CA1102823A - Catalysis in hydroformylation - Google Patents
Catalysis in hydroformylationInfo
- Publication number
- CA1102823A CA1102823A CA305,731A CA305731A CA1102823A CA 1102823 A CA1102823 A CA 1102823A CA 305731 A CA305731 A CA 305731A CA 1102823 A CA1102823 A CA 1102823A
- Authority
- CA
- Canada
- Prior art keywords
- process according
- rhodium
- complex
- pph3
- rhh
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000007037 hydroformylation reaction Methods 0.000 title abstract description 8
- 238000006555 catalytic reaction Methods 0.000 title 1
- 239000010948 rhodium Substances 0.000 claims abstract description 52
- 238000000034 method Methods 0.000 claims abstract description 33
- 230000008569 process Effects 0.000 claims abstract description 33
- 229910052703 rhodium Inorganic materials 0.000 claims abstract description 22
- 239000003426 co-catalyst Substances 0.000 claims abstract description 20
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000012429 reaction media Substances 0.000 claims abstract description 16
- 150000001336 alkenes Chemical class 0.000 claims abstract description 12
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 6
- 238000004519 manufacturing process Methods 0.000 claims abstract description 6
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 5
- 239000007788 liquid Substances 0.000 claims abstract description 4
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims abstract 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical group C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 40
- -1 hydrido carbonyl Chemical group 0.000 claims description 22
- 239000003446 ligand Substances 0.000 claims description 21
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 claims description 14
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical group C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 claims description 14
- 239000003054 catalyst Substances 0.000 claims description 12
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 claims description 8
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 230000003019 stabilising effect Effects 0.000 claims description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 6
- QMMOXUPEWRXHJS-UHFFFAOYSA-N pentene-2 Natural products CCC=CC QMMOXUPEWRXHJS-UHFFFAOYSA-N 0.000 claims description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims description 6
- RYPKRALMXUUNKS-UHFFFAOYSA-N 2-Hexene Natural products CCCC=CC RYPKRALMXUUNKS-UHFFFAOYSA-N 0.000 claims description 4
- ZQDPJFUHLCOCRG-UHFFFAOYSA-N 3-hexene Chemical compound CCC=CCC ZQDPJFUHLCOCRG-UHFFFAOYSA-N 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 claims description 4
- 150000007530 organic bases Chemical group 0.000 claims description 4
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 4
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 239000012433 hydrogen halide Substances 0.000 claims description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 230000000087 stabilizing effect Effects 0.000 claims description 3
- 229910017333 Mo(CO)6 Inorganic materials 0.000 claims description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N Pd(PPh3)4 Substances [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- SJLOMQIUPFZJAN-UHFFFAOYSA-N oxorhodium Chemical compound [Rh]=O SJLOMQIUPFZJAN-UHFFFAOYSA-N 0.000 claims description 2
- 125000002577 pseudohalo group Chemical group 0.000 claims description 2
- 150000003283 rhodium Chemical class 0.000 claims description 2
- 229910003450 rhodium oxide Inorganic materials 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims 1
- 229910019813 Cr(CO)6 Inorganic materials 0.000 claims 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 1
- 229910008940 W(CO)6 Inorganic materials 0.000 claims 1
- 125000005595 acetylacetonate group Chemical group 0.000 claims 1
- IETKMTGYQIVLRF-UHFFFAOYSA-N carbon monoxide;rhodium;triphenylphosphane Chemical group [Rh].[O+]#[C-].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 IETKMTGYQIVLRF-UHFFFAOYSA-N 0.000 claims 1
- NQZFAUXPNWSLBI-UHFFFAOYSA-N carbon monoxide;ruthenium Chemical compound [Ru].[Ru].[Ru].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] NQZFAUXPNWSLBI-UHFFFAOYSA-N 0.000 claims 1
- JKDRQYIYVJVOPF-FDGPNNRMSA-L palladium(ii) acetylacetonate Chemical compound [Pd+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O JKDRQYIYVJVOPF-FDGPNNRMSA-L 0.000 claims 1
- SYKXNRFLNZUGAJ-UHFFFAOYSA-N platinum;triphenylphosphane Chemical compound [Pt].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 SYKXNRFLNZUGAJ-UHFFFAOYSA-N 0.000 claims 1
- PZSJYEAHAINDJI-UHFFFAOYSA-N rhodium(3+) Chemical compound [Rh+3] PZSJYEAHAINDJI-UHFFFAOYSA-N 0.000 claims 1
- GGQQNYXPYWCUHG-RMTFUQJTSA-N (3e,6e)-deca-3,6-diene Chemical compound CCC\C=C\C\C=C\CC GGQQNYXPYWCUHG-RMTFUQJTSA-N 0.000 abstract description 5
- 230000003197 catalytic effect Effects 0.000 abstract description 3
- 229910052763 palladium Inorganic materials 0.000 abstract description 3
- 230000000737 periodic effect Effects 0.000 abstract description 3
- 229910052723 transition metal Inorganic materials 0.000 abstract description 3
- 150000003624 transition metals Chemical class 0.000 abstract description 3
- 229910052742 iron Inorganic materials 0.000 abstract description 2
- 229910052697 platinum Inorganic materials 0.000 abstract description 2
- 229910052707 ruthenium Inorganic materials 0.000 abstract description 2
- 229910052721 tungsten Inorganic materials 0.000 abstract description 2
- 229910052804 chromium Inorganic materials 0.000 abstract 1
- 229910052750 molybdenum Inorganic materials 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 12
- 150000001299 aldehydes Chemical class 0.000 description 6
- CUJRVFIICFDLGR-UHFFFAOYSA-N acetylacetonate Chemical compound CC(=O)[CH-]C(C)=O CUJRVFIICFDLGR-UHFFFAOYSA-N 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 3
- 125000004437 phosphorous atom Chemical group 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 2
- 239000007792 gaseous phase Substances 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- FXHGMKSSBGDXIY-UHFFFAOYSA-N heptanal Chemical compound CCCCCCC=O FXHGMKSSBGDXIY-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 150000003003 phosphines Chemical class 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- GEKRISJWBAIIAA-UHFFFAOYSA-N 5-methylhexanal Chemical compound CC(C)CCCC=O GEKRISJWBAIIAA-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 101100182729 Homo sapiens LY6K gene Proteins 0.000 description 1
- 102100032129 Lymphocyte antigen 6K Human genes 0.000 description 1
- 229910019603 Rh2O3 Inorganic materials 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- FCFJWGBWPHEZLT-UHFFFAOYSA-N [Rh]C=O Chemical class [Rh]C=O FCFJWGBWPHEZLT-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- 150000003284 rhodium compounds Chemical class 0.000 description 1
- ITDJKCJYYAQMRO-UHFFFAOYSA-L rhodium(2+);diacetate Chemical compound [Rh+2].CC([O-])=O.CC([O-])=O ITDJKCJYYAQMRO-UHFFFAOYSA-L 0.000 description 1
- XBBXDTCPEWHXKL-UHFFFAOYSA-N rhodium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[Rh+3].[Rh+3] XBBXDTCPEWHXKL-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- DMEUUKUNSVFYAA-UHFFFAOYSA-N trinaphthalen-1-ylphosphane Chemical compound C1=CC=C2C(P(C=3C4=CC=CC=C4C=CC=3)C=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 DMEUUKUNSVFYAA-UHFFFAOYSA-N 0.000 description 1
- WXAZIUYTQHYBFW-UHFFFAOYSA-N tris(4-methylphenyl)phosphane Chemical compound C1=CC(C)=CC=C1P(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 WXAZIUYTQHYBFW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
- C07C45/50—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide by oxo-reactions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB25857/77 | 1977-06-21 | ||
| GB2585777 | 1977-06-21 | ||
| GB3492077 | 1977-08-19 | ||
| GB34920/77 | 1977-08-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1102823A true CA1102823A (en) | 1981-06-09 |
Family
ID=26257916
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA305,731A Expired CA1102823A (en) | 1977-06-21 | 1978-06-19 | Catalysis in hydroformylation |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4200592A (enExample) |
| JP (1) | JPS5416418A (enExample) |
| CA (1) | CA1102823A (enExample) |
| DE (1) | DE2827300A1 (enExample) |
| FR (1) | FR2395246A1 (enExample) |
| GB (1) | GB2000124B (enExample) |
| NL (1) | NL7806623A (enExample) |
| SG (1) | SG46682G (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2459683A1 (fr) * | 1979-06-22 | 1981-01-16 | Ugine Kuhlmann | Procede de stabilisation et de regeneration du catalyseur d'hydroformylation du propene |
| US4388477A (en) * | 1981-06-02 | 1983-06-14 | Eastman Kodak Company | Hydroformylation process employing unmodified rhodium-cobalt catalyst |
| DE3361212D1 (en) * | 1982-06-11 | 1985-12-19 | Davy Mckee London | Hydroformylation process |
| EP0096986B1 (en) * | 1982-06-11 | 1987-04-22 | DAVY McKEE (LONDON) LIMITED | Hydroformylation process |
| US4528404A (en) * | 1983-03-16 | 1985-07-09 | Exxon Research And Engineering Co. | High temperature hydroformylation in the presence of triarylphosphine rhodium carbonyl hydride complex catalyst systems |
| FR2544713B1 (fr) * | 1983-04-22 | 1986-08-22 | Ugine Kuhlmann | Systeme catalytique pour l'hydroformylation des olefines. procede d'hydroformylation |
| JPS6099772U (ja) * | 1983-12-14 | 1985-07-08 | 日本電子株式会社 | 直接試料導入装置 |
| JPS62127648U (enExample) * | 1986-02-05 | 1987-08-13 | ||
| CA1327365C (en) * | 1988-06-29 | 1994-03-01 | Stephen R. Stobart | Process for catalytic hydroformylation |
| IT1229512B (it) * | 1989-01-27 | 1991-09-03 | Eniricerche Spa | Procedimento per la idroformilazione catalitica di.olefine |
| US5233093A (en) * | 1992-07-20 | 1993-08-03 | Arco Chemical Technology, L.P. | Hydroformylation process and bimetallic catalyst therefor |
| US5756855A (en) * | 1994-08-19 | 1998-05-26 | Union Carbide Chemicals & Plastics Technology Corporation | Stabilization of phosphite ligands in hydroformylation process |
| US5821389A (en) * | 1996-04-24 | 1998-10-13 | Union Carbide Chemicals & Technology Corporation | Processes for producing hydroxyaldehydes |
| US5817883A (en) * | 1996-04-24 | 1998-10-06 | Union Carbide Chemicals & Plastics Technology Corporation | Processes for producing hydroxyaldehydes |
| US5925754A (en) * | 1997-04-15 | 1999-07-20 | Union Carbide Chemicals & Plastics Technology Corporation | Epsilon caprolactam compositions |
| GB0106219D0 (en) * | 2001-03-14 | 2001-05-02 | Ici Plc | Improvements in and relating to the production of oxygenated organic compounds |
| US6831035B2 (en) * | 2002-01-22 | 2004-12-14 | Eastman Kodak Company | Stabilization of fluorophosphite-containing catalysts |
| US7674937B2 (en) * | 2008-05-28 | 2010-03-09 | Eastman Chemical Company | Hydroformylation catalysts |
| WO2025029369A1 (en) | 2023-08-03 | 2025-02-06 | Dow Technology Investments Llc | Process for improving rhodium/phosphite- based homogenous hydroformylation catalyst activity |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1171390A (fr) * | 1956-01-11 | 1959-01-26 | Exxon Research Engineering Co | Réaction de synthèse par carbonylation |
| NL98500C (enExample) * | 1956-01-11 | |||
| US3378590A (en) * | 1964-05-27 | 1968-04-16 | Toa Nenryo Kogyo Kk | Production of aldehydes and/or alcohols from compound having olefinic double bonds |
| US3488296A (en) * | 1967-02-06 | 1970-01-06 | Exxon Research Engineering Co | Oxonation process |
| US3631111A (en) * | 1968-12-17 | 1971-12-28 | Gulf Research Development Co | Oxo process |
| GB1338225A (en) * | 1969-12-31 | 1973-11-21 | Johnson Matthey Co Ltd | Catalytic reactions |
| US3989759A (en) * | 1970-07-01 | 1976-11-02 | Atlantic Richfield Company | Hydroformylation process over catalyst having silica alumina support with separate alumina phase and noble metal and cobalt or nickel |
| US4143075A (en) * | 1976-08-12 | 1979-03-06 | Union Carbide Corporation | Control of condensation products in hydroformylation process |
| DE2650829A1 (de) * | 1976-11-06 | 1978-05-11 | Basf Ag | Verfahren zur reindarstellung von oxo-aldehyden |
-
1978
- 1978-06-14 GB GB7826881A patent/GB2000124B/en not_active Expired
- 1978-06-19 CA CA305,731A patent/CA1102823A/en not_active Expired
- 1978-06-19 US US05/916,535 patent/US4200592A/en not_active Expired - Lifetime
- 1978-06-20 NL NL7806623A patent/NL7806623A/xx not_active Application Discontinuation
- 1978-06-21 DE DE19782827300 patent/DE2827300A1/de active Granted
- 1978-06-21 FR FR7818565A patent/FR2395246A1/fr active Granted
- 1978-06-21 JP JP7529278A patent/JPS5416418A/ja active Granted
-
1982
- 1982-09-23 SG SG46682A patent/SG46682G/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB2000124A (en) | 1979-01-04 |
| GB2000124B (en) | 1982-03-24 |
| JPS5416418A (en) | 1979-02-07 |
| DE2827300A1 (de) | 1979-01-11 |
| NL7806623A (nl) | 1978-12-27 |
| SG46682G (en) | 1983-02-25 |
| FR2395246A1 (fr) | 1979-01-19 |
| FR2395246B1 (enExample) | 1984-07-06 |
| US4200592A (en) | 1980-04-29 |
| DE2827300C2 (enExample) | 1989-09-14 |
| JPS6123172B2 (enExample) | 1986-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1102823A (en) | Catalysis in hydroformylation | |
| US5929289A (en) | Stabilization of phosphite ligands in hydroformylation process | |
| US3939188A (en) | Preparation of zerovalent phosphine substituted rhodium compounds and their use in the selective carbonylation of olefins | |
| KR102073732B1 (ko) | 하이드로포밀화 촉매, 이를 포함하는 촉매 조성물 및 이를 이용한 알데히드 제조방법 | |
| KR100964099B1 (ko) | 인을 포함하는 촉매 조성물 및 이를 이용한 히드로포밀화방법 | |
| EP0159460A1 (en) | A hydroformylation catalyst and process | |
| KR100964098B1 (ko) | 포스파이트 리간드를 포함하는 촉매 조성물 및 이를 이용한히드로포르밀화 방법 | |
| EP3156127B1 (en) | Catalytic composition containing phosphorus-based ligand and method for hydroformylation using same | |
| KR101095775B1 (ko) | 올레핀계 화합물의 히드로포밀화 반응용 촉매 조성물 및 이를 이용한 올레핀계 화합물의 히드로포밀화 방법 | |
| EP2404671A2 (en) | Catalyst composition for hydroformylation and method for preparing aldehydes using the same | |
| EP1755782B1 (en) | Phosphorus-containing catalyst composition and hydroformylation process using the same | |
| US4200591A (en) | Catalytic hydroformylation | |
| EP3213817B1 (en) | Catalyst composition containing phosphorus-based ligand and method for hydroformylation using same | |
| EP3466540B1 (en) | Catalyst composition for hydroformylation reaction and method for preparing aldehyde using same | |
| US3946082A (en) | Preparation of zerovalent phosphine substituted rhodium compounds and their use in the selective carbonylation of olefins | |
| KR101615028B1 (ko) | 히드로포밀화 반응용 촉매 조성물 및 이를 이용한 올레핀의 히드로포밀화 방법 | |
| JPH0328406B2 (enExample) | ||
| KR20100092169A (ko) | 인을 포함하는 촉매 조성물을 이용한 알데히드의 제조방법 | |
| EP3357574B1 (en) | Hydroformylation method | |
| KR20250057145A (ko) | 모노포스핀, 테트라포스핀 리간드의 조합을 포함하는 촉매 조성물 및 이를 이용하는 하이드로포밀화 공정 | |
| US4593141A (en) | Hydroformylation catalysis by branched alkyl diaryl phosphine rhodium complexes | |
| KR101309918B1 (ko) | 반응 중 촉매의 안정성이 개선된 하이드로포밀화 방법 | |
| KR102131788B1 (ko) | 히드로포밀화 반응용 촉매 조성물 및 이를 이용한 알데히드 제조방법 | |
| WO2022072182A1 (en) | Processes of preparing ferrocene ligand mixtures suitable for propylene hydroformylation | |
| JPS60501399A (ja) | オレフィンのヒドロホルミル化用触媒系及びヒドロホルミル化方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |