DE2820860A1 - Katalysatortraeger - Google Patents
KatalysatortraegerInfo
- Publication number
- DE2820860A1 DE2820860A1 DE19782820860 DE2820860A DE2820860A1 DE 2820860 A1 DE2820860 A1 DE 2820860A1 DE 19782820860 DE19782820860 DE 19782820860 DE 2820860 A DE2820860 A DE 2820860A DE 2820860 A1 DE2820860 A1 DE 2820860A1
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- aluminum
- chromium
- support
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000003054 catalyst Substances 0.000 title claims description 74
- 229910052782 aluminium Inorganic materials 0.000 claims description 71
- 239000011651 chromium Substances 0.000 claims description 54
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 53
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 41
- -1 aluminum compound Chemical class 0.000 claims description 40
- 229910052804 chromium Inorganic materials 0.000 claims description 40
- 229920005989 resin Polymers 0.000 claims description 40
- 239000011347 resin Substances 0.000 claims description 40
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 33
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 28
- 238000006116 polymerization reaction Methods 0.000 claims description 25
- 239000011148 porous material Substances 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 22
- 238000004519 manufacturing process Methods 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 18
- 239000007795 chemical reaction product Substances 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 14
- 239000012298 atmosphere Substances 0.000 claims description 12
- 238000000071 blow moulding Methods 0.000 claims description 12
- 239000000155 melt Substances 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 9
- 239000000377 silicon dioxide Substances 0.000 claims description 8
- 230000004913 activation Effects 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 239000000047 product Substances 0.000 claims description 7
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 6
- 239000005977 Ethylene Substances 0.000 claims description 6
- 230000003197 catalytic effect Effects 0.000 claims description 6
- 229910002028 silica xerogel Inorganic materials 0.000 claims description 6
- 238000000354 decomposition reaction Methods 0.000 claims description 5
- 229910052809 inorganic oxide Inorganic materials 0.000 claims description 5
- 230000001105 regulatory effect Effects 0.000 claims description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 235000012239 silicon dioxide Nutrition 0.000 claims description 4
- 229910019142 PO4 Inorganic materials 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 229920013716 polyethylene resin Polymers 0.000 claims description 3
- 239000002685 polymerization catalyst Substances 0.000 claims description 3
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052720 vanadium Inorganic materials 0.000 claims description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052750 molybdenum Inorganic materials 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 229920005672 polyolefin resin Polymers 0.000 claims description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 2
- 239000010937 tungsten Substances 0.000 claims description 2
- 229910052721 tungsten Inorganic materials 0.000 claims description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- 230000004044 response Effects 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 239000003638 chemical reducing agent Substances 0.000 description 11
- 150000001845 chromium compounds Chemical class 0.000 description 11
- 229910052739 hydrogen Chemical group 0.000 description 11
- 239000001257 hydrogen Chemical group 0.000 description 10
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- 150000001336 alkenes Chemical class 0.000 description 7
- 238000009826 distribution Methods 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 6
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 6
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000499 gel Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 4
- 229960005235 piperonyl butoxide Drugs 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000012876 carrier material Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 3
- 238000005336 cracking Methods 0.000 description 3
- 230000008021 deposition Effects 0.000 description 3
- 230000004069 differentiation Effects 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- WOZZOSDBXABUFO-UHFFFAOYSA-N tri(butan-2-yloxy)alumane Chemical compound [Al+3].CCC(C)[O-].CCC(C)[O-].CCC(C)[O-] WOZZOSDBXABUFO-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 229910000423 chromium oxide Inorganic materials 0.000 description 2
- 229940117975 chromium trioxide Drugs 0.000 description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000005470 impregnation Methods 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 238000006317 isomerization reaction Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229910052755 nonmetal Inorganic materials 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 1
- HHUIAYDQMNHELC-UHFFFAOYSA-N [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O HHUIAYDQMNHELC-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005234 alkyl aluminium group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- JPUHCPXFQIXLMW-UHFFFAOYSA-N aluminium triethoxide Chemical compound CCO[Al](OCC)OCC JPUHCPXFQIXLMW-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000004517 catalytic hydrocracking Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- DLRHRQTUCJTIIV-UHFFFAOYSA-N diethoxy(ethyl)alumane Chemical compound CC[O-].CC[O-].CC[Al+2] DLRHRQTUCJTIIV-UHFFFAOYSA-N 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- 238000013551 empirical research Methods 0.000 description 1
- GCPCLEKQVMKXJM-UHFFFAOYSA-N ethoxy(diethyl)alumane Chemical compound CCO[Al](CC)CC GCPCLEKQVMKXJM-UHFFFAOYSA-N 0.000 description 1
- AIGRXSNSLVJMEA-FQEVSTJZSA-N ethoxy-(4-nitrophenoxy)-phenyl-sulfanylidene-$l^{5}-phosphane Chemical compound O([P@@](=S)(OCC)C=1C=CC=CC=1)C1=CC=C([N+]([O-])=O)C=C1 AIGRXSNSLVJMEA-FQEVSTJZSA-N 0.000 description 1
- XGAIERUWZADBAO-UHFFFAOYSA-N ethoxy-bis(2-methylpropyl)alumane Chemical compound CCO[Al](CC(C)C)CC(C)C XGAIERUWZADBAO-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical class [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- JMRWHIBGEUIERH-UHFFFAOYSA-N methylaluminum(2+);propan-1-olate Chemical compound [Al+2]C.CCC[O-].CCC[O-] JMRWHIBGEUIERH-UHFFFAOYSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 239000003348 petrochemical agent Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000002407 reforming Methods 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 210000002105 tongue Anatomy 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- WXRGABKACDFXMG-UHFFFAOYSA-N trimethylborane Chemical compound CB(C)C WXRGABKACDFXMG-UHFFFAOYSA-N 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
- OPSWAWSNPREEFQ-UHFFFAOYSA-K triphenoxyalumane Chemical compound [Al+3].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 OPSWAWSNPREEFQ-UHFFFAOYSA-K 0.000 description 1
- JQPMDTQDAXRDGS-UHFFFAOYSA-N triphenylalumane Chemical compound C1=CC=CC=C1[Al](C=1C=CC=CC=1)C1=CC=CC=C1 JQPMDTQDAXRDGS-UHFFFAOYSA-N 0.000 description 1
- XDSSGQHOYWGIKC-UHFFFAOYSA-N tris(2-methylpropyl)borane Chemical compound CC(C)CB(CC(C)C)CC(C)C XDSSGQHOYWGIKC-UHFFFAOYSA-N 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 238000000196 viscometry Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US80058677A | 1977-05-25 | 1977-05-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2820860A1 true DE2820860A1 (de) | 1978-11-30 |
Family
ID=25178793
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782820860 Ceased DE2820860A1 (de) | 1977-05-25 | 1978-05-12 | Katalysatortraeger |
Country Status (24)
| Country | Link |
|---|---|
| JP (1) | JPS53146287A (https=) |
| AU (1) | AU3589478A (https=) |
| BE (1) | BE867488A (https=) |
| BR (1) | BR7803329A (https=) |
| CA (1) | CA1094749A (https=) |
| DD (1) | DD137111A5 (https=) |
| DE (1) | DE2820860A1 (https=) |
| DK (1) | DK229478A (https=) |
| ES (2) | ES470105A1 (https=) |
| FI (1) | FI781634A7 (https=) |
| FR (1) | FR2391773A1 (https=) |
| GB (1) | GB1604708A (https=) |
| GR (1) | GR65605B (https=) |
| IT (1) | IT1096324B (https=) |
| LU (1) | LU79699A1 (https=) |
| MX (1) | MX6326E (https=) |
| NL (1) | NL186163C (https=) |
| NO (1) | NO155292C (https=) |
| NZ (1) | NZ187359A (https=) |
| PH (1) | PH13805A (https=) |
| PL (1) | PL112965B1 (https=) |
| PT (1) | PT68070B (https=) |
| SE (1) | SE7805965L (https=) |
| ZA (1) | ZA782752B (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3142155A1 (de) * | 1980-10-24 | 1982-06-16 | National Petro Chemicals Corp., New York, N.Y. | Herstellung von polyolefinen mit einer verbesserten umwelt-spannungsrissbestaendigkeit (escr) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4134146A1 (de) * | 1991-10-16 | 1993-04-22 | Basf Ag | Phillips-katalysator und seine verwendung zur herstellung von ethylenhomopolymerisaten und -copolymerisaten |
| DE19643512A1 (de) * | 1996-10-22 | 1998-04-23 | Basf Ag | Verfahren zur Herstellung von geträgerten Chromkatalysatoren |
| US6989344B2 (en) * | 2002-12-27 | 2006-01-24 | Univation Technologies, Llc | Supported chromium oxide catalyst for the production of broad molecular weight polyethylene |
| WO2010150410A1 (ja) * | 2009-06-26 | 2010-12-29 | 日本ポリエチレン株式会社 | ポリエチレン系樹脂、その製造触媒及び製造方法、並びにポリエチレン系樹脂を含む中空プラスチック成形品およびその用途 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4910596A (https=) * | 1972-05-29 | 1974-01-30 | ||
| JPS5134394A (https=) * | 1974-09-18 | 1976-03-24 | Hitachi Ltd | |
| JPS5743087B2 (https=) * | 1974-09-26 | 1982-09-13 | ||
| IT1054410B (it) * | 1975-11-21 | 1981-11-10 | Mitsui Petrochemical Ind | Catalizzatori per la polimerizzazione delle alfa olefine |
| US4100104A (en) * | 1977-01-13 | 1978-07-11 | National Petro Chemicals Corporation | Catalytic materials as for olefin polymerization |
-
1978
- 1978-05-03 CA CA302,516A patent/CA1094749A/en not_active Expired
- 1978-05-08 AU AU35894/78A patent/AU3589478A/en active Pending
- 1978-05-12 DE DE19782820860 patent/DE2820860A1/de not_active Ceased
- 1978-05-15 ZA ZA00782752A patent/ZA782752B/xx unknown
- 1978-05-16 GB GB19876/78A patent/GB1604708A/en not_active Expired
- 1978-05-19 PH PH21162A patent/PH13805A/en unknown
- 1978-05-19 JP JP5901178A patent/JPS53146287A/ja active Granted
- 1978-05-22 PT PT68070A patent/PT68070B/pt unknown
- 1978-05-22 DD DD78205502A patent/DD137111A5/xx unknown
- 1978-05-23 FR FR7815278A patent/FR2391773A1/fr active Granted
- 1978-05-23 ES ES470105A patent/ES470105A1/es not_active Expired
- 1978-05-23 FI FI781634A patent/FI781634A7/fi not_active Application Discontinuation
- 1978-05-24 IT IT23767/78A patent/IT1096324B/it active
- 1978-05-24 NO NO781806A patent/NO155292C/no unknown
- 1978-05-24 NL NLAANVRAGE7805620,A patent/NL186163C/xx not_active IP Right Cessation
- 1978-05-24 PL PL1978207066A patent/PL112965B1/pl unknown
- 1978-05-24 SE SE7805965A patent/SE7805965L/xx unknown
- 1978-05-24 DK DK229478A patent/DK229478A/da unknown
- 1978-05-24 GR GR56318A patent/GR65605B/el unknown
- 1978-05-24 BR BR7803329A patent/BR7803329A/pt unknown
- 1978-05-24 NZ NZ187359A patent/NZ187359A/xx unknown
- 1978-05-24 LU LU79699A patent/LU79699A1/xx unknown
- 1978-05-25 BE BE188048A patent/BE867488A/xx not_active IP Right Cessation
- 1978-05-29 MX MX787102U patent/MX6326E/es unknown
-
1979
- 1979-02-27 ES ES478118A patent/ES478118A1/es not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS ERMITTELT * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3142155A1 (de) * | 1980-10-24 | 1982-06-16 | National Petro Chemicals Corp., New York, N.Y. | Herstellung von polyolefinen mit einer verbesserten umwelt-spannungsrissbestaendigkeit (escr) |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1604708A (en) | 1981-12-16 |
| SE7805965L (sv) | 1978-11-26 |
| LU79699A1 (fr) | 1979-02-02 |
| ZA782752B (en) | 1979-05-30 |
| ES478118A1 (es) | 1979-05-16 |
| NZ187359A (en) | 1980-11-28 |
| IT1096324B (it) | 1985-08-26 |
| NO155292B (no) | 1986-12-01 |
| BR7803329A (pt) | 1979-01-02 |
| PH13805A (en) | 1980-10-01 |
| JPS646207B2 (https=) | 1989-02-02 |
| ES470105A1 (es) | 1979-10-01 |
| IT7823767A0 (it) | 1978-05-24 |
| PL112965B1 (en) | 1980-11-29 |
| NL186163C (nl) | 1990-10-01 |
| BE867488A (fr) | 1978-11-27 |
| MX6326E (es) | 1985-04-09 |
| CA1094749A (en) | 1981-01-27 |
| JPS53146287A (en) | 1978-12-20 |
| PT68070A (en) | 1978-06-01 |
| NO781806L (no) | 1978-11-28 |
| GR65605B (en) | 1980-10-14 |
| DD137111A5 (de) | 1979-08-15 |
| PL207066A1 (pl) | 1979-06-04 |
| FR2391773B1 (https=) | 1984-12-14 |
| DK229478A (da) | 1978-11-26 |
| FR2391773A1 (fr) | 1978-12-22 |
| FI781634A7 (fi) | 1978-11-26 |
| NO155292C (no) | 1987-03-11 |
| PT68070B (en) | 1979-10-26 |
| NL186163B (nl) | 1990-05-01 |
| NL7805620A (nl) | 1978-11-28 |
| AU3589478A (en) | 1979-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2502940C2 (de) | Chrom- und phoshorhaltiger Trägerkatalysator, Verfahren zu dessen Herstellung sowie dessen Verwendung zur Polymerisation von Äthylen und zu deren Copolymerisation mit α-Olefinen | |
| DE2324766C2 (de) | Verfahren zur Niederdruckpolymerisation von α-Olefinen mit 2 bis 6 Kohlenstoffatomen | |
| DE2610422C2 (https=) | ||
| DE3228065C2 (https=) | ||
| DE3028759C2 (https=) | ||
| DE3206303C2 (de) | Feste titanhaltige Katalysatorkomponenten, deren Herstellung und deren Verwendung in Kombination mit einem Aktivator als Katalysatorsystem für die Polymerisation von Äthylen und dessen Copolymerisation mit α-Olefinen mit 3 bis 8 Kohlenstoffatomen | |
| DE19615953A1 (de) | Verfahren zur Herstellung von Polymerisaten von Alk-1-enen in Gegenwart eines geträgerten Metallocenkatalysatorsystems und eines Antistatikums | |
| DE69415829T2 (de) | Katalysatorzusammensetzung für die copolymerisation von ethylen | |
| DE69807703T2 (de) | Hochaktive polyethylenkatalysatoren | |
| DE3142155C2 (de) | Verfahren zur Polymerisation von Olefinen | |
| DE3635710A1 (de) | Verfahren zum herstellen von homo- sowie copolymerisaten des ethens durch phillips-katalyse | |
| DE2654940A1 (de) | Polymerisationsverfahren | |
| DE3889001T2 (de) | Verbesserte Chromkatalysatorzusammensetzungen. | |
| US4593079A (en) | Resin rheology control process and catalyst therefor | |
| EP0585683B1 (de) | Phillips-Katalysator zur Polymerisation von alpha-Olefinen | |
| DE3918646A1 (de) | Verfahren zur herstellung eines poly-l-olefins | |
| EP0560128B1 (de) | Feststoff, enthaltend chemisch gebundene Metallalkylgruppen, und seine Verwendung | |
| DE2820860A1 (de) | Katalysatortraeger | |
| DE3003327C2 (https=) | ||
| US4192775A (en) | Olefin polymerization catalyst | |
| DE2621591C2 (de) | Verfahren zur Polymerisation von Äthylen | |
| DE2820859A1 (de) | Verfahren zur polymerisation von olefinen | |
| CA1080207A (en) | Olefin polymerization catalyst | |
| DE2314412A1 (de) | Verfahren zum polymerisieren von olefinen | |
| EP0520346A2 (de) | Phillips-Katalysator und seine Verwendung zur Herstellung von Ethylenhomopolymerisaten und -copolymerisaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C08F 4/22 |
|
| 8131 | Rejection |