DE2536395A1 - Verfahren zur dehalogenierung und/oder verhinderung der halogenierung - Google Patents
Verfahren zur dehalogenierung und/oder verhinderung der halogenierungInfo
- Publication number
- DE2536395A1 DE2536395A1 DE19752536395 DE2536395A DE2536395A1 DE 2536395 A1 DE2536395 A1 DE 2536395A1 DE 19752536395 DE19752536395 DE 19752536395 DE 2536395 A DE2536395 A DE 2536395A DE 2536395 A1 DE2536395 A1 DE 2536395A1
- Authority
- DE
- Germany
- Prior art keywords
- copper
- ions
- solution
- catalyst
- zone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 60
- 238000005695 dehalogenation reaction Methods 0.000 title description 20
- 238000005658 halogenation reaction Methods 0.000 title description 9
- 230000026030 halogenation Effects 0.000 title description 7
- 230000002265 prevention Effects 0.000 title description 2
- 239000003054 catalyst Substances 0.000 claims description 79
- 239000000243 solution Substances 0.000 claims description 78
- -1 Halogen ion Chemical class 0.000 claims description 77
- 238000006243 chemical reaction Methods 0.000 claims description 60
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 54
- 239000001301 oxygen Substances 0.000 claims description 53
- 229910052760 oxygen Inorganic materials 0.000 claims description 53
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 43
- 150000001336 alkenes Chemical class 0.000 claims description 38
- 238000007254 oxidation reaction Methods 0.000 claims description 36
- 238000010405 reoxidation reaction Methods 0.000 claims description 35
- 230000003647 oxidation Effects 0.000 claims description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 32
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 28
- 229910001882 dioxygen Inorganic materials 0.000 claims description 27
- QSKPIOLLBIHNAC-UHFFFAOYSA-N 2-chloro-acetaldehyde Chemical compound ClCC=O QSKPIOLLBIHNAC-UHFFFAOYSA-N 0.000 claims description 26
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 26
- 229910021591 Copper(I) chloride Inorganic materials 0.000 claims description 26
- 239000010949 copper Substances 0.000 claims description 26
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 claims description 26
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 23
- 239000007789 gas Substances 0.000 claims description 21
- 150000001299 aldehydes Chemical class 0.000 claims description 20
- 125000005843 halogen group Chemical group 0.000 claims description 20
- 230000036961 partial effect Effects 0.000 claims description 20
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 18
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 18
- 229910052802 copper Inorganic materials 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 15
- 239000005977 Ethylene Substances 0.000 claims description 15
- 239000013078 crystal Substances 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 10
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims description 8
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 150000002500 ions Chemical class 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 6
- 239000000047 product Substances 0.000 claims description 6
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 claims description 5
- 239000003701 inert diluent Substances 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- KNZADIMHVBBPOA-UHFFFAOYSA-N dyclonine hydrochloride Chemical compound [Cl-].C1=CC(OCCCC)=CC=C1C(=O)CC[NH+]1CCCCC1 KNZADIMHVBBPOA-UHFFFAOYSA-N 0.000 claims description 4
- 239000007791 liquid phase Substances 0.000 claims description 4
- 229910000510 noble metal Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 238000010924 continuous production Methods 0.000 claims description 3
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 150000001923 cyclic compounds Chemical class 0.000 claims description 2
- 239000010970 precious metal Substances 0.000 claims description 2
- 238000007792 addition Methods 0.000 claims 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 230000002123 temporal effect Effects 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- NWQWQKUXRJYXFH-UHFFFAOYSA-N 2,2-Dichloroacetaldehyde Chemical compound ClC(Cl)C=O NWQWQKUXRJYXFH-UHFFFAOYSA-N 0.000 description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 238000000926 separation method Methods 0.000 description 9
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 230000008929 regeneration Effects 0.000 description 7
- 238000011069 regeneration method Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 238000011027 product recovery Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 229940029273 trichloroacetaldehyde Drugs 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 229910001431 copper ion Inorganic materials 0.000 description 3
- 230000008030 elimination Effects 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000000962 organic group Chemical group 0.000 description 3
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 3
- 101100301148 Arabidopsis thaliana RCCR gene Proteins 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(i) oxide Chemical compound [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000002265 redox agent Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- CWVMWSZEMZOUPC-JUAXIXHSSA-N (3s,5s,8r,9s,10s,13s,14s,16r)-16-bromo-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one Chemical compound C1[C@@H](O)CC[C@]2(C)[C@H]3CC[C@](C)(C([C@H](Br)C4)=O)[C@@H]4[C@@H]3CC[C@H]21 CWVMWSZEMZOUPC-JUAXIXHSSA-N 0.000 description 1
- YTGSYRVSBPFKMQ-UHFFFAOYSA-N 2,2,2-tribromoacetaldehyde Chemical compound BrC(Br)(Br)C=O YTGSYRVSBPFKMQ-UHFFFAOYSA-N 0.000 description 1
- OXVISHZELPRKFQ-UHFFFAOYSA-N 2,2,3-trichlorobutanal Chemical compound CC(Cl)C(Cl)(Cl)C=O OXVISHZELPRKFQ-UHFFFAOYSA-N 0.000 description 1
- JCJGYHWIZAUUPU-UHFFFAOYSA-N 2,2-dichloro-1-cyclopropylethanone Chemical compound ClC(Cl)C(=O)C1CC1 JCJGYHWIZAUUPU-UHFFFAOYSA-N 0.000 description 1
- SGPKEYSZPHMVNI-UHFFFAOYSA-N 2-bromo-1-(2-hydroxyphenyl)ethanone Chemical compound OC1=CC=CC=C1C(=O)CBr SGPKEYSZPHMVNI-UHFFFAOYSA-N 0.000 description 1
- PYXPYXVGFLQQIS-UHFFFAOYSA-N 2-bromo-3-methylbutanal Chemical compound CC(C)C(Br)C=O PYXPYXVGFLQQIS-UHFFFAOYSA-N 0.000 description 1
- ZXWAHROJUXWVCU-UHFFFAOYSA-N 2-chloro-1-cyclopropylethanone Chemical compound ClCC(=O)C1CC1 ZXWAHROJUXWVCU-UHFFFAOYSA-N 0.000 description 1
- UJZCIPIWDBMTLY-UHFFFAOYSA-N 2-chloro-2-methylpropanal Chemical compound CC(C)(Cl)C=O UJZCIPIWDBMTLY-UHFFFAOYSA-N 0.000 description 1
- OMPRMWFZHLNRQJ-UHFFFAOYSA-N 2-chlorohexanoic acid Chemical compound CCCCC(Cl)C(O)=O OMPRMWFZHLNRQJ-UHFFFAOYSA-N 0.000 description 1
- VRJSDMNRPHLGRD-UHFFFAOYSA-N 2-chloropentanal Chemical compound CCCC(Cl)C=O VRJSDMNRPHLGRD-UHFFFAOYSA-N 0.000 description 1
- AZUMJLIDCHNBCX-UHFFFAOYSA-N 6-(2-bromoacetyl)-5-hydroxy-4-methylchromen-2-one Chemical compound C1=CC(C(=O)CBr)=C(O)C2=C1OC(=O)C=C2C AZUMJLIDCHNBCX-UHFFFAOYSA-N 0.000 description 1
- LZSCSLQORLJIIM-UHFFFAOYSA-N 6-chloro-3,5,5-trimethylcyclohex-2-en-1-one Chemical compound CC1=CC(=O)C(Cl)C(C)(C)C1 LZSCSLQORLJIIM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HZZXNJGNVODIMY-UHFFFAOYSA-N 8-(2-bromoacetyl)-7-hydroxy-4-methylchromen-2-one Chemical compound BrCC(=O)C1=C(O)C=CC2=C1OC(=O)C=C2C HZZXNJGNVODIMY-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021593 Copper(I) fluoride Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- YXLXNENXOJSQEI-UHFFFAOYSA-L Oxine-copper Chemical compound [Cu+2].C1=CN=C2C([O-])=CC=CC2=C1.C1=CN=C2C([O-])=CC=CC2=C1 YXLXNENXOJSQEI-UHFFFAOYSA-L 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 229940079721 copper chloride Drugs 0.000 description 1
- RFKZUAOAYVHBOY-UHFFFAOYSA-M copper(1+);acetate Chemical compound [Cu+].CC([O-])=O RFKZUAOAYVHBOY-UHFFFAOYSA-M 0.000 description 1
- RPJAQOVNRDOGAY-UHFFFAOYSA-L copper(1+);sulfite Chemical compound [Cu+].[Cu+].[O-]S([O-])=O RPJAQOVNRDOGAY-UHFFFAOYSA-L 0.000 description 1
- 229910000336 copper(I) sulfate Inorganic materials 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- BMRUOURRLCCWHB-UHFFFAOYSA-M copper(i) fluoride Chemical compound [Cu]F BMRUOURRLCCWHB-UHFFFAOYSA-M 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- WIVXEZIMDUGYRW-UHFFFAOYSA-L copper(i) sulfate Chemical compound [Cu+].[Cu+].[O-]S([O-])(=O)=O WIVXEZIMDUGYRW-UHFFFAOYSA-L 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/347—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/30—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with halogen containing compounds, e.g. hypohalogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/65—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by splitting-off hydrogen atoms or functional groups; by hydrogenolysis of functional groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/497,609 US4008279A (en) | 1974-08-15 | 1974-08-15 | Process for dehalogenation and/or prevention of halogenation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2536395A1 true DE2536395A1 (de) | 1976-03-04 |
Family
ID=23977566
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752536395 Pending DE2536395A1 (de) | 1974-08-15 | 1975-08-14 | Verfahren zur dehalogenierung und/oder verhinderung der halogenierung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4008279A (enExample) |
| JP (1) | JPS5141314A (enExample) |
| BE (1) | BE832436A (enExample) |
| CA (1) | CA1064964A (enExample) |
| DE (1) | DE2536395A1 (enExample) |
| FR (1) | FR2281915A1 (enExample) |
| IT (1) | IT1042087B (enExample) |
| NL (1) | NL7509689A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4190606A (en) * | 1976-06-17 | 1980-02-26 | Celanese Corporation | Process for dehalogenation and/or prevention of halogenation |
| US5015780A (en) * | 1989-02-02 | 1991-05-14 | Ciba-Geigy Corporation | Process for the preparation of dihalobutyraldehydes |
| JPWO2003018523A1 (ja) * | 2001-08-27 | 2004-12-09 | 株式会社カネカ | 光学活性ハロプロパンジオール誘導体の製造法 |
| US8969645B2 (en) * | 2012-12-14 | 2015-03-03 | Chevron U.S.A. Inc. | Process for reducing chloride in hydrocarbon products using an ionic liquid catalyst |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA750422A (en) * | 1967-01-10 | Eastman Kodak Company | Acetaldehyde manufacture | |
| DE1132909B (de) * | 1958-10-24 | 1962-07-12 | Consortium Elektrochem Ind | Verfahren zur Herstellung von Aldehyden und Ketonen |
| US3149167A (en) * | 1959-09-26 | 1964-09-15 | Hoechst Ag | Process for oxidizing olefins to aldehydes and ketones |
-
1974
- 1974-08-15 US US05/497,609 patent/US4008279A/en not_active Expired - Lifetime
-
1975
- 1975-07-25 CA CA232,214A patent/CA1064964A/en not_active Expired
- 1975-08-11 JP JP50096728A patent/JPS5141314A/ja active Pending
- 1975-08-13 FR FR7525248A patent/FR2281915A1/fr active Granted
- 1975-08-14 NL NL7509689A patent/NL7509689A/xx unknown
- 1975-08-14 BE BE159207A patent/BE832436A/xx unknown
- 1975-08-14 IT IT26367/75A patent/IT1042087B/it active
- 1975-08-14 DE DE19752536395 patent/DE2536395A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| BE832436A (fr) | 1976-02-16 |
| CA1064964A (en) | 1979-10-23 |
| US4008279A (en) | 1977-02-15 |
| JPS5141314A (en) | 1976-04-07 |
| NL7509689A (nl) | 1976-02-17 |
| IT1042087B (it) | 1980-01-30 |
| FR2281915A1 (fr) | 1976-03-12 |
| FR2281915B3 (enExample) | 1978-04-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69620461T2 (de) | Verfahren zur herstellung von 1,1,1,3,3,-pentafluoropropanen | |
| DE69009393T2 (de) | Verfahren zur Herstellung eines Diesters der Kohlensäure. | |
| DE69611658T2 (de) | Verfahren zur Herstellung von Ethylenglykol | |
| DE2447551C3 (de) | Verfahren zur Herstellung von Methylchlorid | |
| DE3016715C2 (de) | Verfahren zur Herstellung von Äthanol | |
| DE2151417C3 (de) | Verfahren zur Herstellung von Katalysatoren | |
| DE69324377T2 (de) | Verfahren zur herstellung von 1,1,1,3,3-pentafluoropropan | |
| DE3025475C2 (de) | Verfahren zur Herstellung von aromatischen Dialdehyden | |
| DE2422379B2 (de) | Verfahren zur Herstellung von Methylmercaptan | |
| EP0638539A2 (de) | Verfahren zur Herstellung von Poly- und Perfluorcarbonsäurechloriden | |
| DE1468680C3 (de) | Verfahren zur Herstellung chlorfluorierter Derivate des Äthylens oder des Äthans | |
| DE2536395A1 (de) | Verfahren zur dehalogenierung und/oder verhinderung der halogenierung | |
| DE2534541C3 (de) | Verfahren zur Gewinnung von Brom | |
| DE3604968A1 (de) | Verfahren zur herstellung von dichlorethan | |
| DE2542496A1 (de) | Verfahren zur herstellung von perfluoralkyljodidtelomeren | |
| EP0635473B1 (de) | Verfahren zur Herstellung von Carbonsäurechloriden | |
| DE3415833C2 (de) | Verfahren zur Gewinnung von Hexafluoracetonhydrat | |
| DE69801180T2 (de) | Verfahren zur Herstellung von 3,3-dichlor-1,1,1-trifluoraceton | |
| DE1643081B2 (de) | Verfahren zur herstellung von alkylenchlor- oder -bromhydrinen und/oder alkylenglykolen mit 2 bis 4 kohlenstoffatomen | |
| DE69423910T2 (de) | Verfahren zur herstellung von difluormethan und 1,1,1,2-tetrafluorethan | |
| DE69628060T2 (de) | Verfahren zur Herstellung von Difluormethan und Difluorchlormethan | |
| DE69414375T2 (de) | Verfahren zur herstellung von 1,1,1,2,2-pentafluoroethan, verfahren zur herstellung von 2,2-dichloro-1,1,1-trifluoroethan und verfahren zur reinigung von 1,1,1,2,2-pentafluoroethan | |
| DE69307492T2 (de) | Verfahren zur herstellung von kohlensauren diestern | |
| DE2607039A1 (de) | Verfahren zur oxidation von olefinen mit molekularem sauerstoff | |
| DE1815336A1 (de) | Verfahren zur Entfernung von in 1,2-Dichloraethan vorhandenem Trichloraethylen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |