DE2648003B2 - Verfahren zur Herstellung einer Emulsionszusammensetzung - Google Patents
Verfahren zur Herstellung einer EmulsionszusammensetzungInfo
- Publication number
- DE2648003B2 DE2648003B2 DE2648003A DE2648003A DE2648003B2 DE 2648003 B2 DE2648003 B2 DE 2648003B2 DE 2648003 A DE2648003 A DE 2648003A DE 2648003 A DE2648003 A DE 2648003A DE 2648003 B2 DE2648003 B2 DE 2648003B2
- Authority
- DE
- Germany
- Prior art keywords
- resin
- fatty acid
- maleic
- modified
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000000203 mixture Substances 0.000 title claims description 52
- 239000000839 emulsion Substances 0.000 title claims description 45
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 229920005989 resin Polymers 0.000 claims description 55
- 239000011347 resin Substances 0.000 claims description 55
- 239000000178 monomer Substances 0.000 claims description 52
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 45
- 239000000194 fatty acid Substances 0.000 claims description 45
- 229930195729 fatty acid Natural products 0.000 claims description 45
- 150000004665 fatty acids Chemical group 0.000 claims description 30
- 239000003995 emulsifying agent Substances 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 20
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 18
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 17
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 239000011976 maleic acid Substances 0.000 claims description 15
- 229920000180 alkyd Polymers 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 12
- 229920000642 polymer Polymers 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 239000003208 petroleum Substances 0.000 claims description 11
- 238000007720 emulsion polymerization reaction Methods 0.000 claims description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 9
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 claims description 8
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 8
- 239000004925 Acrylic resin Substances 0.000 claims description 8
- 229920000178 Acrylic resin Polymers 0.000 claims description 8
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 8
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 150000001993 dienes Chemical class 0.000 claims description 8
- 238000001035 drying Methods 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 8
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 7
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 claims description 6
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 claims description 6
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 claims description 6
- QZPSOSOOLFHYRR-UHFFFAOYSA-N 3-hydroxypropyl prop-2-enoate Chemical compound OCCCOC(=O)C=C QZPSOSOOLFHYRR-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229920001577 copolymer Polymers 0.000 claims description 6
- -1 fatty acid modified urethane Chemical class 0.000 claims description 6
- 125000000524 functional group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 239000003822 epoxy resin Substances 0.000 claims description 5
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 claims description 5
- 229920001519 homopolymer Polymers 0.000 claims description 5
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 claims description 5
- 229920000647 polyepoxide Polymers 0.000 claims description 5
- 229920002554 vinyl polymer Polymers 0.000 claims description 5
- 150000001735 carboxylic acids Chemical group 0.000 claims description 4
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 3
- 238000006386 neutralization reaction Methods 0.000 claims description 3
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 claims description 3
- 239000002966 varnish Substances 0.000 claims description 3
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 claims description 2
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 claims description 2
- 239000004593 Epoxy Substances 0.000 claims description 2
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 claims description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 150000003857 carboxamides Chemical class 0.000 claims description 2
- 230000001804 emulsifying effect Effects 0.000 claims description 2
- UTSYWKJYFPPRAP-UHFFFAOYSA-N n-(butoxymethyl)prop-2-enamide Chemical compound CCCCOCNC(=O)C=C UTSYWKJYFPPRAP-UHFFFAOYSA-N 0.000 claims description 2
- SWPMNMYLORDLJE-UHFFFAOYSA-N n-ethylprop-2-enamide Chemical compound CCNC(=O)C=C SWPMNMYLORDLJE-UHFFFAOYSA-N 0.000 claims description 2
- YPHQUSNPXDGUHL-UHFFFAOYSA-N n-methylprop-2-enamide Chemical compound CNC(=O)C=C YPHQUSNPXDGUHL-UHFFFAOYSA-N 0.000 claims description 2
- 229920001228 polyisocyanate Chemical class 0.000 claims description 2
- 239000005056 polyisocyanate Chemical class 0.000 claims description 2
- 150000005846 sugar alcohols Polymers 0.000 claims description 2
- 229920002803 thermoplastic polyurethane Polymers 0.000 claims description 2
- 229920001567 vinyl ester resin Polymers 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims 1
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 claims 1
- NBZANZVJRKXVBH-GYDPHNCVSA-N alpha-Cryptoxanthin Natural products O[C@H]1CC(C)(C)C(/C=C/C(=C\C=C\C(=C/C=C/C=C(\C=C\C=C(/C=C/[C@H]2C(C)=CCCC2(C)C)\C)/C)\C)/C)=C(C)C1 NBZANZVJRKXVBH-GYDPHNCVSA-N 0.000 claims 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims 1
- 238000004945 emulsification Methods 0.000 claims 1
- 239000003921 oil Substances 0.000 description 27
- 235000019198 oils Nutrition 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 238000000576 coating method Methods 0.000 description 20
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 16
- 239000011248 coating agent Substances 0.000 description 11
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 10
- FIHBHSQYSYVZQE-UHFFFAOYSA-N 6-prop-2-enoyloxyhexyl prop-2-enoate Chemical compound C=CC(=O)OCCCCCCOC(=O)C=C FIHBHSQYSYVZQE-UHFFFAOYSA-N 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 9
- 239000008399 tap water Substances 0.000 description 8
- 235000020679 tap water Nutrition 0.000 description 8
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 238000006116 polymerization reaction Methods 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 5
- VAZSKTXWXKYQJF-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)OOS([O-])=O VAZSKTXWXKYQJF-UHFFFAOYSA-N 0.000 description 5
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 5
- 239000000944 linseed oil Substances 0.000 description 5
- 235000021388 linseed oil Nutrition 0.000 description 5
- 238000003385 ring cleavage reaction Methods 0.000 description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 230000001070 adhesive effect Effects 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 125000005313 fatty acid group Chemical group 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- UPTHZKIDNHJFKQ-UHFFFAOYSA-N 2-methylprop-2-enoic acid;propane-1,2,3-triol Chemical compound CC(=C)C(O)=O.CC(=C)C(O)=O.OCC(O)CO UPTHZKIDNHJFKQ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 244000124209 Crocus sativus Species 0.000 description 2
- 235000015655 Crocus sativus Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000008199 coating composition Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 239000004248 saffron Substances 0.000 description 2
- 235000013974 saffron Nutrition 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000003549 soybean oil Substances 0.000 description 2
- 235000012424 soybean oil Nutrition 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- QTYUSOHYEPOHLV-FNORWQNLSA-N 1,3-Octadiene Chemical compound CCCC\C=C\C=C QTYUSOHYEPOHLV-FNORWQNLSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- SJIXRGNQPBQWMK-UHFFFAOYSA-N 2-(diethylamino)ethyl 2-methylprop-2-enoate Chemical compound CCN(CC)CCOC(=O)C(C)=C SJIXRGNQPBQWMK-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- YYLLIJHXUHJATK-UHFFFAOYSA-N Cyclohexyl acetate Chemical compound CC(=O)OC1CCCCC1 YYLLIJHXUHJATK-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 235000004347 Perilla Nutrition 0.000 description 1
- 244000124853 Perilla frutescens Species 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 229910000754 Wrought iron Inorganic materials 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 239000010460 hemp oil Substances 0.000 description 1
- AHAREKHAZNPPMI-UHFFFAOYSA-N hexa-1,3-diene Chemical compound CCC=CC=C AHAREKHAZNPPMI-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- GIWKOZXJDKMGQC-UHFFFAOYSA-L lead(2+);naphthalene-2-carboxylate Chemical compound [Pb+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 GIWKOZXJDKMGQC-UHFFFAOYSA-L 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920002589 poly(vinylethylene) polymer Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003784 tall oil Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000002383 tung oil Substances 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000010698 whale oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/12—Polymerisation in non-solvents
- C08F2/16—Aqueous medium
- C08F2/22—Emulsion polymerisation
- C08F2/24—Emulsion polymerisation with the aid of emulsifying agents
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F283/00—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Paints Or Removers (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Polymerisation Methods In General (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50127944A JPS5922723B2 (ja) | 1975-10-23 | 1975-10-23 | エマルジヨンソセイブツ |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2648003A1 DE2648003A1 (de) | 1977-05-05 |
| DE2648003B2 true DE2648003B2 (de) | 1980-06-26 |
Family
ID=14972487
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2648003A Ceased DE2648003B2 (de) | 1975-10-23 | 1976-10-23 | Verfahren zur Herstellung einer Emulsionszusammensetzung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4107114A (OSRAM) |
| JP (1) | JPS5922723B2 (OSRAM) |
| DE (1) | DE2648003B2 (OSRAM) |
| FR (1) | FR2328505A1 (OSRAM) |
| GB (1) | GB1534323A (OSRAM) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4293595A (en) * | 1979-03-28 | 1981-10-06 | International Paper Company | Aqueous process for making a conductive medium for electrostatic printing |
| JPS565863A (en) * | 1979-06-28 | 1981-01-21 | Kansai Paint Co Ltd | Aqueous coating composition |
| DE2934950A1 (de) * | 1979-08-29 | 1981-03-19 | Bayer Ag, 5090 Leverkusen | Lufttrocknende, fettsaeuremodifizierte lackbindemittel auf der grundlage von fumar- bzw. maleinsaeurebisglycidylestercopolymerisaten |
| US4540752A (en) * | 1984-02-17 | 1985-09-10 | The Dow Chemical Company | Epoxy coating compositions with improved weatherability |
| US5364945A (en) * | 1994-01-03 | 1994-11-15 | The Sherwin-Williams Company | Anhydride-functional monomers and polymers and reactive compositions prepared from same |
| US5418307A (en) * | 1994-01-03 | 1995-05-23 | The Sherwin-Williams Company | Hydrogenated polymers having acid functionality |
| US5418306A (en) * | 1994-01-03 | 1995-05-23 | The Sherwin-Williams Company | Acid-functional polymers derived from anhydride-functional polymers comprising ene reaction products of unsaturated anhydrides and polyolefins and curable compositions prepared from same |
| US5480951A (en) * | 1994-01-03 | 1996-01-02 | The Sherwin-Williams Company | Curable compositions incorporating anhydride-functional polymers derived from alkenyl succinic anhydride |
| US5492976A (en) * | 1994-01-03 | 1996-02-20 | The Sherwin-Williams Company | Anhydride-functional polymers comprising ene reaction products of unsaturated anhydrides and polyolefins |
| US5391818A (en) * | 1994-01-03 | 1995-02-21 | The Sherwin-Williams Company | Tricarboxylic acid-functional monomers and polymers prepared from same |
| US5679742A (en) * | 1994-01-03 | 1997-10-21 | The Sherwin-Williams Company | Hydrogenated polymers having anhydride functionality |
| US5863998A (en) * | 1994-01-03 | 1999-01-26 | The Sherwin-Williams Company | Dicarboxylic acid-functional monomers and polymers prepared from same |
| US5633091A (en) * | 1994-01-03 | 1997-05-27 | The Sherwin-Williams Company | Graft copolymers having anhydride functionality |
| US5410078A (en) * | 1994-01-03 | 1995-04-25 | The Sherwin-Williams Company | Styrene-based dicarboxylic acid-functional monomers and polymers prepared from same |
| US5444139A (en) * | 1994-01-03 | 1995-08-22 | The Sherwin-Williams Company | Anhydride-functional polymers derived from alkenyl succinic anhydride |
| US5405973A (en) * | 1994-01-03 | 1995-04-11 | The Sherwin-Williams Company | Vinylbenzyl group-containing succinic anhydride |
| US5552228A (en) * | 1994-09-02 | 1996-09-03 | Minnesota Mining And Manufacturing Company | Waterborne maleinized polybutadiene emulsion coating composition |
| EP1236750B1 (en) * | 2001-02-27 | 2003-09-10 | Rohm And Haas Company | Non-gelling high polymer compositions and thermoplastic blends thereof |
| DE60223612T2 (de) | 2001-02-27 | 2008-10-23 | Rohm And Haas Co. | Verfahren zur Herstellung von nicht gelierenden Hochpolymer- zusammensetzungen und deren thermoplastischen Blends |
| US20090004394A1 (en) * | 2007-06-29 | 2009-01-01 | Anne Denise Koller | Aqueous polymeric composition |
| JP2014129470A (ja) * | 2012-12-28 | 2014-07-10 | Tosoh Corp | ポリクロロプレン及びその製造方法 |
| CN107955101A (zh) * | 2017-12-19 | 2018-04-24 | 上海华谊精细化工有限公司 | 一种氧化交联型水性丙烯酸乳液的制备方法 |
| CN112126292A (zh) * | 2020-08-27 | 2020-12-25 | 广州集泰化工股份有限公司 | 一种水性单组份防腐面漆及其制备方法 |
| CN118027923B (zh) * | 2022-11-11 | 2025-07-15 | 中国石油天然气集团有限公司 | 马来化脂肪酸及其衍生物的组合物及超高温油基钻井液 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2550114A (en) * | 1947-06-02 | 1951-04-24 | Westinghouse Electric Corp | Resinous copolymers of castor oilunsaturated dicarboxylic acid reaction products andpolymerizable vinyl compounds |
| US2941968A (en) * | 1954-11-03 | 1960-06-21 | Pittsburgh Plate Glass Co | Water dispersible interpolymers |
| US3458602A (en) * | 1962-12-31 | 1969-07-29 | Phillips Petroleum Co | Process for preparing polymeric blends |
| US3904563A (en) * | 1970-10-12 | 1975-09-09 | Kansai Paint Co Ltd | Synthetic resin-acrylamide derivative condensation product based polymerization composition |
| JPS4943381B1 (OSRAM) * | 1971-04-05 | 1974-11-20 | ||
| US3880793A (en) * | 1972-03-30 | 1975-04-29 | Kansai Paint Co Ltd | Emulsifiers for emulsion polymerization of vinyl monomers |
| GB1482969A (en) * | 1973-10-12 | 1977-08-17 | Kansai Paint Co Ltd | Non-flammable binder compositions |
| JPS50128722A (OSRAM) * | 1974-04-02 | 1975-10-11 | ||
| JPS5324106B2 (OSRAM) * | 1974-05-25 | 1978-07-19 | ||
| JPS5232038A (en) * | 1975-09-04 | 1977-03-10 | Kansai Paint Co Ltd | Emulsion composition |
| JPS5922722B2 (ja) * | 1975-09-12 | 1984-05-29 | 関西ペイント株式会社 | エマルジヨン組成物 |
| JPS5235239A (en) * | 1975-09-12 | 1977-03-17 | Kansai Paint Co Ltd | Emulsion composition |
-
1975
- 1975-10-23 JP JP50127944A patent/JPS5922723B2/ja not_active Expired
-
1976
- 1976-10-12 GB GB42248/76A patent/GB1534323A/en not_active Expired
- 1976-10-13 US US05/731,947 patent/US4107114A/en not_active Expired - Lifetime
- 1976-10-22 FR FR7631849A patent/FR2328505A1/fr active Granted
- 1976-10-23 DE DE2648003A patent/DE2648003B2/de not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| US4107114A (en) | 1978-08-15 |
| JPS5251487A (en) | 1977-04-25 |
| JPS5922723B2 (ja) | 1984-05-29 |
| DE2648003A1 (de) | 1977-05-05 |
| FR2328505A1 (fr) | 1977-05-20 |
| FR2328505B1 (OSRAM) | 1980-04-30 |
| GB1534323A (en) | 1978-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2648003A1 (de) | Emulsions-praeparate | |
| DE2513516C3 (de) | Wässrige Überzugsmasse | |
| DE3006175C3 (de) | Überzugsharzmasse in Form einer wäßrigen Dispersion | |
| DE1520610A1 (de) | Polymerisate fuer hitzehaertbare UEberzugsmassen und Verfahren zu deren Herstellung | |
| DE2513515B2 (de) | Waessrige ueberzugsmasse | |
| DE69103796T2 (de) | Emulsionspolymer und daraus hergestellte Beschichtungszusammensetzungen. | |
| DE3024368C2 (de) | Überzugsmasse auf der Basis eines wäßrigen Mediums | |
| DE2729900C3 (de) | Masse für Anstriche auf Wasserbasis | |
| EP0381030B1 (de) | Wässriges Polyacrylat-System für die Schlusslackierung von Polyvinylchlorid-Oberflächen | |
| DE2640513B2 (de) | Emulsionsmasse | |
| AT390799B (de) | Wasserverduennbare lufttrocknende beschichtungsmittel und deren verwendung | |
| DE2112718B2 (de) | Durch katalysatorzusatz haertbare ueberzugsmassen | |
| DE1621822A1 (de) | Verfahren zur Herstellung von UEberzuegen | |
| DE2733274C3 (de) | Verfahren zur Herstellung von Polymeremulsionen | |
| EP0362643A2 (de) | Verwendung von Acrylatcopolymerisaten als Additive für wässrige anionische Lacksysteme | |
| DE1808229B2 (de) | Wasserverdfinnbare Überzugsmittel für Elektrobeschichtung | |
| DE2633267B2 (de) | Mit Polyester modifiziertes Vinylpolymeres, Verfahren zu seiner Herstellung und Verwendung | |
| EP0005229B1 (de) | Luftvernetzende, eingebaute Holzschutzwirkstoffe enthaltende, Polyacrylat-Lackbindemittel | |
| DE2816944C2 (OSRAM) | ||
| DE3432482C2 (OSRAM) | ||
| DE3303930A1 (de) | Verwendung einer waessrigen poly(meth)acrylat-sekundaerdispersion als verdickendes bindemittel fuer buntsteinputz | |
| DE2264467A1 (de) | Neue lackzusammensetzungen | |
| EP0316732B1 (de) | Wässriges Beschichtungsmittel, ein Verfahren zu seiner Herstellung und seine Verwendung | |
| DE2709876C2 (de) | Verfahren zur Herstellung einer Emulsionsmasse | |
| DE2728568A1 (de) | Luft- und ofentrocknende acrylat- lackbindemittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8235 | Patent refused |