 DE 19782827414 DE 2827414 A DE2827414 A DE 2827414A DE 2827414 A1 DE2827414 A1 DE 2827414A1
- Authority
- DE
- Germany
- Prior art keywords
- radical
- parts
- carbon atoms
- dichlorophenyl
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001477 2,4-oxazolidinediones Chemical class 0.000 title abstract description 4
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 8
- 238000006243 chemical reaction Methods 0.000 claims abstract description 7
- 150000003672 ureas Chemical class 0.000 claims abstract description 5
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- -1 alkyl radical Chemical class 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 2
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 claims description 2
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 claims 1
- 150000005840 aryl radicals Chemical group 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 235000013877 carbamide Nutrition 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 5
- 238000004821 distillation Methods 0.000 description 4
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 4
- 239000000725 suspension Substances 0.000 description 3
- VKVJIWVUYNTBEZ-UHFFFAOYSA-N 1,3-bis(3,5-dichlorophenyl)urea Chemical compound ClC1=CC(Cl)=CC(NC(=O)NC=2C=C(Cl)C=C(Cl)C=2)=C1 VKVJIWVUYNTBEZ-UHFFFAOYSA-N 0.000 description 2
- XEFUJGURFLOFAN-UHFFFAOYSA-N 1,3-dichloro-5-isocyanatobenzene Chemical compound ClC1=CC(Cl)=CC(N=C=O)=C1 XEFUJGURFLOFAN-UHFFFAOYSA-N 0.000 description 2
- FSCWZHGZWWDELK-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-2,4-oxazolidinedione Chemical compound O=C1C(C)(C=C)OC(=O)N1C1=CC(Cl)=CC(Cl)=C1 FSCWZHGZWWDELK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- COWNFYYYZFRNOY-UHFFFAOYSA-N oxazolidinedione Chemical compound O=C1COC(=O)N1 COWNFYYYZFRNOY-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- FTJBMYITMFAUCP-UHFFFAOYSA-N (3,5-dichlorophenyl)urea Chemical compound NC(=O)NC1=CC(Cl)=CC(Cl)=C1 FTJBMYITMFAUCP-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000004362 3,4,5-trichlorophenyl group Chemical group [H]C1=C(Cl)C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- JIQNWFBLYKVZFY-UHFFFAOYSA-N methoxycyclohexatriene Chemical compound COC1=C[C]=CC=C1 JIQNWFBLYKVZFY-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/44—Two oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782827414 DE2827414A1 (de) | 1978-06-22 | 1978-06-22 | Verfahren zur herstellung von oxazolidin-2,4-dionen |
| US06/040,282 US4233450A (en) | 1978-06-22 | 1979-05-18 | Preparation of oxazolidine-2,4-diones |
| AT79101896T ATE134T1 (de) | 1978-06-22 | 1979-06-11 | Verfahren zur herstellung von oxazoliden-2,4-dionen. |
| EP79101896A EP0007415B1 (de) | 1978-06-22 | 1979-06-11 | Verfahren zur Herstellung von Oxazoliden-2,4-dionen |
| DE7979101896T DE2960574D1 (en) | 1978-06-22 | 1979-06-11 | Process for the preparation of oxazolidine-2,4 diones |
| JP7314879A JPS552671A (en) | 1978-06-22 | 1979-06-12 | Manufacture of oxazolidinee2*44diones |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782827414 DE2827414A1 (de) | 1978-06-22 | 1978-06-22 | Verfahren zur herstellung von oxazolidin-2,4-dionen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2827414A1 true DE2827414A1 (de) | 1980-01-10 |
Family
ID=6042471
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782827414 Pending DE2827414A1 (de) | 1978-06-22 | 1978-06-22 | Verfahren zur herstellung von oxazolidin-2,4-dionen |
| DE7979101896T Expired DE2960574D1 (en) | 1978-06-22 | 1979-06-11 | Process for the preparation of oxazolidine-2,4 diones |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979101896T Expired DE2960574D1 (en) | 1978-06-22 | 1979-06-11 | Process for the preparation of oxazolidine-2,4 diones |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4233450A (enExample) |
| EP (1) | EP0007415B1 (enExample) |
| JP (1) | JPS552671A (enExample) |
| AT (1) | ATE134T1 (enExample) |
| DE (2) | DE2827414A1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2913522A1 (de) * | 1979-04-04 | 1980-10-23 | Basf Ag | Verfahren zur herstellung von n-aryloxazolidin-2,4-dionen |
| DE3102359A1 (de) * | 1981-01-24 | 1982-08-19 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von oxazolidin-2,4-dionen |
| DE3115649A1 (de) * | 1981-04-18 | 1982-11-04 | Bayer Ag, 5090 Leverkusen | "verfahren zur herstellung von n-aryloxazolidin-2,4-dionen" |
| WO2012103523A2 (en) | 2011-01-27 | 2012-08-02 | Samuel Rahbar | Novel modulators of development of adipocyte and cancer cells |
| US9808434B2 (en) | 2011-01-27 | 2017-11-07 | City Of Hope | Compound for treating cancer and diabetes |
| CA3110129A1 (en) * | 2018-09-10 | 2020-03-19 | Huntsman International Llc | Oxazolidinedione-terminated prepolymer |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE729852C (de) | 1939-07-06 | 1943-01-04 | Carl Nachtigall | Verfahren zur Herstellung von 2, 4-Dioxooxazolidinen |
| US2349796A (en) * | 1942-01-14 | 1944-05-23 | Mallinckrodt Chemical Works | Derivatives of 2,4-oxazolidinedione |
| US3280136A (en) * | 1965-05-03 | 1966-10-18 | Gen Electric | 5-substituted-2, 4-oxazolidinediones and magnesium chelate intermediates therefor |
| US3743651A (en) * | 1969-02-01 | 1973-07-03 | Sumitomo Chemical Co | N-(3,5-dihalogenophenyl)-oxazolidine compounds and preparation thereof |
| DE2022494A1 (de) * | 1970-05-08 | 1971-11-18 | Bayer Ag | Fungizide Mittel |
| DE2207576C2 (de) * | 1972-02-18 | 1985-07-25 | Basf Ag, 6700 Ludwigshafen | Oxazolidinderivate |
| US3868383A (en) * | 1973-04-23 | 1975-02-25 | Lilly Co Eli | Process for preparing 5-({60 -cyanobenzylidene) oxazolidine-2, 4-diones |
| DE2324591C2 (de) * | 1973-05-16 | 1985-12-12 | Basf Ag, 6700 Ludwigshafen | Oxazolidin-Derivate |
| JPS5231935B2 (enExample) * | 1973-07-03 | 1977-08-18 | ||
| DE2711659A1 (de) * | 1977-03-17 | 1978-09-21 | Basf Ag | Verfahren zur herstellung von 2,4-dioxo-oxazolidinen |
-
1978
- 1978-06-22 DE DE19782827414 patent/DE2827414A1/de active Pending
-
1979
- 1979-05-18 US US06/040,282 patent/US4233450A/en not_active Expired - Lifetime
- 1979-06-11 DE DE7979101896T patent/DE2960574D1/de not_active Expired
- 1979-06-11 EP EP79101896A patent/EP0007415B1/de not_active Expired
- 1979-06-11 AT AT79101896T patent/ATE134T1/de not_active IP Right Cessation
- 1979-06-12 JP JP7314879A patent/JPS552671A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0007415B1 (de) | 1981-08-05 |
| EP0007415A1 (de) | 1980-02-06 |
| ATE134T1 (de) | 1981-08-15 |
| JPH0125745B2 (enExample) | 1989-05-19 |
| JPS552671A (en) | 1980-01-10 |
| US4233450A (en) | 1980-11-11 |
| DE2960574D1 (en) | 1981-11-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0004582B1 (de) | Verfahren zur Herstellung von Oxazolidin-2,4-dionen | |
| DE3235933A1 (de) | Verfahren zur herstellung bicyclischer orthoesteramide | |
| DE2827414A1 (de) | Verfahren zur herstellung von oxazolidin-2,4-dionen | |
| EP0444508A2 (de) | Ethylenisch ungesättigte, fluorhaltige Urethanderivate und Verfahren zu ihrer Herstellung | |
| DE102007036068A1 (de) | Verfahren zur Herstellung von Alkyl-methoxymethyl-trimethylsilanylmethylaminen | |
| DE2556760A1 (de) | Verfahren zur herstellung von carbodiimiden | |
| US2972618A (en) | Adducts of heterocyclic amides | |
| DE68902673T2 (de) | Verfahren zur herstellung von oxalsaeureestern und -amiden. | |
| DE2659851C3 (de) | Verfahren zur Herstellung von 2-Phenyl-4-hydroxymethylimidazolen | |
| DE2946085A1 (de) | Blockierte isocyanatgruppen und isocyanuratgruppen enthaltende gemische sowie deren herstellung | |
| EP0123123A2 (de) | Verfahren zur Herstellung von 2-Isopropenyloxazolinen | |
| DE3102359A1 (de) | Verfahren zur herstellung von oxazolidin-2,4-dionen | |
| DE1126392B (de) | Verfahren zur Herstellung cyclischer Harnstoffe und Thioharnstoffe | |
| DE2711659A1 (de) | Verfahren zur herstellung von 2,4-dioxo-oxazolidinen | |
| DE102008050414A1 (de) | 1,4,2-Diazaphospholidin-Derivate | |
| DE1568501C3 (de) | Verfahren zur Herstellung von Carbodiimiden bzw. Carbodiimid-Isocyanat- Addukte n | |
| DE2812400C2 (de) | Verfahren zur Herstellung von N-(2-Mercaptoethyl)-alkanamiden und 2-Mercaptoethylamin-hydrochloriden | |
| AT222884B (de) | Verfahren zur Polymerisation von Aldehyden | |
| DE2528368A1 (de) | Verfahren zur herstellung von heterozyklischen verbindungen | |
| EP0859001A1 (de) | Herstellung von Oxazolderivaten | |
| DE3229665A1 (de) | Regiospezifisches verfahren zur herstellung von ergolinderivaten | |
| DD251134A1 (de) | Verfahren zur herstellung von organosilylmethylphosphinsaeureestern | |
| DE1518873A1 (de) | Verfahren zur Herstellung neuartiger Isocyanatadditionsprodukte | |
| DE2703106A1 (de) | Verfahren zur desulfurierung von dithiocarbamaten | |
| DE1138390B (de) | Verfahren zur Herstellung von tetra-substituierten Formamidochlorformamidinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |