DE2623226C2 - N-Benzyl-2,2-dimethoxy-acetamide, Verfahren zu ihrer Herstellung und ihre Verwendung - Google Patents
N-Benzyl-2,2-dimethoxy-acetamide, Verfahren zu ihrer Herstellung und ihre VerwendungInfo
- Publication number
- DE2623226C2 DE2623226C2 DE2623226A DE2623226A DE2623226C2 DE 2623226 C2 DE2623226 C2 DE 2623226C2 DE 2623226 A DE2623226 A DE 2623226A DE 2623226 A DE2623226 A DE 2623226A DE 2623226 C2 DE2623226 C2 DE 2623226C2
- Authority
- DE
- Germany
- Prior art keywords
- dimethoxy
- benzyl
- singlet
- acetamide
- spectrum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title description 13
- MMXLGGLOHDUYTD-UHFFFAOYSA-N n-benzyl-2,2-dimethoxyacetamide Chemical class COC(OC)C(=O)NCC1=CC=CC=C1 MMXLGGLOHDUYTD-UHFFFAOYSA-N 0.000 title description 6
- 238000002360 preparation method Methods 0.000 title description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 31
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- -1 alkyl radical Chemical class 0.000 description 18
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 14
- 239000003208 petroleum Substances 0.000 description 14
- 238000002329 infrared spectrum Methods 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- VDBNYAPERZTOOF-UHFFFAOYSA-N isoquinolin-1(2H)-one Chemical class C1=CC=C2C(=O)NC=CC2=C1 VDBNYAPERZTOOF-UHFFFAOYSA-N 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 10
- 238000004821 distillation Methods 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- NZTCVGHPDWAALP-UHFFFAOYSA-N methyl 2,2-dimethoxyacetate Chemical compound COC(OC)C(=O)OC NZTCVGHPDWAALP-UHFFFAOYSA-N 0.000 description 9
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 8
- 238000001819 mass spectrum Methods 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- 238000000921 elemental analysis Methods 0.000 description 7
- 150000002431 hydrogen Chemical class 0.000 description 7
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- GYPOFOQUZZUVQL-UHFFFAOYSA-N 2h-isoquinolin-3-one Chemical class C1=CC=C2C=NC(O)=CC2=C1 GYPOFOQUZZUVQL-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- OJOSABWCUVCSTQ-UHFFFAOYSA-N cyclohepta-2,4,6-trienylium Chemical compound C1=CC=C[CH+]=C[CH]1 OJOSABWCUVCSTQ-UHFFFAOYSA-N 0.000 description 6
- DRDKZDRPQBJADJ-UHFFFAOYSA-N 2,2-dimethoxyacetyl chloride Chemical compound COC(OC)C(Cl)=O DRDKZDRPQBJADJ-UHFFFAOYSA-N 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- PHELOKYCCWVWFE-UHFFFAOYSA-N 2,2-dimethoxyacetic acid Chemical compound COC(OC)C(O)=O PHELOKYCCWVWFE-UHFFFAOYSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000005840 aryl radicals Chemical class 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- KDDNKZCVYQDGKE-UHFFFAOYSA-N (2-chlorophenyl)methanamine Chemical compound NCC1=CC=CC=C1Cl KDDNKZCVYQDGKE-UHFFFAOYSA-N 0.000 description 3
- DIVNUTGTTIRPQA-UHFFFAOYSA-N (3,4-dimethoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1OC DIVNUTGTTIRPQA-UHFFFAOYSA-N 0.000 description 3
- GRRIMVWABNHKBX-UHFFFAOYSA-N (3-methoxyphenyl)methanamine Chemical compound COC1=CC=CC(CN)=C1 GRRIMVWABNHKBX-UHFFFAOYSA-N 0.000 description 3
- HMTSWYPNXFHGEP-UHFFFAOYSA-N (4-methylphenyl)methanamine Chemical compound CC1=CC=C(CN)C=C1 HMTSWYPNXFHGEP-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000003939 benzylamines Chemical class 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 229940047889 isobutyramide Drugs 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 2
- CGAPWOGXEVQSBM-UHFFFAOYSA-N 2,2-dimethoxy-n-[(3-methoxyphenyl)methyl]acetamide Chemical compound COC(OC)C(=O)NCC1=CC=CC(OC)=C1 CGAPWOGXEVQSBM-UHFFFAOYSA-N 0.000 description 2
- RKUNDVUUJKQIHB-UHFFFAOYSA-N 2,2-dimethoxy-n-[(4-methylphenyl)methyl]acetamide Chemical compound COC(OC)C(=O)NCC1=CC=C(C)C=C1 RKUNDVUUJKQIHB-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- HJYOONYMOXUFSF-UHFFFAOYSA-N n-[(2-chlorophenyl)methyl]-2,2-dimethoxyacetamide Chemical compound COC(OC)C(=O)NCC1=CC=CC=C1Cl HJYOONYMOXUFSF-UHFFFAOYSA-N 0.000 description 2
- CJJZCWJJAZMVCJ-UHFFFAOYSA-N n-benzyl-2,5-dimethylaniline Chemical compound CC1=CC=C(C)C(NCC=2C=CC=CC=2)=C1 CJJZCWJJAZMVCJ-UHFFFAOYSA-N 0.000 description 2
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 2
- HIPXPABRMMYVQD-UHFFFAOYSA-N n-benzylbutan-1-amine Chemical compound CCCCNCC1=CC=CC=C1 HIPXPABRMMYVQD-UHFFFAOYSA-N 0.000 description 2
- LLXPNYVWDXGYFA-UHFFFAOYSA-N n-formyl-2-phenylacetamide Chemical class O=CNC(=O)CC1=CC=CC=C1 LLXPNYVWDXGYFA-UHFFFAOYSA-N 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- TWNILEJSESZZDB-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-n-[(3,4-dimethoxyphenyl)methyl]ethanamine Chemical compound C1=C(OC)C(OC)=CC=C1CCNCC1=CC=C(OC)C(OC)=C1 TWNILEJSESZZDB-UHFFFAOYSA-N 0.000 description 1
- KRTGJZMJJVEKRX-UHFFFAOYSA-N 2-phenylethan-1-yl Chemical compound [CH2]CC1=CC=CC=C1 KRTGJZMJJVEKRX-UHFFFAOYSA-N 0.000 description 1
- 208000012639 Balance disease Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- ANOUKFYBOAKOIR-UHFFFAOYSA-N DIMPEA Natural products COC1=CC=C(CCN)C=C1OC ANOUKFYBOAKOIR-UHFFFAOYSA-N 0.000 description 1
- 206010012218 Delirium Diseases 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000028017 Psychotic disease Diseases 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 230000036626 alertness Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 230000000146 antalgic effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005253 cladding Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- MGHPNCMVUAKAIE-UHFFFAOYSA-N diphenylmethanamine Chemical compound C=1C=CC=CC=1C(N)C1=CC=CC=C1 MGHPNCMVUAKAIE-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 208000002173 dizziness Diseases 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000003400 hallucinatory effect Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- GXMIHVHJTLPVKL-UHFFFAOYSA-N n,n,2-trimethylpropanamide Chemical compound CC(C)C(=O)N(C)C GXMIHVHJTLPVKL-UHFFFAOYSA-N 0.000 description 1
- VAVGNJHWLCTVOT-UHFFFAOYSA-N n,n-dibenzyl-2,2-dimethoxyacetamide Chemical compound C=1C=CC=CC=1CN(C(=O)C(OC)OC)CC1=CC=CC=C1 VAVGNJHWLCTVOT-UHFFFAOYSA-N 0.000 description 1
- RKWKOXMOPCYYPE-UHFFFAOYSA-N n-[(3,4-dimethoxyphenyl)methyl]-2,2-dimethoxyacetamide Chemical compound COC(OC)C(=O)NCC1=CC=C(OC)C(OC)=C1 RKWKOXMOPCYYPE-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2318475 | 1975-05-27 | ||
| GB2318375A GB1487104A (en) | 1975-05-27 | 1975-05-27 | N-benzyl-2,2-dimethoxy-acetamides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2623226A1 DE2623226A1 (de) | 1976-12-16 |
| DE2623226C2 true DE2623226C2 (de) | 1986-03-20 |
Family
ID=26256391
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2623226A Expired DE2623226C2 (de) | 1975-05-27 | 1976-05-24 | N-Benzyl-2,2-dimethoxy-acetamide, Verfahren zu ihrer Herstellung und ihre Verwendung |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4041077A (enExample) |
| JP (1) | JPS51143630A (enExample) |
| CA (1) | CA1060045A (enExample) |
| DE (1) | DE2623226C2 (enExample) |
| DK (1) | DK223376A (enExample) |
| FI (1) | FI761421A7 (enExample) |
| FR (1) | FR2312489A1 (enExample) |
| HU (1) | HU173288B (enExample) |
| NL (1) | NL7605552A (enExample) |
| SU (1) | SU663299A3 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5564553A (en) * | 1978-11-09 | 1980-05-15 | Sumitomo Chem Co Ltd | N-benzyl-trimethylacetamide derivative, its preparation, and herbicide containing the same as effective component |
| JPS57192347A (en) * | 1981-05-18 | 1982-11-26 | Microbial Chem Res Found | N-(4-(3-aminopropyl)aminobutyl)-2,2-dihydroxyethanamide and its synthesis |
| JPS57185254A (en) | 1981-05-11 | 1982-11-15 | Microbial Chem Res Found | Novel carcinostatic substances and their preparation |
| JPH0193150U (enExample) * | 1987-12-14 | 1989-06-19 | ||
| GB8926512D0 (en) * | 1989-11-23 | 1990-01-10 | Pfizer Ltd | Therapeutic agents |
| UA57810C2 (uk) * | 1997-10-14 | 2003-07-15 | Монсанто Компані | Спосіб одержання похідних тіофену та проміжна сполука |
| AT500495A1 (de) * | 2004-03-12 | 2006-01-15 | Dsm Fine Chem Austria Gmbh | Verfahren zur herstellung von acetamid-acetalen |
-
1976
- 1976-05-12 SU SU762356009A patent/SU663299A3/ru active
- 1976-05-20 FI FI761421A patent/FI761421A7/fi not_active Application Discontinuation
- 1976-05-20 DK DK223376A patent/DK223376A/da not_active Application Discontinuation
- 1976-05-24 NL NL7605552A patent/NL7605552A/xx not_active Application Discontinuation
- 1976-05-24 US US05/689,148 patent/US4041077A/en not_active Expired - Lifetime
- 1976-05-24 DE DE2623226A patent/DE2623226C2/de not_active Expired
- 1976-05-24 FR FR7615720A patent/FR2312489A1/fr active Granted
- 1976-05-26 JP JP51061049A patent/JPS51143630A/ja active Granted
- 1976-05-26 CA CA253,407A patent/CA1060045A/en not_active Expired
- 1976-05-27 HU HU76UE73A patent/HU173288B/hu unknown
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| FI761421A7 (enExample) | 1976-11-28 |
| US4041077A (en) | 1977-08-09 |
| CA1060045A (en) | 1979-08-07 |
| NL7605552A (nl) | 1976-11-30 |
| DE2623226A1 (de) | 1976-12-16 |
| JPS51143630A (en) | 1976-12-10 |
| DK223376A (da) | 1976-11-28 |
| FR2312489A1 (fr) | 1976-12-24 |
| HU173288B (hu) | 1979-04-28 |
| JPS6114146B2 (enExample) | 1986-04-17 |
| SU663299A3 (ru) | 1979-05-15 |
| FR2312489B1 (enExample) | 1979-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2623226C2 (de) | N-Benzyl-2,2-dimethoxy-acetamide, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1240846B (de) | Verfahren zur Herstellung von Sulfamiden | |
| EP0380712A1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| DE2522314A1 (de) | In 2-stellung substituierte dimethoxyindazole | |
| DE1935404C3 (de) | Verfahren zur Herstellung von Chinazoline nen | |
| CH497367A (de) | Verfahren zur Herstellung von Zimtsäurederivaten und deren Verwendung | |
| DE2735036A1 (de) | Optisch aktive, n-substituierte pyrrolidine, verfahren zu ihrer herstellung und deren verwendung | |
| DE3884412T2 (de) | Verfahren zur Herstellung von alpha-(Benzyliden)-acetonylphosphonate. | |
| DE3403778A1 (de) | Cyanomethyl-(2-cyano-ethyl)-(3-hydroxy-propyl)-amin seine verwendung zur herstellung von 1-(3-hydroxy-propyl)-1,4-diazepan und 1,4-bis(3-(3,4,5-trimethoxybenzoyloxy)-propyl)-diazepan | |
| DE2627709C2 (de) | Malonsäure-pentachlorphenylester und deren Herstellung | |
| DD150057A5 (de) | Verfahren zur herstellung von 2-aminopyrazinen | |
| EP0064953A1 (de) | Stilbenverbindungen | |
| EP0345464A2 (de) | Verfahren zur Herstellung von substituierten 3-Amino-2(benzoyl)-acrylsäureestern sowie ein Verfahren zur Herstellung von Zwischenprodukten für antibakterielle Wirkstoffe aus diesen Verbindungen | |
| EP0271695B1 (de) | Verfahren zur Herstellung von Phosphin- oder Phosphonsäurechloriden | |
| AT364819B (de) | Verfahren zur stereospezifischen synthese von optisch aktiven, n-substituierten pyrrolidinen | |
| AT273972B (de) | Verfahren zur Herstellung von neuen 1-(2-Aminophenyl)-1,2,3,4-tetrahydroisochinolinen sowie von deren Salzen | |
| DE2923697A1 (de) | Neue 1-pyrrol- und pyrrolidin-carbonsaeure-derivate und verfahren zu deren herstellung | |
| AT270630B (de) | Verfahren zur Herstellung von neuen Pyrrolinderivaten und ihren Salzen | |
| CH532037A (de) | Verfahren zur Herstellung von Pyrrolverbindungen | |
| DE1470133C (de) | Substituierte alpha Pyrazinyl succinimide und Verfahren zu ihrer Herstellung | |
| DE1445659C (de) | Pyndylphosphorverbindungen und Verfahren zu ihrer Herstellung | |
| AT323123B (de) | Verfahren zur herstellung von n,n-disubstituierten charbonsäureamiden | |
| AT274802B (de) | Verfahren zur Herstellung von Indolderivaten | |
| DE1445073C (de) | 3H-l,4-Benzodiazepin-4-oxyde | |
| AT226724B (de) | Verfahren zur Herstellung von neuen 1-Aza-thioxanthen-Derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |