DE2827300C2 - - Google Patents
Info
- Publication number
- DE2827300C2 DE2827300C2 DE2827300A DE2827300A DE2827300C2 DE 2827300 C2 DE2827300 C2 DE 2827300C2 DE 2827300 A DE2827300 A DE 2827300A DE 2827300 A DE2827300 A DE 2827300A DE 2827300 C2 DE2827300 C2 DE 2827300C2
- Authority
- DE
- Germany
- Prior art keywords
- complex
- catalyst
- reaction
- rhodium
- pph3
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000010948 rhodium Substances 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 23
- 239000003446 ligand Substances 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 239000003426 co-catalyst Substances 0.000 claims description 13
- 239000012429 reaction media Substances 0.000 claims description 9
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 9
- 230000000087 stabilizing effect Effects 0.000 claims description 8
- -1 phosphorus compound Chemical class 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims description 6
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 5
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 5
- GGQQNYXPYWCUHG-RMTFUQJTSA-N (3e,6e)-deca-3,6-diene Chemical compound CCC\C=C\C\C=C\CC GGQQNYXPYWCUHG-RMTFUQJTSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 150000001299 aldehydes Chemical class 0.000 claims description 3
- 150000004696 coordination complex Chemical class 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 229910052723 transition metal Inorganic materials 0.000 claims description 3
- 150000003624 transition metals Chemical class 0.000 claims description 3
- 229910052721 tungsten Inorganic materials 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 229910052763 palladium Inorganic materials 0.000 claims description 2
- JKDRQYIYVJVOPF-FDGPNNRMSA-L palladium(ii) acetylacetonate Chemical compound [Pd+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O JKDRQYIYVJVOPF-FDGPNNRMSA-L 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 239000002815 homogeneous catalyst Substances 0.000 claims 1
- 239000003054 catalyst Substances 0.000 description 10
- 229910052703 rhodium Inorganic materials 0.000 description 8
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical class C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- 150000001336 alkenes Chemical group 0.000 description 5
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 4
- 238000007037 hydroformylation reaction Methods 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- CUJRVFIICFDLGR-UHFFFAOYSA-N acetylacetonate Chemical compound CC(=O)[CH-]C(C)=O CUJRVFIICFDLGR-UHFFFAOYSA-N 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- 125000004437 phosphorous atom Chemical group 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- ZQDPJFUHLCOCRG-UHFFFAOYSA-N 3-hexene Chemical compound CCC=CCC ZQDPJFUHLCOCRG-UHFFFAOYSA-N 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- IETKMTGYQIVLRF-UHFFFAOYSA-N carbon monoxide;rhodium;triphenylphosphane Chemical compound [Rh].[O+]#[C-].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 IETKMTGYQIVLRF-UHFFFAOYSA-N 0.000 description 2
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- FXHGMKSSBGDXIY-UHFFFAOYSA-N heptanal Chemical compound CCCCCCC=O FXHGMKSSBGDXIY-UHFFFAOYSA-N 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 150000003003 phosphines Chemical class 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- MBVAQOHBPXKYMF-LNTINUHCSA-N (z)-4-hydroxypent-3-en-2-one;rhodium Chemical compound [Rh].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O MBVAQOHBPXKYMF-LNTINUHCSA-N 0.000 description 1
- GEKRISJWBAIIAA-UHFFFAOYSA-N 5-methylhexanal Chemical compound CC(C)CCCC=O GEKRISJWBAIIAA-UHFFFAOYSA-N 0.000 description 1
- 229910021604 Rhodium(III) chloride Inorganic materials 0.000 description 1
- FCFJWGBWPHEZLT-UHFFFAOYSA-N [Rh]C=O Chemical class [Rh]C=O FCFJWGBWPHEZLT-UHFFFAOYSA-N 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- SJLOMQIUPFZJAN-UHFFFAOYSA-N oxorhodium Chemical compound [Rh]=O SJLOMQIUPFZJAN-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000002577 pseudohalo group Chemical group 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- 150000003283 rhodium Chemical class 0.000 description 1
- 150000003284 rhodium compounds Chemical class 0.000 description 1
- 229910003450 rhodium oxide Inorganic materials 0.000 description 1
- ITDJKCJYYAQMRO-UHFFFAOYSA-L rhodium(2+);diacetate Chemical compound [Rh+2].CC([O-])=O.CC([O-])=O ITDJKCJYYAQMRO-UHFFFAOYSA-L 0.000 description 1
- PZSJYEAHAINDJI-UHFFFAOYSA-N rhodium(3+) Chemical compound [Rh+3] PZSJYEAHAINDJI-UHFFFAOYSA-N 0.000 description 1
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 1
- XBBXDTCPEWHXKL-UHFFFAOYSA-N rhodium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[Rh+3].[Rh+3] XBBXDTCPEWHXKL-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- DMEUUKUNSVFYAA-UHFFFAOYSA-N trinaphthalen-1-ylphosphane Chemical compound C1=CC=C2C(P(C=3C4=CC=CC=C4C=CC=3)C=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 DMEUUKUNSVFYAA-UHFFFAOYSA-N 0.000 description 1
- WXAZIUYTQHYBFW-UHFFFAOYSA-N tris(4-methylphenyl)phosphane Chemical compound C1=CC(C)=CC=C1P(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 WXAZIUYTQHYBFW-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
- C07C45/50—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide by oxo-reactions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2585777 | 1977-06-21 | ||
| GB3492077 | 1977-08-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2827300A1 DE2827300A1 (de) | 1979-01-11 |
| DE2827300C2 true DE2827300C2 (enExample) | 1989-09-14 |
Family
ID=26257916
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782827300 Granted DE2827300A1 (de) | 1977-06-21 | 1978-06-21 | Verfahren zum herstellen eines geradkettigen aldehyds aus einem olefin |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4200592A (enExample) |
| JP (1) | JPS5416418A (enExample) |
| CA (1) | CA1102823A (enExample) |
| DE (1) | DE2827300A1 (enExample) |
| FR (1) | FR2395246A1 (enExample) |
| GB (1) | GB2000124B (enExample) |
| NL (1) | NL7806623A (enExample) |
| SG (1) | SG46682G (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2459683A1 (fr) * | 1979-06-22 | 1981-01-16 | Ugine Kuhlmann | Procede de stabilisation et de regeneration du catalyseur d'hydroformylation du propene |
| US4388477A (en) * | 1981-06-02 | 1983-06-14 | Eastman Kodak Company | Hydroformylation process employing unmodified rhodium-cobalt catalyst |
| ATE16475T1 (de) * | 1982-06-11 | 1985-11-15 | Davy Mckee London | Hydroformylierungsverfahren. |
| EP0096986B1 (en) * | 1982-06-11 | 1987-04-22 | DAVY McKEE (LONDON) LIMITED | Hydroformylation process |
| US4528404A (en) * | 1983-03-16 | 1985-07-09 | Exxon Research And Engineering Co. | High temperature hydroformylation in the presence of triarylphosphine rhodium carbonyl hydride complex catalyst systems |
| FR2544713B1 (fr) * | 1983-04-22 | 1986-08-22 | Ugine Kuhlmann | Systeme catalytique pour l'hydroformylation des olefines. procede d'hydroformylation |
| JPS6099772U (ja) * | 1983-12-14 | 1985-07-08 | 日本電子株式会社 | 直接試料導入装置 |
| JPS62127648U (enExample) * | 1986-02-05 | 1987-08-13 | ||
| CA1327365C (en) * | 1988-06-29 | 1994-03-01 | Stephen R. Stobart | Process for catalytic hydroformylation |
| IT1229512B (it) * | 1989-01-27 | 1991-09-03 | Eniricerche Spa | Procedimento per la idroformilazione catalitica di.olefine |
| US5233093A (en) * | 1992-07-20 | 1993-08-03 | Arco Chemical Technology, L.P. | Hydroformylation process and bimetallic catalyst therefor |
| US5756855A (en) * | 1994-08-19 | 1998-05-26 | Union Carbide Chemicals & Plastics Technology Corporation | Stabilization of phosphite ligands in hydroformylation process |
| US5817883A (en) * | 1996-04-24 | 1998-10-06 | Union Carbide Chemicals & Plastics Technology Corporation | Processes for producing hydroxyaldehydes |
| US5821389A (en) * | 1996-04-24 | 1998-10-13 | Union Carbide Chemicals & Technology Corporation | Processes for producing hydroxyaldehydes |
| US5925754A (en) * | 1997-04-15 | 1999-07-20 | Union Carbide Chemicals & Plastics Technology Corporation | Epsilon caprolactam compositions |
| GB0106219D0 (en) * | 2001-03-14 | 2001-05-02 | Ici Plc | Improvements in and relating to the production of oxygenated organic compounds |
| US6831035B2 (en) * | 2002-01-22 | 2004-12-14 | Eastman Kodak Company | Stabilization of fluorophosphite-containing catalysts |
| US7674937B2 (en) * | 2008-05-28 | 2010-03-09 | Eastman Chemical Company | Hydroformylation catalysts |
| WO2025029369A1 (en) | 2023-08-03 | 2025-02-06 | Dow Technology Investments Llc | Process for improving rhodium/phosphite- based homogenous hydroformylation catalyst activity |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL98500C (enExample) * | 1956-01-11 | |||
| FR1171390A (fr) * | 1956-01-11 | 1959-01-26 | Exxon Research Engineering Co | Réaction de synthèse par carbonylation |
| US3378590A (en) * | 1964-05-27 | 1968-04-16 | Toa Nenryo Kogyo Kk | Production of aldehydes and/or alcohols from compound having olefinic double bonds |
| US3488296A (en) * | 1967-02-06 | 1970-01-06 | Exxon Research Engineering Co | Oxonation process |
| US3631111A (en) * | 1968-12-17 | 1971-12-28 | Gulf Research Development Co | Oxo process |
| GB1338225A (en) * | 1969-12-31 | 1973-11-21 | Johnson Matthey Co Ltd | Catalytic reactions |
| US3989759A (en) * | 1970-07-01 | 1976-11-02 | Atlantic Richfield Company | Hydroformylation process over catalyst having silica alumina support with separate alumina phase and noble metal and cobalt or nickel |
| US4143075A (en) * | 1976-08-12 | 1979-03-06 | Union Carbide Corporation | Control of condensation products in hydroformylation process |
| DE2650829A1 (de) * | 1976-11-06 | 1978-05-11 | Basf Ag | Verfahren zur reindarstellung von oxo-aldehyden |
-
1978
- 1978-06-14 GB GB7826881A patent/GB2000124B/en not_active Expired
- 1978-06-19 CA CA305,731A patent/CA1102823A/en not_active Expired
- 1978-06-19 US US05/916,535 patent/US4200592A/en not_active Expired - Lifetime
- 1978-06-20 NL NL7806623A patent/NL7806623A/xx not_active Application Discontinuation
- 1978-06-21 FR FR7818565A patent/FR2395246A1/fr active Granted
- 1978-06-21 JP JP7529278A patent/JPS5416418A/ja active Granted
- 1978-06-21 DE DE19782827300 patent/DE2827300A1/de active Granted
-
1982
- 1982-09-23 SG SG46682A patent/SG46682G/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7806623A (nl) | 1978-12-27 |
| US4200592A (en) | 1980-04-29 |
| FR2395246B1 (enExample) | 1984-07-06 |
| DE2827300A1 (de) | 1979-01-11 |
| GB2000124A (en) | 1979-01-04 |
| JPS5416418A (en) | 1979-02-07 |
| SG46682G (en) | 1983-02-25 |
| CA1102823A (en) | 1981-06-09 |
| JPS6123172B2 (enExample) | 1986-06-04 |
| FR2395246A1 (fr) | 1979-01-19 |
| GB2000124B (en) | 1982-03-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2827300C2 (enExample) | ||
| DE1793069C3 (enExample) | ||
| DE2064471C2 (de) | Verfahren zur Herstellung von Aldehyden durch Hydroformylierung | |
| WO2008071508A1 (de) | Bisphosphitliganden für die übergangsmetallkatalysierte hydroformylierung | |
| EP0435084A1 (de) | Verfahren zur Herstellung von Aldehyden | |
| DE2322751A1 (de) | Verfahren zur herstellung von aldehyden durch hydroformylierung von olefinen | |
| DE2552351A1 (de) | Hydroformylierung von olefinen | |
| EP0982314B1 (de) | Valeraldehyd und Verfahren zu seiner Herstellung | |
| DE69915669T2 (de) | Hydroformylierungsverfahren unter verwendung eines chlorphosphit-metall katalysatorsystems | |
| DE3035468C2 (enExample) | ||
| DE2827301A1 (de) | Verfahren zum herstellen eines geradkettigen aldehyds aus einem olefin | |
| EP0226988B1 (de) | Verfahren zur Herstellung von Aldehyden | |
| EP0811424A2 (de) | Katalysatorsysteme auf der Basis von Rhodium-Komplex-verbindungen mit Diphosphin-Liganden und ihre Verwendung bei der Herstellung von Aldehyden | |
| EP0491239B1 (de) | Verfahren zur Herstellung von Aldehyden | |
| DE2833538C2 (de) | Verfahren zur Herstellung von α-methylverzweigten Aldehyden | |
| DE1812504C2 (de) | Verfahren zur Herstellung von Alkoholen und/oder Aldehyden nach der Oxosynthese | |
| DE69707533T2 (de) | Verfahren zur Herstellung von 3-Formyl-tetrahydrofuran | |
| EP0544091B2 (de) | Verfahren zur Reaktivierung wasserlöslicher Hydroformylierungskatalysatoren | |
| EP0160249B1 (de) | Verfahren zur Herstellung von Aldehyden | |
| DE1280839B (de) | Verfahren zur Herstellung von 1, 4-Dicyanbuten und bzw. oder Adipinsaeuredinitril durch Hydrodimerisierung von Acrylnitril | |
| DE3885593T2 (de) | Verfahren zur Herstellung von Aldehyden oder Gemischen von Ketonen und Aldehyden. | |
| EP1178951B1 (de) | Eta 5-phospholylkomplexe und ihre verwendung in der hydroformylierung | |
| DE3126265C2 (enExample) | ||
| DE1918695B2 (de) | Herstellung von Carbonsäureester des 3-Formyl-buten-(3)-ol-(l) | |
| DE2744207A1 (de) | Verfahren zur herstellung eines oxidierten produktes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8125 | Change of the main classification |
Ipc: C07C 45/50 |
|
| 8127 | New person/name/address of the applicant |
Owner name: JOHNSON MATTHEY PLC, LONDON, GB |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |