DE2621835A1 - Verfahren zur herstellung von cyclopropancarbonsaeurederivaten - Google Patents
Verfahren zur herstellung von cyclopropancarbonsaeurederivatenInfo
- Publication number
- DE2621835A1 DE2621835A1 DE19762621835 DE2621835A DE2621835A1 DE 2621835 A1 DE2621835 A1 DE 2621835A1 DE 19762621835 DE19762621835 DE 19762621835 DE 2621835 A DE2621835 A DE 2621835A DE 2621835 A1 DE2621835 A1 DE 2621835A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- alkali metal
- metal alkoxide
- stage
- treated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 29
- 239000002253 acid Substances 0.000 title description 12
- -1 alkali metal alkoxide Chemical class 0.000 claims description 29
- 229910052783 alkali metal Inorganic materials 0.000 claims description 25
- 239000002585 base Substances 0.000 claims description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 9
- 150000003512 tertiary amines Chemical class 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 claims description 3
- 229910014033 C-OH Inorganic materials 0.000 claims description 2
- 229910014570 C—OH Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 125000005270 trialkylamine group Chemical group 0.000 claims 1
- 125000006414 CCl Chemical group ClC* 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- LLMLSUSAKZVFOA-UHFFFAOYSA-N 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(O)=O LLMLSUSAKZVFOA-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- QPTWKDNRYCGMJM-UHFFFAOYSA-N ethyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CCOC(=O)C1C(C=C(Cl)Cl)C1(C)C QPTWKDNRYCGMJM-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- DKFGXLPITKDNNE-UHFFFAOYSA-N 4,6,6,6-tetrachloro-3,3-dimethylhexanoic acid Chemical compound OC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)Cl DKFGXLPITKDNNE-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- BXEFQPCKQSTMKA-UHFFFAOYSA-N OC(=O)C=[N+]=[N-] Chemical compound OC(=O)C=[N+]=[N-] BXEFQPCKQSTMKA-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 231100000357 carcinogen Toxicity 0.000 description 1
- 239000003183 carcinogenic agent Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Inorganic materials Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- QJOOIMSFFIUFKX-UHFFFAOYSA-N methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound COC(=O)C1C(C=C(Cl)Cl)C1(C)C QJOOIMSFFIUFKX-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C53/00—Saturated compounds having only one carboxyl group bound to an acyclic carbon atom or hydrogen
- C07C53/38—Acyl halides
- C07C53/46—Acyl halides containing halogen outside the carbonyl halide group
- C07C53/50—Acyl halides containing halogen outside the carbonyl halide group of acids containing three or more carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB20898/75A GB1519053A (en) | 1975-05-16 | 1975-05-16 | Process for preparing cyclopropane esters |
| GB2331575 | 1975-05-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2621835A1 true DE2621835A1 (de) | 1976-11-25 |
Family
ID=26254970
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762621835 Withdrawn DE2621835A1 (de) | 1975-05-16 | 1976-05-17 | Verfahren zur herstellung von cyclopropancarbonsaeurederivaten |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS51143648A (en)) |
| AU (1) | AU507917B2 (en)) |
| DE (1) | DE2621835A1 (en)) |
| FR (2) | FR2333776A1 (en)) |
| NL (1) | NL7605173A (en)) |
| NZ (1) | NZ180822A (en)) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0021114A1 (de) * | 1979-06-12 | 1981-01-07 | Bayer Ag | Verfahren zur Herstellung von 2-Cyano-3,3-dimethyl-cyclopropan-1-carbonsäureestern, Zwischenprodukte hierfür und deren Herstellung |
| EP0056154A1 (de) * | 1981-01-08 | 1982-07-21 | Bayer Ag | Verfahren zur Herstellung von 2,2-Dimethyl-3-vinyl-cyclopropancarbonsäuren und deren Estern |
| EP0095047A1 (de) * | 1982-05-05 | 1983-11-30 | Bayer Ag | Verfahren zur Herstellung von 3-vinylsubstituierten 2,2-Dimethylcyclopropan-1-carbonsäuren bzw. ihren Estern und neue Zwischenprodukte dafür |
| US4458090A (en) * | 1975-07-22 | 1984-07-03 | Kuraray Co., Ltd. | Method of producing cyclopropanecarboxylic acids and esters |
| US4551281A (en) * | 1978-10-31 | 1985-11-05 | Imperial Chemical Industries Plc | Process for the preparation of cyclopropane carboxylic acid esters |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU511487B2 (en) * | 1975-05-16 | 1980-08-21 | Imperial Chemical Industries Ltd | Cyclopropane derivatives |
| EP0051355A1 (en) * | 1980-10-08 | 1982-05-12 | Imperial Chemical Industries Plc | An improved process for the preparation of certain cyclopropane pyrethroid intermediates having a high cis-content |
| GB0017617D0 (en) * | 2000-07-18 | 2000-09-06 | Zeneca Ltd | Chemical process |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1239370A (fr) * | 1959-07-11 | 1960-08-26 | Rhone Poulenc Sa | Procédé de préparation de l'acide dihydrochrysanthémique et produits intermédiaires nouveaux |
| DE2544150A1 (de) * | 1974-10-03 | 1976-04-15 | Kuraray Co | Verfahren zur herstellung von substituierten cyclopropancarbonsaeuren und ihren estern |
| JPS5159839A (ja) * | 1974-10-23 | 1976-05-25 | Sankyo Co | Shikuropuropankarubonsanjudotaino seizoho |
| LU73349A1 (en)) * | 1975-09-08 | 1976-04-13 |
-
1976
- 1976-05-10 NZ NZ18082276A patent/NZ180822A/xx unknown
- 1976-05-11 AU AU13799/76A patent/AU507917B2/en not_active Expired
- 1976-05-14 NL NL7605173A patent/NL7605173A/xx not_active Application Discontinuation
- 1976-05-14 FR FR7614736A patent/FR2333776A1/fr active Granted
- 1976-05-17 DE DE19762621835 patent/DE2621835A1/de not_active Withdrawn
- 1976-05-17 JP JP5548876A patent/JPS51143648A/ja active Pending
-
1977
- 1977-01-07 FR FR7700362A patent/FR2322845A1/fr active Granted
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4458090A (en) * | 1975-07-22 | 1984-07-03 | Kuraray Co., Ltd. | Method of producing cyclopropanecarboxylic acids and esters |
| US4468521A (en) * | 1975-07-22 | 1984-08-28 | Kuraray Co., Ltd. | Method of producing gamma-halogeno-delta unsaturated carboxylic acid esters |
| US4551281A (en) * | 1978-10-31 | 1985-11-05 | Imperial Chemical Industries Plc | Process for the preparation of cyclopropane carboxylic acid esters |
| EP0021114A1 (de) * | 1979-06-12 | 1981-01-07 | Bayer Ag | Verfahren zur Herstellung von 2-Cyano-3,3-dimethyl-cyclopropan-1-carbonsäureestern, Zwischenprodukte hierfür und deren Herstellung |
| EP0056154A1 (de) * | 1981-01-08 | 1982-07-21 | Bayer Ag | Verfahren zur Herstellung von 2,2-Dimethyl-3-vinyl-cyclopropancarbonsäuren und deren Estern |
| US4423243A (en) | 1981-01-08 | 1983-12-27 | Bayer Aktiengesellschaft | Process for the preparation of 2,2-dimethyl-3-vinyl-cyclopropanecarboxylic acids and esters |
| EP0095047A1 (de) * | 1982-05-05 | 1983-11-30 | Bayer Ag | Verfahren zur Herstellung von 3-vinylsubstituierten 2,2-Dimethylcyclopropan-1-carbonsäuren bzw. ihren Estern und neue Zwischenprodukte dafür |
| US4992577A (en) * | 1982-05-05 | 1991-02-12 | Bayer Aktiengesellschaft | Preparation of 3-vinyl-substituted 2,2-dimethylcyclopropane-1-carboxylic acids and esters and intermediates therefor |
Also Published As
| Publication number | Publication date |
|---|---|
| AU1379976A (en) | 1977-11-17 |
| FR2322845B1 (en)) | 1980-07-11 |
| FR2333776B1 (en)) | 1981-02-27 |
| NL7605173A (nl) | 1976-11-18 |
| FR2322845A1 (fr) | 1977-04-01 |
| JPS51143648A (en) | 1976-12-10 |
| AU507917B2 (en) | 1980-03-06 |
| NZ180822A (en) | 1979-03-16 |
| FR2333776A1 (fr) | 1977-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2621835A1 (de) | Verfahren zur herstellung von cyclopropancarbonsaeurederivaten | |
| DE2634663B2 (de) | Verfahren zur Herstellung eines optisch aktiven Alkylchrysanthemummonocarbonsäureesters | |
| DE2751610A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| DE2404160C3 (de) | Verfahren zur Herstellung von 2-(4-Alkylphenyl)-propionsäuren | |
| DE2630981C2 (de) | 4-β,β-Dichlor- und 4-β,β-Dibromvinyl-3,3-dimethylbutyrolactone, Verfahren zu ihrer Herstellung und deren Verwendung zur Herstellung von Estern der 3-β,β-Dichlor- oder 3-β,β-Dibrom-vinyl-2,2-dimethylcyclopropancarbonsäure | |
| DE69409733T2 (de) | Verfahren zur Herstellung optisch aktiven 2-Norbornanons | |
| EP0087585A1 (de) | Verfahren zur Herstellung von 3-Alkoxi-acrylnitrilen | |
| DE2621830A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| DE2533396C2 (de) | 3-Methyl-3-aryl-brenztraubensäureester und Verfahren zu ihrer Herstellung | |
| DE60101391T2 (de) | Verfahren zum Herstellen von Pivaloylessigsäureester | |
| DE2044698B2 (de) | Verfahren zur herstellung von cyclopentanderivaten mit der struktur der prostaglandine | |
| DE2708677B2 (de) | Verfahren zur Herstellung von Alkoxycarbonylperfluoralkylperfluorvinyläthern | |
| DE2727613A1 (de) | Cyanosubstituierte cyclopropanderivate und verfahren zu ihrer herstellung | |
| DE3037086A1 (de) | 3-(m-chloranilino-)acrylsaeureaethylester und ein verfahren zu dessen herstellung | |
| EP0103749B1 (de) | Dialkoxymethyl-butyrolactone, Verfahren zu ihrer Herstellung, Zwischenprodukte dafür und ihre Verwendung | |
| DE3636818A1 (de) | Verfahren zur herstellung von valpronsaeure | |
| DE1951294B2 (de) | Verfahren zur Herstellung von 3-Hydroxy-2-methyl-y-pyron (Maltol) | |
| DE2412784C3 (de) | Verfahren zur Herstellung von aliphatischen ß -Ketoestern | |
| EP0014478A1 (de) | Verfahren zur Herstellung von Alkyl-4,10-dihydro-10-oxo-thieno-(3,2-c)-(1)-benzoxepin-8-acetat | |
| EP0502392B1 (de) | Verfahren zur Herstellung von D-(+)-Biotin und Zwischenprodukte in diesem Verfahren | |
| CH628634A5 (de) | Verfahren zur herstellung von 2,2'-bis(3,4-epoxy-5-oxotetrahydropyran)aether und produkt. | |
| DE2653446C2 (de) | Verfahren zur Herstellung von Pyrogallolverbindungen | |
| DE2744828C3 (de) | Verfahren zur Herstellung von a -Oxoestern | |
| DE2229225A1 (de) | Derivate von 10 Oxaprostansaure und Verfahren zu ihrer Herstellung | |
| DE2440745C3 (de) | Verfahren zur Abtrennung von cis-Chrysanthemummonocarbonsäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |