DE2745076C3 - Massen auf Polyamidbasis - Google Patents
Massen auf PolyamidbasisInfo
- Publication number
- DE2745076C3 DE2745076C3 DE2745076A DE2745076A DE2745076C3 DE 2745076 C3 DE2745076 C3 DE 2745076C3 DE 2745076 A DE2745076 A DE 2745076A DE 2745076 A DE2745076 A DE 2745076A DE 2745076 C3 DE2745076 C3 DE 2745076C3
- Authority
- DE
- Germany
- Prior art keywords
- red phosphorus
- polyamide
- coated
- oxide
- phosphorus
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920002647 polyamide Polymers 0.000 title claims description 14
- 150000001875 compounds Chemical class 0.000 title description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 34
- 239000004952 Polyamide Substances 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 12
- CXKCTMHTOKXKQT-UHFFFAOYSA-N cadmium oxide Inorganic materials [Cd]=O CXKCTMHTOKXKQT-UHFFFAOYSA-N 0.000 claims description 10
- CFEAAQFZALKQPA-UHFFFAOYSA-N cadmium(2+);oxygen(2-) Chemical compound [O-2].[Cd+2] CFEAAQFZALKQPA-UHFFFAOYSA-N 0.000 claims description 10
- 239000003365 glass fiber Substances 0.000 claims description 9
- 239000002245 particle Substances 0.000 claims description 6
- 229910044991 metal oxide Inorganic materials 0.000 claims description 4
- 150000004706 metal oxides Chemical class 0.000 claims description 4
- 238000007792 addition Methods 0.000 description 8
- 239000000654 additive Substances 0.000 description 8
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 7
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 239000005751 Copper oxide Substances 0.000 description 4
- 229910000431 copper oxide Inorganic materials 0.000 description 4
- 229960004279 formaldehyde Drugs 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000003063 flame retardant Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- 101710134784 Agnoprotein Proteins 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 230000009970 fire resistant effect Effects 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000004005 microsphere Substances 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 238000010606 normalization Methods 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- -1 polyhexamethylene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/02—Elements
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/18—Oxygen-containing compounds, e.g. metal carbonyls
- C08K3/20—Oxides; Hydroxides
- C08K3/22—Oxides; Hydroxides of metals
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/32—Phosphorus-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7631308A FR2367100A1 (fr) | 1976-10-11 | 1976-10-11 | Compositions a base de polyamide ignifuge |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2745076A1 DE2745076A1 (de) | 1978-04-13 |
| DE2745076B2 DE2745076B2 (de) | 1979-08-09 |
| DE2745076C3 true DE2745076C3 (de) | 1981-07-23 |
Family
ID=9178878
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2745076A Expired DE2745076C3 (de) | 1976-10-11 | 1977-10-07 | Massen auf Polyamidbasis |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4187207A (enExample) |
| JP (1) | JPS5381563A (enExample) |
| AT (1) | AT355308B (enExample) |
| BE (1) | BE859591A (enExample) |
| BR (1) | BR7706754A (enExample) |
| CH (1) | CH624974A5 (enExample) |
| DE (1) | DE2745076C3 (enExample) |
| DK (1) | DK144013C (enExample) |
| ES (1) | ES463077A1 (enExample) |
| FR (1) | FR2367100A1 (enExample) |
| GB (1) | GB1543511A (enExample) |
| GR (1) | GR62018B (enExample) |
| IE (1) | IE45792B1 (enExample) |
| IT (1) | IT1091306B (enExample) |
| LU (1) | LU78282A1 (enExample) |
| NL (1) | NL181439C (enExample) |
| SE (1) | SE435725B (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2860466D1 (en) * | 1977-07-28 | 1981-03-26 | Bayer Ag | Flame resistant polyamide moulding materials |
| IT1134333B (it) * | 1980-11-19 | 1986-08-13 | F F A Spa Sa | Processo per stabilizzare mediante incapsulamento il fosforo rosso per impiego come ritardante di fiamma dei materiali polimerici e prodotto cosi' ottenuto |
| IT1137409B (it) * | 1981-03-05 | 1986-09-10 | Saffa Spa | Materiali cartari autoestinguenti |
| DE3215750A1 (de) * | 1982-04-28 | 1983-11-03 | Basf Ag, 6700 Ludwigshafen | Flammfeste polyamid- oder polyurethan-formmassen |
| DE3215751A1 (de) * | 1982-04-28 | 1983-11-24 | Basf Ag, 6700 Ludwigshafen | Verfahren zum flammfestausruesten von thermoplastischen kunststoffen |
| US4403052A (en) * | 1982-08-30 | 1983-09-06 | Allied Corporation | Injection moldable poly(ethylene terephthalate) |
| DE3317822A1 (de) * | 1983-05-17 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Stabilisierter, roter phosphor und dessen verwendung fuer flammfeste, thermoplastische polyamid-formmassen |
| FR2553783B1 (fr) * | 1983-10-21 | 1986-01-17 | Rhone Poulenc Spec Chim | Compositions a base de polyamide ignifuge |
| GB2212149A (en) * | 1987-11-12 | 1989-07-19 | Secr Defence | Phosphine inhibition |
| DE58908791D1 (de) * | 1988-07-13 | 1995-02-02 | Basf Ag | Flammgeschützte thermoplastische Formmassen auf der Basis teilaromatischer Copolyamide. |
| DE3905038A1 (de) * | 1989-02-18 | 1990-08-23 | Basf Ag | Flammgeschuetzte thermoplastische formmassen auf der basis von phlegmatisiertem roten phosphor |
| US5135971A (en) * | 1989-02-18 | 1992-08-04 | Basf Aktiengesellschaft | Flameproofed thermoplastic molding compositions based on phlegmatized red phosphorus |
| US5216063A (en) * | 1990-01-13 | 1993-06-01 | Bip Chemicals Limited | Polyamide compositions |
| US5543447A (en) * | 1994-09-28 | 1996-08-06 | Southwest Research Institute | Stabilization of red amorphous phosphorus by ordered polymeric structures for the manufacture of non-emissive fire retardant plastics |
| DE19648503A1 (de) * | 1996-11-22 | 1998-05-28 | Basf Ag | Flammgeschützte thermoplastische Formmassen |
| RU2200744C2 (ru) * | 2000-06-27 | 2003-03-20 | Гродненское производственное объединение "Химволокно" | Огнестойкая полиамидная композиция |
| US6873550B2 (en) * | 2003-08-07 | 2005-03-29 | Micron Technology, Inc. | Method for programming and erasing an NROM cell |
| US20070173572A1 (en) * | 2006-01-20 | 2007-07-26 | General Electric Company | Flame retardant resin composition |
| CN106633187A (zh) * | 2016-12-29 | 2017-05-10 | 广东宇星阻燃新材股份有限公司 | 一种安全环保无机次磷酸铝阻燃剂及其在pbt中的应用 |
| JP2025537855A (ja) | 2022-11-17 | 2025-11-20 | ビーエーエスエフ ソシエタス・ヨーロピア | 難燃性ポリアミド用安定剤としての混合金属酸化物組成物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3344107A (en) * | 1963-12-26 | 1967-09-26 | Monsanto Co | Reinforced polyamides containing phosphorus coupling agents and processes therefor |
| DE1720387A1 (de) * | 1967-05-26 | 1971-06-16 | Albert Ag Chem Werke | Flammwidrige Kunstharzmassen |
| DE1931387B2 (de) * | 1969-06-20 | 1974-10-17 | Basf Ag, 6700 Ludwigshafen | Flammschutzausrüstung für glasfaserverstärktes Polyamid |
| US3847861A (en) * | 1971-09-14 | 1974-11-12 | Allied Chem | Polyethylene terephthalate |
| US3808289A (en) * | 1972-09-13 | 1974-04-30 | Teijin Ltd | Novel flame-resistant fibers and method of producing the same |
| DE2308104A1 (de) * | 1973-02-19 | 1974-08-22 | Hoechst Ag | Formmasse aus thermoplastischen kunststoffen |
| US3882076A (en) * | 1973-03-15 | 1975-05-06 | Allied Chem | Method for improving flame retardancy of polyamide compositions and resultant product |
| DE2405985A1 (de) * | 1974-02-08 | 1975-08-21 | Hoechst Ag | Flammwidrige polyamidformmassen |
| DE2408488A1 (de) * | 1974-02-22 | 1975-08-28 | Hoechst Ag | Granulat aus rotem phosphor und einem bindemittel zur flammwidrigen ausruestung von kunststoffen |
| FR2314219A1 (fr) * | 1975-06-10 | 1977-01-07 | Rhone Poulenc Ind | Compositions destinees a l'ignifugation de matieres plastiques |
| DE2551718B2 (de) * | 1975-11-18 | 1979-08-02 | Basf Ag, 6700 Ludwigshafen | Brandgeschützte Polyamidformmassen |
-
1976
- 1976-10-11 FR FR7631308A patent/FR2367100A1/fr active Granted
-
1977
- 1977-10-07 GB GB41887/77A patent/GB1543511A/en not_active Expired
- 1977-10-07 DE DE2745076A patent/DE2745076C3/de not_active Expired
- 1977-10-07 JP JP12015577A patent/JPS5381563A/ja active Granted
- 1977-10-08 GR GR54529A patent/GR62018B/el unknown
- 1977-10-10 BR BR7706754A patent/BR7706754A/pt unknown
- 1977-10-10 NL NLAANVRAGE7711107,A patent/NL181439C/xx not_active IP Right Cessation
- 1977-10-10 IT IT51348/77A patent/IT1091306B/it active
- 1977-10-10 AT AT723077A patent/AT355308B/de not_active IP Right Cessation
- 1977-10-10 ES ES463077A patent/ES463077A1/es not_active Expired
- 1977-10-10 DK DK448977A patent/DK144013C/da not_active IP Right Cessation
- 1977-10-10 LU LU7778282A patent/LU78282A1/xx unknown
- 1977-10-10 CH CH1235777A patent/CH624974A5/fr not_active IP Right Cessation
- 1977-10-10 IE IE2063/77A patent/IE45792B1/en not_active IP Right Cessation
- 1977-10-10 SE SE7711371A patent/SE435725B/xx not_active IP Right Cessation
- 1977-10-11 US US05/840,634 patent/US4187207A/en not_active Expired - Lifetime
- 1977-10-11 BE BE181631A patent/BE859591A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ATA723077A (de) | 1979-07-15 |
| NL7711107A (nl) | 1978-04-13 |
| AT355308B (de) | 1980-02-25 |
| GB1543511A (en) | 1979-04-04 |
| ES463077A1 (es) | 1979-01-01 |
| IE45792L (en) | 1978-04-11 |
| GR62018B (en) | 1979-02-16 |
| SE435725B (sv) | 1984-10-15 |
| DE2745076B2 (de) | 1979-08-09 |
| US4187207A (en) | 1980-02-05 |
| FR2367100A1 (fr) | 1978-05-05 |
| DK144013C (da) | 1982-04-26 |
| CH624974A5 (enExample) | 1981-08-31 |
| DE2745076A1 (de) | 1978-04-13 |
| LU78282A1 (enExample) | 1979-02-02 |
| BE859591A (fr) | 1978-04-11 |
| NL181439B (nl) | 1987-03-16 |
| DK448977A (da) | 1978-04-12 |
| FR2367100B1 (enExample) | 1980-10-17 |
| NL181439C (nl) | 1987-08-17 |
| IE45792B1 (en) | 1982-12-01 |
| DK144013B (da) | 1981-11-16 |
| IT1091306B (it) | 1985-07-06 |
| SE7711371L (sv) | 1978-04-12 |
| JPS5381563A (en) | 1978-07-19 |
| JPS5430701B2 (enExample) | 1979-10-02 |
| BR7706754A (pt) | 1978-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2745076C3 (de) | Massen auf Polyamidbasis | |
| DE3485944T2 (de) | Flammfeste polyamidzusammensetzungen. | |
| EP1183306B1 (de) | Flammgeschützte polymerzusammensetzung | |
| DE69823245T2 (de) | Flammhemmende Polyamid-Zusammensetzung | |
| DE2625673C2 (de) | Flammfestausrüsten von Kunststoffen | |
| DE3687160T2 (de) | Koernige flammhemmende mittel, verfahren zu deren herstellung, methode und so erhaltene materialien. | |
| EP0002514B2 (de) | Verfahren zum Flammfest- Ausrüsten von thermoplastischen Kunststoffen | |
| DE3884734T2 (de) | Flammwidrige Polyamid-Mischungen. | |
| DE2727690B2 (de) | Polyamidgemisch mit feuerhemmenden Additiven für die Weiterverarbeitung zu einer feuerhemmenden Polyamidmasse und dessen Verwendung | |
| DE1273193B (de) | Spritzgussmassen, die Polyaethylenterephthalat und polymere Olefine enthalten | |
| DE2515632C2 (de) | Verfahren zur antistatischen Ausrüstung von Kunststoffen | |
| DE2646965A1 (de) | Anorganischer fuellstoff und damit gefuellte kunstharzmasse | |
| DE2460194A1 (de) | Verfahren zur unterdrueckung der rauchentwicklung brennender halogenhaltiger polymerisatmassen | |
| DE69312116T2 (de) | Zusammensetzungen auf Basis von flammfesten Polyamiden | |
| DE68921404T2 (de) | Polyarylensulfidzusammensetzung und Formmasse, die eine Metallverbindung enhält. | |
| DE2706827C2 (de) | Verstärkte Polyamidmasse | |
| DE2737908A1 (de) | Polyamidformmasse und deren verwendung | |
| EP0092776B1 (de) | Verfahren zum Flammfestausrüsten von Polyamiden | |
| DE3001901B2 (de) | Feuerhemmende Harzmasse und ihre Verwendung | |
| DE2551718B2 (de) | Brandgeschützte Polyamidformmassen | |
| DE2754515C2 (de) | Flammfestausrüsten von Kunststoffen | |
| DE3485943T2 (de) | Flammfeste polyamidzusammensetzungen. | |
| DE3722118C2 (enExample) | ||
| DE4300260A1 (de) | Schwerentflammbare Polyamidformmassen | |
| DE2412611C2 (de) | Nichtentflammbare Polyamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |