DE2601958A1 - Loesungspolymerisationsverfahren fuer die herstellung von linearen aromatischen polyestern - Google Patents
Loesungspolymerisationsverfahren fuer die herstellung von linearen aromatischen polyesternInfo
- Publication number
- DE2601958A1 DE2601958A1 DE19762601958 DE2601958A DE2601958A1 DE 2601958 A1 DE2601958 A1 DE 2601958A1 DE 19762601958 DE19762601958 DE 19762601958 DE 2601958 A DE2601958 A DE 2601958A DE 2601958 A1 DE2601958 A1 DE 2601958A1
- Authority
- DE
- Germany
- Prior art keywords
- glycol
- hydroxyl
- chloride
- carbon atoms
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 64
- 230000008569 process Effects 0.000 title claims description 38
- 229920000728 polyester Polymers 0.000 title claims description 20
- 238000010528 free radical solution polymerization reaction Methods 0.000 title claims description 17
- 238000004519 manufacturing process Methods 0.000 title claims description 9
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical group C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 45
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 33
- 150000004820 halides Chemical class 0.000 claims description 30
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 25
- -1 oxalyl halide Chemical class 0.000 claims description 22
- 229930185605 Bisphenol Natural products 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical group ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 10
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 claims description 9
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 claims description 6
- 125000000732 arylene group Chemical group 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000006492 halo alkyl aryl group Chemical group 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000003106 haloaryl group Chemical group 0.000 claims description 2
- 125000005347 halocycloalkyl group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 75
- 239000000243 solution Substances 0.000 description 52
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 36
- 229920000642 polymer Polymers 0.000 description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- 239000002904 solvent Substances 0.000 description 20
- 238000003756 stirring Methods 0.000 description 15
- 238000007792 addition Methods 0.000 description 13
- 239000012153 distilled water Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 11
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 10
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 239000001294 propane Substances 0.000 description 10
- 238000001556 precipitation Methods 0.000 description 8
- 239000000376 reactant Substances 0.000 description 8
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 229920001634 Copolyester Polymers 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000000465 moulding Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 239000001273 butane Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 238000005227 gel permeation chromatography Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 2
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 235000019437 butane-1,3-diol Nutrition 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- PFURGBBHAOXLIO-UHFFFAOYSA-N cyclohexane-1,2-diol Chemical compound OC1CCCCC1O PFURGBBHAOXLIO-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000012086 standard solution Substances 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- ZLYYJUJDFKGVKB-OWOJBTEDSA-N (e)-but-2-enedioyl dichloride Chemical compound ClC(=O)\C=C\C(Cl)=O ZLYYJUJDFKGVKB-OWOJBTEDSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- IPNQEKDRLAFQKQ-UHFFFAOYSA-N 1,2-dimethylcyclohexane-1,2-diol Chemical compound CC1(O)CCCCC1(C)O IPNQEKDRLAFQKQ-UHFFFAOYSA-N 0.000 description 1
- IICHVFLQUNQPON-UHFFFAOYSA-N 1,2-dimethylcyclopentane-1,2-diol Chemical compound CC1(O)CCCC1(C)O IICHVFLQUNQPON-UHFFFAOYSA-N 0.000 description 1
- 229940058015 1,3-butylene glycol Drugs 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PCMIWASLPQNSCD-UHFFFAOYSA-N 1-cyclohexyl-2-methylbenzene Chemical compound CC1=CC=CC=C1C1CCCCC1 PCMIWASLPQNSCD-UHFFFAOYSA-N 0.000 description 1
- ZAJYARZMPOEGLK-UHFFFAOYSA-N 1-ethyl-2-propan-2-ylbenzene Chemical compound CCC1=CC=CC=C1C(C)C ZAJYARZMPOEGLK-UHFFFAOYSA-N 0.000 description 1
- KZFJKZOIPUWQJU-UHFFFAOYSA-N 1-hexyl-2-propan-2-ylbenzene Chemical compound CCCCCCC1=CC=CC=C1C(C)C KZFJKZOIPUWQJU-UHFFFAOYSA-N 0.000 description 1
- LLARTCSTTUKQSG-UHFFFAOYSA-N 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol Chemical compound C1=C(Br)C(O)=C(Br)C=C1P(=O)(C=1C=C(Br)C(O)=C(Br)C=1)C1=CC=CC=C1 LLARTCSTTUKQSG-UHFFFAOYSA-N 0.000 description 1
- WPZJSWWEEJJSIZ-UHFFFAOYSA-N 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)methyl]phenol Chemical compound C1=C(Br)C(O)=C(Br)C=C1CC1=CC(Br)=C(O)C(Br)=C1 WPZJSWWEEJJSIZ-UHFFFAOYSA-N 0.000 description 1
- WIFDRXSVRSCMMY-UHFFFAOYSA-N 2,6-dichloro-4-[(3,5-dichloro-4-hydroxyphenyl)methyl]phenol Chemical compound C1=C(Cl)C(O)=C(Cl)C=C1CC1=CC(Cl)=C(O)C(Cl)=C1 WIFDRXSVRSCMMY-UHFFFAOYSA-N 0.000 description 1
- RWLALWYNXFYRGW-UHFFFAOYSA-N 2-Ethyl-1,3-hexanediol Chemical compound CCCC(O)C(CC)CO RWLALWYNXFYRGW-UHFFFAOYSA-N 0.000 description 1
- HYYFAYFMSHAWFA-UHFFFAOYSA-N 2-cyclohexylethylbenzene Chemical compound C1CCCCC1CCC1=CC=CC=C1 HYYFAYFMSHAWFA-UHFFFAOYSA-N 0.000 description 1
- VNAWKNVDKFZFSU-UHFFFAOYSA-N 2-ethyl-2-methylpropane-1,3-diol Chemical compound CCC(C)(CO)CO VNAWKNVDKFZFSU-UHFFFAOYSA-N 0.000 description 1
- BZVMGPSXJDFUPI-UHFFFAOYSA-N 3-[2-(3-carboxyphenyl)propan-2-yl]benzoic acid Chemical compound C=1C=CC(C(O)=O)=CC=1C(C)(C)C1=CC=CC(C(O)=O)=C1 BZVMGPSXJDFUPI-UHFFFAOYSA-N 0.000 description 1
- LAIMYEJOJSIPQW-UHFFFAOYSA-N 3-[3-(3-carboxyphenyl)heptan-3-yl]benzoic acid Chemical compound C=1C=CC(C(O)=O)=CC=1C(CC)(CCCC)C1=CC=CC(C(O)=O)=C1 LAIMYEJOJSIPQW-UHFFFAOYSA-N 0.000 description 1
- XWEBTVZIZWEJOO-UHFFFAOYSA-N 3-chlorosulfonylbenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 XWEBTVZIZWEJOO-UHFFFAOYSA-N 0.000 description 1
- VWGKEVWFBOUAND-UHFFFAOYSA-N 4,4'-thiodiphenol Chemical compound C1=CC(O)=CC=C1SC1=CC=C(O)C=C1 VWGKEVWFBOUAND-UHFFFAOYSA-N 0.000 description 1
- ICJAQOPPQSZXTM-UHFFFAOYSA-N 4,5,6-trichlorobenzene-1,3-disulfonyl chloride Chemical compound ClC1=C(Cl)C(S(Cl)(=O)=O)=CC(S(Cl)(=O)=O)=C1Cl ICJAQOPPQSZXTM-UHFFFAOYSA-N 0.000 description 1
- DELKNGSNILXDSN-UHFFFAOYSA-N 4,5-dichlorobenzene-1,3-disulfonyl chloride Chemical compound ClC1=CC(S(Cl)(=O)=O)=CC(S(Cl)(=O)=O)=C1Cl DELKNGSNILXDSN-UHFFFAOYSA-N 0.000 description 1
- DNZIWTIEBNEXOF-UHFFFAOYSA-N 4,6-dichlorobenzene-1,3-disulfonyl chloride Chemical compound ClC1=CC(Cl)=C(S(Cl)(=O)=O)C=C1S(Cl)(=O)=O DNZIWTIEBNEXOF-UHFFFAOYSA-N 0.000 description 1
- LFEWXDOYPCWFHR-UHFFFAOYSA-N 4-(4-carboxybenzoyl)benzoic acid Chemical group C1=CC(C(=O)O)=CC=C1C(=O)C1=CC=C(C(O)=O)C=C1 LFEWXDOYPCWFHR-UHFFFAOYSA-N 0.000 description 1
- WVDRSXGPQWNUBN-UHFFFAOYSA-N 4-(4-carboxyphenoxy)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OC1=CC=C(C(O)=O)C=C1 WVDRSXGPQWNUBN-UHFFFAOYSA-N 0.000 description 1
- SQJQLYOMPSJVQS-UHFFFAOYSA-N 4-(4-carboxyphenyl)sulfonylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1S(=O)(=O)C1=CC=C(C(O)=O)C=C1 SQJQLYOMPSJVQS-UHFFFAOYSA-N 0.000 description 1
- OTFAWEIFBPUXOH-UHFFFAOYSA-N 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1C1=CC=C(S(Cl)(=O)=O)C=C1 OTFAWEIFBPUXOH-UHFFFAOYSA-N 0.000 description 1
- JONQFYJSLCHKJR-UHFFFAOYSA-N 4-(4-hydroxy-n-methylanilino)phenol Chemical compound C=1C=C(O)C=CC=1N(C)C1=CC=C(O)C=C1 JONQFYJSLCHKJR-UHFFFAOYSA-N 0.000 description 1
- RQCACQIALULDSK-UHFFFAOYSA-N 4-(4-hydroxyphenyl)sulfinylphenol Chemical compound C1=CC(O)=CC=C1S(=O)C1=CC=C(O)C=C1 RQCACQIALULDSK-UHFFFAOYSA-N 0.000 description 1
- NOGYFAIHVRCHRE-UHFFFAOYSA-N 4-[(3,5-difluoro-4-hydroxyphenyl)methyl]-2,6-difluorophenol Chemical compound C1=C(F)C(O)=C(F)C=C1CC1=CC(F)=C(O)C(F)=C1 NOGYFAIHVRCHRE-UHFFFAOYSA-N 0.000 description 1
- JGEQBQZIGJPCSP-UHFFFAOYSA-N 4-[(4-carboxyphenyl)-dichloromethyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(Cl)(Cl)C1=CC=C(C(O)=O)C=C1 JGEQBQZIGJPCSP-UHFFFAOYSA-N 0.000 description 1
- VTDMBRAUHKUOON-UHFFFAOYSA-N 4-[(4-carboxyphenyl)methyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CC1=CC=C(C(O)=O)C=C1 VTDMBRAUHKUOON-UHFFFAOYSA-N 0.000 description 1
- MIFGCULLADMRTF-UHFFFAOYSA-N 4-[(4-hydroxy-3-methylphenyl)methyl]-2-methylphenol Chemical compound C1=C(O)C(C)=CC(CC=2C=C(C)C(O)=CC=2)=C1 MIFGCULLADMRTF-UHFFFAOYSA-N 0.000 description 1
- BATCUENAARTUKW-UHFFFAOYSA-N 4-[(4-hydroxyphenyl)-diphenylmethyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BATCUENAARTUKW-UHFFFAOYSA-N 0.000 description 1
- OLZBOWFKDWDPKA-UHFFFAOYSA-N 4-[1-(4-carboxyphenyl)ethyl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1C(C)C1=CC=C(C(O)=O)C=C1 OLZBOWFKDWDPKA-UHFFFAOYSA-N 0.000 description 1
- WJTQZEKXTKIYOW-UHFFFAOYSA-N 4-[2-(4-carboxyphenyl)-3-methylbutan-2-yl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1C(C)(C(C)C)C1=CC=C(C(O)=O)C=C1 WJTQZEKXTKIYOW-UHFFFAOYSA-N 0.000 description 1
- XZRZTOJUXFSPMZ-UHFFFAOYSA-N 4-[2-(4-carboxyphenyl)butan-2-yl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1C(C)(CC)C1=CC=C(C(O)=O)C=C1 XZRZTOJUXFSPMZ-UHFFFAOYSA-N 0.000 description 1
- PKECBVSFYYXVOV-UHFFFAOYSA-N 4-[2-(4-carboxyphenyl)pentan-2-yl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1C(C)(CCC)C1=CC=C(C(O)=O)C=C1 PKECBVSFYYXVOV-UHFFFAOYSA-N 0.000 description 1
- XKACUVXWRVMXOE-UHFFFAOYSA-N 4-[2-(4-carboxyphenyl)propan-2-yl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1C(C)(C)C1=CC=C(C(O)=O)C=C1 XKACUVXWRVMXOE-UHFFFAOYSA-N 0.000 description 1
- NNDRYYQCGFNWDX-UHFFFAOYSA-N 4-[3-(4-carboxyphenyl)heptan-3-yl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1C(CC)(CCCC)C1=CC=C(C(O)=O)C=C1 NNDRYYQCGFNWDX-UHFFFAOYSA-N 0.000 description 1
- JYJUMAFOXPQPAU-UHFFFAOYSA-N 4-chlorosulfonylbenzoyl chloride Chemical compound ClC(=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JYJUMAFOXPQPAU-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- AQZGPSLYZOOYQP-UHFFFAOYSA-N Diisoamyl ether Chemical compound CC(C)CCOCCC(C)C AQZGPSLYZOOYQP-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 238000012695 Interfacial polymerization Methods 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N Tetraethylene glycol, Natural products OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- PWAXUOGZOSVGBO-UHFFFAOYSA-N adipoyl chloride Chemical compound ClC(=O)CCCCC(Cl)=O PWAXUOGZOSVGBO-UHFFFAOYSA-N 0.000 description 1
- 229920003232 aliphatic polyester Polymers 0.000 description 1
- 239000012296 anti-solvent Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- YBGQXNZTVFEKEN-UHFFFAOYSA-N benzene-1,2-disulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1S(Cl)(=O)=O YBGQXNZTVFEKEN-UHFFFAOYSA-N 0.000 description 1
- ALIQZUMMPOYCIS-UHFFFAOYSA-N benzene-1,3-disulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 ALIQZUMMPOYCIS-UHFFFAOYSA-N 0.000 description 1
- VXAHVGZHHKANSQ-UHFFFAOYSA-N benzene-1,4-dicarbonyl chloride;2,2-dimethylpropane-1,3-diol Chemical compound OCC(C)(C)CO.ClC(=O)C1=CC=C(C(Cl)=O)C=C1 VXAHVGZHHKANSQ-UHFFFAOYSA-N 0.000 description 1
- DCCKKXXKYBHGCC-UHFFFAOYSA-N benzene-1,4-disulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(S(Cl)(=O)=O)C=C1 DCCKKXXKYBHGCC-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- IMHDGJOMLMDPJN-UHFFFAOYSA-N biphenyl-2,2'-diol Chemical group OC1=CC=CC=C1C1=CC=CC=C1O IMHDGJOMLMDPJN-UHFFFAOYSA-N 0.000 description 1
- HPDJOPVEPSPVPX-UHFFFAOYSA-N bis(3,5-dibromo-4-hydroxyphenyl)methanone Chemical compound C1=C(Br)C(O)=C(Br)C=C1C(=O)C1=CC(Br)=C(O)C(Br)=C1 HPDJOPVEPSPVPX-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- OWBTYPJTUOEWEK-UHFFFAOYSA-N butane-2,3-diol Chemical compound CC(O)C(C)O OWBTYPJTUOEWEK-UHFFFAOYSA-N 0.000 description 1
- 238000011088 calibration curve Methods 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- WMPOZLHMGVKUEJ-UHFFFAOYSA-N decanedioyl dichloride Chemical compound ClC(=O)CCCCCCCCC(Cl)=O WMPOZLHMGVKUEJ-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005485 electric heating Methods 0.000 description 1
- 229940082150 encore Drugs 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 229940051250 hexylene glycol Drugs 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000010406 interfacial reaction Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002991 molded plastic Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical compound C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 1
- FJKUZZHKEDNPDN-UHFFFAOYSA-N naphthalene-2,7-disulfonyl chloride Chemical compound C1=CC(S(Cl)(=O)=O)=CC2=CC(S(=O)(=O)Cl)=CC=C21 FJKUZZHKEDNPDN-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- BNIXVQGCZULYKV-UHFFFAOYSA-N pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
- 229950006389 thiodiglycol Drugs 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/12—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/40—Polyesters derived from ester-forming derivatives of polycarboxylic acids or of polyhydroxy compounds, other than from esters thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/542,644 US4049629A (en) | 1975-01-20 | 1975-01-20 | Solution polycondensation method |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2601958A1 true DE2601958A1 (de) | 1976-07-22 |
Family
ID=24164717
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762601958 Pending DE2601958A1 (de) | 1975-01-20 | 1976-01-20 | Loesungspolymerisationsverfahren fuer die herstellung von linearen aromatischen polyestern |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4049629A (enExample) |
| JP (1) | JPS5196887A (enExample) |
| BE (1) | BE837724A (enExample) |
| BR (1) | BR7600330A (enExample) |
| DE (1) | DE2601958A1 (enExample) |
| FR (1) | FR2297871A1 (enExample) |
| GB (1) | GB1504091A (enExample) |
| IT (1) | IT1054269B (enExample) |
| NL (1) | NL7600561A (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4132705A (en) * | 1977-07-28 | 1979-01-02 | Celanese Corporation | Process for preparing a halogenated aromatic polyester having a predetermined molecular weight by solution polymerization technique |
| EP0005858B1 (en) * | 1978-06-01 | 1983-05-11 | Union Carbide Corporation | Preparation of polyarylates |
| JPS578243A (en) * | 1980-06-19 | 1982-01-16 | Unitika Ltd | Method of improving transparency of aromatic polyester or composition thereof |
| KR950006716B1 (ko) * | 1991-10-16 | 1995-06-21 | 재단법인한국화학연구소 | 열경화성 폴리아릴레이트 수지 |
| KR0170080B1 (ko) * | 1996-02-26 | 1999-03-30 | 김흥기 | 난연성 전방향족 폴리에스테르 및 그의 제조방법 |
| CN102482405B (zh) * | 2009-07-01 | 2014-06-04 | 索尔维投资有限公司 | 制备聚醚-聚酯嵌段共聚物的方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3037960A (en) * | 1958-01-09 | 1962-06-05 | Du Pont | Linear segmented copolyester and articles formed therefrom |
| NL129038C (nl) * | 1960-06-01 | 1970-01-15 | Gen Electric | Werkwijze ter bereiding van lineaire polyesters |
| NL279466A (enExample) | 1962-06-07 | |||
| US3498950A (en) * | 1964-04-24 | 1970-03-03 | Hooker Chemical Corp | Process for preparation of a polyester polymer |
| US3702838A (en) * | 1970-08-26 | 1972-11-14 | Du Pont | Lewis acid catalyzed diacyl chloride-diphenol polyesterification |
| US3972852A (en) * | 1973-08-07 | 1976-08-03 | Teijin Limited | Process for preparing aromatic polyesters from diphenols |
-
1975
- 1975-01-20 US US05/542,644 patent/US4049629A/en not_active Expired - Lifetime
-
1976
- 1976-01-19 BR BR7600330A patent/BR7600330A/pt unknown
- 1976-01-19 GB GB1987/76A patent/GB1504091A/en not_active Expired
- 1976-01-20 NL NL7600561A patent/NL7600561A/xx unknown
- 1976-01-20 BE BE163640A patent/BE837724A/xx unknown
- 1976-01-20 FR FR7601417A patent/FR2297871A1/fr not_active Withdrawn
- 1976-01-20 DE DE19762601958 patent/DE2601958A1/de active Pending
- 1976-01-20 JP JP51005372A patent/JPS5196887A/ja active Pending
- 1976-01-20 IT IT19417/76A patent/IT1054269B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| BR7600330A (pt) | 1976-08-31 |
| BE837724A (fr) | 1976-07-20 |
| IT1054269B (it) | 1981-11-10 |
| JPS5196887A (enExample) | 1976-08-25 |
| NL7600561A (nl) | 1976-07-22 |
| GB1504091A (en) | 1978-03-15 |
| US4049629A (en) | 1977-09-20 |
| FR2297871A1 (fr) | 1976-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2720502A (en) | Organo-metallic titanium catalysts for the preparation of polyesters | |
| DE2261503C3 (de) | Verfahren zur Herstellung eines zweiten Polyesters aus einem ersten Polyester | |
| EP0157732B1 (de) | Vernetzbare, lineare Polyätherharze | |
| DE2342415A1 (de) | Neue, lineare homo- und copolyester auf basis von tere- und/oder isophthalsaeure | |
| DE2714544A1 (de) | Bisphenol-a-terephthalat-carbonat- copolymer und verfahren zu dessen herstellung | |
| DE3016019A1 (de) | Verfahren zur herstellung von polyester/carbonat-mischpolymeren | |
| DE2846689A1 (de) | Thermoplastische polymermassen | |
| EP0127842A1 (de) | Diphenolmonoester von Carbonsäuren, ein Verfahren zu ihrer Herstellung, ihre Verwendung zur Herstellung von Polyestercarbonaten, die erfindungsgemäss erhältlichen Polyestercarbonate sowie flammwidrige Formmassen enthaltend diese Polyestercarbonate | |
| DE2331596A1 (de) | Thermoplastische mischpolyaetherester auf der grundlage von 2,6-naphthalindicarbonsaeure | |
| DE2744648A1 (de) | Thermoplastische kopolyester | |
| US4251429A (en) | Polymer blends with improved flame retardance | |
| US4866155A (en) | Polester of bis(2-(hydroxyphenyl)-hexafluoroisopropyl)diphenyl ether | |
| DE2601958A1 (de) | Loesungspolymerisationsverfahren fuer die herstellung von linearen aromatischen polyestern | |
| DE3028092A1 (de) | Thermoplastische polymermaterialien und ihre herstellung | |
| DE2601960A1 (de) | Lineare aromatische polyester und schmelzpolymerisationsverfahren fuer ihre herstellung | |
| DE3727730A1 (de) | Verfahren zur herstellung von vollaromatischen, thermotropen polyestern und polyestercarbonaten | |
| DE2833024C2 (enExample) | ||
| DE2601957A1 (de) | Mikrostrukturierte polyesterpolymere und verfahren zu ihrer herstellung | |
| DE2333017A1 (de) | Zubereitungen auf copolyester-basis mit herabgesetzter haarrissbildung und verbesserter verpress- bzw. verformbarkeit | |
| DE3700660A1 (de) | Verfahren zur herstellung eines copolyesters | |
| US3310532A (en) | Method for preparation of modified polyesters having fiber- and film-forming properties | |
| DE2601959A1 (de) | Copolyesterharze mit hohem molekulargewicht und hohem grad an alternierender struktur und verfahren zu ihrer herstellung | |
| DE69122703T2 (de) | Kristalliner vollaromatischer Polyester, Verfahren zu seiner Herstellung, seine Harzzusammensetzung und aus dieser Harzzusammensetzung hergestellte Gegenstände | |
| DE69219798T2 (de) | Verfahren zur Herstellung aromatischer Polyester | |
| CA1063292A (en) | Polyester solution polycondensation method |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |