DE2653096C2 - Verfahren zur Herstellung von 2,2-disubstituierten Propan-1,3-diolen - Google Patents
Verfahren zur Herstellung von 2,2-disubstituierten Propan-1,3-diolenInfo
- Publication number
- DE2653096C2 DE2653096C2 DE2653096A DE2653096A DE2653096C2 DE 2653096 C2 DE2653096 C2 DE 2653096C2 DE 2653096 A DE2653096 A DE 2653096A DE 2653096 A DE2653096 A DE 2653096A DE 2653096 C2 DE2653096 C2 DE 2653096C2
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- hydrogenation
- mol
- ion exchanger
- optionally substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 2,2-disubstituted propane-1,3-diols Chemical class 0.000 title claims description 20
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 3
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 22
- 150000002500 ions Chemical class 0.000 description 22
- 238000005984 hydrogenation reaction Methods 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000003054 catalyst Substances 0.000 description 15
- 239000004793 Polystyrene Substances 0.000 description 13
- 238000009835 boiling Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 8
- 239000008098 formaldehyde solution Substances 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 150000001299 aldehydes Chemical class 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000012295 chemical reaction liquid Substances 0.000 description 4
- 239000010941 cobalt Substances 0.000 description 4
- 229910017052 cobalt Inorganic materials 0.000 description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- DCFDVJPDXYGCOK-UHFFFAOYSA-N cyclohex-3-ene-1-carbaldehyde Chemical compound O=CC1CCC=CC1 DCFDVJPDXYGCOK-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- BYGQBDHUGHBGMD-UHFFFAOYSA-N 2-methylbutanal Chemical compound CCC(C)C=O BYGQBDHUGHBGMD-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical class CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229910002061 Ni-Cr-Al alloy Inorganic materials 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 2
- 238000005882 aldol condensation reaction Methods 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- RJTANRZEWTUVMA-UHFFFAOYSA-N boron;n-methylmethanamine Chemical compound [B].CNC RJTANRZEWTUVMA-UHFFFAOYSA-N 0.000 description 2
- 241001233037 catfish Species 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical class OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000001893 (2R)-2-methylbutanal Substances 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- UQURIQWAEZGLAC-UHFFFAOYSA-N 2-cyclohexylpropanal Chemical compound O=CC(C)C1CCCCC1 UQURIQWAEZGLAC-UHFFFAOYSA-N 0.000 description 1
- SHGPBDQRELYPLO-UHFFFAOYSA-N 2-ethyl-3-methylbutanal Chemical compound CCC(C=O)C(C)C SHGPBDQRELYPLO-UHFFFAOYSA-N 0.000 description 1
- LGYNIFWIKSEESD-UHFFFAOYSA-N 2-ethylhexanal Chemical compound CCCCC(CC)C=O LGYNIFWIKSEESD-UHFFFAOYSA-N 0.000 description 1
- OZGRFPZYTKHWMZ-UHFFFAOYSA-N 2-ethylpentanal Chemical compound CCCC(CC)C=O OZGRFPZYTKHWMZ-UHFFFAOYSA-N 0.000 description 1
- DIBSCKQIZZVKMG-UHFFFAOYSA-N 2-phenylbutanal Chemical compound CCC(C=O)C1=CC=CC=C1 DIBSCKQIZZVKMG-UHFFFAOYSA-N 0.000 description 1
- IQVAERDLDAZARL-UHFFFAOYSA-N 2-phenylpropanal Chemical compound O=CC(C)C1=CC=CC=C1 IQVAERDLDAZARL-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- 229910018182 Al—Cu Inorganic materials 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910019086 Mg-Cu Inorganic materials 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- PCWSNKLABDQTKE-UHFFFAOYSA-N [Ni+2].[O-][Cr]([O-])=O Chemical compound [Ni+2].[O-][Cr]([O-])=O PCWSNKLABDQTKE-UHFFFAOYSA-N 0.000 description 1
- YPPQDPIIWDQYRY-UHFFFAOYSA-N [Ru].[Rh] Chemical compound [Ru].[Rh] YPPQDPIIWDQYRY-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- VSSAZBXXNIABDN-UHFFFAOYSA-N cyclohexylmethanol Chemical compound OCC1CCCCC1 VSSAZBXXNIABDN-UHFFFAOYSA-N 0.000 description 1
- VELDYOPRLMJFIK-UHFFFAOYSA-N cyclopentanecarbaldehyde Chemical compound O=CC1CCCC1 VELDYOPRLMJFIK-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 235000013847 iso-butane Nutrition 0.000 description 1
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- QMMOXUPEWRXHJS-UHFFFAOYSA-N pentene-2 Natural products CCC=CC QMMOXUPEWRXHJS-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920001447 polyvinyl benzene Polymers 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N sec-butylidene Natural products CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
- C07C45/75—Reactions with formaldehyde
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group
- C07C29/141—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group with hydrogen or hydrogen-containing gases
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2653096A DE2653096C2 (de) | 1976-11-23 | 1976-11-23 | Verfahren zur Herstellung von 2,2-disubstituierten Propan-1,3-diolen |
| US05/852,117 US4181810A (en) | 1976-11-23 | 1977-11-16 | Process for the preparation of propane-1,3-diols, disubstituted in the 2-position |
| JP13903377A JPS5365808A (en) | 1976-11-23 | 1977-11-21 | Process for preparing propanee1*33diol diisubstituted at 22position |
| NL7712799A NL7712799A (nl) | 1976-11-23 | 1977-11-21 | Werkwijze voor de bereiding van propaan-1.3-dio- len met twee substituenten op de plaats (2.2). |
| IT51872/77A IT1091791B (it) | 1976-11-23 | 1977-11-21 | Procedimento per produrre propan-1,3-dioli 2,2-bisostituiti |
| GB48604/77A GB1566048A (en) | 1976-11-23 | 1977-11-22 | Process for the preparation of propane-1,3-diols disubstituted in the 2-position |
| FR7735257A FR2371407A1 (fr) | 1976-11-23 | 1977-11-23 | Procede de preparation de propane-1,3-diols disubstitues en position 2-. |
| BE2056448A BE861077A (fr) | 1976-11-23 | 1977-11-23 | Procede de preparation de propane-1,3-diols disubstitues en position 2- |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2653096A DE2653096C2 (de) | 1976-11-23 | 1976-11-23 | Verfahren zur Herstellung von 2,2-disubstituierten Propan-1,3-diolen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2653096A1 DE2653096A1 (de) | 1978-05-24 |
| DE2653096C2 true DE2653096C2 (de) | 1985-04-11 |
Family
ID=5993742
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2653096A Expired DE2653096C2 (de) | 1976-11-23 | 1976-11-23 | Verfahren zur Herstellung von 2,2-disubstituierten Propan-1,3-diolen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4181810A (enExample) |
| JP (1) | JPS5365808A (enExample) |
| BE (1) | BE861077A (enExample) |
| DE (1) | DE2653096C2 (enExample) |
| FR (1) | FR2371407A1 (enExample) |
| GB (1) | GB1566048A (enExample) |
| IT (1) | IT1091791B (enExample) |
| NL (1) | NL7712799A (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3027889A1 (de) * | 1980-07-23 | 1982-03-11 | Basf Ag, 6700 Ludwigshafen | Hydrierkatalysatoren fuer die herstellung von propandiolen und verfahren zur herstellung von propandiolen |
| DE3027890A1 (de) * | 1980-07-23 | 1982-03-04 | Basf Ag, 6700 Ludwigshafen | Hydrierkatalysatoren fuer die herstellung von propandiolen und verfahren zur herstellung von propandiolen mit solchen katalysatoren |
| US4740639A (en) * | 1987-06-12 | 1988-04-26 | Eastman Kodak Company | Process for preparation of 2,4-disubstituted-1,5-pentanediols |
| US4855515A (en) * | 1987-08-12 | 1989-08-08 | Eastman Kodak Company | Process for the production of neopentyl glycol |
| JPH01299239A (ja) * | 1988-05-25 | 1989-12-04 | Mitsubishi Gas Chem Co Inc | ネオペンチルグリコールの製造方法 |
| US5155086A (en) * | 1989-09-12 | 1992-10-13 | Engelhard Corporation | Hydrogenation catalyst, process for preparing and process of using said catalyst |
| US5345005A (en) * | 1989-09-12 | 1994-09-06 | Engelhard Corporation | Hydrogenation catalyst, process for preparing and process of using said catalyst |
| JPH0627083B2 (ja) * | 1989-11-21 | 1994-04-13 | チッソ株式会社 | プロパンジオールおよびその製造法 |
| DE3942792A1 (de) * | 1989-12-23 | 1991-06-27 | Hoechst Ag | Verfahren zur herstellung von 2,2-dimethylpropandiol-(1,3) |
| US5395989A (en) * | 1990-11-06 | 1995-03-07 | Mitsubishi Gas Chemical Company, Inc. | Process for producing neopentyl glycol |
| US5177267A (en) * | 1991-07-25 | 1993-01-05 | Eastman Kodak Company | Continuous process for the recovery of 2 ethylhexanal and a tertiary amine from a mixture comprising 2-ethyl-2-(hydroxymethyl) hexanal, 2-ethylhexanal, tertiary amine and water |
| FI102474B1 (fi) | 1996-12-30 | 1998-12-15 | Neste Oy | Menetelmä moniarvoisten alkoholien valmistamiseksi |
| US6069222A (en) * | 1997-07-24 | 2000-05-30 | Showa Denko K.K. | Polyester and polyurethane derived from specific alicyclic diols |
| FI108029B (fi) * | 1997-12-30 | 2001-11-15 | Neste Oy | Menetelmä neopentyyliglykolin valmistamiseksi |
| US5945570A (en) * | 1998-10-29 | 1999-08-31 | Arhancet; Juan Pedro | Catalyst and process for preparing 1,3-propanediol |
| IN192074B (enExample) * | 1999-03-22 | 2004-02-14 | Malshe Vinod Chintamani | |
| US6410807B1 (en) * | 2000-05-10 | 2002-06-25 | Chevron Phillips Chemical Company Lp | Synthesis of cyclohexene dimethanol compounds |
| DE10156116A1 (de) * | 2001-11-15 | 2003-06-26 | Basf Ag | Verfahren zur Herstellung von (Meth)acrylsäureestern mehrwertiger Alkohole |
| JP2011528745A (ja) * | 2008-07-23 | 2011-11-24 | ビーエーエスエフ ソシエタス・ヨーロピア | ポリマーを製造するための2−イソプロピル−2−アルキル−1,3−プロパンジオールの使用 |
| DE102013021508A1 (de) | 2013-12-18 | 2015-06-18 | Oxea Gmbh | Verfahren zur Herstellung von Neopentylglykol |
| JP2016150909A (ja) * | 2015-02-17 | 2016-08-22 | 株式会社クラレ | ジオールの製造方法 |
| JP2019001746A (ja) * | 2017-06-15 | 2019-01-10 | 株式会社クラレ | ジオールの製造方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2818443A (en) * | 1955-01-17 | 1957-12-31 | Celanese Corp | Polyhydroxy compounds via anion-exchange resin catalyzed aldehyde condensation and subsequent hydrogenation |
-
1976
- 1976-11-23 DE DE2653096A patent/DE2653096C2/de not_active Expired
-
1977
- 1977-11-16 US US05/852,117 patent/US4181810A/en not_active Expired - Lifetime
- 1977-11-21 IT IT51872/77A patent/IT1091791B/it active
- 1977-11-21 JP JP13903377A patent/JPS5365808A/ja active Granted
- 1977-11-21 NL NL7712799A patent/NL7712799A/xx not_active Application Discontinuation
- 1977-11-22 GB GB48604/77A patent/GB1566048A/en not_active Expired
- 1977-11-23 BE BE2056448A patent/BE861077A/xx unknown
- 1977-11-23 FR FR7735257A patent/FR2371407A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2371407A1 (fr) | 1978-06-16 |
| BE861077A (fr) | 1978-05-23 |
| FR2371407B1 (enExample) | 1981-09-11 |
| DE2653096A1 (de) | 1978-05-24 |
| NL7712799A (nl) | 1978-05-25 |
| GB1566048A (en) | 1980-04-30 |
| JPS6126767B2 (enExample) | 1986-06-21 |
| JPS5365808A (en) | 1978-06-12 |
| US4181810A (en) | 1980-01-01 |
| IT1091791B (it) | 1985-07-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2653096C2 (de) | Verfahren zur Herstellung von 2,2-disubstituierten Propan-1,3-diolen | |
| DE2702582C3 (de) | Verfahren zur Herstellung von Trimethylolalkanen | |
| DE1957591C3 (de) | Verfahren zur Herstellung von 2,2- Dimethylpropandiol-(1,3) | |
| DE2907869C2 (enExample) | ||
| DE4038192A1 (de) | Verfahren zur herstellung von 1,3-propandiol | |
| DE2813201A1 (de) | Verfahren zur herstellung von 2,2-dimethylolalkanalen | |
| EP0142090B1 (de) | Verfahren zur Herstellung von Trimethylolalkanen aus Alkanalen und Formaldehyd | |
| EP0070512B1 (de) | Verfahren zur Herstellung von tert. Aminen | |
| DE10357718A1 (de) | Verfahren zur Herstellung von Tricyclodecandialdehyd | |
| EP0177912B1 (de) | Verfahren zur Herstellung von Alkandiolen | |
| EP0328920B1 (de) | Verfahren zur Herstellung von 1,2,4-Butantriol | |
| EP0295435A2 (de) | Verfahren zur Herstellung von Alkanolen aus Alkinolen | |
| EP0111861B1 (de) | Verfahren zur Herstellung von Aminen | |
| DE2057001C3 (de) | Verfahren zur Herstellung von tertiären Aminen | |
| EP0211205B1 (de) | Verfahren zur Herstellung von 2-Methyl-2-alkenalen | |
| DE2416584C2 (de) | Verfahren zur Herstellung von Squalan | |
| EP0071079B1 (de) | Verfahren zur Herstellung von 2-Trimethylsilyloxy-ethylaminen | |
| DE2430038C3 (de) | Verfahren zur Herstellung von Acetoxybutanol | |
| EP0137418B1 (de) | Verfahren zur Herstellung von partiell hydrierten Derivaten von 2-Nitro-1,1,1-trifluoralkanen | |
| DE4023255A1 (de) | Verfahren zur herstellung von glykolen, insbesondere propylenglykol aus formaldehyd | |
| DE2835848A1 (de) | Verfahren zur reinigung von aldehydhaltigen ketonen | |
| DE2106243C2 (de) | Verfahren zur Herstellung von Aldehyden | |
| WO1993013047A1 (de) | Verfahren zur herstellung von dibenzylamin | |
| EP0229884B1 (de) | Verfahren zur Herstellung von 2,5-Dimethoxy-und 2,5-Diethoxytetrahydrofuran | |
| DE19602049A1 (de) | Verfahren zur Herstellung von 4-Aminobutanol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |