DE2541407C3 - Zündmaterial für eine mit hoher Spannung betriebene Blitzlichtlampe - Google Patents
Zündmaterial für eine mit hoher Spannung betriebene BlitzlichtlampeInfo
- Publication number
- DE2541407C3 DE2541407C3 DE2541407A DE2541407A DE2541407C3 DE 2541407 C3 DE2541407 C3 DE 2541407C3 DE 2541407 A DE2541407 A DE 2541407A DE 2541407 A DE2541407 A DE 2541407A DE 2541407 C3 DE2541407 C3 DE 2541407C3
- Authority
- DE
- Germany
- Prior art keywords
- ignition material
- ignition
- lamp
- high voltage
- flashlight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 42
- 239000000203 mixture Substances 0.000 claims description 10
- 238000002485 combustion reaction Methods 0.000 claims description 9
- 239000000843 powder Substances 0.000 claims description 8
- 229910020599 Co 3 O 4 Inorganic materials 0.000 claims description 7
- 239000000654 additive Substances 0.000 claims description 6
- 230000000996 additive effect Effects 0.000 claims description 6
- 239000007800 oxidant agent Substances 0.000 claims description 6
- 239000008247 solid mixture Substances 0.000 claims description 4
- 229910000480 nickel oxide Inorganic materials 0.000 claims description 3
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical class [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 claims description 3
- 229920005596 polymer binder Polymers 0.000 claims description 2
- 239000002491 polymer binding agent Substances 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 7
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 6
- 229910052746 lanthanum Inorganic materials 0.000 description 6
- 229910052963 cobaltite Inorganic materials 0.000 description 5
- 229910052726 zirconium Inorganic materials 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000000446 fuel Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 150000002603 lanthanum Chemical class 0.000 description 3
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000004065 semiconductor Substances 0.000 description 3
- 239000011324 bead Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000008199 coating composition Substances 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- VEASZGAADGZARC-UHFFFAOYSA-L barium(2+);dibromate Chemical compound [Ba+2].[O-]Br(=O)=O.[O-]Br(=O)=O VEASZGAADGZARC-UHFFFAOYSA-L 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 239000012777 electrically insulating material Substances 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000005355 lead glass Substances 0.000 description 1
- 239000012476 oxidizable substance Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000002987 primer (paints) Substances 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002492 water-soluble polymer binding agent Substances 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F21—LIGHTING
- F21K—NON-ELECTRIC LIGHT SOURCES USING LUMINESCENCE; LIGHT SOURCES USING ELECTROCHEMILUMINESCENCE; LIGHT SOURCES USING CHARGES OF COMBUSTIBLE MATERIAL; LIGHT SOURCES USING SEMICONDUCTOR DEVICES AS LIGHT-GENERATING ELEMENTS; LIGHT SOURCES NOT OTHERWISE PROVIDED FOR
- F21K5/00—Light sources using charges of combustible material, e.g. illuminating flash devices
- F21K5/02—Light sources using charges of combustible material, e.g. illuminating flash devices ignited in a non-disrupting container, e.g. photo-flash bulb
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Air Bags (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
- Formation Of Various Coating Films On Cathode Ray Tubes And Lamps (AREA)
- Common Detailed Techniques For Electron Tubes Or Discharge Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/508,107 US3972673A (en) | 1974-09-23 | 1974-09-23 | Photoflash lamp |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2541407A1 DE2541407A1 (de) | 1976-04-01 |
| DE2541407B2 DE2541407B2 (de) | 1979-11-08 |
| DE2541407C3 true DE2541407C3 (de) | 1980-07-24 |
Family
ID=24021412
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2541407A Expired DE2541407C3 (de) | 1974-09-23 | 1975-09-17 | Zündmaterial für eine mit hoher Spannung betriebene Blitzlichtlampe |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3972673A (https=) |
| JP (1) | JPS5728161B2 (https=) |
| BE (1) | BE833706A (https=) |
| BR (1) | BR7506159A (https=) |
| CA (1) | CA1071401A (https=) |
| DE (1) | DE2541407C3 (https=) |
| FR (1) | FR2285354A1 (https=) |
| GB (1) | GB1515404A (https=) |
| IT (1) | IT1042702B (https=) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4128858A (en) * | 1975-04-14 | 1978-12-05 | General Electric Company | Multiple flashlamp system |
| US4059388A (en) * | 1975-11-05 | 1977-11-22 | Gte Sylvania Incorporated | Photoflash lamp |
| US4369028A (en) * | 1976-11-24 | 1983-01-18 | Gte Products Corporation | Photoflash lamp |
| US4341513A (en) * | 1980-05-05 | 1982-07-27 | Gte Products Corporation | Subminiature photoflash lamp having light-emitting pyrotechnic charge |
| US5821451A (en) * | 1996-12-19 | 1998-10-13 | Eastman Kodak Company | Photoflash particle mixture |
| CN108083235B (zh) * | 2017-12-29 | 2021-03-16 | 陕西斯达防爆安全科技股份有限公司 | 一种氧烛用传火药及其制备方法 |
| CN115317969B (zh) * | 2022-07-28 | 2024-10-25 | 格林美（江苏）钴业股份有限公司 | 一种机洗压滤机的深度脱水方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE473152A (https=) * | ||||
| US2791111A (en) * | 1953-01-15 | 1957-05-07 | Westinghouse Electric Corp | Fulminator for photoflash lamps |
| US3028229A (en) * | 1958-08-27 | 1962-04-03 | Universal Match Corp | Pyrotechnic compositions |
| US2982119A (en) * | 1959-04-27 | 1961-05-02 | Gen Electric | Flash lamp |
| US3111016A (en) * | 1960-12-01 | 1963-11-19 | Sylvania Electric Prod | Photoflash lamp and ignition means therefor |
| NL151491B (nl) * | 1966-09-30 | 1976-11-15 | Philips Nv | Verbrandingsflitslamp. |
| US3556699A (en) * | 1968-02-05 | 1971-01-19 | Tokyo Shibaura Electric Co | Discharge ignition type photoflash lamp |
| NL6813921A (https=) * | 1968-09-27 | 1970-04-01 | ||
| NL153659B (nl) * | 1969-02-21 | 1977-06-15 | Philips Nv | Verbrandingsflitslamp en magazijn voorzien van deze verbrandingsflitslampen. |
| US3724991A (en) * | 1971-11-15 | 1973-04-03 | Gen Electric | Photoflash lamp |
| BE795646A (fr) * | 1972-02-19 | 1973-08-20 | Philips Nv | Lampe-flash a combustion |
-
1974
- 1974-09-23 US US05/508,107 patent/US3972673A/en not_active Expired - Lifetime
-
1975
- 1975-07-25 JP JP9035975A patent/JPS5728161B2/ja not_active Expired
- 1975-08-21 CA CA234,116A patent/CA1071401A/en not_active Expired
- 1975-09-09 GB GB37020/75A patent/GB1515404A/en not_active Expired
- 1975-09-17 DE DE2541407A patent/DE2541407C3/de not_active Expired
- 1975-09-19 IT IT27427/75A patent/IT1042702B/it active
- 1975-09-22 FR FR7528952A patent/FR2285354A1/fr active Granted
- 1975-09-23 BE BE160281A patent/BE833706A/xx not_active IP Right Cessation
- 1975-09-23 BR BR7506159*A patent/BR7506159A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2285354B1 (https=) | 1978-03-17 |
| JPS5143134A (https=) | 1976-04-13 |
| IT1042702B (it) | 1980-01-30 |
| US3972673A (en) | 1976-08-03 |
| FR2285354A1 (fr) | 1976-04-16 |
| BE833706A (fr) | 1976-03-23 |
| DE2541407B2 (de) | 1979-11-08 |
| CA1071401A (en) | 1980-02-12 |
| BR7506159A (pt) | 1976-08-03 |
| JPS5728161B2 (https=) | 1982-06-15 |
| GB1515404A (en) | 1978-06-21 |
| DE2541407A1 (de) | 1976-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68905710T2 (de) | Sich selbst erwaermender behaelter. | |
| DE2541407C3 (de) | Zündmaterial für eine mit hoher Spannung betriebene Blitzlichtlampe | |
| AT166186B (de) | Blitzlichtlampe | |
| DE2827132A1 (de) | Elektrische lampe | |
| DE2615508C3 (de) | Zundmaterial fur Blitzlampe | |
| DE1255487B (de) | Blitzlampe mit Zuendpille | |
| DE2206468A1 (de) | Huelsenlose patrone fuer elektrische zuendung | |
| DE2845283C2 (https=) | ||
| DE2609674A1 (de) | Blitzlampe | |
| DE2648692C2 (de) | Elektrisch zündbare Photoblitzlampe | |
| DE2709245A1 (de) | Verbrennungsblitzlichtlampe | |
| DE2755410C3 (de) | Blitzlampe | |
| DE2752250A1 (de) | Photoblitzlampe | |
| DE2005597C3 (de) | Verbrennungsblitzlichtlampe | |
| DE2542458C2 (de) | Elektrisch zündbare Fotoblitzlampe | |
| DE2311979C3 (de) | Anordnung zum Betrieb einer Gas- und/oder Dampfentladungslampe | |
| DE3942384A1 (de) | Verfahren zur erzeugung eines sauerstoffnachweiselementes | |
| DE2062305C3 (de) | Blitzlampe | |
| DE575576C (de) | Blitzlichtlampe | |
| DE2136534B2 (de) | Brennstoffblock fuer heissgas-hybridgeneratoren | |
| DE1036643B (de) | Blitzlichtlampe mit Zuendfunkenstrecke | |
| DE2543223A1 (de) | Anzuendkette | |
| DE1597721C3 (de) | Verbrennungsblitzlichtlampe | |
| DE1955668C3 (de) | Geschlossener Bleisammler mit einem porösen reaktiven Teil, dessen eine Oberfläche der Atmosphäre auBerhalb des Sammlers und dessen andere Oberfläche dem Gas im Sammler ausgesetzt ist und das einen Katalysator, der Sauerstoff und Wasserstoff Ionisiert, enthält | |
| AT213238B (de) | Durch Funken zündbare photographische Blitzlichtlampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |