DE2725178A1 - Lampenanordnung mit schutzschirm - Google Patents
Lampenanordnung mit schutzschirmInfo
- Publication number
- DE2725178A1 DE2725178A1 DE19772725178 DE2725178A DE2725178A1 DE 2725178 A1 DE2725178 A1 DE 2725178A1 DE 19772725178 DE19772725178 DE 19772725178 DE 2725178 A DE2725178 A DE 2725178A DE 2725178 A1 DE2725178 A1 DE 2725178A1
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- sleeve
- jacket
- protective screen
- ultraviolet radiation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000001681 protective effect Effects 0.000 title claims description 27
- 239000004033 plastic Substances 0.000 claims description 39
- 229920003023 plastic Polymers 0.000 claims description 39
- 239000000463 material Substances 0.000 claims description 34
- 230000005855 radiation Effects 0.000 claims description 27
- 238000002834 transmittance Methods 0.000 claims description 17
- 239000011521 glass Substances 0.000 claims description 11
- 239000004812 Fluorinated ethylene propylene Substances 0.000 claims description 8
- 229920002313 fluoropolymer Polymers 0.000 claims description 8
- 229920009441 perflouroethylene propylene Polymers 0.000 claims description 8
- 230000003595 spectral effect Effects 0.000 claims description 8
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims description 6
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- 229920001577 copolymer Polymers 0.000 claims description 4
- 230000035699 permeability Effects 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 238000001746 injection moulding Methods 0.000 claims 1
- 230000000717 retained effect Effects 0.000 claims 1
- 239000004809 Teflon Substances 0.000 description 6
- 229920006362 Teflon® Polymers 0.000 description 6
- 230000005540 biological transmission Effects 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 206010073306 Exposure to radiation Diseases 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229910052754 neon Inorganic materials 0.000 description 2
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- -1 polypropylene Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920005372 Plexiglas® Polymers 0.000 description 1
- 229920006355 Tefzel Polymers 0.000 description 1
- 230000037338 UVA radiation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000004323 axial length Effects 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- QHSJIZLJUFMIFP-UHFFFAOYSA-N ethene;1,1,2,2-tetrafluoroethene Chemical compound C=C.FC(F)=C(F)F QHSJIZLJUFMIFP-UHFFFAOYSA-N 0.000 description 1
- 229920000840 ethylene tetrafluoroethylene copolymer Polymers 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/34—Double-wall vessels or containers
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/693,026 US4048537A (en) | 1976-06-04 | 1976-06-04 | Protective ultraviolet-transmitting sleeve for fluorescent lamp |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2725178A1 true DE2725178A1 (de) | 1977-12-22 |
Family
ID=24783011
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772725178 Withdrawn DE2725178A1 (de) | 1976-06-04 | 1977-06-03 | Lampenanordnung mit schutzschirm |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4048537A (enExample) |
| BE (1) | BE855343A (enExample) |
| DE (1) | DE2725178A1 (enExample) |
| FR (1) | FR2353955A1 (enExample) |
| GB (1) | GB1582230A (enExample) |
| NL (1) | NL183259C (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3033172A1 (de) * | 1980-09-03 | 1982-04-08 | WOCO Franz-Josef Wolf & Co, 6483 Bad Soden-Salmünster | Klemmring |
| DE3717393A1 (de) * | 1987-05-22 | 1988-12-01 | Mutzhas Maximilian F | Bestrahlungseinrichtung |
| DE3721937A1 (de) * | 1987-07-02 | 1989-01-12 | Mutzhas Maximilian F | Bestrahlungseinrichtung |
| DE29606857U1 (de) * | 1996-04-16 | 1998-01-29 | Weth, Gosbert, Dr.med. Dr.rer.nat., 95346 Stadtsteinach | Leuchtmittel für therapeutische Zwecke |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2844967A1 (de) * | 1978-10-16 | 1980-04-30 | Wolff System Service Gmbh | Stabfoermige leuchtstofflampe fuer ein bestrahlungsgeraet |
| US4469102A (en) * | 1980-12-24 | 1984-09-04 | Fish Errol R | Suntanning booth |
| US4318163A (en) * | 1980-12-29 | 1982-03-02 | Emanuel Bryan | Protective shield for ultraviolet lamps |
| NL8204258A (nl) * | 1982-11-03 | 1984-06-01 | Metaalbewerking Ind Mij Bv | Lagedrukkwikdampontladingslamp. |
| CA1243723A (en) * | 1984-09-17 | 1988-10-25 | Peter R. Gagnon | Electric lamp including a containment coating as part thereof |
| GB8604117D0 (en) * | 1986-02-19 | 1986-03-26 | Mclauchlan R A | Light tube protector |
| CH670956A5 (enExample) * | 1986-09-23 | 1989-07-31 | Friedrich Wolff | |
| DE3717390A1 (de) * | 1987-05-22 | 1988-12-01 | Mutzhas Maximilian F | Bestrahlungsgeraet |
| FR2642397B1 (fr) * | 1989-01-27 | 1991-07-12 | Verboom Durouchard | Procede de gainage fonctionnel des lampes de sterilisation par rayonnements ultra-violets |
| EP0409337A1 (en) * | 1989-07-21 | 1991-01-23 | Koninklijke Philips Electronics N.V. | Low-pressure metal vapour discharge lamp |
| US5243251A (en) * | 1990-04-13 | 1993-09-07 | Toshiba Lighting & Technology Corporation | Lamp having a glass envelope with fluorocarbon polymer layer |
| US5173637A (en) * | 1990-07-19 | 1992-12-22 | Royal Lite Manufacturing And Supply Corp. | Fluorescent lamp with protective assembly |
| US5143443A (en) * | 1990-08-31 | 1992-09-01 | Integrated Systems Engineering, Inc. | Light permeable, color adding, self-securing stressed covers for large display light-emitting devices, and methods |
| IL100181A (en) * | 1991-11-28 | 1995-10-31 | Dimotech Ltd | Device for the treatment of skin diseases |
| US5210461A (en) * | 1992-02-18 | 1993-05-11 | Gte Products Corporation | Arc discharge lamp containing mechanism for extinguishing arc at end-of-life |
| US5536998A (en) * | 1994-11-28 | 1996-07-16 | Royal Lite Manufacturing And Supply Corp. | Fluorescent lamp with a protective assembly |
| CA2211330C (en) * | 1995-01-25 | 2000-11-21 | Northern Engraving Corporation | Improved fluorescent inks |
| US5729085A (en) * | 1996-03-22 | 1998-03-17 | Royal Lite Manufacturing And Supply Corp. | Fluorescent lamp with a protective assembly |
| US5751007A (en) * | 1996-09-05 | 1998-05-12 | Weaver; William C. | Method and apparatus for generating a predetermined amount of ozone using ultraviolet light |
| US6179443B1 (en) * | 1998-06-30 | 2001-01-30 | Commercial Refrigerator Door Company, Inc. | Fluorescent lamp lens assembly |
| US6078136A (en) | 1998-11-06 | 2000-06-20 | Royal Lite Manufacturing And Supply Corp. | Fluorescent lamp with a protective assembly having vent holes |
| US6278125B1 (en) | 1998-11-23 | 2001-08-21 | Loctite Corporation | Shielded radiation assembly |
| US6254318B1 (en) | 1998-12-16 | 2001-07-03 | Michael F. Sica | Apparatus for making numerous holes in a tube |
| US6614039B2 (en) * | 1999-06-23 | 2003-09-02 | Brad C. Hollander | Hermetically sealed ultraviolet light source |
| US6193894B1 (en) * | 1999-06-23 | 2001-02-27 | Brad C. Hollander | Methods and apparatus for disinfecting and sterilizing water in water dispensers using ultraviolet radiation |
| US6246167B1 (en) | 1999-06-29 | 2001-06-12 | Michael F. Sica | U-shaped fluorescent lamp with protective assembly |
| US7081225B1 (en) | 1999-07-20 | 2006-07-25 | Hollander Brad C | Methods and apparatus for disinfecting and sterilizing fluid using ultraviolet radiation |
| DE10023504A1 (de) * | 2000-05-13 | 2001-11-15 | Philips Corp Intellectual Pty | Edelgas-Niederdruck-Entladungslampe, Verfahren zum Herstellen einer Edelgas-Niederdruck-Entladungslampe Lampe sowie Verwendung einer Gasentladungslampe |
| US6452325B1 (en) * | 2000-07-24 | 2002-09-17 | Thermoplastic Processes, Inc. | Shatterproofing of fluorescent lamps |
| US6406167B1 (en) * | 2000-10-31 | 2002-06-18 | General Electric Company | Method and apparatus for affixing a cover guard on a linear fluorescent lamp |
| JP2003123699A (ja) * | 2001-10-19 | 2003-04-25 | Manabu Nitoda | 光触媒作用を活性化する方法及び光触媒放電管、並びにこの原理を用いた製品 |
| US20040045501A1 (en) * | 2002-09-10 | 2004-03-11 | Shat-R-Shield, Inc. | Method and apparatus for extrusion coating of fluorescent light tubes |
| SE0302595D0 (sv) * | 2003-09-30 | 2003-09-30 | Auralight Int Ab | Lysrör anpassat för kalla utrymmen |
| US7281834B2 (en) * | 2004-01-28 | 2007-10-16 | Photoglow, Inc. | Method and apparatus for image illumination using self-contained luminaire |
| WO2005088677A2 (en) * | 2004-03-04 | 2005-09-22 | Koninklijke Philips Electronics N.V. | Fluorescent lamp and method for manufacturing the same |
| US20060034087A1 (en) * | 2004-08-16 | 2006-02-16 | A.L.P. Lighting & Ceiling Products, Inc. | End cap for illumination tube guards |
| WO2006056934A2 (en) * | 2004-11-24 | 2006-06-01 | Koninklijke Philips Electronics N.V. | Low-pressure mercury vapor discharge lamp and apparatus for treatment |
| DE502004007302D1 (de) * | 2004-11-26 | 2008-07-10 | Bae Ro Gmbh & Co Kg | Entkeimungsleuchte |
| US7819548B1 (en) * | 2005-02-01 | 2010-10-26 | Light Lines, Inc. | Protective sleeve combination for tubes of fluorescent bulbs |
| US20060186573A1 (en) * | 2005-02-21 | 2006-08-24 | Ellis Harrell P | System for fabricating sleeved ultra violet lamps |
| US7661839B2 (en) * | 2007-05-01 | 2010-02-16 | Hua-Hsin Tsai | Light structure |
| JP2009245845A (ja) * | 2008-03-31 | 2009-10-22 | Mitsubishi Electric Corp | パッキン及びランプチューブユニット及び照明器具 |
| US8152586B2 (en) | 2008-08-11 | 2012-04-10 | Shat-R-Shield, Inc. | Shatterproof light tube having after-glow |
| US8288949B2 (en) * | 2009-04-29 | 2012-10-16 | General Electric Company | Fluorescent lamp with protective sleeve |
| US8053962B2 (en) * | 2009-05-04 | 2011-11-08 | General Electric Company | Fluorescent lamp with UV-blocking layer and protective sleeve |
| DE202011000880U1 (de) * | 2011-04-14 | 2011-06-30 | Luxtime Limited, Kwun Tong | Schwarzlicht erzeugende UV-Leuchtstoffröhre |
| DE102015105362A1 (de) | 2015-04-09 | 2016-10-13 | Sterilair Ag | Schutzrohr für eine UV-Röhre, insbesondere eine UVC-Röhre |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3124307A (en) * | 1964-03-10 | Vapor lamp units | ||
| US2382939A (en) * | 1944-06-08 | 1945-08-14 | George W Gates & Co Inc | Ultraviolet lamp |
| US3157812A (en) * | 1962-04-27 | 1964-11-17 | Friedman Herbert | Teflon coated photon counter tube |
| US3358167A (en) * | 1965-10-18 | 1967-12-12 | Gen Electric | Jacketed discharge lamp |
| US3453470A (en) * | 1966-11-17 | 1969-07-01 | Gen Electric | Jacketed fluorescent lamp utilizing standard base plus spacer and wind cap |
| US3673401A (en) * | 1969-10-29 | 1972-06-27 | Thermoplastic Processes Inc | Fluorescent lamp protection apparatus |
| GB1280172A (en) * | 1969-11-05 | 1972-07-05 | Pennsylvania Fluorocarbon Comp | Heat shrinkable fluorocarbon tubing |
| US3720826A (en) * | 1970-05-05 | 1973-03-13 | Westinghouse Electric Corp | Tubular electric discharge lamp with integral protective-insulating sleeve |
| US3787382A (en) * | 1972-02-16 | 1974-01-22 | Gen Electric | Photopolymerization of tetrafluoro-ethylene and polymer and products produced therefrom |
| US3808495A (en) * | 1972-08-21 | 1974-04-30 | Malcolite Corp | Guard for illumination tubes |
| US3798481A (en) * | 1972-10-20 | 1974-03-19 | Thermoplastic Processes Inc | Fluorescent lamp heat shield |
| GB1472424A (en) * | 1974-07-09 | 1977-05-04 | Custom Services Ltd | Fluorescent light fittings |
| US4100415A (en) * | 1976-06-04 | 1978-07-11 | Gte Sylvania Incorporated | Modular photochemotherapy chamber |
-
1976
- 1976-06-04 US US05/693,026 patent/US4048537A/en not_active Expired - Lifetime
-
1977
- 1977-05-30 GB GB22847/77A patent/GB1582230A/en not_active Expired
- 1977-06-03 DE DE19772725178 patent/DE2725178A1/de not_active Withdrawn
- 1977-06-03 FR FR7716969A patent/FR2353955A1/fr active Granted
- 1977-06-03 BE BE2055967A patent/BE855343A/xx not_active IP Right Cessation
- 1977-06-03 NL NLAANVRAGE7706123,A patent/NL183259C/xx not_active IP Right Cessation
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3033172A1 (de) * | 1980-09-03 | 1982-04-08 | WOCO Franz-Josef Wolf & Co, 6483 Bad Soden-Salmünster | Klemmring |
| DE3717393A1 (de) * | 1987-05-22 | 1988-12-01 | Mutzhas Maximilian F | Bestrahlungseinrichtung |
| DE3721937A1 (de) * | 1987-07-02 | 1989-01-12 | Mutzhas Maximilian F | Bestrahlungseinrichtung |
| DE3732241A1 (de) * | 1987-07-02 | 1989-04-20 | Mutzhas Maximilian F | Bestrahlungseinrichtung |
| DE29606857U1 (de) * | 1996-04-16 | 1998-01-29 | Weth, Gosbert, Dr.med. Dr.rer.nat., 95346 Stadtsteinach | Leuchtmittel für therapeutische Zwecke |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2353955A1 (fr) | 1977-12-30 |
| NL183259B (nl) | 1988-04-05 |
| NL7706123A (nl) | 1977-12-06 |
| US4048537A (en) | 1977-09-13 |
| GB1582230A (en) | 1981-01-07 |
| FR2353955B1 (enExample) | 1983-02-04 |
| BE855343A (fr) | 1977-10-03 |
| NL183259C (nl) | 1988-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2725178A1 (de) | Lampenanordnung mit schutzschirm | |
| DE3032741A1 (de) | Hautbraeunungs-fluoreszenzlampe mit einer phosphoren-kombination | |
| DE4317252C1 (de) | Gasentladungslampe | |
| CH642196A5 (de) | Beleuchtungsvorrichtung zum liefern von licht im ultravioletten und/oder sichtbaren spektralbereich. | |
| DE19641216A1 (de) | Bestrahlungsvorrichtung, insbesondere zur kosmetischen, diagnostischen und therapeutischen Lichtanwendung | |
| DE2219926A1 (de) | Untersuchungslampe | |
| DE3904521A1 (de) | Erdungsvorrichtung fuer eine leuchte mit abgeschirmten elektroden | |
| DE2622424A1 (de) | Beleuchtungsvorrichtung | |
| WO1983002233A1 (fr) | Appareil a rayonnement ultra-violet pour la photo therapie de dermatoses et notamment de psoriasis | |
| DE10306150B4 (de) | Gepulster Sonnensimulator mit verbesserter Homogenität | |
| EP1154461A1 (de) | Edelgas-Niederdruck-Entladungslampe, Verfahren zum Herstellen einer Edelgas-Niederdruck-Entladungslampe Lampe sowie Verwendung einer Gasentladungslampe | |
| DE60022266T2 (de) | Niederdruckquecksilberdampfentladungslampe und UV-Strahlen bestrahlende Einrichtung und Verfahren, die diese benützen | |
| DE2845890C3 (de) | Quecksilber-Edelgas-Entladungslampe | |
| DE2844967A1 (de) | Stabfoermige leuchtstofflampe fuer ein bestrahlungsgeraet | |
| DE905414C (de) | Entladungslampe mit langgestreckter Glashuelle und je einer Elektrode an beiden Enden dieser Huelle | |
| DE7925996U1 (de) | Bestrahlungsgerät | |
| DE3438519C2 (de) | UV-Bestrahlungsgerät | |
| DE69104866T2 (de) | Metalldampfentladungslampe. | |
| DE3632430A1 (de) | Magnesiumdampf-entladungslampe | |
| CH272702A (de) | Lichtquelle für Beleuchtung, Bestrahlung, Scheinwerfer und/oder Projektion. | |
| DE7801019U1 (enExample) | ||
| DE1464558C3 (de) | Vorrichtung zum Bestrahlen von lebendem Gewebe | |
| DE830224C (de) | Mischlichtstrahler, insbesondere zur Emission gerichteter, sichtbarer Waerme- und Ultraviolettstrahlung | |
| DE2707894A1 (de) | Speziallampe fuer die selektive uv-photobehandlung | |
| DE8704271U1 (de) | Bestrahlungsgerät |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OGA | New person/name/address of the applicant | ||
| 8125 | Change of the main classification |
Ipc: A61N 5/06 |
|
| 8126 | Change of the secondary classification |
Ipc: F21V 17/04 |
|
| 8128 | New person/name/address of the agent |
Representative=s name: LEMKE, J., DIPL.-ING., PAT.-ANW., 8900 AUGSBURG |
|
| 8139 | Disposal/non-payment of the annual fee |