DE2754086C3 - Spezifisches Bindungsverfahren zum Nachweis und zur Bestimmung eines Liganden in einem flüssigen Medium - Google Patents
Spezifisches Bindungsverfahren zum Nachweis und zur Bestimmung eines Liganden in einem flüssigen MediumInfo
- Publication number
- DE2754086C3 DE2754086C3 DE2754086A DE2754086A DE2754086C3 DE 2754086 C3 DE2754086 C3 DE 2754086C3 DE 2754086 A DE2754086 A DE 2754086A DE 2754086 A DE2754086 A DE 2754086A DE 2754086 C3 DE2754086 C3 DE 2754086C3
- Authority
- DE
- Germany
- Prior art keywords
- enzyme
- binding
- ligand
- modulator
- conjugate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003446 ligand Substances 0.000 title claims description 69
- 238000000034 method Methods 0.000 title claims description 52
- 230000009870 specific binding Effects 0.000 title claims description 50
- 239000007788 liquid Substances 0.000 title claims description 43
- 238000001514 detection method Methods 0.000 title claims description 11
- 238000009739 binding Methods 0.000 claims description 78
- 230000027455 binding Effects 0.000 claims description 63
- 102000004190 Enzymes Human genes 0.000 claims description 43
- 108090000790 Enzymes Proteins 0.000 claims description 43
- 239000000126 substance Substances 0.000 claims description 38
- 230000000694 effects Effects 0.000 claims description 36
- 238000006243 chemical reaction Methods 0.000 claims description 29
- 108040000578 enzyme regulator activity proteins Proteins 0.000 claims description 29
- 102000006966 enzyme regulator activity proteins Human genes 0.000 claims description 29
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 21
- 239000003112 inhibitor Substances 0.000 claims description 16
- BZKPWHYZMXOIDC-UHFFFAOYSA-N acetazolamide Chemical compound CC(=O)NC1=NN=C(S(N)(=O)=O)S1 BZKPWHYZMXOIDC-UHFFFAOYSA-N 0.000 claims description 15
- 229960000571 acetazolamide Drugs 0.000 claims description 14
- 239000003153 chemical reaction reagent Substances 0.000 claims description 14
- 230000002860 competitive effect Effects 0.000 claims description 7
- 238000002372 labelling Methods 0.000 claims description 6
- 239000003550 marker Substances 0.000 claims description 6
- 230000002441 reversible effect Effects 0.000 claims description 4
- XPTCECRKQRKFLH-UHFFFAOYSA-N 2,6,8-trichloro-7h-purine Chemical compound ClC1=NC(Cl)=C2NC(Cl)=NC2=N1 XPTCECRKQRKFLH-UHFFFAOYSA-N 0.000 claims description 3
- 229940124530 sulfonamide Drugs 0.000 claims description 3
- XECPAIJNBXCOBO-MMPJQOAZSA-N D-glucaro-1,4-lactone Chemical compound OC(=O)[C@@H](O)[C@H]1OC(=O)[C@H](O)[C@H]1O XECPAIJNBXCOBO-MMPJQOAZSA-N 0.000 claims description 2
- 108010092464 Urate Oxidase Proteins 0.000 claims description 2
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims description 2
- 229940088598 enzyme Drugs 0.000 claims 7
- 102000012440 Acetylcholinesterase Human genes 0.000 claims 1
- 108010022752 Acetylcholinesterase Proteins 0.000 claims 1
- 108010022394 Threonine synthase Proteins 0.000 claims 1
- 229940022698 acetylcholinesterase Drugs 0.000 claims 1
- 102000004419 dihydrofolate reductase Human genes 0.000 claims 1
- ZNEOHLHCKGUAEB-UHFFFAOYSA-N trimethylphenylammonium Chemical compound C[N+](C)(C)C1=CC=CC=C1 ZNEOHLHCKGUAEB-UHFFFAOYSA-N 0.000 claims 1
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 40
- 229960002685 biotin Drugs 0.000 description 20
- 235000020958 biotin Nutrition 0.000 description 20
- 239000011616 biotin Substances 0.000 description 20
- 230000008569 process Effects 0.000 description 17
- 108090001008 Avidin Proteins 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- -1 N-methyl-N- (p-aminophenyl) -carbamate ester Chemical class 0.000 description 10
- 230000007062 hydrolysis Effects 0.000 description 10
- 238000006460 hydrolysis reaction Methods 0.000 description 10
- 230000008859 change Effects 0.000 description 9
- 230000009137 competitive binding Effects 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 108090000371 Esterases Proteins 0.000 description 7
- 238000011534 incubation Methods 0.000 description 7
- YBADLXQNJCMBKR-UHFFFAOYSA-M (4-nitrophenyl)acetate Chemical compound [O-]C(=O)CC1=CC=C([N+]([O-])=O)C=C1 YBADLXQNJCMBKR-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000000872 buffer Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- ZKHQWZAMYRWXGA-KQYNXXCUSA-N Adenosine triphosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 241000588724 Escherichia coli Species 0.000 description 5
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 5
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- LTMRRSWNXVJMBA-UHFFFAOYSA-N 2,2-diethylpropanedioic acid Chemical compound CCC(CC)(C(O)=O)C(O)=O LTMRRSWNXVJMBA-UHFFFAOYSA-N 0.000 description 4
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 4
- ZKHQWZAMYRWXGA-UHFFFAOYSA-N Adenosine triphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O ZKHQWZAMYRWXGA-UHFFFAOYSA-N 0.000 description 4
- 108010064711 Homoserine dehydrogenase Proteins 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 239000012637 allosteric effector Substances 0.000 description 4
- 239000000427 antigen Substances 0.000 description 4
- 102000036639 antigens Human genes 0.000 description 4
- 108091007433 antigens Proteins 0.000 description 4
- 239000007853 buffer solution Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- AEOBEOJCBAYXBA-UHFFFAOYSA-N A2P5P Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1OP(O)(O)=O AEOBEOJCBAYXBA-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000004473 Threonine Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 3
- 230000002255 enzymatic effect Effects 0.000 description 3
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 3
- 229960000304 folic acid Drugs 0.000 description 3
- 239000011724 folic acid Substances 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 229940088597 hormone Drugs 0.000 description 3
- 239000005556 hormone Substances 0.000 description 3
- 230000001900 immune effect Effects 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 239000002207 metabolite Substances 0.000 description 3
- 210000003205 muscle Anatomy 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 239000002831 pharmacologic agent Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000007790 solid phase Substances 0.000 description 3
- 229960002898 threonine Drugs 0.000 description 3
- 229940088594 vitamin Drugs 0.000 description 3
- 229930003231 vitamin Natural products 0.000 description 3
- 235000013343 vitamin Nutrition 0.000 description 3
- 239000011782 vitamin Substances 0.000 description 3
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 2
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 2
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 108010055400 Aspartate kinase Proteins 0.000 description 2
- PCDQPRRSZKQHHS-XVFCMESISA-N CTP Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 PCDQPRRSZKQHHS-XVFCMESISA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 101710088194 Dehydrogenase Proteins 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- XKMLYUALXHKNFT-UUOKFMHZSA-N Guanosine-5'-triphosphate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XKMLYUALXHKNFT-UUOKFMHZSA-N 0.000 description 2
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 2
- 229930182844 L-isoleucine Natural products 0.000 description 2
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 2
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Chemical compound CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 2
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 2
- XCCTYIAWTASOJW-XVFCMESISA-N Uridine-5'-Diphosphate Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(O)=O)O[C@H]1N1C(=O)NC(=O)C=C1 XCCTYIAWTASOJW-XVFCMESISA-N 0.000 description 2
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 2
- 229960004373 acetylcholine Drugs 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000013060 biological fluid Substances 0.000 description 2
- OTBHHUPVCYLGQO-UHFFFAOYSA-N bis(3-aminopropyl)amine Chemical compound NCCCNCCCN OTBHHUPVCYLGQO-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 229940104302 cytosine Drugs 0.000 description 2
- NHVNXKFIZYSCEB-XLPZGREQSA-N dTTP Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)C1 NHVNXKFIZYSCEB-XLPZGREQSA-N 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000012636 effector Substances 0.000 description 2
- 239000002532 enzyme inhibitor Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 235000019152 folic acid Nutrition 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 2
- 229960000310 isoleucine Drugs 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 229950006238 nadide Drugs 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229940014800 succinic anhydride Drugs 0.000 description 2
- XUIIKFGFIJCVMT-UHFFFAOYSA-N thyroxine-binding globulin Natural products IC1=CC(CC([NH3+])C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-UHFFFAOYSA-N 0.000 description 2
- PROQIPRRNZUXQM-UHFFFAOYSA-N (16alpha,17betaOH)-Estra-1,3,5(10)-triene-3,16,17-triol Natural products OC1=CC=C2C3CCC(C)(C(C(O)C4)O)C4C3CCC2=C1 PROQIPRRNZUXQM-UHFFFAOYSA-N 0.000 description 1
- VTJMVZKNLJJTRH-AUZZILAKSA-N (2s,3r)-2-amino-3-hydroxybutanoic acid;(2s)-2,6-diaminohexanoic acid Chemical compound C[C@@H](O)[C@H](N)C(O)=O.NCCCC[C@H](N)C(O)=O VTJMVZKNLJJTRH-AUZZILAKSA-N 0.000 description 1
- NZNYVIUTGSSMJK-LELNYTAUSA-N (2s,3r)-2-amino-3-hydroxybutanoic acid;(2s)-2-amino-3-methylbutanoic acid Chemical compound CC(C)[C@H](N)C(O)=O.C[C@@H](O)[C@H](N)C(O)=O NZNYVIUTGSSMJK-LELNYTAUSA-N 0.000 description 1
- WKKCYLSCLQVWFD-UHFFFAOYSA-N 1,2-dihydropyrimidin-4-amine Chemical compound N=C1NCNC=C1 WKKCYLSCLQVWFD-UHFFFAOYSA-N 0.000 description 1
- KIOBNZYUIQWQNP-UHFFFAOYSA-N 2,3-dihydrothiadiazole-5-sulfonamide Chemical compound NS(=O)(=O)C1=CNNS1 KIOBNZYUIQWQNP-UHFFFAOYSA-N 0.000 description 1
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical class O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 1
- LRQKBLKVPFOOQJ-UHFFFAOYSA-N 2-aminohexanoic acid Chemical compound CCCCC(N)C(O)=O LRQKBLKVPFOOQJ-UHFFFAOYSA-N 0.000 description 1
- ZOOGRGPOEVQQDX-UUOKFMHZSA-N 3',5'-cyclic GMP Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](O)[C@@H]2N1C(N=C(NC2=O)N)=C2N=C1 ZOOGRGPOEVQQDX-UUOKFMHZSA-N 0.000 description 1
- UPJKSWLLCONYMW-UHFFFAOYSA-N 5'-Adenosine monophosphate Natural products COc1cc(O)c(C(=O)C)c(OC2OC(COC3OC(C)C(O)C(O)C3O)C(O)C(O)C2O)c1 UPJKSWLLCONYMW-UHFFFAOYSA-N 0.000 description 1
- 101710098583 ATP-dependent 6-phosphofructokinase 3 Proteins 0.000 description 1
- 101710136471 ATP-dependent 6-phosphofructokinase subunit gamma Proteins 0.000 description 1
- 108010000700 Acetolactate synthase Proteins 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 101000950981 Bacillus subtilis (strain 168) Catabolic NAD-specific glutamate dehydrogenase RocG Proteins 0.000 description 1
- 101800004538 Bradykinin Proteins 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- 108010051152 Carboxylesterase Proteins 0.000 description 1
- 102000013392 Carboxylesterase Human genes 0.000 description 1
- 102000014914 Carrier Proteins Human genes 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 102000011022 Chorionic Gonadotropin Human genes 0.000 description 1
- 108010062540 Chorionic Gonadotropin Proteins 0.000 description 1
- 241000186520 Clostridium tetanomorphum Species 0.000 description 1
- UDMBCSSLTHHNCD-UHFFFAOYSA-N Coenzym Q(11) Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1O UDMBCSSLTHHNCD-UHFFFAOYSA-N 0.000 description 1
- NBSCHQHZLSJFNQ-GASJEMHNSA-N D-Glucose 6-phosphate Chemical compound OC1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@H]1O NBSCHQHZLSJFNQ-GASJEMHNSA-N 0.000 description 1
- ODBLHEXUDAPZAU-ZAFYKAAXSA-N D-threo-isocitric acid Chemical compound OC(=O)[C@H](O)[C@@H](C(O)=O)CC(O)=O ODBLHEXUDAPZAU-ZAFYKAAXSA-N 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- GUBGYTABKSRVRQ-WFVLMXAXSA-N DEAE-cellulose Chemical compound OC1C(O)C(O)C(CO)O[C@H]1O[C@@H]1C(CO)OC(O)C(O)C1O GUBGYTABKSRVRQ-WFVLMXAXSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- WDJUZGPOPHTGOT-OAXVISGBSA-N Digitoxin Natural products O([C@H]1[C@@H](C)O[C@@H](O[C@@H]2C[C@@H]3[C@@](C)([C@@H]4[C@H]([C@]5(O)[C@@](C)([C@H](C6=CC(=O)OC6)CC5)CC4)CC3)CC2)C[C@H]1O)[C@H]1O[C@@H](C)[C@H](O[C@H]2O[C@@H](C)[C@@H](O)[C@@H](O)C2)[C@@H](O)C1 WDJUZGPOPHTGOT-OAXVISGBSA-N 0.000 description 1
- LTMHDMANZUZIPE-AMTYYWEZSA-N Digoxin Natural products O([C@H]1[C@H](C)O[C@H](O[C@@H]2C[C@@H]3[C@@](C)([C@@H]4[C@H]([C@]5(O)[C@](C)([C@H](O)C4)[C@H](C4=CC(=O)OC4)CC5)CC3)CC2)C[C@@H]1O)[C@H]1O[C@H](C)[C@@H](O[C@H]2O[C@@H](C)[C@H](O)[C@@H](O)C2)[C@@H](O)C1 LTMHDMANZUZIPE-AMTYYWEZSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 241000283074 Equus asinus Species 0.000 description 1
- 241001646716 Escherichia coli K-12 Species 0.000 description 1
- 102000008857 Ferritin Human genes 0.000 description 1
- 108050000784 Ferritin Proteins 0.000 description 1
- 238000008416 Ferritin Methods 0.000 description 1
- 241000982822 Ficus obtusifolia Species 0.000 description 1
- 108010017464 Fructose-Bisphosphatase Proteins 0.000 description 1
- 102000027487 Fructose-Bisphosphatase Human genes 0.000 description 1
- VFRROHXSMXFLSN-UHFFFAOYSA-N Glc6P Natural products OP(=O)(O)OCC(O)C(O)C(O)C(O)C=O VFRROHXSMXFLSN-UHFFFAOYSA-N 0.000 description 1
- 102000016901 Glutamate dehydrogenase Human genes 0.000 description 1
- 108010001483 Glycogen Synthase Proteins 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 1
- 102000004867 Hydro-Lyases Human genes 0.000 description 1
- 108090001042 Hydro-Lyases Proteins 0.000 description 1
- 108090000604 Hydrolases Proteins 0.000 description 1
- 102000004157 Hydrolases Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- ODBLHEXUDAPZAU-FONMRSAGSA-N Isocitric acid Natural products OC(=O)[C@@H](O)[C@H](C(O)=O)CC(O)=O ODBLHEXUDAPZAU-FONMRSAGSA-N 0.000 description 1
- 102100035792 Kininogen-1 Human genes 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- XUIIKFGFIJCVMT-LBPRGKRZSA-N L-thyroxine Chemical compound IC1=CC(C[C@H]([NH3+])C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-LBPRGKRZSA-N 0.000 description 1
- 235000019687 Lamb Nutrition 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical group CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 241000221961 Neurospora crassa Species 0.000 description 1
- JZTPOMIFAFKKSK-UHFFFAOYSA-N O-phosphonohydroxylamine Chemical compound NOP(O)(O)=O JZTPOMIFAFKKSK-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 108090000854 Oxidoreductases Proteins 0.000 description 1
- 102000004316 Oxidoreductases Human genes 0.000 description 1
- 108010065081 Phosphorylase b Proteins 0.000 description 1
- 244000281247 Ribes rubrum Species 0.000 description 1
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 description 1
- 101000642986 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) L-threonine dehydratase Proteins 0.000 description 1
- 229920005654 Sephadex Polymers 0.000 description 1
- 239000012507 Sephadex™ Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 102000006601 Thymidine Kinase Human genes 0.000 description 1
- 108020004440 Thymidine kinase Proteins 0.000 description 1
- AUYYCJSJGJYCDS-LBPRGKRZSA-N Thyrolar Chemical compound IC1=CC(C[C@H](N)C(O)=O)=CC(I)=C1OC1=CC=C(O)C(I)=C1 AUYYCJSJGJYCDS-LBPRGKRZSA-N 0.000 description 1
- 102000002248 Thyroxine-Binding Globulin Human genes 0.000 description 1
- 108010000259 Thyroxine-Binding Globulin Proteins 0.000 description 1
- 102000003929 Transaminases Human genes 0.000 description 1
- 108090000340 Transaminases Proteins 0.000 description 1
- 102000011409 Transcobalamins Human genes 0.000 description 1
- 108010023603 Transcobalamins Proteins 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 101710091363 UDP-N-acetylglucosamine 2-epimerase Proteins 0.000 description 1
- 229930003427 Vitamin E Natural products 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229960005305 adenosine Drugs 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 239000013566 allergen Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940113721 aminocaproate Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229940125717 barbiturate Drugs 0.000 description 1
- 235000021336 beef liver Nutrition 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 108091008324 binding proteins Proteins 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 230000001851 biosynthetic effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 229940015047 chorionic gonadotropin Drugs 0.000 description 1
- 239000005515 coenzyme Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- FTDHDKPUHBLBTL-SHYZEUOFSA-K dCDP(3-) Chemical compound O=C1N=C(N)C=CN1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)C1 FTDHDKPUHBLBTL-SHYZEUOFSA-K 0.000 description 1
- RGWHQCVHVJXOKC-SHYZEUOFSA-J dCTP(4-) Chemical compound O=C1N=C(N)C=CN1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)C1 RGWHQCVHVJXOKC-SHYZEUOFSA-J 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- WDJUZGPOPHTGOT-XUDUSOBPSA-N digitoxin Chemical compound C1[C@H](O)[C@H](O)[C@@H](C)O[C@H]1O[C@@H]1[C@@H](C)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@@H]3C[C@@H]4[C@]([C@@H]5[C@H]([C@]6(CC[C@@H]([C@@]6(C)CC5)C=5COC(=O)C=5)O)CC4)(C)CC3)C[C@@H]2O)C)C[C@@H]1O WDJUZGPOPHTGOT-XUDUSOBPSA-N 0.000 description 1
- 229960000648 digitoxin Drugs 0.000 description 1
- LTMHDMANZUZIPE-PUGKRICDSA-N digoxin Chemical compound C1[C@H](O)[C@H](O)[C@@H](C)O[C@H]1O[C@@H]1[C@@H](C)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@@H]3C[C@@H]4[C@]([C@@H]5[C@H]([C@]6(CC[C@@H]([C@@]6(C)[C@H](O)C5)C=5COC(=O)C=5)O)CC4)(C)CC3)C[C@@H]2O)C)C[C@@H]1O LTMHDMANZUZIPE-PUGKRICDSA-N 0.000 description 1
- 229960005156 digoxin Drugs 0.000 description 1
- LTMHDMANZUZIPE-UHFFFAOYSA-N digoxine Natural products C1C(O)C(O)C(C)OC1OC1C(C)OC(OC2C(OC(OC3CC4C(C5C(C6(CCC(C6(C)C(O)C5)C=5COC(=O)C=5)O)CC4)(C)CC3)CC2O)C)CC1O LTMHDMANZUZIPE-UHFFFAOYSA-N 0.000 description 1
- 239000001177 diphosphate Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000007071 enzymatic hydrolysis Effects 0.000 description 1
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- PROQIPRRNZUXQM-ZXXIGWHRSA-N estriol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H]([C@H](O)C4)O)[C@@H]4[C@@H]3CCC2=C1 PROQIPRRNZUXQM-ZXXIGWHRSA-N 0.000 description 1
- 229960001348 estriol Drugs 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 1
- 208000006454 hepatitis Diseases 0.000 description 1
- 231100000283 hepatitis Toxicity 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229940125396 insulin Drugs 0.000 description 1
- 229940029329 intrinsic factor Drugs 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 235000018977 lysine Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- FFEARJCKVFRZRR-UHFFFAOYSA-N methionine Chemical compound CSCCC(N)C(O)=O FFEARJCKVFRZRR-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 210000001589 microsome Anatomy 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000036963 noncompetitive effect Effects 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 239000000941 radioactive substance Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- ODBLHEXUDAPZAU-UHFFFAOYSA-N threo-D-isocitric acid Natural products OC(=O)C(O)C(C(O)=O)CC(O)=O ODBLHEXUDAPZAU-UHFFFAOYSA-N 0.000 description 1
- 229940034208 thyroxine Drugs 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 229940035722 triiodothyronine Drugs 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 1
- 241001515965 unidentified phage Species 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 229960004295 valine Drugs 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N33/00—Investigating or analysing materials by specific methods not covered by groups G01N1/00 - G01N31/00
- G01N33/48—Biological material, e.g. blood, urine; Haemocytometers
- G01N33/50—Chemical analysis of biological material, e.g. blood, urine; Testing involving biospecific ligand binding methods; Immunological testing
- G01N33/53—Immunoassay; Biospecific binding assay; Materials therefor
- G01N33/536—Immunoassay; Biospecific binding assay; Materials therefor with immune complex formed in liquid phase
- G01N33/542—Immunoassay; Biospecific binding assay; Materials therefor with immune complex formed in liquid phase with steric inhibition or signal modification, e.g. fluorescent quenching
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N2470/00—Immunochemical assays or immunoassays characterised by the reaction format or reaction type
- G01N2470/04—Sandwich assay format
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S436/00—Chemistry: analytical and immunological testing
- Y10S436/815—Test for named compound or class of compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S436/00—Chemistry: analytical and immunological testing
- Y10S436/815—Test for named compound or class of compounds
- Y10S436/817—Steroids or hormones
Landscapes
- Health & Medical Sciences (AREA)
- Immunology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Molecular Biology (AREA)
- Biomedical Technology (AREA)
- Chemical & Material Sciences (AREA)
- Hematology (AREA)
- Urology & Nephrology (AREA)
- Biotechnology (AREA)
- Biochemistry (AREA)
- Cell Biology (AREA)
- Food Science & Technology (AREA)
- Medicinal Chemistry (AREA)
- Physics & Mathematics (AREA)
- Analytical Chemistry (AREA)
- Microbiology (AREA)
- General Health & Medical Sciences (AREA)
- General Physics & Mathematics (AREA)
- Pathology (AREA)
- Measuring Or Testing Involving Enzymes Or Micro-Organisms (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/748,005 US4134792A (en) | 1976-12-06 | 1976-12-06 | Specific binding assay with an enzyme modulator as a labeling substance |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2754086A1 DE2754086A1 (de) | 1978-06-22 |
| DE2754086B2 DE2754086B2 (de) | 1979-02-15 |
| DE2754086C3 true DE2754086C3 (de) | 1979-10-18 |
Family
ID=25007583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2754086A Expired DE2754086C3 (de) | 1976-12-06 | 1977-12-05 | Spezifisches Bindungsverfahren zum Nachweis und zur Bestimmung eines Liganden in einem flüssigen Medium |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4134792A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS53105291A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1079632A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2754086C3 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2373063A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1575425A (cg-RX-API-DMAC10.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4273866A (en) | 1979-02-05 | 1981-06-16 | Abbott Laboratories | Ligand analog-irreversible enzyme inhibitor conjugates and methods for use |
| US4341865A (en) | 1980-07-21 | 1982-07-27 | Abbott Laboratories | Determination of thyroxine binding globulin |
Families Citing this family (139)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL51668A (en) * | 1977-03-16 | 1981-12-31 | Israel State | Analytical method for the quantitative determination of immunogens and antibodies and a kit therefor |
| USRE34394E (en) * | 1978-01-23 | 1993-09-28 | Baxter Diagnostics Inc. | Method and composition for double receptor, specific binding assays |
| US4279992A (en) * | 1978-03-13 | 1981-07-21 | Miles Laboratories, Inc. | Specific binding assay employing an enzyme-cleavable substrate as label |
| US4275149A (en) * | 1978-11-24 | 1981-06-23 | Syva Company | Macromolecular environment control in specific receptor assays |
| AU531777B2 (en) * | 1978-04-05 | 1983-09-08 | Syva Co. | Label/solid conjugate immunoassay system |
| FR2422956A1 (fr) * | 1978-04-13 | 1979-11-09 | Pasteur Institut | Procede de detection et de caracterisation d'un acide nucleique ou d'une sequence de celui-ci, et reactif enzymatique pour la mise en oeuvre de ce procede |
| US5605800A (en) * | 1978-04-13 | 1997-02-25 | Institut Pasteur | Method of detecting and characterizing a nucleic acid or a sequence of the latter, and enzymatic reactant for the application of this method |
| JPS5510590A (en) * | 1978-05-04 | 1980-01-25 | Wellcome Found | Enzyme immunity quantity analysis |
| US4376165A (en) * | 1978-06-22 | 1983-03-08 | Miles Laboratories, Inc. | Method of preparing an enzyme-labeled ligand for use in specific binding assays and the labeled conjugate produced thereby |
| US4238565A (en) * | 1978-06-22 | 1980-12-09 | Miles Laboratories, Inc. | Specific binding assay with a prosthetic group as a label component |
| US4600690A (en) * | 1978-08-07 | 1986-07-15 | Albert Einstein College Of Medicine Of Yeshiva University, A Division Of Yeshiva University | Immunoassay |
| US4430263A (en) | 1978-09-18 | 1984-02-07 | Abbott Laboratories | Hapten-inhibitor immunoassay |
| US4228237A (en) * | 1978-09-21 | 1980-10-14 | Calbiochem-Behring Corp. | Methods for the detection and determination of ligands |
| US4307190A (en) * | 1978-10-30 | 1981-12-22 | Technicon Instruments Corporation | Immunoassay using ascitic fluid |
| FR2440555A1 (fr) * | 1978-10-31 | 1980-05-30 | Maes Roland | Perfectionnements aux procedes de determination de substances montrant entre elles des affinites de liaison specifiques, par des tests faisant intervenir une phase solide |
| US4374925A (en) * | 1978-11-24 | 1983-02-22 | Syva Company | Macromolecular environment control in specific receptor assays |
| US4318707A (en) * | 1978-11-24 | 1982-03-09 | Syva Company | Macromolecular fluorescent quencher particle in specific receptor assays |
| US4256834A (en) * | 1979-04-09 | 1981-03-17 | Syva Company | Fluorescent scavenger particle immunoassay |
| US4340668A (en) * | 1979-06-04 | 1982-07-20 | Miles Laboratories, Inc. | Heme-labeled specific binding assay |
| US4318982A (en) * | 1979-06-04 | 1982-03-09 | Miles Laboratories, Inc. | FMN-Labeled specific binding assay |
| US4318983A (en) * | 1979-06-04 | 1982-03-09 | Miles Laboratories, Inc. | Fad-labeled specific binding assay monitored with apoglutathione reductase or apolipoamide dehydrogenase |
| GB2059421A (en) * | 1979-10-03 | 1981-04-23 | Self C H | Assay method and reagents therefor |
| US4446231A (en) * | 1979-10-03 | 1984-05-01 | Self Colin H | Immunoassay using an amplified cyclic detection system |
| USRE31712E (en) * | 1980-01-24 | 1984-10-23 | Biochemical avidin-biotin multiple-layer system | |
| US4478914B1 (en) * | 1980-01-24 | 1997-06-17 | Roger W Giese | Process for applying multiple layers of a protein and a ligand extender to a surface and to the multiple layer system |
| US4282287A (en) * | 1980-01-24 | 1981-08-04 | Giese Roger W | Biochemical avidin-biotin multiple-layer system |
| DE3006709A1 (de) * | 1980-02-22 | 1981-08-27 | Hans A. Dipl.-Chem. Dr. 8000 München Thoma | Homogenes verfahren zur kompetitiven bestimmung von liganden |
| US4318981A (en) * | 1980-04-24 | 1982-03-09 | Miles Laboratories, Inc. | Homogeneous specific binding assay employing an intramolecularly modulated photogenic enzyme substrate label |
| FR2486657A1 (fr) * | 1980-07-09 | 1982-01-15 | Pasteur Institut | Procede de detection et de dosage d'une substance biologique par erythroadsorption |
| US4849353A (en) * | 1980-09-30 | 1989-07-18 | Cornell Research Foundation, Inc. | Immunocapture of enzyme inhibitor, enzyme complexes and uses thereof |
| US4323647A (en) * | 1980-10-15 | 1982-04-06 | University Of Miami | Steric hindrance enzyme immunoassay |
| US4404278A (en) * | 1980-11-24 | 1983-09-13 | Syva Company | Methods and compositions for assaying for the production of 1,4-dihydropyridyl |
| DE3100062A1 (de) * | 1981-01-02 | 1982-08-05 | Hans A. Dipl.-Chem. Dr. 8000 München Thoma | Homogenes verfahren zur bestimmung von liganden |
| DE3100061A1 (de) * | 1981-01-02 | 1982-08-05 | Hans A. Dipl.-Chem. Dr. 8000 München Thoma | Verfahren zur bestimmung von liganden mittels kompetitionsreaktion |
| US4378428A (en) * | 1981-03-30 | 1983-03-29 | Baker Instruments Corporation | Method for carrying out non-isotopic immunoassays, labeled analytes and kits for use in such assays |
| US4785080A (en) * | 1981-03-30 | 1988-11-15 | Baker Instruments Corporation | Labeled analytes |
| US4711955A (en) * | 1981-04-17 | 1987-12-08 | Yale University | Modified nucleotides and methods of preparing and using same |
| EP0070366B1 (de) * | 1981-07-16 | 1985-08-28 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Verfahren zum Nachweisen von okkultem Humanblut in Humanstuhlproben |
| US4433051A (en) * | 1981-10-14 | 1984-02-21 | Yeda Research And Development Co., Ltd. | Derivatives of α-difluoromethylornithine useful in analysis |
| DE3269008D1 (en) * | 1981-11-02 | 1986-03-20 | James Walter Ryan | Method for assaying proteases with tagged proteinaceous inhibitors |
| EP0079489A1 (en) * | 1981-11-04 | 1983-05-25 | Miles Laboratories, Inc. | Methotrexate-labeled iodothyronine conjugates and method, reagent means and test device for the determination of iodothyronine in or iodothyronine uptake of a liquid sample |
| JPS58122459A (ja) * | 1982-01-14 | 1983-07-21 | Yatoron:Kk | 酵素の会合を利用した測定方法 |
| US4506009A (en) * | 1982-03-30 | 1985-03-19 | University Of California | Heterogeneous immunoassay method |
| JPS58209994A (ja) * | 1982-05-10 | 1983-12-07 | Fujirebio Inc | 活性蛋白等固定化物を用いた抗原の測定方法 |
| US4472301A (en) * | 1982-05-27 | 1984-09-18 | Miles Laboratories, Inc. | Propranolol immunogen and antibodies |
| AU574646B2 (en) * | 1982-07-19 | 1988-07-14 | Cooperbiomedical Inc. | Enzyme assay method |
| US4530900A (en) * | 1982-09-13 | 1985-07-23 | Seragen Diagnostics Inc. | Soluble insoluble polymers in enzymeimmunoassay |
| US4994373A (en) | 1983-01-27 | 1991-02-19 | Enzo Biochem, Inc. | Method and structures employing chemically-labelled polynucleotide probes |
| AU559576B2 (en) * | 1983-01-31 | 1987-03-12 | Boots-Celltech Diagnostics Limited | Immunoassay |
| GB2135773B (en) * | 1983-01-31 | 1985-12-04 | Boots Celltech Diagnostics | Enzyme inhibitor labelled immunoassay |
| DE3483620D1 (de) * | 1983-03-11 | 1991-01-03 | Fujirebio Kk | Verfahren zur bestimmung von liganden. |
| US4650751A (en) * | 1983-04-29 | 1987-03-17 | Technicon Instruments Corporation | Protected binding assay avoiding non-specific protein interference |
| US4550075A (en) * | 1983-06-22 | 1985-10-29 | Kallestad Laboratories, Inc. | Method for ligand determination utilizing an immunoassay monitorable by biotin-containing enzymes, and compositions therefor |
| JPS607362A (ja) * | 1983-06-27 | 1985-01-16 | Fujirebio Inc | 酵素を用いた抗原決定基具有物質の測定法 |
| US4629694A (en) * | 1983-07-12 | 1986-12-16 | Cornell Research Foundation, Inc. | Detecting and distinguishing between plasminogen activators |
| US4713324A (en) * | 1983-09-01 | 1987-12-15 | Technicon Instruments Corporation | Inverted latency specific binding assay |
| GB8334499D0 (en) * | 1983-12-24 | 1984-02-01 | Beecham Group Plc | Derivatives |
| GB8400653D0 (en) * | 1984-01-11 | 1984-02-15 | Beecham Group Plc | Conjugates |
| US4708929A (en) * | 1984-10-29 | 1987-11-24 | Microgenics Corporation | Methods for protein binding enzyme complementation assays |
| US4727022A (en) * | 1984-03-14 | 1988-02-23 | Syntex (U.S.A.) Inc. | Methods for modulating ligand-receptor interactions and their application |
| DE3417638A1 (de) * | 1984-05-10 | 1985-11-14 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verfahren zur bestimmung geringer stoffmengen von arzneimitteln, von koerpereigenen oder anderen chemischen substanzen in biologischem material |
| US4737453A (en) * | 1984-12-12 | 1988-04-12 | Immunomedics, Inc. | Sandwich immunoassay utilizing a separation specific binding substance |
| US4780405A (en) * | 1985-06-25 | 1988-10-25 | Siska Diagnostics, Inc. | Carbonic anhydrase inhibitor-tagged nucleic acid probes |
| US4833251A (en) * | 1985-06-25 | 1989-05-23 | Siska Diagnostics, Inc. | Compounds for tagging nucleic acid probes |
| AU7234387A (en) * | 1986-03-24 | 1987-10-20 | Ortho Pharmaceutical Corporation | Synthetic htlv-iii peptides, compositions and uses thereof |
| AU7238087A (en) * | 1986-03-26 | 1987-10-20 | Murex Corp. | Anti-enzyme antibody immunoassay |
| US4883751A (en) * | 1986-05-28 | 1989-11-28 | New York University | Specific immunoassay for heparin |
| WO1987007957A1 (en) * | 1986-06-20 | 1987-12-30 | The Regents Of The University Of California | Low-level detection of human immunodeficiency virus |
| US4935343A (en) * | 1986-08-08 | 1990-06-19 | Syntex (U.S.A.) Inc. | Monoclonal antibodies for interleukin-1β |
| US4960691A (en) * | 1986-09-29 | 1990-10-02 | Abbott Laboratories | Chromatographic test strip for determining ligands or receptors |
| US4906567A (en) * | 1987-01-21 | 1990-03-06 | E. I. Dupont De Nemours And Company | Non-immunochemical binding of lipopolysaccharides and sandwich assays therefor |
| US5003054A (en) * | 1987-04-07 | 1991-03-26 | Abbott Laboratories | Ouabain triacetate derivative compounds |
| US4788136A (en) * | 1987-04-07 | 1988-11-29 | Abbott Laboratories | Diagnostic immunoassay by solid phase separation for digoxin |
| US5474899A (en) * | 1987-05-13 | 1995-12-12 | Cistron Biotechnology, Inc. | Selective immunoassay for IL-1 β |
| IL85596A (en) * | 1987-05-18 | 1992-06-21 | Technicon Instr | Method for a specific binding enzyme immunoassay |
| US5384241A (en) * | 1987-09-11 | 1995-01-24 | Enzo Diagnostics, Inc. | Specific binding assay compound with inhibitive self-quenching characteristics |
| US5132209A (en) * | 1987-09-14 | 1992-07-21 | Vanderbeeken Yves E | Process for testing for maternal-fetal immunoincompatibility in pregnant women |
| EP0310361A3 (en) * | 1987-09-30 | 1989-05-24 | Beckman Instruments, Inc. | Tridentate conjugate and method of use thereof |
| US5196351A (en) * | 1987-09-30 | 1993-03-23 | Beckman Instruments, Inc. | Bidentate conjugate and method of use thereof |
| US5534620A (en) * | 1987-09-30 | 1996-07-09 | Beckman Instruments, Inc. | Method of heterogenous purification using a bidentate conjugate |
| US4962024A (en) * | 1988-08-11 | 1990-10-09 | Becton, Dickinson And Company | Signal enhancement in assay for an enzyme |
| CA1335707C (en) * | 1989-08-15 | 1995-05-30 | Pyare Khanna | Drug screening assay |
| US5376556A (en) * | 1989-10-27 | 1994-12-27 | Abbott Laboratories | Surface-enhanced Raman spectroscopy immunoassay |
| US5792606A (en) * | 1990-02-26 | 1998-08-11 | Boehringer Mannheim Gmbh | Nucleic acid hybridization based assay for determining a substance of interest |
| EP0553113B1 (en) * | 1990-08-02 | 1998-11-25 | Antex Biologics, Inc. | Adhesion receptors for pathogenic or opportunistic microorganisms |
| US5972625A (en) * | 1991-05-06 | 1999-10-26 | The Regents Of The University Of California | Assays for inhibitors of leukocyte adhesion |
| US5877028A (en) * | 1991-05-29 | 1999-03-02 | Smithkline Diagnostics, Inc. | Immunochromatographic assay device |
| US6168956B1 (en) | 1991-05-29 | 2001-01-02 | Beckman Coulter, Inc. | Multiple component chromatographic assay device |
| US5998220A (en) * | 1991-05-29 | 1999-12-07 | Beckman Coulter, Inc. | Opposable-element assay devices, kits, and methods employing them |
| US6100099A (en) | 1994-09-06 | 2000-08-08 | Abbott Laboratories | Test strip having a diagonal array of capture spots |
| US5618675A (en) * | 1992-07-16 | 1997-04-08 | Panorama Research, Inc. | Methods and compositions for detecting lipopolysaccharides using CAP18 fragments |
| US6103888A (en) * | 1992-07-17 | 2000-08-15 | Panorama Research, Inc. | Mammalian cationic proteins having lipopolysaccharide binding and anti-coagulant activity |
| US5798219A (en) * | 1993-11-23 | 1998-08-25 | The United States Of America As Represented By The Secretary Of Agriculture | Serological identification of cattle, sheep or goats infected with anaplasma species |
| WO1995018375A1 (en) * | 1993-12-28 | 1995-07-06 | Ss Pharmaceutical Co., Ltd. | Method of detecting blood constituent and kit therefor |
| US6110689A (en) * | 1994-01-21 | 2000-08-29 | Osteometer A/S | Method of assaying collagen fragments in body fluids, a test kit and means for carrying out the method and use of the method to diagnose the presence of disorders associated with the metabolism of collagen |
| US5747352A (en) * | 1994-05-23 | 1998-05-05 | Beckman Instruments, Inc. | Reagents and methods for the rapid and quantitative assay of pharmacological agents |
| US5962340A (en) * | 1994-11-02 | 1999-10-05 | Wako Pure Chemical Industries Ltd. | Homogeneous immunoassay method utilizing 5-300 mM magnesium |
| US5712103A (en) * | 1995-02-13 | 1998-01-27 | Regents Of The University Of California | Diagnostic assay for the prediction of preeclampsia |
| AU751938B2 (en) * | 1998-05-15 | 2002-08-29 | Sekisui Chemical Co., Ltd. | Immunoassay reagents and immunoassay method |
| US7297554B2 (en) * | 1998-11-18 | 2007-11-20 | Microdiagnostics, Inc. | Immunoassay system |
| JP3649319B2 (ja) * | 1999-01-25 | 2005-05-18 | 東洋紡績株式会社 | レセプター結合能の測定方法および測定用試薬 |
| US6811998B2 (en) * | 1999-06-25 | 2004-11-02 | Roche Diagnostics Operations, Inc. | Conjugates of uncompetitive inhibitors of inosine monophosphate dehydrogenase |
| US6524808B1 (en) * | 1999-06-25 | 2003-02-25 | Roche Diagnostics Corporation | Enzyme inhibition immunoassay |
| US20030228288A1 (en) | 1999-10-15 | 2003-12-11 | Scarborough Nelson L. | Volume maintaining osteoinductive/osteoconductive compositions |
| US6596490B2 (en) | 2000-07-14 | 2003-07-22 | Applied Gene Technologies, Inc. | Nucleic acid hairpin probes and uses thereof |
| US6380377B1 (en) | 2000-07-14 | 2002-04-30 | Applied Gene Technologies, Inc. | Nucleic acid hairpin probes and uses thereof |
| US9387094B2 (en) * | 2000-07-19 | 2016-07-12 | Warsaw Orthopedic, Inc. | Osteoimplant and method of making same |
| DE60140929D1 (de) * | 2000-11-14 | 2010-02-11 | Roche Diagnostics Gmbh | Immunoassay für HIV-Protease-Hemstoffe |
| US7323193B2 (en) * | 2001-12-14 | 2008-01-29 | Osteotech, Inc. | Method of making demineralized bone particles |
| US20020142361A1 (en) * | 2001-03-27 | 2002-10-03 | Emmert-Buck Michael R. | Biodetection method |
| AU2002305337A1 (en) * | 2001-05-03 | 2002-11-18 | Genometrix Genomics, Inc. | Method and apparatus to determine the performance of protein arrays |
| US6800608B2 (en) | 2001-06-22 | 2004-10-05 | Beckman Coulter, Inc. | Homogeneous assay of vancomycin using a stable particle-vancomycin conjugate, a novel rate enhancer, and a novel dose response modulator |
| US8118991B2 (en) * | 2001-09-04 | 2012-02-21 | Stephen Eliot Zweig | Apoenzyme reactivation electrochemical detection method and assay |
| US7166208B2 (en) * | 2004-03-03 | 2007-01-23 | Stephen Eliot Zweig | Apoenzyme reactivation electrochemical detection method and assay |
| US6900237B2 (en) * | 2001-09-14 | 2005-05-31 | Axys Pharmaceuticals, Inc. | Sulfonamide compounds as protease inhibitors |
| WO2003030956A2 (en) * | 2001-10-12 | 2003-04-17 | Osteotech, Inc. | Improved bone graft |
| US20030219755A1 (en) * | 2002-05-24 | 2003-11-27 | Nanibhushan Dattagupta | Compositions and methods for performing hybridization assays using target enhanced signal amplification (TESA) |
| US20040009574A1 (en) * | 2002-07-09 | 2004-01-15 | Nanibhushan Dattagupta | Compositions and methods for detecting streptococcus agalactiae capsular polysaccharide synthesis genes |
| US20040009482A1 (en) * | 2002-07-09 | 2004-01-15 | Nanibhushan Dattagupta | Compositions and methods for detecting streptococcus agalactiae surface immunogenic protein genes |
| US20060073475A1 (en) * | 2002-08-09 | 2006-04-06 | Nanibhushan Dattagupta | Compositions and methods for detecting pathogenic bacteria expressing chaperonin proteins |
| CA2503228A1 (en) * | 2002-10-21 | 2004-05-06 | Discoverx, Inc. | Ip3 protein binding assay |
| JP2006524988A (ja) * | 2003-05-09 | 2006-11-09 | キャピタルバイオ コーポレーション | Sarsウイルスを検出するための方法および組成物 |
| NZ544050A (en) * | 2003-06-11 | 2009-03-31 | Osteotech Inc | Osteoimplants and methods for their manufacture |
| CN100494399C (zh) * | 2003-06-30 | 2009-06-03 | 清华大学 | 一种基于dna芯片的基因分型方法及其应用 |
| CN1580283A (zh) * | 2003-08-13 | 2005-02-16 | 清华大学 | 一种检测核酸分子的方法 |
| US7341837B2 (en) * | 2003-09-02 | 2008-03-11 | Lawton Robert L | Soluble analyte detection and amplification |
| WO2005047305A2 (en) * | 2003-11-06 | 2005-05-26 | Discoverx, Inc. | Cellular membrane protein assay |
| US7608415B2 (en) * | 2004-06-30 | 2009-10-27 | Discoverx Corporation | Analysis of intracellular modifications |
| WO2006009505A1 (en) * | 2004-07-16 | 2006-01-26 | Gyros Patent Ab | Grading of immune responses |
| US20060166236A1 (en) * | 2004-12-15 | 2006-07-27 | Chong-Sheng Yuan | Allosteric enzyme coupled immunoassay (AECIA) |
| CN101141934B (zh) * | 2005-01-14 | 2010-11-24 | 骨骼技术股份有限公司 | 可膨胀的骨植入物 |
| WO2007056671A1 (en) * | 2005-11-02 | 2007-05-18 | Osteotech, Inc. | Hemostatic bone graft |
| US20080026394A1 (en) * | 2006-07-11 | 2008-01-31 | Antara Biosciences Inc. | Methods of detecting one or more cancer markers |
| JP2012506733A (ja) * | 2008-10-24 | 2012-03-22 | ウォーソー・オーソペディック・インコーポレーテッド | 骨形成を促進するための組成物および方法 |
| US12195550B2 (en) | 2012-03-30 | 2025-01-14 | The United States Of America As Represented By The Department Of Veterans Affairs | Targeting intracellular target-binding determinants with intracellular antibodies |
| US9283272B2 (en) | 2012-03-30 | 2016-03-15 | The United States Of America As Represented By The Department Of Veterans Affairs | Targeting intracellular target-binding determinants with intracellular antibodies |
| CA2872978A1 (en) * | 2012-05-08 | 2013-11-14 | Cellixbio Private Limited | Compositions and methods for suppression of carbonic anhydrase activity |
| CN102721802B (zh) * | 2012-07-06 | 2014-11-26 | 深圳市易瑞生物技术有限公司 | 一种提高竞争免疫分析灵敏性的方法 |
| US20150346223A1 (en) * | 2013-01-09 | 2015-12-03 | Vantix Holdings Limited | Ft4 electrochemical assay detection system |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4003792A (en) * | 1967-07-01 | 1977-01-18 | Miles Laboratories, Inc. | Conjugates of acid polysaccharides and complex organic substances |
| NL154598B (nl) * | 1970-11-10 | 1977-09-15 | Organon Nv | Werkwijze voor het aantonen en bepalen van laagmoleculire verbindingen en van eiwitten die deze verbindingen specifiek kunnen binden, alsmede testverpakking. |
| US3817837A (en) * | 1971-05-14 | 1974-06-18 | Syva Corp | Enzyme amplification assay |
| US3880934A (en) * | 1972-02-10 | 1975-04-29 | Syntex Inc | Nitrophenyloxy-butanediols |
| US3975342A (en) * | 1972-05-15 | 1976-08-17 | Biological Developments, Inc. | Tyrosyl-class antigenic conjugates, their preparation and antibodies raised thereto |
| US3966556A (en) * | 1972-11-06 | 1976-06-29 | Syva Company | Compounds for enzyme amplification assay methadone analogs |
-
1976
- 1976-12-06 US US05/748,005 patent/US4134792A/en not_active Expired - Lifetime
-
1977
- 1977-10-13 CA CA288,598A patent/CA1079632A/en not_active Expired
- 1977-11-03 GB GB45843/77A patent/GB1575425A/en not_active Expired
- 1977-12-05 DE DE2754086A patent/DE2754086C3/de not_active Expired
- 1977-12-05 FR FR7736528A patent/FR2373063A1/fr active Granted
- 1977-12-05 JP JP14521577A patent/JPS53105291A/ja active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4273866A (en) | 1979-02-05 | 1981-06-16 | Abbott Laboratories | Ligand analog-irreversible enzyme inhibitor conjugates and methods for use |
| US4341865A (en) | 1980-07-21 | 1982-07-27 | Abbott Laboratories | Determination of thyroxine binding globulin |
Also Published As
| Publication number | Publication date |
|---|---|
| US4134792A (en) | 1979-01-16 |
| GB1575425A (en) | 1980-09-24 |
| JPS6240662B2 (cg-RX-API-DMAC10.html) | 1987-08-29 |
| JPS53105291A (en) | 1978-09-13 |
| DE2754086A1 (de) | 1978-06-22 |
| CA1079632A (en) | 1980-06-17 |
| FR2373063A1 (fr) | 1978-06-30 |
| DE2754086B2 (de) | 1979-02-15 |
| FR2373063B1 (cg-RX-API-DMAC10.html) | 1980-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2754086C3 (de) | Spezifisches Bindungsverfahren zum Nachweis und zur Bestimmung eines Liganden in einem flüssigen Medium | |
| DE2618511C3 (de) | Verfahren zur Bestimmung eines Liganden in einem flüssigen Medium und Mittel zu dessen Durchführung | |
| DE69332891T2 (de) | Testverfahren für Homocysteine | |
| DE69423601T2 (de) | Elektrochemische Bestimmungsmethode und neue p-Phenylendiamin-Verbindung | |
| DE3003959C2 (de) | Konjugate aus Ligandenanalogem und irreversiblem Enzyminhibitor und deren Verwendung zur Bestimmung von Liganden | |
| DE2323467A1 (de) | Verfahren zum nachweis und zur bestimmung von haptenen | |
| EP0429611B1 (de) | Aminoalkylmaleimide und davon abgeleitete hapten- und antigenderivate sowie konjugate mit peptiden oder proteinen | |
| DE2910998A1 (de) | Verfahren zur herstellung von gebundenes enzym enthaltenden produkten und deren verwendung | |
| EP0697021B1 (de) | Photoaktivierbare biotinderivate und deren einsatz zum entstören von immunoassays | |
| DE69534598T2 (de) | Immunotest für mycophenolsäure | |
| CH641570A5 (en) | Process for the determination of an immunologically active material and reagent for carrying out this process | |
| DE69636013T2 (de) | Verfahren zum erlangen von rezeptor-freigabeligand (reland)-komplexen und testansätze | |
| DE2223385C3 (de) | Verfahren zum Nachweis eines organischen Liganden und enzymgebundener Ligand für enzymatische Immunanalysen | |
| DE2924249A1 (de) | Spezifische bindungs-untersuchungsmethode zur bestimmung eines liganden in einem fluessigen medium und reagentien zur durchfuehrung dieser methode | |
| EP0747699B1 (de) | Entstörungsreagenz für die Bestimmung eines Analyten mit einem lumineszenzfähigen Metallkomplex | |
| DE69725118T2 (de) | Reagentien für tests für mycophenolsäure | |
| DE60037723T2 (de) | Verkleinerung der fluoreszenzlöschung während einer bestimmung | |
| DE2916783C3 (de) | Verfahren zur immunologischen Bestimmung einer Gallensäure oder ihres Konjugats | |
| DE2548962A1 (de) | Antikoerper und verfahren zu ihrer herstellung | |
| DE2924332C2 (cg-RX-API-DMAC10.html) | ||
| CH632343A5 (en) | Process for the detection or for the determination of polyiodothyronines | |
| EP0498240B1 (de) | Diphenylmethanderivate, Verfahren zu deren Herstellung und ihre Verwendung zur Verdrängung von Jodthyroninen und diese bindenden Proteinen | |
| EP0055869A2 (de) | Verfahren zur Bestimmung von Liganden, Test-Kit zur Durchführung des Verfahrens und seine Verwendung | |
| DE3006710A1 (de) | Enzymmodulator-ligand-konjugat und verfahren unter dessen anwendung | |
| EP0684956B1 (de) | Acylierte proteinaggregate und deren verwendung zur signalsteigerung in einem immunoassay zum nachweis von antikörpern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: PETERS, G., RECHTSANW., 5090 LEVERKUSEN |
|
| 8339 | Ceased/non-payment of the annual fee |