DE2528045C2 - Verfahren zur Herstellung von Selbstkondensationsprodukten von Phenolen - Google Patents
Verfahren zur Herstellung von Selbstkondensationsprodukten von PhenolenInfo
- Publication number
- DE2528045C2 DE2528045C2 DE2528045A DE2528045A DE2528045C2 DE 2528045 C2 DE2528045 C2 DE 2528045C2 DE 2528045 A DE2528045 A DE 2528045A DE 2528045 A DE2528045 A DE 2528045A DE 2528045 C2 DE2528045 C2 DE 2528045C2
- Authority
- DE
- Germany
- Prior art keywords
- manganese
- chelate
- radical
- ortho
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 31
- 230000008569 process Effects 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- 150000002989 phenols Chemical class 0.000 title claims description 12
- 239000007859 condensation product Substances 0.000 title claims description 4
- 239000013522 chelant Substances 0.000 claims description 53
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 239000012429 reaction media Substances 0.000 claims description 14
- 239000003446 ligand Substances 0.000 claims description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 12
- 239000001301 oxygen Substances 0.000 claims description 12
- 229910052760 oxygen Inorganic materials 0.000 claims description 12
- 150000001412 amines Chemical class 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000002950 monocyclic group Chemical group 0.000 claims description 4
- 230000000269 nucleophilic effect Effects 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000004697 chelate complex Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000003367 polycyclic group Chemical group 0.000 claims description 2
- JXEHBRQVIPIGRN-UHFFFAOYSA-N 2-hydroxyimino-2-phenylethanol Chemical compound OCC(=NO)C1=CC=CC=C1 JXEHBRQVIPIGRN-UHFFFAOYSA-N 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 50
- 239000011572 manganese Substances 0.000 description 47
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 45
- 229910052748 manganese Inorganic materials 0.000 description 45
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 42
- 239000004721 Polyphenylene oxide Substances 0.000 description 35
- 229920006380 polyphenylene oxide Polymers 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- -1 alkyl radical Chemical class 0.000 description 33
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 32
- 239000000243 solution Substances 0.000 description 24
- 239000003054 catalyst Substances 0.000 description 23
- 150000003254 radicals Chemical class 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- 239000002904 solvent Substances 0.000 description 16
- 238000006116 polymerization reaction Methods 0.000 description 14
- 229920000642 polymer Polymers 0.000 description 13
- 150000003141 primary amines Chemical class 0.000 description 13
- 238000009833 condensation Methods 0.000 description 8
- 238000005755 formation reaction Methods 0.000 description 8
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 7
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 201000006747 infectious mononucleosis Diseases 0.000 description 6
- 239000011565 manganese chloride Substances 0.000 description 6
- 235000002867 manganese chloride Nutrition 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- 239000003513 alkali Substances 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- 238000006482 condensation reaction Methods 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 4
- 229920000768 polyamine Polymers 0.000 description 4
- ORIHZIZPTZTNCU-YVMONPNESA-N salicylaldoxime Chemical compound O\N=C/C1=CC=CC=C1O ORIHZIZPTZTNCU-YVMONPNESA-N 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 238000005691 oxidative coupling reaction Methods 0.000 description 3
- 230000001737 promoting effect Effects 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 2
- GDBCGGFNFKMPAE-UHFFFAOYSA-N 1-decylnaphthalene Chemical compound C1=CC=C2C(CCCCCCCCCC)=CC=CC2=C1 GDBCGGFNFKMPAE-UHFFFAOYSA-N 0.000 description 2
- NKTOLZVEWDHZMU-UHFFFAOYSA-N 2,5-xylenol Chemical compound CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 description 2
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical compound COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 2
- JECYUBVRTQDVAT-UHFFFAOYSA-N 2-acetylphenol Chemical compound CC(=O)C1=CC=CC=C1O JECYUBVRTQDVAT-UHFFFAOYSA-N 0.000 description 2
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 2
- 125000002015 acyclic group Chemical group 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- VHRGRCVQAFMJIZ-UHFFFAOYSA-N cadaverine Chemical compound NCCCCCN VHRGRCVQAFMJIZ-UHFFFAOYSA-N 0.000 description 2
- 230000009849 deactivation Effects 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 2
- 229920013637 polyphenylene oxide polymer Polymers 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- JEFSTMHERNSDBC-UHFFFAOYSA-N 1,2-dimethylcyclohexa-2,4-dien-1-ol Chemical class CC1=CC=CCC1(C)O JEFSTMHERNSDBC-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- AIKGZKSZCLOZQJ-UHFFFAOYSA-N 1-[4-(3-aminohexyl)phenyl]hexan-3-amine Chemical compound CCCC(N)CCC1=CC=C(CCC(N)CCC)C=C1 AIKGZKSZCLOZQJ-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- ZHGIKBCGOGBDFG-UHFFFAOYSA-N 1-icosylnaphthalene Chemical compound C1=CC=C2C(CCCCCCCCCCCCCCCCCCCC)=CC=CC2=C1 ZHGIKBCGOGBDFG-UHFFFAOYSA-N 0.000 description 1
- CRNKGYFOWLZFDQ-UHFFFAOYSA-N 1-pentadecylnaphthalene Chemical compound C1=CC=C2C(CCCCCCCCCCCCCCC)=CC=CC2=C1 CRNKGYFOWLZFDQ-UHFFFAOYSA-N 0.000 description 1
- FDHDUXOBMHHFFJ-UHFFFAOYSA-N 1-pentylnaphthalene Chemical compound C1=CC=C2C(CCCCC)=CC=CC2=C1 FDHDUXOBMHHFFJ-UHFFFAOYSA-N 0.000 description 1
- KDUWXMIHHIVXER-UHFFFAOYSA-N 2'-hydroxypropiophenone Chemical compound CCC(=O)C1=CC=CC=C1O KDUWXMIHHIVXER-UHFFFAOYSA-N 0.000 description 1
- IKWYDWRGPXTPHV-UHFFFAOYSA-N 2,6-bis(2-chlorophenoxy)phenol Chemical compound C1=CC=C(OC=2C(=CC=CC=2)Cl)C(O)=C1OC1=CC=CC=C1Cl IKWYDWRGPXTPHV-UHFFFAOYSA-N 0.000 description 1
- LBPCXYZANZSPPY-UHFFFAOYSA-N 2,6-bis(3-chloropropyl)phenol Chemical compound OC1=C(CCCCl)C=CC=C1CCCCl LBPCXYZANZSPPY-UHFFFAOYSA-N 0.000 description 1
- DUCSXVAAPCQAEP-UHFFFAOYSA-N 2,6-dibenzylphenol Chemical compound C1=CC=C(CC=2C=CC=CC=2)C(O)=C1CC1=CC=CC=C1 DUCSXVAAPCQAEP-UHFFFAOYSA-N 0.000 description 1
- PZPVXSMCRLNVRD-UHFFFAOYSA-N 2,6-dibutylphenol Chemical compound CCCCC1=CC=CC(CCCC)=C1O PZPVXSMCRLNVRD-UHFFFAOYSA-N 0.000 description 1
- RGWXSQCOYFRTKU-UHFFFAOYSA-N 2,6-didodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC(CCCCCCCCCCCC)=C1O RGWXSQCOYFRTKU-UHFFFAOYSA-N 0.000 description 1
- SMSZXONJAYKZCU-UHFFFAOYSA-N 2,6-diethoxyphenol Chemical compound CCOC1=CC=CC(OCC)=C1O SMSZXONJAYKZCU-UHFFFAOYSA-N 0.000 description 1
- METWAQRCMRWDAW-UHFFFAOYSA-N 2,6-diethylphenol Chemical compound CCC1=CC=CC(CC)=C1O METWAQRCMRWDAW-UHFFFAOYSA-N 0.000 description 1
- NAILKKRDWBJCNH-UHFFFAOYSA-N 2,6-dipropylphenol Chemical compound CCCC1=CC=CC(CCC)=C1O NAILKKRDWBJCNH-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- CFPNMYCFVVUHHC-UHFFFAOYSA-N 2-(hydroxyiminomethyl)-4-methylphenol Chemical compound CC1=CC=C(O)C(C=NO)=C1 CFPNMYCFVVUHHC-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- NHPYZDWJKMTYLZ-UHFFFAOYSA-N 2-ethoxy-6-methoxyphenol Chemical compound CCOC1=CC=CC(OC)=C1O NHPYZDWJKMTYLZ-UHFFFAOYSA-N 0.000 description 1
- IEURJKJFIZRKAG-UHFFFAOYSA-N 2-ethyl-4-octadecoxyphenol Chemical compound CCCCCCCCCCCCCCCCCCOC1=CC=C(O)C(CC)=C1 IEURJKJFIZRKAG-UHFFFAOYSA-N 0.000 description 1
- PGJXFACHLLIKFG-UHFFFAOYSA-N 2-methyl-6-phenylphenol Chemical compound CC1=CC=CC(C=2C=CC=CC=2)=C1O PGJXFACHLLIKFG-UHFFFAOYSA-N 0.000 description 1
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- NUIURNJTPRWVAP-UHFFFAOYSA-N 3,3'-Dimethylbenzidine Chemical compound C1=C(N)C(C)=CC(C=2C=C(C)C(N)=CC=2)=C1 NUIURNJTPRWVAP-UHFFFAOYSA-N 0.000 description 1
- QPIOXOJERGNNMX-UHFFFAOYSA-N 3-(3-aminopropylsulfanyl)propan-1-amine Chemical compound NCCCSCCCN QPIOXOJERGNNMX-UHFFFAOYSA-N 0.000 description 1
- POTQBGGWSWSMCX-UHFFFAOYSA-N 3-[2-(3-aminopropoxy)ethoxy]propan-1-amine Chemical compound NCCCOCCOCCCN POTQBGGWSWSMCX-UHFFFAOYSA-N 0.000 description 1
- FVWLNKQRYYNYKJ-UHFFFAOYSA-N 3-chloro-2,6-dimethylphenol Chemical compound CC1=CC=C(Cl)C(C)=C1O FVWLNKQRYYNYKJ-UHFFFAOYSA-N 0.000 description 1
- SGEWZUYVXQESSB-UHFFFAOYSA-N 3-methylheptane-1,7-diamine Chemical compound NCCC(C)CCCCN SGEWZUYVXQESSB-UHFFFAOYSA-N 0.000 description 1
- ICNFHJVPAJKPHW-UHFFFAOYSA-N 4,4'-Thiodianiline Chemical compound C1=CC(N)=CC=C1SC1=CC=C(N)C=C1 ICNFHJVPAJKPHW-UHFFFAOYSA-N 0.000 description 1
- BLFRQYKZFKYQLO-UHFFFAOYSA-N 4-aminobutan-1-ol Chemical compound NCCCCO BLFRQYKZFKYQLO-UHFFFAOYSA-N 0.000 description 1
- GDELFUQKNPLION-UHFFFAOYSA-N 4-ethoxybutan-1-amine Chemical compound CCOCCCCN GDELFUQKNPLION-UHFFFAOYSA-N 0.000 description 1
- MFRKYEJMLQUSJX-UHFFFAOYSA-N 4-propan-2-ylcyclohexan-1-amine Chemical compound CC(C)C1CCC(N)CC1 MFRKYEJMLQUSJX-UHFFFAOYSA-N 0.000 description 1
- AUSJTZCDDYIJDX-UHFFFAOYSA-N 5-(3,5-diaminophenyl)benzene-1,3-diamine Chemical group NC1=CC(N)=CC(C=2C=C(N)C=C(N)C=2)=C1 AUSJTZCDDYIJDX-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- QLBRROYTTDFLDX-UHFFFAOYSA-N [3-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCCC(CN)C1 QLBRROYTTDFLDX-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-N hydroperoxyl Chemical group O[O] OUUQCZGPVNCOIJ-UHFFFAOYSA-N 0.000 description 1
- BUHXFUSLEBPCEB-UHFFFAOYSA-N icosan-1-amine Chemical compound CCCCCCCCCCCCCCCCCCCCN BUHXFUSLEBPCEB-UHFFFAOYSA-N 0.000 description 1
- POIZGMCHYSVWDU-UHFFFAOYSA-N icosane-1,20-diamine Chemical compound NCCCCCCCCCCCCCCCCCCCCN POIZGMCHYSVWDU-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940099607 manganese chloride Drugs 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- 229910000158 manganese(II) phosphate Inorganic materials 0.000 description 1
- ZKCBQOQPFCSEFF-UHFFFAOYSA-H manganese(ii) phosphate Chemical compound [Mn+2].[Mn+2].[Mn+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O ZKCBQOQPFCSEFF-UHFFFAOYSA-H 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 1
- DKAABRFYCBBONX-UHFFFAOYSA-N n-methyl-3-propylnaphthalen-1-amine Chemical class C1=CC=CC2=CC(CCC)=CC(NC)=C21 DKAABRFYCBBONX-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000003544 oxime group Chemical group 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920013636 polyphenyl ether polymer Polymers 0.000 description 1
- 229920001955 polyphenylene ether Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/34—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives
- C08G65/38—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols
- C08G65/44—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols by oxidation of phenols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/491,475 US3972851A (en) | 1974-07-24 | 1974-07-24 | Preparation of polyphenylene oxide using a manganese(II) ortho-hydroxyarene-oxime chelate reaction promoter |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2528045A1 DE2528045A1 (de) | 1976-02-05 |
| DE2528045C2 true DE2528045C2 (de) | 1984-07-12 |
Family
ID=23952395
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2528045A Expired DE2528045C2 (de) | 1974-07-24 | 1975-06-24 | Verfahren zur Herstellung von Selbstkondensationsprodukten von Phenolen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3972851A (enExample) |
| JP (1) | JPS5921894B2 (enExample) |
| BE (1) | BE831664A (enExample) |
| CA (1) | CA1066846A (enExample) |
| DE (1) | DE2528045C2 (enExample) |
| DK (1) | DK336375A (enExample) |
| FR (1) | FR2279788A1 (enExample) |
| GB (1) | GB1518186A (enExample) |
| IT (1) | IT1039995B (enExample) |
| NL (1) | NL7508815A (enExample) |
| SE (1) | SE7508406L (enExample) |
| SU (1) | SU686626A3 (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4054553A (en) * | 1975-06-02 | 1977-10-18 | General Electric Company | Polyphenylene oxide process |
| US4097462A (en) * | 1976-01-23 | 1978-06-27 | General Electric Company | Process for making polyphenylene oxides |
| US4075174A (en) * | 1976-12-21 | 1978-02-21 | General Electric Company | Promotion of manganese chelate catalyzed polyphenylene ether oxide polymerization reactions |
| US4427594A (en) | 1976-12-21 | 1984-01-24 | General Electric Company | Oxidative coupling of phenolic monomers with manganese complexes of phenyl benzoin oxime catalysts |
| US4093598A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Oxidative coupling of phenolic monomers in the presence of manganese complexes of manganese phenyl benzoin oxime catalysts |
| US4093596A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Method for polymerization of polyphenylene oxides |
| US4093597A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Polymerization of 2,6-di-substituted phenols |
| US4098766A (en) * | 1977-04-14 | 1978-07-04 | Ici Americas Inc. | Method of oxidatively coupling alkyl phenols utilizing a tetravalent manganese-carbon catalyst |
| US4196278A (en) * | 1977-12-29 | 1980-04-01 | General Electric Company | Method for the controlled polymerization of polyphenylene oxide polymers |
| US4226951A (en) * | 1978-06-19 | 1980-10-07 | General Electric Company | Block polymers of polyphenylene oxide and polystyrene |
| US4335234A (en) * | 1979-10-24 | 1982-06-15 | General Electric Company | Use of manganese chelate to oxidatively couple phenolic compound in a self-precipitating system |
| US4385168A (en) * | 1981-03-06 | 1983-05-24 | Sumitomo Chemical Company, Limited | Process for producing polyphenylene oxide |
| JPS58114842A (ja) * | 1981-12-28 | 1983-07-08 | Yamazaki Mazak Corp | 数値制御工作機械に於ける工具寿命管理方法 |
| JPS59115124A (ja) * | 1982-12-22 | 1984-07-03 | Mitsubishi Electric Corp | 放電加工装置 |
| JPS59142046A (ja) * | 1983-02-04 | 1984-08-15 | Ikegai Corp | 工具寿命の管理方法及び装置 |
| JPS609638A (ja) * | 1983-06-30 | 1985-01-18 | Toyoda Mach Works Ltd | 工具寿命検出方法 |
| DE3504646A1 (de) | 1985-02-12 | 1986-08-14 | Basf Ag, 6700 Ludwigshafen | Halogenfreie, selbstverloeschende thermoplastische formmasse |
| JPS61249248A (ja) * | 1985-04-24 | 1986-11-06 | Hitachi Metals Ltd | 刃具寿命管理装置 |
| JPS63295157A (ja) * | 1987-05-26 | 1988-12-01 | Fanuc Ltd | 数値制御装置 |
| JPS6434636A (en) * | 1987-07-29 | 1989-02-06 | Fanuc Ltd | Tool life control system |
| JPH01146644A (ja) * | 1987-12-02 | 1989-06-08 | Fanuc Ltd | 加工セル工具の補修情報指示装置 |
| JPH033757A (ja) * | 1989-05-30 | 1991-01-09 | Fanuc Ltd | 切削負荷管理方式 |
| JPH03245949A (ja) * | 1990-02-26 | 1991-11-01 | Fanuc Ltd | 工具寿命管理方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1570458A1 (de) * | 1965-07-14 | 1969-09-18 | Dynamit Nobel Ag | Verfahren zur Herstellung von Polyphenylenoxyden |
| US3825521A (en) * | 1971-07-31 | 1974-07-23 | Asahi Dow Ltd | Manganese amine chelate catalyzed aromatic polyether formation |
-
1974
- 1974-07-24 US US05/491,475 patent/US3972851A/en not_active Expired - Lifetime
-
1975
- 1975-06-24 DE DE2528045A patent/DE2528045C2/de not_active Expired
- 1975-06-26 CA CA230,753A patent/CA1066846A/en not_active Expired
- 1975-07-08 GB GB28718/75A patent/GB1518186A/en not_active Expired
- 1975-07-23 BE BE158550A patent/BE831664A/xx unknown
- 1975-07-23 NL NL7508815A patent/NL7508815A/xx not_active Application Discontinuation
- 1975-07-23 SE SE7508406A patent/SE7508406L/xx unknown
- 1975-07-23 IT IT25662/75A patent/IT1039995B/it active
- 1975-07-24 SU SU752159082A patent/SU686626A3/ru active
- 1975-07-24 DK DK336375A patent/DK336375A/da not_active Application Discontinuation
- 1975-07-24 FR FR7523171A patent/FR2279788A1/fr active Granted
- 1975-07-24 JP JP50089689A patent/JPS5921894B2/ja not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2279788A1 (fr) | 1976-02-20 |
| IT1039995B (it) | 1979-12-10 |
| JPS5921894B2 (ja) | 1984-05-23 |
| DK336375A (da) | 1976-01-25 |
| US3972851A (en) | 1976-08-03 |
| DE2528045A1 (de) | 1976-02-05 |
| BE831664A (fr) | 1975-11-17 |
| FR2279788B1 (enExample) | 1981-08-28 |
| GB1518186A (en) | 1978-07-19 |
| CA1066846A (en) | 1979-11-20 |
| SU686626A3 (ru) | 1979-09-15 |
| SE7508406L (sv) | 1976-01-26 |
| JPS5134995A (enExample) | 1976-03-25 |
| NL7508815A (nl) | 1976-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2528045C2 (de) | Verfahren zur Herstellung von Selbstkondensationsprodukten von Phenolen | |
| DE2527759C2 (de) | Verfahren zum Herstellen der Selbstkondensationsprodukte eines Phenols unter Verwendung eines Mangan-(II)ω-Hydroxyoxim-Chelatkomplexes als Katalysator | |
| DE2622700A1 (de) | Verfahren zur herstellung von polyphenylenoxiden | |
| DE2648774C2 (de) | Endständige Aminogruppen aufweisende Polyäther, Verfahren zu deren Herstellung und deren Verwendung zur Herstellung von Kunststoffen | |
| DE2754887C2 (enExample) | ||
| DE2755937A1 (de) | Verfahren zur steuerung der grundmolaren viskositaetszahl von polyphenylenaether-reaktionsmischungen | |
| DE2738520C2 (de) | Verfahren zur Herstellung von aromatischen Carbonaten | |
| DE2557333A1 (de) | Verfahren zur herstellung von polyphenylenoxid | |
| DE1720887A1 (de) | Verfahren zur Herstellung von hochmolekularen Polymeren aus unreinem 2,6-Xylcnol | |
| US3444133A (en) | Cobalt chelate catalysts in the production of polyphenylene oxides | |
| DE1495953B2 (de) | Verfahren zur herstellung von poly (halogenphenylenaethern) | |
| DE1151938B (de) | Verfahren zur Herstellung von Additionsprodukten aus aromatischen Aminen und Alkylenoxyden | |
| DE2756111A1 (de) | Verfahren zur herstellung eines polyphenylenoxid-harzes unter verwendung eines manganchelat-katalysators | |
| DE2451905B2 (de) | Verfahren zur Herstellung von Polyphenylenoxiden mit niedrigem Molekulargewicht | |
| DE2460323C2 (de) | Verfahren zur Herstellung von Polyphenylenäthern | |
| DE2702294A1 (de) | Verfahren zur herstellung von polyphenylenoxiden | |
| DE2446425A1 (de) | Verfahren zur herstellung von polyphenylenaethern bei erhoehtem druck | |
| DE2756323A1 (de) | Mangankomplexe von salicylaldehydalkanoliminen als katalysatoren fuer die polymerisation von 2,6-disubstituierten phenolen | |
| EP0197469B1 (de) | Verfahren zur kontinuierlichen Herstellung von Polyphenylenethern | |
| DE1645035A1 (de) | Verfahren zur Polymerisation von aromatischen primaeren Diaminen | |
| DE2011710A1 (enExample) | ||
| DE2756416A1 (de) | Komplexer mangan-katalysator und verfahren zur polymerisation von polyphenylenoxiden | |
| DE2012443C3 (de) | Verfahren zur Herstellung von PoIy-1,4-Phenylenoxiden | |
| DE4015653A1 (de) | Verfahren zur herstellung von polyphenylenethern | |
| DE2755829A1 (de) | Verfahren zur herstellung von polyphenylenoxidharzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |